{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ab5c2a9e-9c97-4d7e-ba09-1bea02a5a3c9",
          "code": "66441-23-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=66441-23-4",
          "code_system": "CAS",
          "references": [
            "cd5f5fb1-b630-4618-9ce5-69ce5f5fcf3b",
            "3654f788-4f5a-4693-a06e-5a220cb5c839"
          ]
        },
        {
          "uuid": "a7accaa9-68e9-4a9d-b026-f033d1f41734",
          "code": "266-362-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.060.311",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "cd5f5fb1-b630-4618-9ce5-69ce5f5fcf3b"
          ]
        },
        {
          "uuid": "5937ce84-ba77-4551-97ea-538b4d83517d",
          "code": "m5285",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5285?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "cd5f5fb1-b630-4618-9ce5-69ce5f5fcf3b"
          ]
        },
        {
          "uuid": "6d1219a0-4716-483d-9c8a-b683e0720d4c",
          "code": "47938",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/47938",
          "code_system": "PUBCHEM",
          "references": [
            "cd5f5fb1-b630-4618-9ce5-69ce5f5fcf3b"
          ]
        },
        {
          "uuid": "fcc8b8ff-61e1-64f6-b6f0-991c1d3628ad",
          "code": "6848",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6848",
          "code_system": "HSDB",
          "references": [
            "39228727-4480-11de-1796-293028c8487c"
          ]
        },
        {
          "uuid": "eb8327c3-3294-f470-af99-f0ec324f8a2e",
          "code": "DTXSID2032392",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2032392",
          "code_system": "EPA CompTox",
          "references": [
            "66c44e28-a3fb-e387-3076-7301fd925996"
          ]
        },
        {
          "uuid": "3b63a56a-18dc-1bd3-254c-f1b169e92619",
          "code": "DB05252",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB05252",
          "code_system": "DRUG BANK",
          "references": [
            "0b2c85db-3a55-9af6-8d8f-71bbe57aaf5c"
          ]
        },
        {
          "uuid": "dbefe53c-066e-4691-a79c-995eed41c980",
          "code": "7U20WEM458",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b1e046ff-8f7e-3745-9485-ba90fe5b09c3",
          "code": "fenoxaprop-ethyl",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/fenoxaprop-ethyl.html",
          "code_system": "ALANWOOD",
          "references": [
            "f464d886-6da9-cf9d-0215-946b3f691cf8"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "13f2f201-4e12-4718-a6d9-b411724fe727",
          "name": "(±)-FENOXAPROP-ETHYL",
          "stdName": "(+/-)-FENOXAPROP-ETHYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "53ef8157-a464-47f6-8b2e-65ce5427466a"
          ],
          "display_name": false
        },
        {
          "uuid": "9986085b-9e71-4fd5-86da-c53aefa4afa2",
          "name": "FENOXAPROP ETHYL ESTER",
          "stdName": "FENOXAPROP ETHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2a0c33a1-9fe5-493a-a252-db42d2496783"
          ],
          "display_name": false
        },
        {
          "uuid": "add2b84c-9887-4139-a386-e4496ed6863a",
          "name": "FENOXAPROP-ETHYL",
          "stdName": "FENOXAPROP-ETHYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "36836e39-b20c-4298-9a87-0a2c897970fd",
            "b17db33c-a488-4f4f-96af-6847880ccd4f",
            "a0db08d1-ee4a-4305-a66d-94dc70edfb29",
            "366d9e83-4347-45e4-8708-86fd8e267015"
          ],
          "display_name": true
        },
        {
          "uuid": "fa6cffd3-f5d5-4f12-b5ab-f593243d5ffb",
          "name": "FENOXAPROP-ETHYL [ISO]",
          "stdName": "FENOXAPROP-ETHYL [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a0db08d1-ee4a-4305-a66d-94dc70edfb29"
          ],
          "display_name": false
        },
        {
          "uuid": "2ae02a8f-1df8-4b99-b5b8-30622595fe3d",
          "name": "FENOXAPROP-ETHYL [MI]",
          "stdName": "FENOXAPROP-ETHYL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b17db33c-a488-4f4f-96af-6847880ccd4f"
          ],
          "display_name": false
        },
        {
          "uuid": "5cf4da7e-54fc-4f14-8a57-12c6f93b376b",
          "name": "FENOXAPROP-ETHYL, (±)-",
          "stdName": "FENOXAPROP-ETHYL, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1fab1449-70f1-4e70-9a25-38335338bc29"
          ],
          "display_name": false
        },
        {
          "uuid": "af7559a0-0890-43d9-bbe4-b8ac593fea55",
          "name": "HOE-33171",
          "stdName": "HOE-33171",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b17db33c-a488-4f4f-96af-6847880ccd4f"
          ],
          "display_name": false
        },
        {
          "uuid": "58d46d1d-7898-4e4e-b2a6-2ef2dfbb3bce",
          "name": "PROPANOIC ACID, 2-(4-((6-CHLORO-2-BENZOXAZOLYL)OXY)PHENOXY)-, ETHYL ESTER, (±)-",
          "stdName": "PROPANOIC ACID, 2-(4-((6-CHLORO-2-BENZOXAZOLYL)OXY)PHENOXY)-, ETHYL ESTER, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "53ef8157-a464-47f6-8b2e-65ce5427466a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "2a0c33a1-9fe5-493a-a252-db42d2496783",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "1fab1449-70f1-4e70-9a25-38335338bc29",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b17db33c-a488-4f4f-96af-6847880ccd4f",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "53ef8157-a464-47f6-8b2e-65ce5427466a",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a0db08d1-ee4a-4305-a66d-94dc70edfb29",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cd5f5fb1-b630-4618-9ce5-69ce5f5fcf3b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391638000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6a04dfb7-dc7d-46a3-8639-ab4b8330fff2",
          "citation": "SRS import [7U20WEM458]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7U20WEM458",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391638000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "366d9e83-4347-45e4-8708-86fd8e267015",
          "citation": "FENOXAPROP-ETHYL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "36836e39-b20c-4298-9a87-0a2c897970fd",
          "citation": "FENOXAPROP-ETHYL [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "39228727-4480-11de-1796-293028c8487c",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+66441-23-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "66c44e28-a3fb-e387-3076-7301fd925996",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=66441-23-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f464d886-6da9-cf9d-0215-946b3f691cf8",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "0b2c85db-3a55-9af6-8d8f-71bbe57aaf5c",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "3654f788-4f5a-4693-a06e-5a220cb5c839",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0b57aa66-0c21-4534-bb2e-20ef1d177d8f",
          "id": "0b57aa66-0c21-4534-bb2e-20ef1d177d8f",
          "molfile": "\n  Marvin  01132100502D          \n\n 25 27  0  0  0  0            999 V2000\n   12.8043   -5.5034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2242   -6.0547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5144   -5.6453    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7955   -6.0607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7955   -6.8855    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0855   -5.6513    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   10.0855   -4.8217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3669   -6.0615    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6506   -5.6501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6506   -4.8269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9365   -4.4128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2223   -4.8278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5046   -4.4298    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6844   -4.4298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1841   -3.7606    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4060   -4.0308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6874   -3.6231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9833   -4.0391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9833   -4.8660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2744   -5.2898    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.6966   -5.2751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4060   -4.8539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2063   -5.1044    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2223   -5.6568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9364   -6.0650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  4  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 25  9  2  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 12 24  2  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  2  0  0  0  0\n 23 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 22  2  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 24 25  1  0  0  0  0\nM  END",
          "smiles": "CCOC(=O)C(C)Oc1ccc(cc1)Oc2nc3ccc(cc3o2)Cl",
          "formula": "C18H16ClNO5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0bdbbb73-0e49-418b-bc19-94b234727c80"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "361.777",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e077ba65-70cd-4bba-94df-a858893a4626",
      "version": "6",
      "structure": {
        "id": "a26c7195-7ae6-4419-a842-13cfc41915e2",
        "molfile": "\n  Marvin  01132108262D          \n\n 25 27  0  0  0  0            999 V2000\n    3.6874   -3.6231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4060   -4.0308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1841   -3.7606    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6844   -4.4298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5046   -4.4298    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2223   -4.8278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9365   -4.4128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6506   -4.8269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6506   -5.6501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3669   -6.0615    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0855   -5.6513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0855   -4.8217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7955   -6.0607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5144   -5.6453    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2242   -6.0547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8043   -5.5034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7955   -6.8855    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9364   -6.0650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2223   -5.6568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2063   -5.1044    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4060   -4.8539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6966   -5.2751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9833   -4.8660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9833   -4.0391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2744   -5.2898    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 13 17  2  0  0  0  0\n 18  9  1  0  0  0  0\n 19 18  2  0  0  0  0\n  6 19  1  0  0  0  0\n 20  4  1  0  0  0  0\n 21 20  1  0  0  0  0\n  2 21  2  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  2  0  0  0  0\n 24 23  1  0  0  0  0\n  1 24  2  0  0  0  0\n 23 25  1  0  0  0  0\nM  END",
        "smiles": "CCOC(=O)C(C)Oc1ccc(cc1)Oc2nc3ccc(cc3o2)Cl",
        "formula": "C18H16ClNO5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "361.777",
        "optical_activity": "( + / - )",
        "references": [
          "53ef8157-a464-47f6-8b2e-65ce5427466a",
          "6a04dfb7-dc7d-46a3-8639-ab4b8330fff2"
        ],
        "stereo_centers": 1
      },
      "unii": "7U20WEM458"
    }
  ]
}