{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ea2f2cb0-2a90-4ccf-bf07-6d0b3c2897ae",
          "code": "15336-82-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=15336-82-0",
          "code_system": "CAS",
          "references": [
            "ece5c0c7-6503-4004-b181-5b87ba29092a",
            "7fa130ac-8abf-4d58-96a5-eef1c96a1044"
          ]
        },
        {
          "uuid": "006f5dc4-f2f4-4bde-a950-c12cd7faaf90",
          "code": "239-366-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.035.772",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "ece5c0c7-6503-4004-b181-5b87ba29092a"
          ]
        },
        {
          "uuid": "fb0306fb-6421-4b5e-9694-a711795cf561",
          "code": "27204",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/27204",
          "code_system": "PUBCHEM",
          "references": [
            "ece5c0c7-6503-4004-b181-5b87ba29092a"
          ]
        },
        {
          "uuid": "a141409d-e956-9307-1b14-13c491f7b5a1",
          "code": "DTXSID9051745",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9051745",
          "code_system": "EPA CompTox",
          "references": [
            "b189aa9d-617b-9076-0134-2d900af1bb2b"
          ]
        },
        {
          "uuid": "8b6fa8e1-f531-4438-aef9-a2a7d530ed23",
          "code": "7TD883UOFT",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c5279902-7463-4b55-9d60-874c568cfd24",
          "name": "2,4-IMIDAZOLIDINEDIONE, 5-ETHYL-5-METHYL-1,3-BIS(2- OXIRANYLMETHYL)-",
          "stdName": "2,4-IMIDAZOLIDINEDIONE, 5-ETHYL-5-METHYL-1,3-BIS(2- OXIRANYLMETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6b24d97e-0b98-4dbc-aaf2-44589b781a0c"
          ],
          "display_name": false
        },
        {
          "uuid": "0a92f7dc-3c68-47ea-bc5d-d5fc1ec94be8",
          "name": "5-ETHYL-1,3-DIGLYCIDYL-5-METHYLHYDANTOIN",
          "stdName": "5-ETHYL-1,3-DIGLYCIDYL-5-METHYLHYDANTOIN",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2fa95602-b590-47c9-a777-3af9daca6a9b"
          ],
          "display_name": true
        },
        {
          "uuid": "9ce7e8e1-f59a-4942-a8db-a8827cc34a40",
          "name": "5-ETHYL-5-METHYL-1,3-BIS(OXIRANYLMETHYL)IMIDAZOLIDINE-2,4- DIONE",
          "stdName": "5-ETHYL-5-METHYL-1,3-BIS(OXIRANYLMETHYL)IMIDAZOLIDINE-2,4- DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6b24d97e-0b98-4dbc-aaf2-44589b781a0c"
          ],
          "display_name": false
        },
        {
          "uuid": "23e36ac1-063d-4290-bae1-7ea801e8dfe8",
          "name": "ARALDITE EPS 104",
          "stdName": "ARALDITE EPS 104",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6b24d97e-0b98-4dbc-aaf2-44589b781a0c"
          ],
          "display_name": false
        },
        {
          "uuid": "1e31f4cd-624f-40c5-83d7-1f36763caffd",
          "name": "ARALDITE XU AY 238",
          "stdName": "ARALDITE XU AY 238",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6b24d97e-0b98-4dbc-aaf2-44589b781a0c"
          ],
          "display_name": false
        },
        {
          "uuid": "025bf894-c3c8-4653-ba55-ec0091b6097e",
          "name": "BIS(2,3-EPOXYPROPYL)-5-ETHYL-5-METHYLHYDANTOIN",
          "stdName": "BIS(2,3-EPOXYPROPYL)-5-ETHYL-5-METHYLHYDANTOIN",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6b24d97e-0b98-4dbc-aaf2-44589b781a0c"
          ],
          "display_name": false
        },
        {
          "uuid": "0eec7770-f407-4b8c-b2c6-5cbe3ccb219d",
          "name": "HYDANTOIN, BIS(2,3-EPOXYPROPYL)-5-ETHYL-5-METHYL-",
          "stdName": "HYDANTOIN, BIS(2,3-EPOXYPROPYL)-5-ETHYL-5-METHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6b24d97e-0b98-4dbc-aaf2-44589b781a0c"
          ],
          "display_name": false
        },
        {
          "uuid": "ea93dbac-9620-45cb-a771-1366634e0377",
          "name": "N,N-DIGLYCIDYL-5-ETHYL-5-METHYLHYDANTOIN",
          "stdName": "N,N-DIGLYCIDYL-5-ETHYL-5-METHYLHYDANTOIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6b24d97e-0b98-4dbc-aaf2-44589b781a0c"
          ],
          "display_name": false
        },
        {
          "uuid": "037a99e7-b1b4-48f7-8bb4-57e6f4720d78",
          "name": "TK-10744",
          "stdName": "TK-10744",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6b24d97e-0b98-4dbc-aaf2-44589b781a0c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "2fa95602-b590-47c9-a777-3af9daca6a9b",
          "citation": "CEDI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "6b24d97e-0b98-4dbc-aaf2-44589b781a0c",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ece5c0c7-6503-4004-b181-5b87ba29092a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390315000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fb35e95e-2f38-4195-8c7b-7db8c1f5fe48",
          "citation": "SRS import [7TD883UOFT]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7TD883UOFT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390315000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b189aa9d-617b-9076-0134-2d900af1bb2b",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=15336-82-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7fa130ac-8abf-4d58-96a5-eef1c96a1044",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "adcc9386-2642-4ff3-9258-7677afe710a3",
          "id": "adcc9386-2642-4ff3-9258-7677afe710a3",
          "molfile": "\n  Marvin  01132109012D          \n\n 18 20  0  0  0  0            999 V2000\n    2.4700    0.3618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7556   -0.0507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0411    0.3618    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    1.7556    0.7743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5562   -0.3057    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8111   -1.0903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6181   -1.2618    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    2.4027   -1.0069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2312   -1.8138    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2284   -0.0507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8959   -0.5356    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2284    0.7743    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8959    1.2592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6496    0.9236    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   -2.1345    0.2562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4700    1.0099    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5562    1.0292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8111    1.8138    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  3 17  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 10  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 17  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 18  2  0  0  0  0\nM  END",
          "smiles": "CCC1(C)C(=O)N(CC2CO2)C(=O)N1CC3CO3",
          "formula": "C12H18N2O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e15644ef-3751-4b33-beb4-88efbbfce575"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "254.2828",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f3341d4b-04ba-4559-a516-0e416e61cbb4",
      "version": "3",
      "structure": {
        "id": "bec24d68-e889-4e8d-8833-32edf28883d0",
        "molfile": "\n  Marvin  01132109522D          \n\n 18 20  0  0  0  0            999 V2000\n    1.0411    0.3618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5562   -0.3057    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2284   -0.0507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8959   -0.5356    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2284    0.7743    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5562    1.0292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8111    1.8138    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7556    0.7743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8959    1.2592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6496    0.9236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1345    0.2562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4700    1.0099    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8111   -1.0903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6181   -1.2618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4027   -1.0069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2312   -1.8138    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7556   -0.0507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4700    0.3618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  1  6  1  0  0  0  0\n  1  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 10 12  1  0  0  0  0\n  5  9  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 14 16  1  0  0  0  0\n  2 13  1  0  0  0  0\n 17 18  1  0  0  0  0\n  1 17  1  0  0  0  0\nM  END",
        "smiles": "CCC1(C)C(=O)N(CC2CO2)C(=O)N1CC3CO3",
        "formula": "C12H18N2O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "254.2828",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "6b24d97e-0b98-4dbc-aaf2-44589b781a0c",
          "fb35e95e-2f38-4195-8c7b-7db8c1f5fe48"
        ],
        "stereo_centers": 3
      },
      "unii": "7TD883UOFT"
    }
  ]
}