{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "af916b6f-a8f7-4b23-9d9d-6fc77777a1f9",
          "code": "587-98-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=587-98-4",
          "code_system": "CAS",
          "references": [
            "aa537fb2-c39e-48af-8a26-fae59ca90e3e",
            "2cd43a88-f628-4991-85ad-46cc2ae9f0b2"
          ]
        },
        {
          "uuid": "b6b87ace-ea53-40e8-9b60-b85b375ad2f5",
          "code": "C71672",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C71672",
          "code_system": "NCI_THESAURUS",
          "references": [
            "aa537fb2-c39e-48af-8a26-fae59ca90e3e"
          ]
        },
        {
          "uuid": "ec3eec01-817c-4866-9dad-69618ddcbc49",
          "code": "C005108",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67005108",
          "code_system": "MESH",
          "references": [
            "aa537fb2-c39e-48af-8a26-fae59ca90e3e"
          ]
        },
        {
          "uuid": "f442c198-6719-413d-8c2c-f30a2b0fa24a",
          "code": "209-608-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.008.736",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "aa537fb2-c39e-48af-8a26-fae59ca90e3e"
          ]
        },
        {
          "uuid": "23e9fe1d-ea92-46fc-92fc-b909e0ad8c4c",
          "code": "1305576",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1305576/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "aa537fb2-c39e-48af-8a26-fae59ca90e3e"
          ]
        },
        {
          "uuid": "f40636ec-935f-40e8-a174-f541ea571dde",
          "code": "m7269",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7269?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "aa537fb2-c39e-48af-8a26-fae59ca90e3e"
          ]
        },
        {
          "uuid": "154016c6-e0e7-451d-91e1-94437f68ba7e",
          "code": "SUB169713",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "aa537fb2-c39e-48af-8a26-fae59ca90e3e"
          ]
        },
        {
          "uuid": "22dc78f3-b330-1c9a-3654-ad3c0fff8869",
          "code": "DTXSID5041722",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5041722",
          "code_system": "EPA CompTox",
          "references": [
            "a13b56d8-ef20-3b87-7475-5f5686f74215"
          ]
        },
        {
          "uuid": "fc718667-76be-9b24-9f31-dc04d6d530e1",
          "code": "C461",
          "comments": "Industrial Aid[C45678]|Dye",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C461",
          "code_system": "NCI_THESAURUS",
          "references": [
            "1c2bf4a6-89e8-2566-b559-7c3a2532c298"
          ]
        },
        {
          "uuid": "29a45623-51c9-4e9e-ab0d-50051147e024",
          "code": "7SPF5O5BW8",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d7336d2d-4a3b-6ce4-578e-5aaae8d18a7b",
          "code": "87235",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:87235",
          "code_system": "CHEBI",
          "references": [
            "1c2bf4a6-89e8-2566-b559-7c3a2532c298"
          ]
        },
        {
          "uuid": "3cce3180-afb5-5728-7cd9-bd0257ec863e",
          "code": "87240",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:87240",
          "code_system": "CHEBI",
          "references": [
            "1c2bf4a6-89e8-2566-b559-7c3a2532c298"
          ]
        },
        {
          "uuid": "83631246-902f-a935-b3eb-9266763e2252",
          "code": "Metanil Yellow",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Metanil_Yellow",
          "code_system": "WIKIPEDIA",
          "references": [
            "556aaa0c-fa97-c276-bb1c-9307e6a4aa37"
          ]
        },
        {
          "uuid": "0fd7b2c7-d036-ec20-7fba-aa58e8a2d5c1",
          "code": "7337",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=7337",
          "code_system": "NSC",
          "references": [
            "4636fbb1-6179-f076-ecb1-6b8535dafa0d"
          ]
        },
        {
          "uuid": "5c371884-92c7-bcc8-08a8-f5100849254a",
          "code": "9292",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=9292",
          "code_system": "NSC",
          "references": [
            "4636fbb1-6179-f076-ecb1-6b8535dafa0d"
          ]
        },
        {
          "uuid": "e3f35b0b-44fa-edc5-edb2-fd3fb5dbae0f",
          "code": "100000159527",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "2f1d16a4-1fb4-6e37-2240-e093e59e9683"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "342a7dea-b14e-4f5b-a2d1-ba28be202df0",
          "name": "ACID YELLOW 36",
          "stdName": "ACID YELLOW 36",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd5c98c4-4238-4406-be57-c5651b431491",
            "7a9994d7-3f58-4706-858b-87dc7accc3a1"
          ],
          "display_name": false
        },
        {
          "uuid": "24d999ec-fadd-4c97-ae32-8b495c86c368",
          "name": "BENZENESULFONIC ACID, 3-(2-(4-(PHENYLAMINO)PHENYL)DIAZENYL)-, SODIUM SALT (1:1)",
          "stdName": "BENZENESULFONIC ACID, 3-(2-(4-(PHENYLAMINO)PHENYL)DIAZENYL)-, SODIUM SALT (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd5c98c4-4238-4406-be57-c5651b431491",
            "a57355c1-039a-45ff-94ce-67568412c731"
          ],
          "display_name": false
        },
        {
          "uuid": "919df975-4832-4429-acb0-6651197e6800",
          "name": "C.I. 13065",
          "stdName": "C.I. 13065",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd5c98c4-4238-4406-be57-c5651b431491",
            "7a9994d7-3f58-4706-858b-87dc7accc3a1"
          ],
          "display_name": false
        },
        {
          "uuid": "c3bf897e-aed2-4879-bf0d-1e4bb8df31b1",
          "name": "C.I. ACID YELLOW 36",
          "stdName": "C.I. ACID YELLOW 36",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd5c98c4-4238-4406-be57-c5651b431491",
            "f4fea0a9-f387-4732-98da-c87a62d4859a"
          ],
          "display_name": false
        },
        {
          "uuid": "19fb3b11-c723-442c-80a3-bafa9a4de891",
          "name": "EXT. D&C YELLOW NO. 1 (DELISTED)",
          "stdName": "EXT. D&C YELLOW NO. 1 (DELISTED)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "74587414-34b6-49c8-aa56-4c70dca2663a",
            "cd5c98c4-4238-4406-be57-c5651b431491"
          ],
          "display_name": false
        },
        {
          "uuid": "fb92ee26-f357-415a-b472-91011d4def38",
          "name": "KI406",
          "stdName": "KI406",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "cd5c98c4-4238-4406-be57-c5651b431491",
            "08e34654-966f-4ae5-a7ab-9bedcd614a2f",
            "a88db728-7892-47a7-a844-e0196ee152d7",
            "3741eed0-4206-4d91-bded-84b2127236a3",
            "7fdbf94c-3dc2-4d22-94cd-5f0372a6553c"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "744bcfaf-2783-4376-b142-a6b6b30be0d4",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "bd9d9ccd-bc5a-4ce0-bd60-a0fad0924dfa",
          "name": "METANIL YELLOW",
          "stdName": "METANIL YELLOW",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "064b4819-712d-4db3-bcf4-17d2b5fe7521",
            "cd5c98c4-4238-4406-be57-c5651b431491",
            "9ee06ccb-faf7-48d4-bec6-07bf09eb49e8",
            "08e34654-966f-4ae5-a7ab-9bedcd614a2f",
            "7fdbf94c-3dc2-4d22-94cd-5f0372a6553c"
          ],
          "display_name": true
        },
        {
          "uuid": "d165a4eb-2d70-414d-b33f-e7c499a03c48",
          "name": "METANIL YELLOW [MI]",
          "stdName": "METANIL YELLOW [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "064b4819-712d-4db3-bcf4-17d2b5fe7521",
            "cd5c98c4-4238-4406-be57-c5651b431491"
          ],
          "display_name": false
        },
        {
          "uuid": "4fc591cc-1f2e-4736-a562-50a376ae0b75",
          "name": "NSC-7337",
          "stdName": "NSC-7337",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd5c98c4-4238-4406-be57-c5651b431491",
            "4dc7a8fb-53b4-4162-9361-caa3c0b26ca3"
          ],
          "display_name": false
        },
        {
          "uuid": "f41d6891-8bf8-40bd-9cd1-acdfe4381a8a",
          "name": "NSC-9292",
          "stdName": "NSC-9292",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd5c98c4-4238-4406-be57-c5651b431491",
            "4dc7a8fb-53b4-4162-9361-caa3c0b26ca3"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "7fdbf94c-3dc2-4d22-94cd-5f0372a6553c",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "08e34654-966f-4ae5-a7ab-9bedcd614a2f",
          "citation": "CTFA 2006",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7a9994d7-3f58-4706-858b-87dc7accc3a1",
          "citation": "http://www.chemexper.com/chemicals/supplier/cas/587-98-4.html",
          "url": "http://www.chemexper.com/chemicals/supplier/cas/587-98-4.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cd5c98c4-4238-4406-be57-c5651b431491",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a57355c1-039a-45ff-94ce-67568412c731",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "74587414-34b6-49c8-aa56-4c70dca2663a",
          "citation": "CFR",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "064b4819-712d-4db3-bcf4-17d2b5fe7521",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f4fea0a9-f387-4732-98da-c87a62d4859a",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a88db728-7892-47a7-a844-e0196ee152d7",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4dc7a8fb-53b4-4162-9361-caa3c0b26ca3",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aa537fb2-c39e-48af-8a26-fae59ca90e3e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390560000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eaeb6e5b-f4ae-4416-b8cb-f361d2b28dbb",
          "citation": "SRS import [7SPF5O5BW8]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7SPF5O5BW8",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390560000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9d899e5e-3bf7-4c43-9963-389e20f1e514",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9ee06ccb-faf7-48d4-bec6-07bf09eb49e8",
          "citation": "METANIL YELLOW [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3741eed0-4206-4d91-bded-84b2127236a3",
          "citation": "KI406 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a13b56d8-ef20-3b87-7475-5f5686f74215",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=587-98-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1c2bf4a6-89e8-2566-b559-7c3a2532c298",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "556aaa0c-fa97-c276-bb1c-9307e6a4aa37",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "2cd43a88-f628-4991-85ad-46cc2ae9f0b2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4636fbb1-6179-f076-ecb1-6b8535dafa0d",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "68dacf47-e0ed-f60d-3e89-1e0114a817bf",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "2f1d16a4-1fb4-6e37-2240-e093e59e9683",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "df9b57f1-9929-43d0-9b0b-788b13556997",
          "id": "df9b57f1-9929-43d0-9b0b-788b13556997",
          "molfile": "\n  Marvin  01132111352D          \n\n  1  0  0  0  0  0            999 V2000\n    7.7164   -1.3348    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7035542d-88dd-44cf-9f66-2203692caeaa"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "f77a0504-52d5-4319-8c72-e20c2d14b666",
          "id": "f77a0504-52d5-4319-8c72-e20c2d14b666",
          "molfile": "\n  Marvin  01132112502D          \n\n 25 27  0  0  0  0            999 V2000\n    7.0534   -1.3348    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.3320   -0.9346    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9173   -0.2220    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7380   -0.2161    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6250   -1.3601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6314   -2.1885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9184   -2.6039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2037   -2.1951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2028   -1.3698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9097   -0.9551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4873   -0.9609    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7746   -1.3756    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0591   -0.9668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3522   -1.3815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6369   -0.9764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6306   -0.1480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0876    0.2611    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8011   -0.1562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5175    0.2538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2304   -0.1629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2260   -0.9903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5029   -1.3993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7929   -0.9802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3435    0.2673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0582   -0.1415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  2  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 10  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11  9  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 13 25  2  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 24 16  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 23 18  2  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 25 24  1  0  0  0  0\nM  CHG  1   1  -1\nM  END",
          "smiles": "c1ccc(cc1)Nc2ccc(cc2)/N=N/c3cccc(c3)S(=O)(=O)[O-]",
          "formula": "C18H14N3O3S",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1cc32bed-339c-4bc3-98b2-979c911b374d"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "352.3888",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5cf646ec-0c70-45e1-a709-97e40e018b8b",
      "version": "13",
      "structure": {
        "id": "e8c86b7e-3d16-4a0c-aff6-71d06da2ddbd",
        "molfile": "\n  Marvin  01132112032D          \n\n 26 27  0  0  0  0            999 V2000\n    2.0591   -0.9668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7746   -1.3756    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4873   -0.9609    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2028   -1.3698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0582   -0.1415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3435    0.2673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6306   -0.1480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6369   -0.9764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3522   -1.3815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2037   -2.1951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9184   -2.6039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6314   -2.1885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6250   -1.3601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9097   -0.9551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3320   -0.9346    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0534   -1.3348    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.9173   -0.2220    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7380   -0.2161    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0876    0.2611    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8011   -0.1562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5175    0.2538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2304   -0.1629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2260   -0.9903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5029   -1.3993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7929   -0.9802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7164   -1.3348    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n 12 13  1  0  0  0  0\n  6  7  2  0  0  0  0\n 13 14  2  0  0  0  0\n 14  4  1  0  0  0  0\n  3  4  1  0  0  0  0\n 13 15  1  0  0  0  0\n  7  8  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  2  0  0  0  0\n  8  9  2  0  0  0  0\n 15 18  2  0  0  0  0\n  9  1  1  0  0  0  0\n  7 19  1  0  0  0  0\n  1  5  2  0  0  0  0\n 19 20  1  0  0  0  0\n  4 10  2  0  0  0  0\n 20 21  2  0  0  0  0\n  2  3  2  0  0  0  0\n 21 22  1  0  0  0  0\n 10 11  1  0  0  0  0\n 22 23  2  0  0  0  0\n  5  6  1  0  0  0  0\n 23 24  1  0  0  0  0\n 11 12  2  0  0  0  0\n 24 25  2  0  0  0  0\n 25 20  1  0  0  0  0\nM  CHG  2  16  -1  26   1\nM  END",
        "smiles": "c1ccc(cc1)Nc2ccc(cc2)/N=N/c3cccc(c3)S(=O)(=O)[O-].[Na+]",
        "formula": "C18H14N3O3S.Na",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "375.3786",
        "optical_activity": "NONE",
        "references": [
          "9d899e5e-3bf7-4c43-9963-389e20f1e514",
          "eaeb6e5b-f4ae-4416-b8cb-f361d2b28dbb"
        ],
        "stereo_centers": 0
      },
      "unii": "7SPF5O5BW8"
    }
  ]
}