{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "66d3f035-9a33-4d51-b07c-21878a965ad8", "code": "5598-15-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=5598-15-2", "code_system": "CAS", "references": [ "e5a9c538-3c76-41c4-b561-38c3ba9cf89f", "e5e43a04-5d22-4c17-8554-5a481f95cc76" ] }, { "uuid": "dfcf5361-827a-4e75-9aee-67cc8dc20d5c", "code": "659101", "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL", "type": "PRIMARY", "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:1823", "code_system": "EPA PESTICIDE CODE", "references": [ "e5a9c538-3c76-41c4-b561-38c3ba9cf89f" ] }, { "uuid": "89df531f-106a-4454-9b70-ada6a9beec86", "code": "21804", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/21804", "code_system": "PUBCHEM", "references": [ "e5a9c538-3c76-41c4-b561-38c3ba9cf89f" ] }, { "uuid": "fb32980f-259e-c906-1256-63eb538914e7", "code": "DTXSID1038666", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1038666", "code_system": "EPA CompTox", "references": [ "78e364b9-7ec4-67e4-8404-941987bc1b83" ] }, { "uuid": "d1654ea6-dd6d-423c-9dde-1d6f8cbf5277", "code": "7RC6H1MPX6", "type": "PRIMARY", "code_system": "FDA UNII" } ], "relationships": [ { "uuid": "487acd2d-42ea-4adf-bbf9-f576a626b158", "amount": { "uuid": "f56ed4e9-11f8-4e05-9549-eca9a8833544" }, "type": "TARGET->INHIBITOR", "interaction_type": "IRREVERSIBLE INHIBITOR", "related_substance": { "uuid": "1494f871-4360-4ef8-87ea-f885d101cfe5", "refuuid": "fb927795-bac1-4bc5-97e4-9c4f4fe48025", "name": "ACETYLCHOLINESTERASE HUMAN", "unii": "EK71H4HC3N", "linking_id": "EK71H4HC3N", "ref_pname": "ACETYLCHOLINESTERASE HUMAN", "substance_class": "reference" } }, { "uuid": "f1413706-c1d5-45fa-b97e-80cbc0a0a4be", "amount": { "uuid": "2a36298a-e146-4f1b-95c5-07dc8ce37108" }, "type": "METABOLITE->PARENT", "related_substance": { "uuid": "6b771192-3ba5-47d3-aad5-ed82ddec0217", "refuuid": "e7764c43-b54e-458f-b860-77c6b4ecab13", "name": "CHLORPYRIFOS", "unii": "JCS58I644W", "linking_id": "JCS58I644W", "ref_pname": "CHLORPYRIFOS", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "886d86fa-fc01-4b0b-9292-a3804c9a53f3", "name": "CHLORPYRIFOS OXON", "stdName": "CHLORPYRIFOS OXON", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "97ec52fb-f5ab-0b23-b35e-73230f8a4a66" ], "display_name": true }, { "uuid": "c8e46697-13bf-4f56-b17c-9e1e13376c31", "name": "DIETHYL-2,5,6-TRICHLORO-2-PYRIDINOL", "stdName": "DIETHYL-2,5,6-TRICHLORO-2-PYRIDINOL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "f3f04bda-d31c-409b-bdcc-27b2887a6d4a" ], "display_name": false } ], "references": [ { "uuid": "f3f04bda-d31c-409b-bdcc-27b2887a6d4a", "citation": "ICSAS BATCH 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e5a9c538-3c76-41c4-b561-38c3ba9cf89f", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390944000, "tags": [ "NOMEN" ] }, { "uuid": "5748b708-5fb0-463d-89f0-a66c692a3476", "citation": "CHEMID 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "78e364b9-7ec4-67e4-8404-941987bc1b83", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=5598-15-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "97ec52fb-f5ab-0b23-b35e-73230f8a4a66", "citation": "https://en.wikipedia.org/wiki/Chlorpyrifos", "doc_type": "WIKI", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "e5e43a04-5d22-4c17-8554-5a481f95cc76", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "a976bcff-f4d9-4555-8374-ab062a042ee1", "id": "a976bcff-f4d9-4555-8374-ab062a042ee1", "molfile": "\n Marvin 01132108482D \n\n 18 18 0 0 0 0 999 V2000\n 6.3308 -2.4161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7448 -3.1297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3308 -3.8788 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7448 -4.5925 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1627 -5.3024 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4545 -4.1747 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2077 -4.5925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9175 -4.1747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0430 -5.0106 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0430 -5.8226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7448 -6.2405 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7448 -7.0765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4545 -7.4944 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0430 -7.4944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0430 -8.3304 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2859 -7.0765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2859 -6.2405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5801 -5.8226 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 2 0 0 0 0\n 4 6 1 0 0 0 0\n 4 9 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 17 2 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 12 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 16 14 2 0 0 0 0\n 17 16 1 0 0 0 0\n 17 18 1 0 0 0 0\nM END", "smiles": "CCOP(=O)(OCC)Oc1c(cc(c(Cl)n1)Cl)Cl", "formula": "C9H11Cl3NO4P", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "f16cddf3-5e08-4fdb-a31f-734b19ee933c" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "334.5209", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "0d1cf3c0-ccaf-4406-b0ff-8464c82545cc", "version": "8", "structure": { "id": "5b8b5e07-2e43-4077-aad5-47471d63bd8d", "molfile": "\n Marvin 01132104452D \n\n 18 18 0 0 0 0 999 V2000\n 6.7448 -4.5925 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0430 -5.0106 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0430 -5.8226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2859 -6.2405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2859 -7.0765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0430 -7.4944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0430 -8.3304 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7448 -7.0765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7448 -6.2405 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4545 -7.4944 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5801 -5.8226 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3308 -3.8788 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7448 -3.1297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3308 -2.4161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4545 -4.1747 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2077 -4.5925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9175 -4.1747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1627 -5.3024 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 8 6 1 0 0 0 0\n 9 8 2 0 0 0 0\n 3 9 1 0 0 0 0\n 8 10 1 0 0 0 0\n 4 11 1 0 0 0 0\n 1 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 1 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 1 18 2 0 0 0 0\nM END", "smiles": "CCOP(=O)(OCC)Oc1c(cc(c(Cl)n1)Cl)Cl", "formula": "C9H11Cl3NO4P", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "334.5209", "optical_activity": "NONE", "references": [ "5748b708-5fb0-463d-89f0-a66c692a3476" ], "stereo_centers": 0 }, "unii": "7RC6H1MPX6" } ] }