{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5fb9916d-d9e6-43e8-a1ba-418e85d8a5a6",
          "code": "14807-96-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=14807-96-6",
          "code_system": "CAS",
          "references": [
            "a18bc27a-fcc3-4645-95a3-db76887b9468",
            "d25ec9fb-d9d1-466a-87f7-6671e8fe0306"
          ]
        },
        {
          "uuid": "15863c61-b3f6-4cb6-b5a0-c96bea6d6350",
          "code": "C854",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C854",
          "code_system": "NCI_THESAURUS",
          "references": [
            "a18bc27a-fcc3-4645-95a3-db76887b9468"
          ]
        },
        {
          "uuid": "4a931506-8d6e-4c4d-8c80-0d7ddf659beb",
          "code": "D013627",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68013627",
          "code_system": "MESH",
          "references": [
            "a18bc27a-fcc3-4645-95a3-db76887b9468"
          ]
        },
        {
          "uuid": "c7da74d6-a935-4d1f-b46e-1f4d1136c8d3",
          "code": "INS-553(III)",
          "comments": "Codex Alimentarius|Functional Classification|Anticaking agent|Glazing agent|Thickener",
          "type": "PRIMARY",
          "url": "http://www.fao.org/gsfaonline/additives/details.html?id=299",
          "code_system": "CODEX ALIMENTARIUS (GSFA)",
          "references": [
            "a18bc27a-fcc3-4645-95a3-db76887b9468"
          ]
        },
        {
          "uuid": "fa803008-e10a-4b44-b94c-cd16e6066fbc",
          "code": "INS-553(III)",
          "comments": "JECFA|Functional Classification|ANTICAKING AGENT|BULKING AGENT|CHEWING GUM BASE COMPOUND|FILTERING AID|GLAZING AGENT|THICKENER",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=2965",
          "code_system": "JECFA EVALUATION",
          "references": [
            "a18bc27a-fcc3-4645-95a3-db76887b9468"
          ]
        },
        {
          "uuid": "18f24a9c-803c-4b7b-b5c7-565f159785fa",
          "code": "238-877-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.035.328",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a18bc27a-fcc3-4645-95a3-db76887b9468"
          ]
        },
        {
          "uuid": "a2339775-922b-4c80-8ba0-84919c4c61fc",
          "code": "TALC",
          "comments": "Description. A white or almost white, very fine, homogeneous, unctuous powder; odourless. Solubility: Practically insoluble in water, dilute solutions of acids and alkalis, ethanol (~750 g/l) TS, and ether R. Category: Tablet and capsule lubricant; glidant; diluent. Storage: Talc should be kept in a well-closed container. Additional information: Talc adheres readily to the skin. Attention should be paid to its microbiological quality since it is of mineral origin. Definition: Talc is a powdered, natural hydrate of magnesium silicate that may contain variable proportions of aluminium and iron.",
          "type": "PRIMARY",
          "url": "http://apps.who.int/phint/pdf/b/Jb.6.1.412.pdf",
          "code_system": "WHO INTERNATIONAL PHARMACOPEIA",
          "references": [
            "a18bc27a-fcc3-4645-95a3-db76887b9468"
          ]
        },
        {
          "uuid": "1dad7eec-1ccd-4849-aa5f-45571a507277",
          "code": "10323",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/10323/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "a18bc27a-fcc3-4645-95a3-db76887b9468"
          ]
        },
        {
          "uuid": "317b8d04-2a95-4147-88f8-87eb1af5e592",
          "code": "m10438",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10438?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "a18bc27a-fcc3-4645-95a3-db76887b9468"
          ]
        },
        {
          "uuid": "c4026678-cf0a-4404-8f9a-0644517f6310",
          "code": "SUB20830",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "a18bc27a-fcc3-4645-95a3-db76887b9468"
          ]
        },
        {
          "uuid": "9f55c4f7-2601-4148-a944-c86625b8f4b0",
          "code": "SUB12603MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "a18bc27a-fcc3-4645-95a3-db76887b9468"
          ]
        },
        {
          "uuid": "37717d04-e474-42d6-b867-5efa2cc4a2d6",
          "code": "CHEMBL1200568",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1200568",
          "code_system": "ChEMBL",
          "references": [
            "a18bc27a-fcc3-4645-95a3-db76887b9468"
          ]
        },
        {
          "uuid": "eec76eb6-9da0-87a3-a611-e6903ee6cb5e",
          "code": "830",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/830",
          "code_system": "HSDB",
          "references": [
            "dac857e4-8ae0-26ee-faf8-5f1cafd93dbe"
          ]
        },
        {
          "uuid": "1898dc4c-32e7-8abb-81a7-89ffe6ab8b6c",
          "code": "91595",
          "comments": "ORPHAN DRUG|Designated/Approved|Treatment of malignant pleural effusion.",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=91595",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "3b6ad1f2-8798-207d-6be9-886785529075",
          "code": "109297",
          "comments": "ORPHAN DRUG|Designated/Approved|Treatment of pneumothorax",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=109297",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "3808c406-918e-c6c8-85e7-f25fc11c9e5c",
          "code": "C45678",
          "comments": "Industrial Aid",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C45678",
          "code_system": "NCI_THESAURUS",
          "references": [
            "12328e50-df30-0657-a5a9-da04260613fc"
          ]
        },
        {
          "uuid": "749f0946-9fc9-2c44-bdb4-486ef0530ec5",
          "code": "122173976",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/122173976",
          "code_system": "PUBCHEM",
          "references": [
            "c40c96e0-f1bf-ef73-9b9b-bd7fc8c497b4"
          ]
        },
        {
          "uuid": "26455ec9-4030-9e6a-19cd-c21add3747bb",
          "code": "106797",
          "comments": "ORPHAN DRUG|Designated/Approved|Treatment of malignant pleural effusion",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=106797",
          "code_system": "FDA ORPHAN DRUG",
          "references": [
            "12328e50-df30-0657-a5a9-da04260613fc"
          ]
        },
        {
          "uuid": "fbc8929d-118e-0533-fd9e-35c24b0f6de8",
          "code": "5190",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/5190",
          "code_system": "DRUG CENTRAL",
          "references": [
            "12328e50-df30-0657-a5a9-da04260613fc"
          ]
        },
        {
          "uuid": "6872326a-3ff7-b6a5-f272-622e468e03a3",
          "code": "DB09511",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB09511",
          "code_system": "DRUG BANK",
          "references": [
            "12328e50-df30-0657-a5a9-da04260613fc"
          ]
        },
        {
          "uuid": "9eedff82-424a-49b3-ac05-ee558e2f746f",
          "code": "7SEV7J4R1U",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "45b12d68-bfdf-ecd0-9852-3804670a327e",
          "code": "7SEV7J4R1U",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=7SEV7J4R1U",
          "code_system": "DAILYMED",
          "references": [
            "eca35931-006a-1fd1-8202-43a39f56f53a"
          ]
        },
        {
          "uuid": "a46c2a99-f431-532f-3502-be93c4d830fd",
          "code": "100000078762",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "ecf7bdc5-2cb6-0d0b-4c87-6b2d2d36d454"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "7eba70f3-2243-4e35-905b-c7030f2c3d97",
          "citation": "TALC [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b95dd0af-4e82-4d1a-8376-ba6a6001d06d",
          "citation": "TALC [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5336a3e3-2ed3-4601-89ca-3a87b8d575ac",
          "citation": "TALC [WHO-IP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9dde783c-db58-47b3-a4d6-664603c3dea5",
          "citation": "TALCUM [WHO-IP LATIN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "69cbeb46-8f2f-4d6e-aad3-06125d461cb7",
          "citation": "PULVIS TALCI [CHP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "83a1c353-b908-4c4e-9534-2315f25bc338",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "4e5f283e-423f-4483-8b8f-1e6df0445279",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d93da435-5401-4980-9495-a91775494399",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3bdf1d93-b698-449a-b7da-312be328717a",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "be97d41c-424c-4b4c-9e02-ff6b852b7d93",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a0064e8d-6319-4b9f-ab94-e36ff9109293",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "85a03c71-07ea-4d3d-a345-1d5c2eaeb61f",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "708e8f9d-43ae-4006-9802-d47ed54e4a64",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "76389943-9eb0-483b-b234-bf5112a54569",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "458f1577-121a-4fdf-afdf-feb36db0f48c",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a680d122-f4d8-4614-bf87-41c2b0e43bc3",
          "citation": "CP",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d1d22959-de77-408b-9564-2a97c1108054",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5fade6fb-f9e3-4f74-a6f7-25a872640062",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "38fa76a0-022e-465f-9d5a-6c3f759e0467",
          "citation": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=299",
          "url": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=299",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "12ad3d99-b96d-4465-91b1-14b27f23a3fc",
          "citation": "WHO-IP",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "630737cb-dc54-4384-8999-542e6189fa3f",
          "citation": "CHP",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a18bc27a-fcc3-4645-95a3-db76887b9468",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390568000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e7a15a49-0a6f-43b4-a57f-5c83a096eb94",
          "citation": "SRS import [7SEV7J4R1U]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7SEV7J4R1U",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390568000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0a6610d0-e08a-419b-a06a-4dedefa013a2",
          "citation": "TALC [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0c2143ff-3c15-4a71-81af-83bcb0758644",
          "citation": "TALC [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2080cd51-971f-4775-b0e9-29d08342e0a8",
          "citation": "TALC [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d63790f4-e12a-47f4-b3f6-3ea309895dc8",
          "citation": "TALC [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "55964743-1aad-4dbc-96b1-b1eb267e7e74",
          "citation": "TALC [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c213206a-6943-4f5f-bc85-59c5b41fba39",
          "citation": "TALC [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "561a2a25-2f99-4914-8416-8c1f3634b7ec",
          "citation": "TALC [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "052efabd-cdf0-4471-a3f8-034e828273e9",
          "citation": "TALC [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9b20e9d5-043d-614e-795d-77ab0d2826e7",
          "citation": "Drugs@FDA",
          "url": "https://www.accessdata.fda.gov/drugsatfda_docs/label/2017/205555s000lbl.pdf",
          "doc_type": "DRUGS@FDA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "33383814-794f-042e-f9e0-3ab4103b1e99",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "dac857e4-8ae0-26ee-faf8-5f1cafd93dbe",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+14807-96-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c5c5d3f6-2fe6-412b-f563-7f8df41d566f",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=14807-96-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ecf7bdc5-2cb6-0d0b-4c87-6b2d2d36d454",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "12328e50-df30-0657-a5a9-da04260613fc",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "c40c96e0-f1bf-ef73-9b9b-bd7fc8c497b4",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "d25ec9fb-d9d1-466a-87f7-6671e8fe0306",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "47c55720-d0e9-501f-4e37-4bf444fcb42c",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "1753ab30-2ab5-75b2-ec5a-ebd90af9240e",
          "citation": "USP/NF",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "7821dfdc-2f1a-45b7-f490-fa75b6e38aa5",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "eca35931-006a-1fd1-8202-43a39f56f53a",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ca239de1-6f8e-44e5-aebd-55a3ab2987aa",
          "id": "ca239de1-6f8e-44e5-aebd-55a3ab2987aa",
          "molfile": "\n  Marvin  05232218262D          \n\n  1  0  0  0  0  0            999 V2000\n   10.3848   -4.4671    0.0000 Mg  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Mg+2]",
          "formula": "Mg",
          "atropisomerism": "No",
          "charge": 2,
          "count": 3,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 3,
            "units": "MOL RATIO",
            "uuid": "ef0acd53-4b7c-472b-ac7f-91a31f14273b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "24.3051",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "ebb4a3e8-df55-4f5e-970b-bc10c0735276",
          "id": "ebb4a3e8-df55-4f5e-970b-bc10c0735276",
          "molfile": "\n  Marvin  05232218262D          \n\n 14 16  0  0  0  0            999 V2000\n   13.0951   -4.3794    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n   13.8662   -4.6077    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6372   -4.3794    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n   14.6372   -3.5622    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8662   -3.2617    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n   13.8662   -2.4367    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   13.4749   -3.9272    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4749   -4.8782    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n   13.4857   -5.7031    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   14.2805   -5.1275    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7383   -5.1275    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0951   -3.5622    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2904   -4.1973    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   15.4419   -4.5614    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n 11  1  1  0  0  0  0\n  1 12  1  0  0  0  0\n  1 13  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3 10  1  0  0  0  0\n  3 14  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  5 12  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  8 11  1  0  0  0  0\nM  CHG  4   6  -1   9  -1  13  -1  14  -1\nM  END",
          "smiles": "[O-][Si]12O[Si]3([O-])O[Si]([O-])(O1)O[Si]([O-])(O2)O3",
          "formula": "O10Si4",
          "atropisomerism": "No",
          "charge": -4,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c9423396-8921-4a15-a2ee-103e115b2715"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "272.3356",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "b1078134-f457-41b0-840f-71dbe7bcb7ce",
          "id": "b1078134-f457-41b0-840f-71dbe7bcb7ce",
          "molfile": "\n  Marvin  05232218262D          \n\n  1  0  0  0  0  0            999 V2000\n   16.2345   -3.5067    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1  -1\nM  END",
          "smiles": "[OH-]",
          "formula": "HO",
          "atropisomerism": "No",
          "charge": -1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "2d1e5d72-f48c-4642-883e-ddfaf9fbb14e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "17.0073",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6e0f1504-9686-489e-ba48-13d0a3c03d81",
      "version": "27",
      "structure": {
        "id": "3a512fe9-7555-4051-9258-912cabc19c23",
        "molfile": "\n   JSDraw205232218262D\n\n 19 16  0  0  0  0              0 V2000\n   24.7623   -8.2812    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n   26.2203   -8.7130    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   27.6784   -8.2812    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n   27.6784   -6.7360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   26.2203   -6.1677    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n   26.2203   -4.6077    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   25.4804   -7.4262    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   25.4804   -9.2244    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n   25.5008  -10.7843    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   27.0038   -9.6958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   24.0876   -9.6958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   24.7623   -6.7360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   23.2407   -7.9369    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   29.2000   -8.6254    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   19.6372   -8.4471    0.0000 Mg  0  2  0  0  0  0  0  0  0  0  0  0\n   30.6988   -6.6310    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   19.6372   -8.4471    0.0000 Mg  0  2  0  0  0  0  0  0  0  0  0  0\n   19.6372   -8.4471    0.0000 Mg  0  2  0  0  0  0  0  0  0  0  0  0\n   30.6988   -6.6310    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  8 11  1  0  0  0  0\n 11  1  1  0  0  0  0\n  1 12  1  0  0  0  0\n  1 13  1  0  0  0  0\n  5 12  1  0  0  0  0\n  3 10  1  0  0  0  0\n  3 14  1  0  0  0  0\nM  STY  1   1 MUL\nM  SAL   1  3  15  17  18\nM  SPA   1  1  15\nM  SDI   1  4   18.0440   -9.6836   18.0440   -7.5516\nM  SDI   1  4   21.5800   -7.5516   21.5800   -9.6836\nM  SMT   1 3\nM  STY  1   2 MUL\nM  SAL   2  2  16  19\nM  SPA   2  1  16\nM  SDI   2  4   30.0040   -7.6036   30.0040   -5.6796\nM  SDI   2  4   32.0840   -5.6796   32.0840   -7.6036\nM  SMT   2 2\nM  CHG  8   6  -1   9  -1  13  -1  14  -1  15   2  16  -1  17   2  18   2\nM  CHG  1  19  -1\nM  END",
        "smiles": "[Mg+2].[Mg+2].[Mg+2].[O-][Si]12O[Si]3([O-])O[Si]([O-])(O1)O[Si]([O-])(O2)O3.[OH-].[OH-]",
        "formula": "3Mg.O10Si4.2HO",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "379.2654",
        "optical_activity": "NONE",
        "references": [
          "e7a15a49-0a6f-43b4-a57f-5c83a096eb94",
          "83a1c353-b908-4c4e-9534-2315f25bc338"
        ],
        "stereo_centers": 4
      },
      "unii": "7SEV7J4R1U",
      "relationships": [
        {
          "uuid": "c8cf018f-ad2b-4ba0-affb-d765d38fb37c",
          "amount": {
            "uuid": "a9eee2a4-ce7f-4658-a3b3-c835e239aa7f"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "91c11bdf-ca23-4bbe-87ad-6954e841ebc2",
            "refuuid": "6e0f1504-9686-489e-ba48-13d0a3c03d81",
            "name": "TALC",
            "unii": "7SEV7J4R1U",
            "linking_id": "7SEV7J4R1U",
            "ref_pname": "TALC",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "8bf65118-ea55-478d-bef1-f12aa11c7f87",
          "amount": {
            "uuid": "3ccea2af-84d6-4857-9ebd-39a59fab7d08"
          },
          "type": "SUB_CONCEPT->SUBSTANCE",
          "related_substance": {
            "uuid": "3079114f-dece-4be0-a610-ba68e70abda8",
            "refuuid": "3839a76c-f815-4cb6-8af5-03f4a87287f0",
            "name": "TALCUM POWDER",
            "linking_id": "3839a76c-f815-4cb6-8af5-03f4a87287f0",
            "ref_pname": "TALCUM POWDER",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "069ad491-91c8-414b-b218-7e383b91a192",
          "name": "E-553(III)",
          "stdName": "E-553(III)",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "38fa76a0-022e-465f-9d5a-6c3f759e0467"
          ],
          "display_name": false
        },
        {
          "uuid": "3770786c-454a-40da-9bac-71fa4fc54577",
          "name": "HUASHIFEN",
          "stdName": "HUASHIFEN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a680d122-f4d8-4614-bf87-41c2b0e43bc3"
          ],
          "display_name": false
        },
        {
          "uuid": "4c248a1b-5da4-4a86-b27b-31d428c4a779",
          "name": "INS NO.553(III)",
          "stdName": "INS NO.553(III)",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "38fa76a0-022e-465f-9d5a-6c3f759e0467"
          ],
          "display_name": false
        },
        {
          "uuid": "bcffc3a2-688e-43ce-b82c-c30dddbd6360",
          "name": "INS-553(III)",
          "stdName": "INS-553(III)",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "38fa76a0-022e-465f-9d5a-6c3f759e0467"
          ],
          "display_name": false
        },
        {
          "uuid": "29de4ee2-8414-4a0c-bb38-147da1f545b1",
          "name": "PULVIS TALCI",
          "stdName": "PULVIS TALCI",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "69cbeb46-8f2f-4d6e-aad3-06125d461cb7",
            "a680d122-f4d8-4614-bf87-41c2b0e43bc3",
            "630737cb-dc54-4384-8999-542e6189fa3f"
          ],
          "display_name": false
        },
        {
          "uuid": "af8379d5-3e31-4f0c-9e05-8044fd75c4da",
          "name": "PULVIS TALCI [CHP]",
          "stdName": "PULVIS TALCI [CHP]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "630737cb-dc54-4384-8999-542e6189fa3f"
          ],
          "display_name": false
        },
        {
          "uuid": "986ea4cd-a532-46f6-b370-9746d554d102",
          "name": "PURIFIED TALC [MART.]",
          "stdName": "PURIFIED TALC [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a0064e8d-6319-4b9f-ab94-e36ff9109293"
          ],
          "display_name": false
        },
        {
          "uuid": "764317dc-b1a0-41c9-bf61-df5430227ceb",
          "name": "SCLEROSOL",
          "stdName": "SCLEROSOL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4e5f283e-423f-4483-8b8f-1e6df0445279"
          ],
          "display_name": false
        },
        {
          "uuid": "fe03013f-09f3-4079-b6a9-52e7fcc5b737",
          "name": "STERITALC",
          "stdName": "STERITALC",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9b20e9d5-043d-614e-795d-77ab0d2826e7"
          ],
          "display_name": false
        },
        {
          "uuid": "b27625bd-4584-477f-8a8e-a6fbfd005386",
          "name": "TALC",
          "stdName": "TALC",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "561a2a25-2f99-4914-8416-8c1f3634b7ec",
            "d1d22959-de77-408b-9564-2a97c1108054",
            "d63790f4-e12a-47f4-b3f6-3ea309895dc8",
            "c213206a-6943-4f5f-bc85-59c5b41fba39",
            "7eba70f3-2243-4e35-905b-c7030f2c3d97",
            "708e8f9d-43ae-4006-9802-d47ed54e4a64",
            "83a1c353-b908-4c4e-9534-2315f25bc338",
            "0a6610d0-e08a-419b-a06a-4dedefa013a2",
            "55964743-1aad-4dbc-96b1-b1eb267e7e74",
            "be97d41c-424c-4b4c-9e02-ff6b852b7d93",
            "458f1577-121a-4fdf-afdf-feb36db0f48c",
            "052efabd-cdf0-4471-a3f8-034e828273e9",
            "d93da435-5401-4980-9495-a91775494399",
            "5fade6fb-f9e3-4f74-a6f7-25a872640062",
            "3bdf1d93-b698-449a-b7da-312be328717a",
            "85a03c71-07ea-4d3d-a345-1d5c2eaeb61f",
            "5336a3e3-2ed3-4601-89ca-3a87b8d575ac",
            "12ad3d99-b96d-4465-91b1-14b27f23a3fc",
            "b95dd0af-4e82-4d1a-8376-ba6a6001d06d",
            "0c2143ff-3c15-4a71-81af-83bcb0758644",
            "2080cd51-971f-4775-b0e9-29d08342e0a8",
            "76389943-9eb0-483b-b234-bf5112a54569"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "77678c5a-9d50-44ee-8f52-94feef2b35c2",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "6722bc80-f650-4de9-9444-5eabc100a7f1",
          "name": "TALC POWDER",
          "stdName": "TALC POWDER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a680d122-f4d8-4614-bf87-41c2b0e43bc3"
          ],
          "display_name": false
        },
        {
          "uuid": "2ede2fbc-7e87-ce12-6337-1598592104c8",
          "name": "TALC [EP IMPURITY]",
          "stdName": "TALC [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d93da435-5401-4980-9495-a91775494399"
          ],
          "display_name": false
        },
        {
          "uuid": "94d646ed-5509-4a05-94bd-2e52e7d115b3",
          "name": "TALC [EP MONOGRAPH]",
          "stdName": "TALC [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "47c55720-d0e9-501f-4e37-4bf444fcb42c"
          ],
          "display_name": false
        },
        {
          "uuid": "fcd8d5cf-0119-42cf-8a32-eab4c90ce6ce",
          "name": "TALC [FCC]",
          "stdName": "TALC [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "76389943-9eb0-483b-b234-bf5112a54569"
          ],
          "display_name": false
        },
        {
          "uuid": "e534be94-542a-4285-9ee3-c06f116f7b0c",
          "name": "TALC [HSDB]",
          "stdName": "TALC [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "458f1577-121a-4fdf-afdf-feb36db0f48c"
          ],
          "display_name": false
        },
        {
          "uuid": "65688475-db4b-4862-8481-de923db64810",
          "name": "TALC [II]",
          "stdName": "TALC [II]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "83a1c353-b908-4c4e-9534-2315f25bc338"
          ],
          "display_name": false
        },
        {
          "uuid": "3c819a95-e9c6-4434-bd76-eb96d685c908",
          "name": "TALC [JAN]",
          "stdName": "TALC [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "33383814-794f-042e-f9e0-3ab4103b1e99"
          ],
          "display_name": false
        },
        {
          "uuid": "8112166e-cee0-4e99-a2e1-f07bb4991bb1",
          "name": "TALC [MI]",
          "stdName": "TALC [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "85a03c71-07ea-4d3d-a345-1d5c2eaeb61f"
          ],
          "display_name": false
        },
        {
          "uuid": "5ff4b527-36cf-45ae-a08f-3089b54282ae",
          "name": "TALC [ORANGE BOOK]",
          "stdName": "TALC [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "be97d41c-424c-4b4c-9e02-ff6b852b7d93"
          ],
          "display_name": false
        },
        {
          "uuid": "79f49a51-d2d9-efb0-1553-04898b2cbe3c",
          "name": "TALC [USP MONOGRAPH]",
          "stdName": "TALC [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1753ab30-2ab5-75b2-ec5a-ebd90af9240e"
          ],
          "display_name": false
        },
        {
          "uuid": "6da829a5-f159-4fba-a6a9-acd807ac1f56",
          "name": "TALC [VANDF]",
          "stdName": "TALC [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5fade6fb-f9e3-4f74-a6f7-25a872640062"
          ],
          "display_name": false
        },
        {
          "uuid": "93a3539f-ccd1-4d66-8ef3-e48e84b40ee1",
          "name": "TALC [WHO-IP]",
          "stdName": "TALC [WHO-IP]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "12ad3d99-b96d-4465-91b1-14b27f23a3fc"
          ],
          "display_name": false
        },
        {
          "uuid": "f23e19fa-f0f0-4e4a-bb76-79c70f17a94e",
          "name": "TALCUM [WHO-IP LATIN]",
          "stdName": "TALCUM [WHO-IP LATIN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "12ad3d99-b96d-4465-91b1-14b27f23a3fc"
          ],
          "display_name": false
        },
        {
          "uuid": "b7a942d2-02e1-0ab7-b61c-2ca977c78f5a",
          "name": "Talc [WHO-DD]",
          "stdName": "TALC [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7821dfdc-2f1a-45b7-f490-fa75b6e38aa5"
          ],
          "display_name": false
        }
      ],
      "modifications": {
        "uuid": "b05880c2-68da-4c11-aa76-c01756148a7e"
      }
    }
  ]
}