{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "887c124c-c583-47bb-a8cb-137f35af95b8",
          "code": "122836-35-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=122836-35-5",
          "code_system": "CAS",
          "references": [
            "e696092c-ecaf-4c66-998b-48c904576cec",
            "3f7e1ffa-46ba-462b-a201-34c42118b010"
          ]
        },
        {
          "uuid": "b80563e8-9562-4d6d-8dd0-5d77712c5701",
          "code": "C475571",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67475571",
          "code_system": "MESH",
          "references": [
            "e696092c-ecaf-4c66-998b-48c904576cec"
          ]
        },
        {
          "uuid": "492d48f2-1cf8-474b-82dd-4e5088745141",
          "code": "129081",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3956",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "e696092c-ecaf-4c66-998b-48c904576cec"
          ]
        },
        {
          "uuid": "94a3b2dd-5256-4955-b5cc-79a9419b7129",
          "code": "m10348",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10348?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "e696092c-ecaf-4c66-998b-48c904576cec"
          ]
        },
        {
          "uuid": "3013fa23-550c-4fd0-a541-708290869a6f",
          "code": "86369",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/86369",
          "code_system": "PUBCHEM",
          "references": [
            "e696092c-ecaf-4c66-998b-48c904576cec"
          ]
        },
        {
          "uuid": "f9570c32-6351-40fb-4738-146f0705d5ce",
          "code": "7014",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7014",
          "code_system": "HSDB",
          "references": [
            "9958870a-26ed-41c4-86fa-dd1f9b1f4a9c"
          ]
        },
        {
          "uuid": "678f3b65-bdb2-6f35-f39b-796103b59e51",
          "code": "DTXSID6032645",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6032645",
          "code_system": "EPA CompTox",
          "references": [
            "1f9fe090-85ad-47c3-0a9b-bdd7eb753ea7"
          ]
        },
        {
          "uuid": "c0a75cf8-570b-41ca-8ba2-923f616c7ad8",
          "code": "7TY7WT1599",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f8a53792-e8ca-396f-e0a9-edb1971426a9",
          "code": "9339",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:9339",
          "code_system": "CHEBI",
          "references": [
            "16c687a8-c4da-7a2b-bced-720a8124e420"
          ]
        },
        {
          "uuid": "bd79c770-1d9c-13a8-f502-95beb3c7b7a6",
          "code": "Sulfentrazone",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Sulfentrazone",
          "code_system": "WIKIPEDIA",
          "references": [
            "f30a254c-bdde-45f5-39c5-80cf266feddc"
          ]
        },
        {
          "uuid": "d0f1dc1b-728c-2c3b-7df5-a98a6d0ff08a",
          "code": "sulfentrazone",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/sulfentrazone.html",
          "code_system": "ALANWOOD",
          "references": [
            "36e8b8fd-7713-b479-7fe6-9fa2594ab947"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "cbaec985-d3f5-423d-a06f-7843c28b83c2",
          "name": "2',4'-DICHLORO-5'-(4-DIFLUOROMETHYL-4,5-DIHYDRO-3-METHYL-5-OXO-1H-1,2,4-TRIAZOL-1-YL)METHANESULFONANILIDE",
          "stdName": "2',4'-DICHLORO-5'-(4-DIFLUOROMETHYL-4,5-DIHYDRO-3-METHYL-5-OXO-1H-1,2,4-TRIAZOL-1-YL)METHANESULFONANILIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b3dc1a0c-338f-4e2f-97fa-4071ff4fb504",
            "fe58a0d0-dabc-4b73-896c-bd776c6ef79a"
          ],
          "display_name": false
        },
        {
          "uuid": "95a80b2f-5549-48d3-b89a-45e5c5c7527d",
          "name": "AUTHORITY",
          "stdName": "AUTHORITY",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "00119645-8ef3-44e3-ad6d-fcfdb0a1fbfe",
            "e6f52d14-edd7-4994-bea6-ca1db4eb8458"
          ],
          "display_name": false
        },
        {
          "uuid": "63923b9f-9430-498a-b3e0-99533deb67af",
          "name": "F-6285",
          "stdName": "F-6285",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "00119645-8ef3-44e3-ad6d-fcfdb0a1fbfe",
            "e6f52d14-edd7-4994-bea6-ca1db4eb8458"
          ],
          "display_name": false
        },
        {
          "uuid": "76658c77-decf-420e-b6e2-28dbbb040911",
          "name": "FMC-97285",
          "stdName": "FMC-97285",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "00119645-8ef3-44e3-ad6d-fcfdb0a1fbfe",
            "e6f52d14-edd7-4994-bea6-ca1db4eb8458"
          ],
          "display_name": false
        },
        {
          "uuid": "905e6bd2-489c-4e6b-a346-950bed2dcffb",
          "name": "N-(2,4-DICHLORO-5-(4-(DIFLUOROMETHYL)-4,5-DIHYDRO-3-METHYL-5-OXO-1H-1,2,4-TRIAZOL-1-YL)PHENYL)METHANESULFONAMIDE",
          "stdName": "N-(2,4-DICHLORO-5-(4-(DIFLUOROMETHYL)-4,5-DIHYDRO-3-METHYL-5-OXO-1H-1,2,4-TRIAZOL-1-YL)PHENYL)METHANESULFONAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b3dc1a0c-338f-4e2f-97fa-4071ff4fb504",
            "6968b038-866c-4662-aec4-c8a0de7f56e1"
          ],
          "display_name": false
        },
        {
          "uuid": "f1e27421-d379-4175-bc24-ce87bc979e03",
          "name": "SPARTAN",
          "stdName": "SPARTAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "efe835b0-b703-4862-b8d3-87149d710124",
            "e6f52d14-edd7-4994-bea6-ca1db4eb8458"
          ],
          "display_name": false
        },
        {
          "uuid": "94414243-e8a5-41be-810d-13a2754ffebb",
          "name": "SULFENTRAZONE",
          "stdName": "SULFENTRAZONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "787de4ad-206e-4a3f-89d9-5d6ac1218706",
            "c4ae12e7-afec-4334-9e62-94df71261c3b",
            "137e4a15-5b4d-4e56-93ba-aef98754f85f",
            "21480156-2322-4efd-bb09-13eebb0e18be",
            "92e77e00-81e8-4319-aec0-ac4ee499c936",
            "b4bbccfd-91e6-4242-bd2c-b7cb4caaa5b5",
            "c3730f73-89df-466d-abab-e823b1456100",
            "e6f52d14-edd7-4994-bea6-ca1db4eb8458"
          ],
          "display_name": true
        },
        {
          "uuid": "a3fe8988-1c10-455f-928d-3e1d297e0262",
          "name": "SULFENTRAZONE [HSDB]",
          "stdName": "SULFENTRAZONE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c4ae12e7-afec-4334-9e62-94df71261c3b",
            "e6f52d14-edd7-4994-bea6-ca1db4eb8458"
          ],
          "display_name": false
        },
        {
          "uuid": "ad11ef3d-0e34-4103-b81d-abeb25c3c196",
          "name": "SULFENTRAZONE [ISO]",
          "stdName": "SULFENTRAZONE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92e77e00-81e8-4319-aec0-ac4ee499c936",
            "e6f52d14-edd7-4994-bea6-ca1db4eb8458"
          ],
          "display_name": false
        },
        {
          "uuid": "e82c8ef3-cf37-4552-8264-c5bd563d5edd",
          "name": "SULFENTRAZONE [MI]",
          "stdName": "SULFENTRAZONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "137e4a15-5b4d-4e56-93ba-aef98754f85f",
            "e6f52d14-edd7-4994-bea6-ca1db4eb8458"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b4bbccfd-91e6-4242-bd2c-b7cb4caaa5b5",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b3dc1a0c-338f-4e2f-97fa-4071ff4fb504",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fe58a0d0-dabc-4b73-896c-bd776c6ef79a",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6968b038-866c-4662-aec4-c8a0de7f56e1",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "137e4a15-5b4d-4e56-93ba-aef98754f85f",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e6f52d14-edd7-4994-bea6-ca1db4eb8458",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "efe835b0-b703-4862-b8d3-87149d710124",
          "citation": "SITTIGS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "00119645-8ef3-44e3-ad6d-fcfdb0a1fbfe",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c4ae12e7-afec-4334-9e62-94df71261c3b",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "92e77e00-81e8-4319-aec0-ac4ee499c936",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e696092c-ecaf-4c66-998b-48c904576cec",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390956000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d82d59b2-4262-42ec-b258-31654e8b7d81",
          "citation": "SRS import [7TY7WT1599]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7TY7WT1599",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390956000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6ecbd91a-9944-4397-9353-8ebc88329531",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "21480156-2322-4efd-bb09-13eebb0e18be",
          "citation": "SULFENTRAZONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c3730f73-89df-466d-abab-e823b1456100",
          "citation": "SULFENTRAZONE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "787de4ad-206e-4a3f-89d9-5d6ac1218706",
          "citation": "SULFENTRAZONE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9958870a-26ed-41c4-86fa-dd1f9b1f4a9c",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+122836-35-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1f9fe090-85ad-47c3-0a9b-bdd7eb753ea7",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=122836-35-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f30a254c-bdde-45f5-39c5-80cf266feddc",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "36e8b8fd-7713-b479-7fe6-9fa2594ab947",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "16c687a8-c4da-7a2b-bced-720a8124e420",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "3f7e1ffa-46ba-462b-a201-34c42118b010",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "34f0d329-ad81-4c06-accb-d247c4c9f985",
          "id": "34f0d329-ad81-4c06-accb-d247c4c9f985",
          "molfile": "\n  Marvin  01132102492D          \n\n 23 24  0  0  0  0            999 V2000\n    8.8817   -6.4928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5505   -5.7372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7407   -5.5719    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6555   -4.7448    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9405   -4.3300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2250   -4.7439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5115   -4.3300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7244   -4.7841    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7244   -5.6121    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7244   -6.4355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5525   -5.6121    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9012   -5.6121    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5115   -3.5067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7997   -3.0941    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.2250   -3.0927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9405   -3.5067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6555   -3.0916    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    8.4110   -4.4091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5858   -3.6016    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9662   -5.0301    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7887   -4.9484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2698   -5.6211    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1264   -4.2021    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  2 20  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n 18  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 16  2  0  0  0  0\n  7  6  2  0  0  0  0\n  7  8  1  0  0  0  0\n 13  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  2  0  0  0  0\n  9 12  2  0  0  0  0\n 13 14  1  0  0  0  0\n 15 13  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 19  2  0  0  0  0\n 20 18  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  1  0  0  0  0\nM  END",
          "smiles": "Cc1nn(-c2cc(c(cc2Cl)Cl)NS(=O)(=O)C)c(=O)n1C(F)F",
          "formula": "C11H10Cl2F2N4O3S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "188e3132-a431-465d-8483-843513268685"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "387.1913",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "61c6721c-6922-4008-85e0-640d912e52f3",
      "version": "7",
      "structure": {
        "id": "4e4aa3a2-8464-477c-83b2-d6812135af87",
        "molfile": "\n  Marvin  01132104052D          \n\n 23 24  0  0  0  0            999 V2000\n    7.6555   -3.0916    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.9405   -3.5067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2250   -3.0927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5115   -3.5067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7997   -3.0941    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.5115   -4.3300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7244   -4.7841    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7244   -5.6121    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5525   -5.6121    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9012   -5.6121    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7244   -6.4355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2250   -4.7439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9405   -4.3300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6555   -4.7448    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7407   -5.5719    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5505   -5.7372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8817   -6.4928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9662   -5.0301    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7887   -4.9484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2698   -5.6211    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1264   -4.2021    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4110   -4.4091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5858   -3.6016    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  2  0  0  0  0\n  8 11  1  0  0  0  0\n  6 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13  2  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  1  0  0  0  0\n 18 22  1  0  0  0  0\n 22 14  1  0  0  0  0\n 22 23  2  0  0  0  0\nM  END",
        "smiles": "Cc1nn(-c2cc(c(cc2Cl)Cl)NS(=O)(=O)C)c(=O)n1C(F)F",
        "formula": "C11H10Cl2F2N4O3S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "387.1913",
        "optical_activity": "NONE",
        "references": [
          "d82d59b2-4262-42ec-b258-31654e8b7d81",
          "6ecbd91a-9944-4397-9353-8ebc88329531"
        ],
        "stereo_centers": 0
      },
      "unii": "7TY7WT1599"
    }
  ]
}