{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "4aff7d5c-e2ef-4033-94b6-6f639854d34f",
          "code": "520-36-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=520-36-5",
          "code_system": "CAS",
          "references": [
            "d31fd859-1117-4c79-a2db-20c2d80fdf0b",
            "e3a5a9ec-1ff1-419c-b20b-2224f58c43c5"
          ]
        },
        {
          "uuid": "f71f3531-32db-485b-82a8-e01f603e5057",
          "code": "C68466",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C68466",
          "code_system": "NCI_THESAURUS",
          "references": [
            "d31fd859-1117-4c79-a2db-20c2d80fdf0b"
          ]
        },
        {
          "uuid": "3da97abc-4911-45e2-97e8-e3a488a3b262",
          "code": "D047310",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68047310",
          "code_system": "MESH",
          "references": [
            "d31fd859-1117-4c79-a2db-20c2d80fdf0b"
          ]
        },
        {
          "uuid": "9ca14f8e-a0df-4190-8129-41c5b6acc6fb",
          "code": "APIGENIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Apigenin",
          "code_system": "WIKIPEDIA",
          "references": [
            "d31fd859-1117-4c79-a2db-20c2d80fdf0b"
          ]
        },
        {
          "uuid": "d18f1915-ae51-44dc-b263-6dedaa79f39e",
          "code": "1368130",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1368130/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "d31fd859-1117-4c79-a2db-20c2d80fdf0b"
          ]
        },
        {
          "uuid": "121564ad-c57c-4dc5-bf01-63616cbd34ab",
          "code": "m1987",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m1987?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "d31fd859-1117-4c79-a2db-20c2d80fdf0b"
          ]
        },
        {
          "uuid": "31d17265-77c1-4bd8-b6f0-35c9f5b88c41",
          "code": "208-292-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.007.540",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "d31fd859-1117-4c79-a2db-20c2d80fdf0b"
          ]
        },
        {
          "uuid": "aff4df8d-90da-45e6-8dd7-4f3e9520ae8e",
          "code": "5280443",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5280443",
          "code_system": "PUBCHEM",
          "references": [
            "d31fd859-1117-4c79-a2db-20c2d80fdf0b"
          ]
        },
        {
          "uuid": "2f19c34c-9ec8-2cb1-f5a4-30c793a232bf",
          "code": "7573",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7573",
          "code_system": "HSDB",
          "references": [
            "14449986-9960-ef58-9c9f-269fd18cbb49"
          ]
        },
        {
          "uuid": "ce918996-ada6-3c65-ad3a-f7a1cb69a031",
          "code": "DTXSID6022391",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6022391",
          "code_system": "EPA CompTox",
          "references": [
            "74bc537e-5b89-0108-ed2a-d29847c5eabd"
          ]
        },
        {
          "uuid": "f484d57a-262b-7d3d-3e33-f2d23324c2d0",
          "code": "C68464",
          "comments": "Food or Food Product[C1949]|Food Component[C1930]|Bioactive Food Component[C54060]|Dietary Polyphenol[C70553]|Dietary Flavonoid[C70554]|Flavone",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C68464",
          "code_system": "NCI_THESAURUS",
          "references": [
            "fa07c468-972b-f9b1-a221-0a159b736701"
          ]
        },
        {
          "uuid": "5bd1c6bd-24a1-0cd6-aee2-744c65388c9c",
          "code": "222 (Number of products:60)",
          "comments": "Dietary Supplement Label Database|Botanical|Apigenin",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=222&item=Apigenin",
          "code_system": "DSLD",
          "references": [
            "fa07c468-972b-f9b1-a221-0a159b736701"
          ]
        },
        {
          "uuid": "f0ddbbf1-5633-994c-bd52-1e8adee52222",
          "code": "1394 (Number of products:104)",
          "comments": "Dietary Supplement Label Database|Botanical|Flavonoid",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=1394&item=Flavonoid",
          "code_system": "DSLD",
          "references": [
            "fa07c468-972b-f9b1-a221-0a159b736701"
          ]
        },
        {
          "uuid": "9b21d8b4-7cec-791c-f778-9265d571747e",
          "code": "DB07352",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB07352",
          "code_system": "DRUG BANK",
          "references": [
            "fa07c468-972b-f9b1-a221-0a159b736701"
          ]
        },
        {
          "uuid": "cbe1506d-210a-44e7-9b44-6cac0e618f17",
          "code": "7V515PI7F6",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "fde352b1-1c0b-549c-e1ad-3c899a01fb44",
          "code": "58470",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:58470",
          "code_system": "CHEBI",
          "references": [
            "fa07c468-972b-f9b1-a221-0a159b736701"
          ]
        },
        {
          "uuid": "e36e1451-9f5b-2ac0-d031-d7ef642d1114",
          "code": "18388",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:18388",
          "code_system": "CHEBI",
          "references": [
            "fa07c468-972b-f9b1-a221-0a159b736701"
          ]
        },
        {
          "uuid": "25c6df13-283b-dde7-8477-b7407e0ab3a1",
          "code": "1040683",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1040683",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "fa07c468-972b-f9b1-a221-0a159b736701"
          ]
        },
        {
          "uuid": "965e134a-fea3-5721-eb91-7cffc55ee7f3",
          "code": "83244",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=83244",
          "code_system": "NSC",
          "references": [
            "24761ec5-27ab-5507-0bc1-13a9279b9459"
          ]
        },
        {
          "uuid": "47c572bd-9a00-fff1-d6b0-c6047bbcaa6a",
          "code": "100000183496",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "3e7dc0d2-c8de-21d2-761e-b7076231e6c2"
          ]
        },
        {
          "uuid": "798bf143-739f-1315-da3e-fee86fde5d08",
          "code": "7V515PI7F6",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=7V515PI7F6",
          "code_system": "DAILYMED",
          "references": [
            "4c1c33d4-baca-ae50-a788-c091feb1b2c4"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "47b24fa9-5103-4a15-99bd-ed560541177b",
          "comments": "1,1-Diphenyl-2-picrylhydrazyl radical scavenging assay(DPPH) IC50 expressed as ug/mL was not tested due to the limited samples available. In vitro hydroxyl radical scavenging assay(Hydroxy Radical) IC50 expressed as ug/mL >5.",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "b8126979-f988-461e-9cf8-1a10bd447b0d"
          ],
          "related_substance": {
            "uuid": "176a2eef-5dcb-412b-b1e2-d003c92ead7c",
            "refuuid": "46ab5b1a-f4c0-4c23-ad5c-bcc4dba3092f",
            "name": "ACAI FRUIT PULP",
            "unii": "51U7FI9EXO",
            "linking_id": "51U7FI9EXO",
            "ref_pname": "ACAI FRUIT PULP",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "fcfaa03f-dea6-46b2-82a8-f9d2578bc092",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "590069ce-7471-42ba-9a4f-fc80ced07eb7"
          ],
          "related_substance": {
            "uuid": "d995f1f3-54e0-47e8-871b-1e5a9c175898",
            "refuuid": "3347cc3f-fac6-4a3c-945d-f0bd68dd3c46",
            "name": "CHAMOMILE",
            "unii": "FGL3685T2X",
            "linking_id": "FGL3685T2X",
            "ref_pname": "CHAMOMILE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d4182afd-d4a5-44fd-99d6-b2b5d20b8558",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "fb3ac63d-8d0f-4b34-94bc-00170e7c08c2"
          ],
          "related_substance": {
            "uuid": "f5d0bad2-ae97-4292-be01-e9257d1bba8f",
            "refuuid": "975b34dd-24d6-4363-900c-3a5d4a9dba32",
            "name": "PRIMULA VERIS FLOWER",
            "unii": "W5BET37294",
            "linking_id": "W5BET37294",
            "ref_pname": "PRIMULA VERIS FLOWER",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c20f8c4a-329c-4e93-aba2-62c9cf80c4db",
          "comments": "53% Cell growth rate of human acute promyelocytic leukemia HL-60 cells at 50 uM of compound vs control",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "0ad9bcf8-2c47-480e-8e55-2af54b4da08c"
          ],
          "related_substance": {
            "uuid": "fcdf1e4a-a49e-4ba9-bc50-49287d6260e6",
            "refuuid": "f0c781b9-482b-457c-8c0c-f6d19a4ea7fc",
            "name": "CITRUS AURANTIUM FRUIT RIND",
            "unii": "055456JHI7",
            "linking_id": "055456JHI7",
            "ref_pname": "CITRUS AURANTIUM FRUIT RIND",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "bb1d7671-b2eb-4cc2-80f4-91b4013625a9",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "8f3f2838-ba64-4176-8352-083e8faaa5d4"
          ],
          "related_substance": {
            "uuid": "ac519c3f-d6ff-44cc-9e92-421e4adec49a",
            "refuuid": "8e61faef-71bb-4cbd-8b70-716ea0fd1d02",
            "name": "CANNABIS SATIVA SUBSP. INDICA TOP",
            "unii": "FTS5RM302N",
            "linking_id": "FTS5RM302N",
            "ref_pname": "CANNABIS SATIVA SUBSP. INDICA TOP",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "34da090a-8174-4998-a63d-d071c58f93c1",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "590069ce-7471-42ba-9a4f-fc80ced07eb7"
          ],
          "related_substance": {
            "uuid": "5e0433e2-259d-4f26-86f7-75d722ddde24",
            "refuuid": "2ba21cff-62f7-40a2-aa50-daef1722fcad",
            "name": "CHAMAEMELUM NOBILE FLOWER",
            "unii": "O2T154T6OG",
            "linking_id": "O2T154T6OG",
            "ref_pname": "CHAMAEMELUM NOBILE FLOWER",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "3ba8f29c-dee2-428a-9983-c75fd066dc5e",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "7e39771b-8116-4d7c-b993-d5d666147213",
            "refuuid": "3b02122d-0d17-4a96-bb83-6f9cdacac46b",
            "name": "APIGENIN",
            "unii": "7V515PI7F6",
            "linking_id": "7V515PI7F6",
            "ref_pname": "APIGENIN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f4e5c62e-01a3-47f7-b9ac-a9d3ba793543",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "related_substance": {
            "uuid": "08b6955d-abd8-43d0-ae14-ddeb97387a9d",
            "refuuid": "5a26b9f9-0f16-4add-944c-6d068d18b740",
            "name": "FENUGREEK SEED",
            "unii": "654825W09Z",
            "linking_id": "654825W09Z",
            "ref_pname": "FENUGREEK SEED"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "efb0cd44-a680-4e11-8f30-8d26f9128fe0",
          "name": "2-(P-HYDROXYPHENYL)-5,7-DIHYDROXYCHROMONE",
          "stdName": "2-(P-HYDROXYPHENYL)-5,7-DIHYDROXYCHROMONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "88fb3db7-04dd-4e82-83f3-d895ee194f0d",
            "f6c2e302-84c8-48ca-8690-fda983b73302"
          ],
          "display_name": false
        },
        {
          "uuid": "3f0c812d-d317-48bc-aff3-a9be77536843",
          "name": "4',5,7-TRIHYDROXYFLAVONE",
          "stdName": "4',5,7-TRIHYDROXYFLAVONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6c2e302-84c8-48ca-8690-fda983b73302",
            "df2d0689-b624-4d3a-89bb-825d2204ff69"
          ],
          "display_name": false
        },
        {
          "uuid": "ec002833-5e05-4195-aed3-aa8850b7a6ae",
          "name": "4H-1-BENZOPYRAN-4-ONE, 5,7-DIHYDROXY-2-(4-HYDROXYPHENYL)-",
          "stdName": "4H-1-BENZOPYRAN-4-ONE, 5,7-DIHYDROXY-2-(4-HYDROXYPHENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7fcbedf8-9945-428d-9f01-0a89420a3e23",
            "f6c2e302-84c8-48ca-8690-fda983b73302"
          ],
          "display_name": false
        },
        {
          "uuid": "c6beafcf-2b8f-4667-a258-cccec1b4fdf2",
          "name": "5,7-DIHYDROXY-2-(4-HYDROXYPHENYL)-4H-1-BENZOPYRAN-4-ONE",
          "stdName": "5,7-DIHYDROXY-2-(4-HYDROXYPHENYL)-4H-1-BENZOPYRAN-4-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "88fb3db7-04dd-4e82-83f3-d895ee194f0d",
            "f6c2e302-84c8-48ca-8690-fda983b73302"
          ],
          "display_name": false
        },
        {
          "uuid": "4f80defc-30ea-4212-8dcd-8bd9919507a8",
          "name": "APEGENIN",
          "stdName": "APEGENIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7fcbedf8-9945-428d-9f01-0a89420a3e23",
            "f6c2e302-84c8-48ca-8690-fda983b73302"
          ],
          "display_name": false
        },
        {
          "uuid": "084e25a7-4f5c-4121-99bc-f4da813346df",
          "name": "APIGENIN",
          "stdName": "APIGENIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "58fd5134-bef2-4f19-a76b-fe03e5b8d502",
            "3c4b245d-ac8b-40d7-9217-5dc7a0696378",
            "38e5f4b7-18a1-44b7-b36e-37af320f4ebc",
            "20336319-b055-44b7-b6af-64e81a8794ab",
            "4512def1-10eb-482f-94b3-985829513e01",
            "df2d0689-b624-4d3a-89bb-825d2204ff69",
            "ef1be099-f55f-44cd-b192-13a9d41b8d81",
            "a887ef6f-bedb-4da3-86e6-4bbbe166cad9",
            "5ec74d48-4ba2-4118-a913-59ba535e3e85",
            "f6c2e302-84c8-48ca-8690-fda983b73302",
            "2564b220-be43-44ba-8f67-9891e6786416",
            "1a390e0a-b692-4337-9d1c-48a2b5e44d09"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "def3795d-375e-468a-9b5d-72e8de6ca5df",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "e0d0c438-20e3-40f1-88ab-ff4629523875",
          "name": "APIGENIN (CONSTITUENT OF CHAMOMILE) [DSC]",
          "stdName": "APIGENIN (CONSTITUENT OF CHAMOMILE) [DSC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6c2e302-84c8-48ca-8690-fda983b73302",
            "b821e452-5b26-4da0-bb83-e9f446f73ae2"
          ],
          "display_name": false
        },
        {
          "uuid": "3a7f4f7c-1a8c-48f0-b41f-01a00611960a",
          "name": "APIGENIN [HSDB]",
          "stdName": "APIGENIN [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a887ef6f-bedb-4da3-86e6-4bbbe166cad9",
            "f6c2e302-84c8-48ca-8690-fda983b73302"
          ],
          "display_name": false
        },
        {
          "uuid": "bf6d691a-cdc5-4796-bba5-f7a53043ce13",
          "name": "APIGENIN [MI]",
          "stdName": "APIGENIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "38e5f4b7-18a1-44b7-b36e-37af320f4ebc",
            "f6c2e302-84c8-48ca-8690-fda983b73302"
          ],
          "display_name": false
        },
        {
          "uuid": "36242377-2008-4be9-956e-61fbda1331d8",
          "name": "APIGENIN [USP-RS]",
          "stdName": "APIGENIN [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5ec74d48-4ba2-4118-a913-59ba535e3e85",
            "f6c2e302-84c8-48ca-8690-fda983b73302"
          ],
          "display_name": false
        },
        {
          "uuid": "0194efe1-9b3f-42a0-9849-e0b2554d5df5",
          "name": "APIGENINE",
          "stdName": "APIGENINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7fcbedf8-9945-428d-9f01-0a89420a3e23",
            "f6c2e302-84c8-48ca-8690-fda983b73302"
          ],
          "display_name": false
        },
        {
          "uuid": "0327f637-810d-42c9-b587-da9e911c83d0",
          "name": "APIGENOL",
          "stdName": "APIGENOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7fcbedf8-9945-428d-9f01-0a89420a3e23",
            "f6c2e302-84c8-48ca-8690-fda983b73302"
          ],
          "display_name": false
        },
        {
          "uuid": "c3c2a0ec-8805-a4f7-9f8b-0bd67844e93c",
          "name": "Apigenin [WHO-DD]",
          "stdName": "APIGENIN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff5333bd-c1ab-20c7-e448-28162b4d9598"
          ],
          "display_name": false
        },
        {
          "uuid": "28272f3f-f2f2-43d5-a302-a5a40e24877f",
          "name": "CI NATURAL YELLOW 1",
          "stdName": "CI NATURAL YELLOW 1",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7fcbedf8-9945-428d-9f01-0a89420a3e23",
            "f6c2e302-84c8-48ca-8690-fda983b73302"
          ],
          "display_name": false
        },
        {
          "uuid": "bde8dc96-2264-4288-9c81-1b1eb912aaf6",
          "name": "FLAVONE, 4',5,7-TRIHYDROXY-",
          "stdName": "FLAVONE, 4',5,7-TRIHYDROXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2eb08108-dd70-4453-bff2-04e865a45a2c",
            "f6c2e302-84c8-48ca-8690-fda983b73302"
          ],
          "display_name": false
        },
        {
          "uuid": "b6948ecb-5395-4e30-9ce4-845aa291de46",
          "name": "LY-080400",
          "stdName": "LY-080400",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7fcbedf8-9945-428d-9f01-0a89420a3e23",
            "f6c2e302-84c8-48ca-8690-fda983b73302"
          ],
          "display_name": false
        },
        {
          "uuid": "dc139069-49ec-4f7d-893c-d87e3b9d754e",
          "name": "NSC-83244",
          "stdName": "NSC-83244",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2eb08108-dd70-4453-bff2-04e865a45a2c",
            "f6c2e302-84c8-48ca-8690-fda983b73302"
          ],
          "display_name": false
        },
        {
          "uuid": "e3d61bfc-f826-422c-88ea-17ab76f857a4",
          "name": "PELARGIDENON-1449",
          "stdName": "PELARGIDENON-1449",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7fcbedf8-9945-428d-9f01-0a89420a3e23",
            "f6c2e302-84c8-48ca-8690-fda983b73302"
          ],
          "display_name": false
        },
        {
          "uuid": "4dbf7e96-1648-4fc0-bb2b-e4d626fe5bd7",
          "name": "UCCF-031",
          "stdName": "UCCF-031",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7fcbedf8-9945-428d-9f01-0a89420a3e23",
            "f6c2e302-84c8-48ca-8690-fda983b73302"
          ],
          "display_name": false
        },
        {
          "uuid": "b5a2fcbc-8d3e-4172-90e0-46e8e4dc7a05",
          "name": "VERSULIN",
          "stdName": "VERSULIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7fcbedf8-9945-428d-9f01-0a89420a3e23",
            "f6c2e302-84c8-48ca-8690-fda983b73302"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "df2d0689-b624-4d3a-89bb-825d2204ff69",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "38e5f4b7-18a1-44b7-b36e-37af320f4ebc",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f6c2e302-84c8-48ca-8690-fda983b73302",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "88fb3db7-04dd-4e82-83f3-d895ee194f0d",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2eb08108-dd70-4453-bff2-04e865a45a2c",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4512def1-10eb-482f-94b3-985829513e01",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a887ef6f-bedb-4da3-86e6-4bbbe166cad9",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5ec74d48-4ba2-4118-a913-59ba535e3e85",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1a390e0a-b692-4337-9d1c-48a2b5e44d09",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7fcbedf8-9945-428d-9f01-0a89420a3e23",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b821e452-5b26-4da0-bb83-e9f446f73ae2",
          "citation": "USP-DSC, VOL.2, 2015",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d31fd859-1117-4c79-a2db-20c2d80fdf0b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390997000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b8126979-f988-461e-9cf8-1a10bd447b0d",
          "citation": "CHIN, Y-W ET AL, LIGNANS AND OTHER CONSTITUENTS OF THE FRUITS OF EUTERPE OLERACEA(AÇAI) WITH ANTIOXIDANT AND CYTOPROTECTIVE ACTIVITIES, JOURNAL OF AGRICULTURAL AND FOOD CHEMISTRY, 56(17)7759-7764, 2008",
          "url": "http://pubs.acs.org/doi/pdf/10.1021/jf801792n",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "590069ce-7471-42ba-9a4f-fc80ced07eb7",
          "citation": "HERBAL MEDICINES 4TH ED 2103",
          "doc_type": "BOOK",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "78c36555-12a6-424c-b267-46529747766a",
          "citation": "USP-DSC",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fb3ac63d-8d0f-4b34-94bc-00170e7c08c2",
          "citation": "HERBAL MEDICINES 4TH ED",
          "doc_type": "BOOK",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d3f3ca53-bb55-4964-8f70-22e490340b8d",
          "citation": "HERBAL MEDICINES 3RD ED 2007",
          "doc_type": "BOOK",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0ad9bcf8-2c47-480e-8e55-2af54b4da08c",
          "citation": "SUGIYAMA S, CHEM PHARM BULL 41(4)714-19(1993)",
          "url": "https://www.jstage.jst.go.jp/article/cpb1958/41/4/41_4_714/_pdf",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8f3f2838-ba64-4176-8352-083e8faaa5d4",
          "citation": "CHAPTER 2 : CHEMISTRY AND ANALYSIS OF PHYTOCANNABINOIDS AND OTHER CANNABIS CONSTITUENTS BY RUDOLF BRENNEISEN; PAGES 17-49",
          "url": "http://www.medicinalgenomics.com/wp-content/uploads/2011/12/Chemical-constituents-of-cannabis.pdf",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d8d57960-4e66-4347-96ce-677f138ee22e",
          "citation": "SRS import [7V515PI7F6]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7V515PI7F6",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390997000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d1ececdf-9d5c-4316-a42a-3061602e568c",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "58fd5134-bef2-4f19-a76b-fe03e5b8d502",
          "citation": "APIGENIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ef1be099-f55f-44cd-b192-13a9d41b8d81",
          "citation": "APIGENIN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "20336319-b055-44b7-b6af-64e81a8794ab",
          "citation": "APIGENIN [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2564b220-be43-44ba-8f67-9891e6786416",
          "citation": "APIGENIN [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3c4b245d-ac8b-40d7-9217-5dc7a0696378",
          "citation": "APIGENIN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "14449986-9960-ef58-9c9f-269fd18cbb49",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+520-36-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "74bc537e-5b89-0108-ed2a-d29847c5eabd",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=520-36-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3e7dc0d2-c8de-21d2-761e-b7076231e6c2",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "fa07c468-972b-f9b1-a221-0a159b736701",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "e3a5a9ec-1ff1-419c-b20b-2224f58c43c5",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4c1c33d4-baca-ae50-a788-c091feb1b2c4",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "24761ec5-27ab-5507-0bc1-13a9279b9459",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "ff5333bd-c1ab-20c7-e448-28162b4d9598",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "739c4683-2662-4edf-9a03-b408653ea860",
          "id": "739c4683-2662-4edf-9a03-b408653ea860",
          "molfile": "\n  Marvin  01132105592D          \n\n 20 22  0  0  0  0            999 V2000\n   10.3331   -3.4440    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6279   -3.8577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8828   -3.4440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1824   -3.8577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1824   -4.6816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8828   -5.1022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6279   -4.6816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4783   -5.1022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4783   -5.9283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7401   -6.3455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7401   -7.1728    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0351   -5.9283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3311   -6.3455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3311   -7.1728    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5873   -5.9283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5873   -5.1022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8833   -4.6816    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3311   -4.6816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0351   -5.1022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7401   -4.6816    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  7  2  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  8  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 20  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 10  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 19  2  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 16  2  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
          "smiles": "c1cc(ccc1-c2cc(=O)c3c(cc(cc3o2)O)O)O",
          "formula": "C15H10O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "04aa1771-73f2-4327-a44c-b8e62caea0b0"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "270.2375",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3b02122d-0d17-4a96-bb83-6f9cdacac46b",
      "version": "28",
      "structure": {
        "id": "1c77158b-93c7-4eec-bd3f-4dc2d023e750",
        "molfile": "\n  Marvin  01132101392D          \n\n 20 22  0  0  0  0            999 V2000\n    6.0351   -5.9283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0351   -5.1022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7401   -4.6816    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4783   -5.1022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1824   -4.6816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1824   -3.8577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8828   -3.4440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6279   -3.8577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3331   -3.4440    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6279   -4.6816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8828   -5.1022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4783   -5.9283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7401   -6.3455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7401   -7.1728    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3311   -4.6816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5873   -5.1022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8833   -4.6816    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5873   -5.9283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3311   -6.3455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3311   -7.1728    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  8  2  0  0  0  0\n 11 10  1  0  0  0  0\n  5 11  2  0  0  0  0\n 12  4  2  0  0  0  0\n 13 12  1  0  0  0  0\n  1 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n  2 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 16  2  0  0  0  0\n 19 18  1  0  0  0  0\n  1 19  2  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
        "smiles": "c1cc(ccc1-c2cc(=O)c3c(cc(cc3o2)O)O)O",
        "formula": "C15H10O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "270.2375",
        "optical_activity": "NONE",
        "references": [
          "d8d57960-4e66-4347-96ce-677f138ee22e",
          "d1ececdf-9d5c-4316-a42a-3061602e568c"
        ],
        "stereo_centers": 0
      },
      "unii": "7V515PI7F6"
    }
  ]
}