{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0dccdbab-a046-4c90-8e36-fa22fb9e1de5",
          "code": "486-67-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=486-67-9",
          "code_system": "CAS",
          "references": [
            "c6da2192-98af-44f3-8873-a0c63c8aa339",
            "bc28cbef-1090-4a63-95a1-67bc6336b7d1"
          ]
        },
        {
          "uuid": "a10e418a-2c44-4cc7-8071-8478c60e9851",
          "code": "C66098",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C66098",
          "code_system": "NCI_THESAURUS",
          "references": [
            "c6da2192-98af-44f3-8873-a0c63c8aa339"
          ]
        },
        {
          "uuid": "fa664143-8050-4e14-88b5-47a6d68e2de4",
          "code": "207-637-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.240.860",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "c6da2192-98af-44f3-8873-a0c63c8aa339"
          ]
        },
        {
          "uuid": "1780acc8-4774-4ee0-b289-ff7a791840be",
          "code": "m7241",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7241?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "c6da2192-98af-44f3-8873-a0c63c8aa339"
          ]
        },
        {
          "uuid": "a24ac8b5-3ace-4e70-9f19-48608d1272f9",
          "code": "DB09338",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB09338",
          "code_system": "DRUG BANK",
          "references": [
            "c6da2192-98af-44f3-8873-a0c63c8aa339"
          ]
        },
        {
          "uuid": "cdde03b3-90bf-7a85-6072-8abbf376537a",
          "code": "Mersalyl acid",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Mersalyl_acid",
          "code_system": "WIKIPEDIA",
          "references": [
            "388807ac-c252-ac95-dbcc-0b16e8fa36ac"
          ]
        },
        {
          "uuid": "bdb3b77e-eef8-1723-7b5a-16101c456cae",
          "code": "C448",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Blood or Body Fluid[C78275]|Diuretic",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C448",
          "code_system": "NCI_THESAURUS",
          "references": [
            "3aff01ec-9f5a-5285-21e8-cbdbf1606187"
          ]
        },
        {
          "uuid": "c233373d-874b-44a7-af3e-a5cb29838033",
          "code": "7RDI07K19U",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "42ca5eba-0ec2-d9e7-eee0-dfad486ddb25",
          "code": "101318324",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/101318324",
          "code_system": "PUBCHEM",
          "references": [
            "7ce7e7cc-ffad-c8ca-a4a2-5e5b04b2ab91"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "2cdeda85-5d78-4d9f-b665-3960766169c9",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "1250f4d2-f910-48de-bf4f-35032629887c",
            "refuuid": "8dfac72e-09bb-4865-9520-ef1968a70d75",
            "name": "MERSALYL ACID",
            "unii": "7RDI07K19U",
            "linking_id": "7RDI07K19U",
            "ref_pname": "MERSALYL ACID",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "7d2542f9-1218-4f3a-a739-feccda8e80f5",
          "name": "(±)-MERSALYL ACID",
          "stdName": "(+/-)-MERSALYL ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "02e8986b-f6a4-4287-a7ff-c3053ba405f4",
            "f52955ec-baf0-4d2f-8dac-41ce8153859d"
          ],
          "display_name": false
        },
        {
          "uuid": "109b2465-7057-4975-b0e1-3b0d21e01c86",
          "name": "MERSALYL ACID",
          "stdName": "MERSALYL ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "334942fa-4e76-4056-b258-c40e3004a9c4",
            "dbca2e6b-c0f0-47cc-8535-7c0b399d5561",
            "ceea8375-0c4c-4963-b1a7-3079a64ef4d1",
            "f52955ec-baf0-4d2f-8dac-41ce8153859d",
            "a56bbd0f-d681-4c61-a41b-835118a04bfc",
            "d2574115-abec-4ce3-8f42-47efc368ddbe"
          ],
          "display_name": true
        },
        {
          "uuid": "86f6ba27-ea3c-455d-914c-13e9778113e9",
          "name": "MERSALYL ACID [MART.]",
          "stdName": "MERSALYL ACID [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d2574115-abec-4ce3-8f42-47efc368ddbe"
          ],
          "display_name": false
        },
        {
          "uuid": "d2b6d5a6-1518-4150-98eb-7ce39038b202",
          "name": "MERSALYL ACID [MI]",
          "stdName": "MERSALYL ACID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dbca2e6b-c0f0-47cc-8535-7c0b399d5561",
            "f52955ec-baf0-4d2f-8dac-41ce8153859d"
          ],
          "display_name": false
        },
        {
          "uuid": "f03f036e-5826-44b1-8c34-ad1235173a46",
          "name": "MERSALYL ACID, (±)-",
          "stdName": "MERSALYL ACID, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "02e8986b-f6a4-4287-a7ff-c3053ba405f4",
            "f52955ec-baf0-4d2f-8dac-41ce8153859d"
          ],
          "display_name": false
        },
        {
          "uuid": "b4da038e-0b61-4e85-b826-fd1ac3eb7b07",
          "name": "N-(.GAMMA.-HYDROXYMERCURI-.BETA.-METHOXYPROPYL)SALICYLAMIDE-O-ACETIC ACID",
          "stdName": "N-(.GAMMA.-HYDROXYMERCURI-.BETA.-METHOXYPROPYL)SALICYLAMIDE-O-ACETIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f52955ec-baf0-4d2f-8dac-41ce8153859d",
            "a56bbd0f-d681-4c61-a41b-835118a04bfc"
          ],
          "display_name": false
        },
        {
          "uuid": "70c1898e-ad6b-4ca0-8e65-5c4ea4aa7ffe",
          "name": "O-((3-(HYDROXYMERCURI)-2-METHOXYPROPYL)CARBAMOYL)PHENOXYACETIC ACID",
          "stdName": "O-((3-(HYDROXYMERCURI)-2-METHOXYPROPYL)CARBAMOYL)PHENOXYACETIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b5415613-e51c-40e2-82a8-f60b073f3a82",
            "f52955ec-baf0-4d2f-8dac-41ce8153859d"
          ],
          "display_name": false
        },
        {
          "uuid": "e3deeaac-15c6-4b62-b9d3-181b443e3472",
          "name": "SALYRGANIC ACID",
          "stdName": "SALYRGANIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4e9ed3cb-16c9-41e0-a636-6b38524c3704",
            "f52955ec-baf0-4d2f-8dac-41ce8153859d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "dd0cb7ed-c6bb-434b-873f-f6183d7c4537",
          "citation": "ACD 9.0(USAN 2006)",
          "doc_type": "ACD",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a56bbd0f-d681-4c61-a41b-835118a04bfc",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f52955ec-baf0-4d2f-8dac-41ce8153859d",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b5415613-e51c-40e2-82a8-f60b073f3a82",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d2574115-abec-4ce3-8f42-47efc368ddbe",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "02e8986b-f6a4-4287-a7ff-c3053ba405f4",
          "citation": "fda_srs",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dbca2e6b-c0f0-47cc-8535-7c0b399d5561",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4e9ed3cb-16c9-41e0-a636-6b38524c3704",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c6da2192-98af-44f3-8873-a0c63c8aa339",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390694000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9aef57ac-1e70-47e0-a2e2-f04982adee3b",
          "citation": "SRS import [7RDI07K19U]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7RDI07K19U",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390694000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7e99d0dc-4b14-421a-98a5-f735ab0a5574",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ceea8375-0c4c-4963-b1a7-3079a64ef4d1",
          "citation": "MERSALYL ACID [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "334942fa-4e76-4056-b258-c40e3004a9c4",
          "citation": "MERSALYL ACID [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "388807ac-c252-ac95-dbcc-0b16e8fa36ac",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Mersalyl_acid",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e4599bf7-f860-cddf-dc03-945f3c8b9558",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=486-67-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3aff01ec-9f5a-5285-21e8-cbdbf1606187",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "7ce7e7cc-ffad-c8ca-a4a2-5e5b04b2ab91",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "bc28cbef-1090-4a63-95a1-67bc6336b7d1",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "56dc6297-2966-49f4-91dd-e318d1c6446f",
          "id": "56dc6297-2966-49f4-91dd-e318d1c6446f",
          "molfile": "\n  Marvin  01132104312D          \n\n  1  0  0  0  0  0            999 V2000\n    7.4123   -2.1958    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1  -1\nM  END",
          "smiles": "[OH-]",
          "formula": "HO",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ce1f99c1-8e17-4870-aa49-1ad914437a37"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "17.0073",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "feb7aab3-ba4d-4d2d-bc83-e6dc4fb6902d",
          "id": "feb7aab3-ba4d-4d2d-bc83-e6dc4fb6902d",
          "molfile": "\n  Marvin  01132113112D          \n\n 20 20  0  0  0  0            999 V2000\n    6.6644   -0.7680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8419   -0.7758    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4308   -1.4896    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    5.8575   -2.1956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6799   -2.1956    0.0000 Hg  0  3  0  0  0  0  0  0  0  0  0  0\n    4.6058   -1.4896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1895   -2.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3671   -2.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9534   -1.4896    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9612   -2.9197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3826   -3.6412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9612   -4.3471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1490   -4.3549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7146   -3.6412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1335   -2.9197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7224   -2.2188    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8922   -2.2266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4811   -1.4974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8844   -0.7783    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3543   -1.5051    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  3  6  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  2  0  0  0  0\n  8 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 15 10  2  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 18  2  0  0  0  0\nM  CHG  1   5   1\nM  END",
          "smiles": "COC(C[Hg+])CNC(=O)c1ccccc1OCC(=O)O",
          "formula": "C13H16HgNO5",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "724d6d4f-6be9-4bdb-9847-43e94a4637f7"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "466.8695",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "8dfac72e-09bb-4865-9520-ef1968a70d75",
      "version": "10",
      "structure": {
        "id": "614bab44-73b0-44b7-a897-10c37b4d7b17",
        "molfile": "\n  Marvin  01132105022D          \n\n 21 20  0  0  0  0            999 V2000\n    2.9612   -2.9197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3671   -2.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1895   -2.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4811   -1.4974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1335   -2.9197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7224   -2.2188    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9534   -1.4896    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8844   -0.7783    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3543   -1.5051    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8922   -2.2266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6799   -2.1956    0.0000 Hg  0  3  0  0  0  0  0  0  0  0  0  0\n    4.6058   -1.4896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4308   -1.4896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8575   -2.1956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3826   -3.6412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8419   -0.7758    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7146   -3.6412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6644   -0.7680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9612   -4.3471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1490   -4.3549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4117   -2.1956    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4 10  1  0  0  0  0\n  5  1  2  0  0  0  0\n  6  5  1  0  0  0  0\n  7  2  2  0  0  0  0\n  8  4  1  0  0  0  0\n  9  4  2  0  0  0  0\n 10  6  1  0  0  0  0\n 11 14  1  0  0  0  0\n 12  3  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15  1  1  0  0  0  0\n 13 16  1  0  0  0  0\n 17  5  1  0  0  0  0\n 18 16  1  0  0  0  0\n 19 15  2  0  0  0  0\n 20 19  1  0  0  0  0\n 17 20  2  0  0  0  0\nM  CHG  2  11   1  21  -1\nM  END",
        "smiles": "COC(C[Hg+])CNC(=O)c1ccccc1OCC(=O)O.[OH-]",
        "formula": "C13H16HgNO5.HO",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "483.8769",
        "optical_activity": "( + / - )",
        "references": [
          "7e99d0dc-4b14-421a-98a5-f735ab0a5574",
          "9aef57ac-1e70-47e0-a2e2-f04982adee3b"
        ],
        "stereo_centers": 1
      },
      "unii": "7RDI07K19U"
    }
  ]
}