{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "6e4d052e-7678-4e9c-a886-f002c204f747",
          "code": "907204-31-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=907204-31-3",
          "code_system": "CAS",
          "references": [
            "518bc113-bc54-45c9-8610-ce81d52ade98",
            "1e22aeac-3ea5-45ec-a761-b3996ff87bf6"
          ]
        },
        {
          "uuid": "c42b6c0e-31f6-4be3-849e-fb6b4221a4a8",
          "code": "138009",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:315",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "518bc113-bc54-45c9-8610-ce81d52ade98"
          ]
        },
        {
          "uuid": "d927c33c-2f5f-4470-b6a8-0714f537fa29",
          "code": "16095400",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/16095400",
          "code_system": "PUBCHEM",
          "references": [
            "518bc113-bc54-45c9-8610-ce81d52ade98"
          ]
        },
        {
          "uuid": "8fd15c26-5b98-71f5-ee14-eaf8ff41a82c",
          "code": "DTXSID6058215",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6058215",
          "code_system": "EPA CompTox",
          "references": [
            "eb585273-ed79-ce68-8cd7-757bf016f1e4"
          ]
        },
        {
          "uuid": "dad0398c-c52c-45d2-9649-59e8b1bd7283",
          "code": "7U8P4NAR2S",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3717bc43-0c6c-6b91-ca07-a2c9ceb52e2f",
          "code": "83113",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:83113",
          "code_system": "CHEBI",
          "references": [
            "4e970f42-c0fe-64ed-318d-c565b7049781"
          ]
        },
        {
          "uuid": "a6726553-5c6d-a2ba-5ee7-86ddd3f1ed67",
          "code": "Fluxapyroxad",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Fluxapyroxad",
          "code_system": "WIKIPEDIA",
          "references": [
            "1b088546-1db4-9149-f5c4-1d836593799d"
          ]
        },
        {
          "uuid": "a32391ec-c01a-25ad-ed61-2f52df3b0a12",
          "code": "fluxapyroxad",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/fluxapyroxad.html",
          "code_system": "ALANWOOD",
          "references": [
            "ae393a1a-6fa4-b358-2a54-5b7434701d1b"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3a617ec9-5447-4fba-a3a4-f9ec0afa8db5",
          "name": "3-(DIFLUOROMETHYL)-1-METHYL-N-(3',4',5'-TRIFLUORO(1,1'-BIPHENYL)-2-YL)-1H-PYRAZOLE-4-CARBOXAMIDE",
          "stdName": "3-(DIFLUOROMETHYL)-1-METHYL-N-(3',4',5'-TRIFLUORO(1,1'-BIPHENYL)-2-YL)-1H-PYRAZOLE-4-CARBOXAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b058aaae-cc68-498a-b615-f41b7735ec97",
            "6f99e7dd-c82f-4417-9f5a-da2ec86925da"
          ],
          "display_name": false
        },
        {
          "uuid": "175df578-9d7a-413d-94a8-6af272d07ccc",
          "name": "3-(DIFLUOROMETHYL)-1-METHYL-N-(3',4',5'-TRIFLUOROBIPHENYL-2-YL)PYRAZOLE-4-CARBOXAMIDE",
          "stdName": "3-(DIFLUOROMETHYL)-1-METHYL-N-(3',4',5'-TRIFLUOROBIPHENYL-2-YL)PYRAZOLE-4-CARBOXAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0ef069d1-9138-4350-8437-cfed45f332b3",
            "6f99e7dd-c82f-4417-9f5a-da2ec86925da"
          ],
          "display_name": false
        },
        {
          "uuid": "5905fd9c-d659-45af-b2d0-6a786330e0d3",
          "name": "FLUXAPYROXAD",
          "stdName": "FLUXAPYROXAD",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4b7d15d5-bfd2-4402-98b0-a53054acb058",
            "0b0f3adf-f54c-4daf-8690-f105a86ed804",
            "199054f8-53f8-43a7-8626-679318d7cd6f",
            "0d741c52-b753-4b43-9c92-314f74ce5e22"
          ],
          "display_name": true
        },
        {
          "uuid": "8fd8ae83-ae10-4153-8d87-916220d46485",
          "name": "FLUXAPYROXAD [ISO]",
          "stdName": "FLUXAPYROXAD [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0b0f3adf-f54c-4daf-8690-f105a86ed804",
            "0d741c52-b753-4b43-9c92-314f74ce5e22"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6f99e7dd-c82f-4417-9f5a-da2ec86925da",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b058aaae-cc68-498a-b615-f41b7735ec97",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0ef069d1-9138-4350-8437-cfed45f332b3",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4b7d15d5-bfd2-4402-98b0-a53054acb058",
          "citation": "ALANWOOD.NET 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0b0f3adf-f54c-4daf-8690-f105a86ed804",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0d741c52-b753-4b43-9c92-314f74ce5e22",
          "citation": "ISO",
          "doc_type": "ISO",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "518bc113-bc54-45c9-8610-ce81d52ade98",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390974000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a3e8a9fd-4732-4c11-b7be-52bd5da4e894",
          "citation": "SRS import [7U8P4NAR2S]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7U8P4NAR2S",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390974000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c088c59a-f346-451a-8a00-17452eaa9da0",
          "citation": "CHEMID  2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "199054f8-53f8-43a7-8626-679318d7cd6f",
          "citation": "FLUXAPYROXAD [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "eb585273-ed79-ce68-8cd7-757bf016f1e4",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=907204-31-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1b088546-1db4-9149-f5c4-1d836593799d",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "ae393a1a-6fa4-b358-2a54-5b7434701d1b",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "4e970f42-c0fe-64ed-318d-c565b7049781",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "1e22aeac-3ea5-45ec-a761-b3996ff87bf6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "185d17a2-3f01-45ec-9e8e-cba068d35fa3",
          "id": "185d17a2-3f01-45ec-9e8e-cba068d35fa3",
          "molfile": "\n  Marvin  01132101272D          \n\n 27 29  0  0  0  0            999 V2000\n    5.8277   -8.1176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7416   -7.2972    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3547   -6.7451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0191   -5.9914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4316   -5.2770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0191   -4.5625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2565   -5.2770    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6691   -4.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2565   -3.8481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6691   -3.1336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4941   -3.1336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9065   -3.8481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4941   -4.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9065   -5.2770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4941   -5.9914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9065   -6.7059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4941   -7.4203    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7315   -6.7059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1440   -7.4203    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1440   -5.9914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9690   -5.9914    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7315   -5.2770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1986   -6.0777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0271   -6.8846    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6466   -5.4646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8397   -5.6362    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9016   -4.6800    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2 24  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  4 23  1  0  0  0  0\n  5  6  2  0  0  0  0\n  7  5  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 13  2  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 22 14  2  0  0  0  0\n 16 15  2  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  1  0  0  0  0\n 23 24  2  0  0  0  0\n 23 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 25 27  1  0  0  0  0\nM  END",
          "smiles": "Cn1cc(c(C(F)F)n1)C(=O)Nc2ccccc2-c3cc(c(c(c3)F)F)F",
          "formula": "C18H12F5N3O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c439bd36-ed7b-458c-837d-44afd18039ff"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "381.3001",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9b647635-1559-4ce6-a11c-a5a375534041",
      "version": "6",
      "structure": {
        "id": "86a32833-8e45-4525-bb8b-37d78325e827",
        "molfile": "\n  Marvin  01132106592D          \n\n 27 29  0  0  0  0            999 V2000\n    7.6691   -4.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4941   -4.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9065   -3.8481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4941   -3.1336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6691   -3.1336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2565   -3.8481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9065   -5.2770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7315   -5.2770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1440   -5.9914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7315   -6.7059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9065   -6.7059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4941   -5.9914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4941   -7.4203    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1440   -7.4203    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9690   -5.9914    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2565   -5.2770    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4316   -5.2770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0191   -5.9914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3547   -6.7451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7416   -7.2972    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0271   -6.8846    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1986   -6.0777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6466   -5.4646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8397   -5.6362    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9016   -4.6800    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8277   -8.1176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0191   -4.5625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  1  6  1  0  0  0  0\n  2  7  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n  7 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 10 14  1  0  0  0  0\n  9 15  1  0  0  0  0\n  1 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 18  2  0  0  0  0\n 20 19  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 21  2  0  0  0  0\n 18 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 23 25  1  0  0  0  0\n 20 26  1  0  0  0  0\n 17 27  2  0  0  0  0\nM  END",
        "smiles": "Cn1cc(c(C(F)F)n1)C(=O)Nc2ccccc2-c3cc(c(c(c3)F)F)F",
        "formula": "C18H12F5N3O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "381.3001",
        "optical_activity": "NONE",
        "references": [
          "c088c59a-f346-451a-8a00-17452eaa9da0",
          "a3e8a9fd-4732-4c11-b7be-52bd5da4e894"
        ],
        "stereo_centers": 0
      },
      "unii": "7U8P4NAR2S"
    }
  ]
}