{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "481a14f8-e8e9-49a5-bfe1-7a61763be2f8",
          "code": "300-54-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=300-54-9",
          "code_system": "CAS",
          "references": [
            "d1413cf8-5d83-4625-90d3-e97d12540bb4",
            "1df2471d-425b-4633-92a0-6fbaa91c20d7"
          ]
        },
        {
          "uuid": "10e5d1f6-fabc-4f45-89d1-bece67738a8c",
          "code": "D009116",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68009116",
          "code_system": "MESH",
          "references": [
            "d1413cf8-5d83-4625-90d3-e97d12540bb4"
          ]
        },
        {
          "uuid": "3cce6e2a-5e83-43e6-b591-d54f894cf0d9",
          "code": "MUSCARINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Muscarine",
          "code_system": "WIKIPEDIA",
          "references": [
            "d1413cf8-5d83-4625-90d3-e97d12540bb4"
          ]
        },
        {
          "uuid": "974d50c6-fc77-43c1-a097-d96d33d0d64c",
          "code": "206-094-1",
          "type": "PRIMARY",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "d1413cf8-5d83-4625-90d3-e97d12540bb4"
          ]
        },
        {
          "uuid": "08b92d6f-430a-44b1-9c81-af55e6e64983",
          "code": "m7665",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7665?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "d1413cf8-5d83-4625-90d3-e97d12540bb4"
          ]
        },
        {
          "uuid": "c19554c0-f733-4360-bda9-f357afeaf7ef",
          "code": "9308",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9308",
          "code_system": "PUBCHEM",
          "references": [
            "d1413cf8-5d83-4625-90d3-e97d12540bb4"
          ]
        },
        {
          "uuid": "57e7e9ba-fafb-87d6-3dfc-c6fcf0942ded",
          "code": "DTXSID50184081",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50184081",
          "code_system": "EPA CompTox",
          "references": [
            "18ed8e89-8115-f169-7520-034538d0ecdc"
          ]
        },
        {
          "uuid": "918ef7f7-5c36-479c-9a5b-070bc6abc03c",
          "code": "7T101UWZ5W",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6e552eee-df12-4176-99d1-b9ab383de918",
          "name": "(2S-(2.ALPHA.,4.BETA.,5.ALPHA.))-TETRAHYDRO-4-HYDROXY-N,N,N,5-TETRAMETHYL-2-FURANMETHANAMINIUM",
          "stdName": "(2S-(2.ALPHA.,4.BETA.,5.ALPHA.))-TETRAHYDRO-4-HYDROXY-N,N,N,5-TETRAMETHYL-2-FURANMETHANAMINIUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ebdacf85-2be8-48ce-95b5-46ee0730f3e1",
            "289e740c-0022-43ab-a05f-eb3063e053d8"
          ],
          "display_name": false
        },
        {
          "uuid": "ff7ffd05-3a64-41d7-9da8-55bd5ddc7845",
          "name": "MUSCARINE",
          "stdName": "MUSCARINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ebdacf85-2be8-48ce-95b5-46ee0730f3e1",
            "e3d3e09e-dab2-4893-be84-b77d0f4829e0",
            "289e740c-0022-43ab-a05f-eb3063e053d8",
            "6718364b-7484-4d47-b898-2aa90a7ef9e0"
          ],
          "display_name": true
        },
        {
          "uuid": "80e57e3b-a6b9-4810-af24-ef640cf1be17",
          "name": "MUSCARINE CATION",
          "stdName": "MUSCARINE CATION",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ebdacf85-2be8-48ce-95b5-46ee0730f3e1",
            "2869b18d-12ba-4bd0-aa4c-43fc4fc8b9eb"
          ],
          "display_name": false
        },
        {
          "uuid": "45290f3c-91fe-41b6-9210-c53c99ec6edd",
          "name": "MUSCARINE ION",
          "stdName": "MUSCARINE ION",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ebdacf85-2be8-48ce-95b5-46ee0730f3e1",
            "2869b18d-12ba-4bd0-aa4c-43fc4fc8b9eb"
          ],
          "display_name": false
        },
        {
          "uuid": "e98d7194-561b-4e76-a42d-b13fdad408bb",
          "name": "MUSCARINE [MI]",
          "stdName": "MUSCARINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ebdacf85-2be8-48ce-95b5-46ee0730f3e1",
            "6718364b-7484-4d47-b898-2aa90a7ef9e0"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "289e740c-0022-43ab-a05f-eb3063e053d8",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "6718364b-7484-4d47-b898-2aa90a7ef9e0",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ebdacf85-2be8-48ce-95b5-46ee0730f3e1",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2869b18d-12ba-4bd0-aa4c-43fc4fc8b9eb",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d1413cf8-5d83-4625-90d3-e97d12540bb4",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391027000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "de14bdd5-2173-402c-bbc3-e071c957366e",
          "citation": "SRS import [7T101UWZ5W]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7T101UWZ5W",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391027000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a81f616c-87cc-438f-8816-7d31daa96bc1",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e3d3e09e-dab2-4893-be84-b77d0f4829e0",
          "citation": "MUSCARINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "18ed8e89-8115-f169-7520-034538d0ecdc",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=300-54-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1df2471d-425b-4633-92a0-6fbaa91c20d7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7008451c-2800-4fa4-b004-3b03e7bcb5f0",
          "id": "7008451c-2800-4fa4-b004-3b03e7bcb5f0",
          "molfile": "\n  Marvin  01132105492D          \n\n 12 12  0  0  1  0            999 V2000\n    5.9718   -5.1987    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.1885   -4.9396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6406   -4.7113    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3147   -5.1987    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    8.0979   -4.9396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8964   -5.1522    0.0000 N   0  3  0  0  0  0  0  0  0  3  0  0\n    9.6948   -4.9344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8964   -5.9768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8964   -4.3225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0557   -5.9820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2258   -5.9820    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.7383   -6.6509    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1 11  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  6  0  0  0\n  4 10  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  6  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  1  0  0  0\nM  CHG  2   6   1  12  -1\nM  END",
          "smiles": "C[C@H]1[C@@H](C[C@@H](C[N+](C)(C)C)O1)[O-]",
          "formula": "C9H19NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "EPIMERIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f2b1e775-b8b9-4749-8ddf-3241d0a7b1ce"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "173.253",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b8765ab6-d6fc-457c-b988-0dcc8d53e05b",
      "version": "3",
      "structure": {
        "id": "0293c527-738b-47ef-bdaf-3212b0b95670",
        "molfile": "\n  Marvin  01132100272D          \n\n 12 12  0  0  1  0            999 V2000\n    8.8964   -5.1522    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    8.0979   -4.9396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3147   -5.1987    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.0557   -5.9820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2258   -5.9820    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.7383   -6.6509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9718   -5.1987    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.6406   -4.7113    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1885   -4.9396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6948   -4.9344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8964   -5.9768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8964   -4.3225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  6  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  1  0  0  0\n  5  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  3  8  1  0  0  0  0\n  7  9  1  6  0  0  0\n  1 10  1  0  0  0  0\n  1 11  1  0  0  0  0\n  1 12  1  0  0  0  0\nM  CHG  1   1   1\nM  END",
        "smiles": "C[C@H]1[C@@H](C[C@@H](C[N+](C)(C)C)O1)O",
        "formula": "C9H20NO2",
        "atropisomerism": "No",
        "charge": 1,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "174.261",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "a81f616c-87cc-438f-8816-7d31daa96bc1",
          "de14bdd5-2173-402c-bbc3-e071c957366e"
        ],
        "stereo_centers": 3
      },
      "unii": "7T101UWZ5W"
    }
  ]
}