{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "56c902e4-c057-4560-814c-4bc2a3b1d8ac",
          "code": "62-76-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=62-76-0",
          "code_system": "CAS",
          "references": [
            "031bace5-ea5f-4cac-b214-944ec7019a15",
            "5e46e7ab-8294-406c-a86c-5f03d36ecdce"
          ]
        },
        {
          "uuid": "9a81553e-3d81-402f-ab2d-daf2bf2f7977",
          "code": "C84163",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C84163",
          "code_system": "NCI_THESAURUS",
          "references": [
            "031bace5-ea5f-4cac-b214-944ec7019a15"
          ]
        },
        {
          "uuid": "5bf3e59f-a71e-4a57-a7a2-d4d22c5ca8c6",
          "code": "SODIUM OXALATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Sodium_oxalate",
          "code_system": "WIKIPEDIA",
          "references": [
            "031bace5-ea5f-4cac-b214-944ec7019a15"
          ]
        },
        {
          "uuid": "174ecc3f-e092-4d53-b5f6-84e0c54ab959",
          "code": "9604",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3881",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "031bace5-ea5f-4cac-b214-944ec7019a15"
          ]
        },
        {
          "uuid": "ca2df357-a36c-4651-b60b-e7a871b2c5c6",
          "code": "200-550-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.501",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "031bace5-ea5f-4cac-b214-944ec7019a15"
          ]
        },
        {
          "uuid": "1d115102-73f7-4bf1-8f78-d0208dbef1b4",
          "code": "1441659",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1441659/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "031bace5-ea5f-4cac-b214-944ec7019a15"
          ]
        },
        {
          "uuid": "96f27c95-65d1-4492-ae32-e4864158d2cc",
          "code": "m10051",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10051?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "031bace5-ea5f-4cac-b214-944ec7019a15"
          ]
        },
        {
          "uuid": "03eda354-6bf9-4eae-b8d8-fdc1d0c24510",
          "code": "SUB33600",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "031bace5-ea5f-4cac-b214-944ec7019a15"
          ]
        },
        {
          "uuid": "d8114318-4455-462e-a8ad-62c85d08f180",
          "code": "6125",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6125",
          "code_system": "PUBCHEM",
          "references": [
            "031bace5-ea5f-4cac-b214-944ec7019a15"
          ]
        },
        {
          "uuid": "1015d047-aa1f-b54a-fb64-a9c684631e5b",
          "code": "DTXSID1037018",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1037018",
          "code_system": "EPA CompTox",
          "references": [
            "472d3be8-e919-eb49-28c3-832db3ce97ca"
          ]
        },
        {
          "uuid": "95f3fa9b-d3a3-4748-962f-ee03cccc7221",
          "code": "C263",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Blood or Body Fluid[C78275]|Anticoagulant Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C263",
          "code_system": "NCI_THESAURUS",
          "references": [
            "1b7f7ea3-9cb7-d57e-35fe-5e6931dc8b26"
          ]
        },
        {
          "uuid": "8d18c729-e371-4b0d-a339-8193469193d9",
          "code": "7U0V68LT9X",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "90e9d6ad-cbe3-5010-375c-1e7f2dcc0476",
          "code": "77458",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=77458",
          "code_system": "NSC",
          "references": [
            "173f64be-31e7-86d0-ce67-cad9dfd8da82"
          ]
        },
        {
          "uuid": "0b281525-481f-4038-10f0-e371b58bd18f",
          "code": "7U0V68LT9X",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=7U0V68LT9X",
          "code_system": "DAILYMED",
          "references": [
            "94120304-c53a-146b-b2fc-b20ec9d95510"
          ]
        },
        {
          "uuid": "f6c599bc-db9d-ea46-c5c0-988057c51bec",
          "code": "100000127566",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "308b2814-c950-4cb7-7719-66cdc6ac54e3"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "010fbc02-57af-4a14-a928-c7cee7a5dcdb",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "65af5a64-fe65-49ba-afa1-d0f2e2eb8ed0",
            "refuuid": "353e1fa7-c753-4f1d-b092-7fff4cf4c42b",
            "name": "Oxalic Acid",
            "unii": "9E7R5L6H31",
            "linking_id": "9E7R5L6H31",
            "ref_pname": "Oxalic Acid",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "3246432f-8d5a-482a-b9c8-50e5926306bb",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "6050c9f1-32a3-4464-bc95-3804b30c5b1e",
            "refuuid": "353e1fa7-c753-4f1d-b092-7fff4cf4c42b",
            "name": "Oxalic Acid",
            "unii": "9E7R5L6H31",
            "linking_id": "9E7R5L6H31",
            "ref_pname": "Oxalic Acid",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "59c9928e-7d1d-48e4-908a-bbcad8ba2a11",
          "name": "ETHANEDIOIC ACID SODIUM SALT (1:2)",
          "stdName": "ETHANEDIOIC ACID SODIUM SALT (1:2)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6c390802-c8be-4d37-b3cf-c680830b191e",
            "1ca7260b-5f7d-431c-899a-79076f7b9236"
          ],
          "display_name": false
        },
        {
          "uuid": "d61374ad-6b18-4559-a4da-80fc274355de",
          "name": "NSC-77458",
          "stdName": "NSC-77458",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9a3e666c-243c-464c-a4d0-c13698efaea0",
            "1ca7260b-5f7d-431c-899a-79076f7b9236"
          ],
          "display_name": false
        },
        {
          "uuid": "19869bf0-4d9f-4f20-9415-f6424955b078",
          "name": "OXALIC ACID DISODIUM SALT",
          "stdName": "OXALIC ACID DISODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6c390802-c8be-4d37-b3cf-c680830b191e",
            "1ca7260b-5f7d-431c-899a-79076f7b9236"
          ],
          "display_name": false
        },
        {
          "uuid": "ed7f86b7-633c-468e-ac6d-a68343bf83de",
          "name": "SODIUM OXALATE",
          "stdName": "SODIUM OXALATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f4819353-e01e-4a4d-927e-975d161f95c5",
            "7cf63606-12d6-4988-912b-1eff345bd5e6",
            "a124b2b5-85b7-4ea0-bbf2-134c56581ec9",
            "6c390802-c8be-4d37-b3cf-c680830b191e",
            "b598357a-4ac0-4868-b55d-49c166998e4e",
            "1ca7260b-5f7d-431c-899a-79076f7b9236"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "67ce744f-7064-49a1-ab21-f1516605f873",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "51618339-6821-461b-af3f-60eaf6b9e93b",
          "name": "SODIUM OXALATE [MI]",
          "stdName": "SODIUM OXALATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a124b2b5-85b7-4ea0-bbf2-134c56581ec9",
            "1ca7260b-5f7d-431c-899a-79076f7b9236"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1ca7260b-5f7d-431c-899a-79076f7b9236",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a124b2b5-85b7-4ea0-bbf2-134c56581ec9",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7cf63606-12d6-4988-912b-1eff345bd5e6",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9a3e666c-243c-464c-a4d0-c13698efaea0",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "031bace5-ea5f-4cac-b214-944ec7019a15",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389654000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "998dc567-fb49-4cd0-8494-0c982f23181f",
          "citation": "SRS import [7U0V68LT9X]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7U0V68LT9X",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389654000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f4819353-e01e-4a4d-927e-975d161f95c5",
          "citation": "SODIUM OXALATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b598357a-4ac0-4868-b55d-49c166998e4e",
          "citation": "SODIUM OXALATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6c390802-c8be-4d37-b3cf-c680830b191e",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "472d3be8-e919-eb49-28c3-832db3ce97ca",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=62-76-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1b7f7ea3-9cb7-d57e-35fe-5e6931dc8b26",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "5e46e7ab-8294-406c-a86c-5f03d36ecdce",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "173f64be-31e7-86d0-ce67-cad9dfd8da82",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "94120304-c53a-146b-b2fc-b20ec9d95510",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "308b2814-c950-4cb7-7719-66cdc6ac54e3",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "13ecd4bb-ed31-475a-9697-60a4c677603e",
          "id": "13ecd4bb-ed31-475a-9697-60a4c677603e",
          "molfile": "\n  Marvin  01132101142D          \n\n  1  0  0  0  0  0            999 V2000\n    6.9946  -18.1225    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "62e40508-8f09-49e0-9f07-756af313d105"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "1b332a66-35d3-4436-b35f-4f36a30a8e97",
          "id": "1b332a66-35d3-4436-b35f-4f36a30a8e97",
          "molfile": "\n  Marvin  01132101352D          \n\n  6  5  0  0  0  0            999 V2000\n    4.0416  -18.5229    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.7548  -18.1058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7465  -17.2799    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4680  -18.5187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1812  -18.0975    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.4597  -19.3445    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  2  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  4  2  0  0  0  0\nM  CHG  2   1  -1   5  -1\nM  END",
          "smiles": "C(=O)(C(=O)[O-])[O-]",
          "formula": "C2O4",
          "atropisomerism": "No",
          "charge": -2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0342b14d-80eb-421d-be09-4592dd32ef8b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "88.0191",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "fa082e55-968b-4af2-a22e-4b42cff91745",
      "version": "8",
      "structure": {
        "id": "fa442cb6-ad2a-4def-b7bb-391f178d7fa7",
        "molfile": "\n  Marvin  01132112582D          \n\n  8  5  0  0  0  0            999 V2000\n    4.7548  -18.1058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4680  -18.5187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0416  -18.5229    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.1812  -18.0975    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.4597  -19.3445    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7465  -17.2799    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9946  -18.1225    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n    3.0698  -18.5229    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5  2  2  0  0  0  0\n  6  1  2  0  0  0  0\nM  CHG  4   3  -1   4  -1   7   1   8   1\nM  END",
        "smiles": "C(=O)(C(=O)[O-])[O-].[Na+].[Na+]",
        "formula": "C2O4.2Na",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "133.9986",
        "optical_activity": "NONE",
        "references": [
          "998dc567-fb49-4cd0-8494-0c982f23181f",
          "6c390802-c8be-4d37-b3cf-c680830b191e"
        ],
        "stereo_centers": 0
      },
      "unii": "7U0V68LT9X"
    }
  ]
}