{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "494f1c85-4679-4c40-84c7-3e35d63463e7",
          "code": "10191-41-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=10191-41-0",
          "code_system": "CAS",
          "references": [
            "4ae61c1d-2d9f-426c-85e6-a429bcfc9969",
            "5f39e70d-f106-40b2-aaed-f2a95dc139c6"
          ]
        },
        {
          "uuid": "d0a0faeb-5d75-4b41-8f51-f6120a5833a6",
          "code": "C74578",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C74578",
          "code_system": "NCI_THESAURUS",
          "references": [
            "4ae61c1d-2d9f-426c-85e6-a429bcfc9969"
          ]
        },
        {
          "uuid": "20271847-c30c-4661-99bb-d9a81bf5133c",
          "code": "INS-307C",
          "comments": "JECFA|Functional Classification|Antioxidant",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemINS=307c",
          "code_system": "JECFA EVALUATION",
          "references": [
            "4ae61c1d-2d9f-426c-85e6-a429bcfc9969"
          ]
        },
        {
          "uuid": "6c62981d-1fb4-4ce5-81dc-24f6e9707730",
          "code": "INS-307C",
          "comments": "Codex Alimentarius|Functional Classification|Antioxidant",
          "type": "PRIMARY",
          "url": "http://www.fao.org/gsfaonline/additives/details.html?id=387",
          "code_system": "CODEX ALIMENTARIUS (GSFA)",
          "references": [
            "4ae61c1d-2d9f-426c-85e6-a429bcfc9969"
          ]
        },
        {
          "uuid": "f916b4c2-838a-4d33-806e-6b9534c0b82d",
          "code": "m10923",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m10923?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "4ae61c1d-2d9f-426c-85e6-a429bcfc9969"
          ]
        },
        {
          "uuid": "5a58205e-4e55-47b2-b64d-e1cc56097d1c",
          "code": "220893",
          "type": "ALTERNATIVE",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/220893/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "4ae61c1d-2d9f-426c-85e6-a429bcfc9969"
          ]
        },
        {
          "uuid": "2e3d77e3-15db-4cf8-964c-3b040c425c3f",
          "code": "402899",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/402899/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "4ae61c1d-2d9f-426c-85e6-a429bcfc9969"
          ]
        },
        {
          "uuid": "abcee042-383a-492b-b19d-a526d626841d",
          "code": "SUB124293",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "4ae61c1d-2d9f-426c-85e6-a429bcfc9969"
          ]
        },
        {
          "uuid": "a485ee23-7b16-40a4-a95a-a7d39fbed9c5",
          "code": "SUB35837",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "4ae61c1d-2d9f-426c-85e6-a429bcfc9969"
          ]
        },
        {
          "uuid": "2b053e8a-5b19-43be-be4f-916cc954d188",
          "code": "233-466-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.030.411",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "4ae61c1d-2d9f-426c-85e6-a429bcfc9969"
          ]
        },
        {
          "uuid": "f1289ce7-4cf6-47af-80fb-56551b6688ef",
          "code": "2116",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/2116",
          "code_system": "PUBCHEM",
          "references": [
            "4ae61c1d-2d9f-426c-85e6-a429bcfc9969"
          ]
        },
        {
          "uuid": "d2d329d7-e0e1-a076-07c1-d4ea4bdf5984",
          "code": "8261",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/8261",
          "code_system": "HSDB",
          "references": [
            "8dfed88f-10d1-0385-bbbf-2f13a79e4b72"
          ]
        },
        {
          "uuid": "130ce82a-91d7-a659-9cbd-961c4bdce27d",
          "code": "DTXSID8021355",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8021355",
          "code_system": "EPA CompTox",
          "references": [
            "42b2af5f-e421-8a40-c625-734565e419f6"
          ]
        },
        {
          "uuid": "5531e578-35b5-5c83-069f-f4a47490a70a",
          "code": "DB14476",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB14476",
          "code_system": "DRUG BANK",
          "references": [
            "057b1935-e1e5-8799-9ee1-6261f0e1ca3e"
          ]
        },
        {
          "uuid": "66c45659-07f5-4c9c-89dc-dd960a9948d5",
          "code": "7QWA1RIO01",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f4aaf347-522f-b3b2-ed87-d123adb50ccd",
          "code": "18145",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:18145",
          "code_system": "CHEBI",
          "references": [
            "057b1935-e1e5-8799-9ee1-6261f0e1ca3e"
          ]
        },
        {
          "uuid": "b91cd9ef-96ee-650c-895a-ec44a257f4e8",
          "code": "22470",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:22470",
          "code_system": "CHEBI",
          "references": [
            "057b1935-e1e5-8799-9ee1-6261f0e1ca3e"
          ]
        },
        {
          "uuid": "f4ca9d70-08b3-c9a5-d039-49e5b06ac77e",
          "code": "100000128593",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "ac90b5a3-d650-b96c-9913-a8360451d807"
          ]
        },
        {
          "uuid": "fa7af563-a806-ba9d-507b-ab29f6439e39",
          "code": "7QWA1RIO01",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=7QWA1RIO01",
          "code_system": "DAILYMED",
          "references": [
            "99d1dcd5-8f87-3628-348a-a0f88bd14372"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "448096c0-c106-47cd-8090-3ff2c988438e",
          "amount": {
            "uuid": "52d1cfc2-4a58-43dc-9093-1b6b490007b8"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "ac448e6d-606e-4595-9ef2-9d9d51ce7d71",
            "refuuid": "f8483c15-c651-47ad-ae24-f0472b11af2a",
            "name": ".ALPHA.-TOCOPHEROL, DL-",
            "unii": "7QWA1RIO01",
            "linking_id": "7QWA1RIO01",
            "ref_pname": ".ALPHA.-TOCOPHEROL, DL-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "7ed2d6ac-f321-41f7-bb08-d3bd4c5afe80",
          "amount": {
            "uuid": "1a8ca7de-d374-49a8-babe-30054c8f60bf"
          },
          "type": "PARENT->IMPURITY",
          "references": [
            "17cba186-0ce2-4b93-8bc9-8f5bbe26a164"
          ],
          "related_substance": {
            "uuid": "930ea3e0-0f29-4112-b538-c378236b5ee0",
            "refuuid": "6b39d8bf-9bc2-44e6-b990-54431ac6a681",
            "name": ".ALPHA.-TOCOPHEROL ACETATE, DL-",
            "unii": "WR1WPI7EW8",
            "linking_id": "WR1WPI7EW8",
            "ref_pname": ".ALPHA.-TOCOPHEROL ACETATE, DL-",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3b296317-b181-4d7d-8cc6-60ace50e59b1",
          "name": "(+)-ALPHA-TOCOPHEROL",
          "stdName": "(+)-ALPHA-TOCOPHEROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6ee807dd-f8a6-43ad-ba5e-4ac96b848363"
          ],
          "display_name": false
        },
        {
          "uuid": "fe0719a4-a0e5-4802-9405-478e5f0f77b3",
          "name": ".ALPHA.-TOCOPHEROL, DL-",
          "stdName": ".ALPHA.-TOCOPHEROL, DL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9148bcd4-20a4-4e1c-9b27-64ea5c5f8c87",
            "39f07821-72b1-4383-8491-67667c5f138b"
          ],
          "display_name": true
        },
        {
          "uuid": "0436bd88-057d-4404-bd72-1ee1b20ea52e",
          "name": ".ALPHA.-TOCOPHEROL, DL- [II]",
          "stdName": ".ALPHA.-TOCOPHEROL, DL- [II]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9148bcd4-20a4-4e1c-9b27-64ea5c5f8c87"
          ],
          "display_name": false
        },
        {
          "uuid": "68543632-a62b-463a-a58a-dbd62b9d9ad7",
          "name": "2,5,7,8-TETRAMETHYL-2-(4',8',12'-TRIMETHYLTRIDECYL)-6-CHROMANOL",
          "stdName": "2,5,7,8-TETRAMETHYL-2-(4',8',12'-TRIMETHYLTRIDECYL)-6-CHROMANOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9148bcd4-20a4-4e1c-9b27-64ea5c5f8c87"
          ],
          "display_name": false
        },
        {
          "uuid": "081910fa-9c31-41ae-baea-0bf196ac5630",
          "name": "2H-1-BENZOPYRAN-6-OL, 3,4-DIHYDRO-2,5,7,8-TETRAMETHYL-2-(4,8,12-TRIMETHYLTRIDECYL)-",
          "stdName": "2H-1-BENZOPYRAN-6-OL, 3,4-DIHYDRO-2,5,7,8-TETRAMETHYL-2-(4,8,12-TRIMETHYLTRIDECYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b323454e-8b9a-451a-a707-3e7b0503162b"
          ],
          "display_name": false
        },
        {
          "uuid": "72106003-edfa-4c73-880c-468548c1c07b",
          "name": "ALL-RAC-ALPHA-TOCOPHEROL",
          "stdName": "ALL-RAC-ALPHA-TOCOPHEROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "510c2384-988a-4c37-b1c8-c8dca6c255aa",
            "082c879a-ea77-4477-8955-8864bd1b6f34"
          ],
          "display_name": false
        },
        {
          "uuid": "c7eee1d9-b234-4938-9563-8f7c7cbbf0eb",
          "name": "ALL-RAC-ALPHA-TOCOPHEROL [FCC]",
          "stdName": "ALL-RAC-ALPHA-TOCOPHEROL [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "082c879a-ea77-4477-8955-8864bd1b6f34"
          ],
          "display_name": false
        },
        {
          "uuid": "c66f9fa3-04c3-4e0a-aeee-c7a06f887a92",
          "name": "ALPHA-TOCOPHEROL, DL-",
          "stdName": "ALPHA-TOCOPHEROL, DL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "178304c4-85d2-435a-aef9-4328c38086b2"
          ],
          "display_name": false
        },
        {
          "uuid": "511f731c-2442-48b8-9411-744c2621fd53",
          "name": "DL-.ALPHA.-TOCOPHEROL",
          "stdName": "DL-.ALPHA.-TOCOPHEROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "18505b79-cfdc-40fb-b5ae-1475a771cc5a",
            "1987be8d-b19f-4ad4-9e44-d428a525619e"
          ],
          "display_name": false
        },
        {
          "uuid": "929464f8-72fb-4e6e-b837-1a5644e0dcee",
          "name": "DL-.ALPHA.-TOCOPHEROL [MI]",
          "stdName": "DL-.ALPHA.-TOCOPHEROL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "18505b79-cfdc-40fb-b5ae-1475a771cc5a"
          ],
          "display_name": false
        },
        {
          "uuid": "54d766c3-7533-4cee-a1ef-571595fd4f5c",
          "name": "DL-5,7,8-TRIMETHYLTOCOL",
          "stdName": "DL-5,7,8-TRIMETHYLTOCOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "341e1e32-46a3-4d3c-b6dc-989d8ebebf7d"
          ],
          "display_name": false
        },
        {
          "uuid": "eeaff451-a14c-47dd-84ab-3c54e2788d56",
          "name": "DL-ALPHA TOCOPHEROL",
          "stdName": "DL-ALPHA TOCOPHEROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "52fe56a7-54c7-4e85-b86e-bfcdaf0efa0b",
            "4ecc6301-035f-4321-a6e0-e6c83ccd7046",
            "d3f4d5e6-da9a-44d4-abef-e7a6e03d4638",
            "1f43a227-d785-4496-9aa9-64bf8bccec63"
          ],
          "display_name": false
        },
        {
          "uuid": "f2c6d59d-a427-4c2d-8c9e-71eb7719c71e",
          "name": "DL-ALPHA TOCOPHEROL [MART.]",
          "stdName": "DL-ALPHA TOCOPHEROL [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4ecc6301-035f-4321-a6e0-e6c83ccd7046"
          ],
          "display_name": false
        },
        {
          "uuid": "8c40f93e-5adb-46b3-b503-af521441de0c",
          "name": "DL-ALPHA-TOCOPHEROL(307C)",
          "stdName": "DL-ALPHA-TOCOPHEROL(307C)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "27320e14-3a9c-46ce-9eed-5f2d7cabfcd1"
          ],
          "display_name": false
        },
        {
          "uuid": "91121543-d242-f9f2-2e61-49fdfa924b3b",
          "name": "Dl-Alpha Tocopherol [WHO-DD]",
          "stdName": "DL-ALPHA TOCOPHEROL [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9ec36a80-34f1-1e59-fae0-83df1e4ffe32"
          ],
          "display_name": false
        },
        {
          "uuid": "2632e22e-b649-4e7e-8ed4-9a422ce95891",
          "name": "E-307C",
          "stdName": "E-307C",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "27320e14-3a9c-46ce-9eed-5f2d7cabfcd1"
          ],
          "display_name": false
        },
        {
          "uuid": "02a17815-ba2b-4ade-a578-5e9b658c99c7",
          "name": "EPHANYL",
          "stdName": "EPHANYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e21811ed-0bfe-4367-948a-04e898263877"
          ],
          "display_name": false
        },
        {
          "uuid": "c13211d9-fe6c-4d80-aa20-fac867563d72",
          "name": "INS NO.307C",
          "stdName": "INS NO.307C",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "27320e14-3a9c-46ce-9eed-5f2d7cabfcd1"
          ],
          "display_name": false
        },
        {
          "uuid": "806a54b3-f98f-44db-9dbc-e166a228886f",
          "name": "INS-307C",
          "stdName": "INS-307C",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "27320e14-3a9c-46ce-9eed-5f2d7cabfcd1"
          ],
          "display_name": false
        },
        {
          "uuid": "cac6c22f-a127-4796-bd00-9d79e0967a00",
          "name": "IRGANOX E 210",
          "stdName": "IRGANOX E 210",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e21811ed-0bfe-4367-948a-04e898263877"
          ],
          "display_name": false
        },
        {
          "uuid": "dd7bcc19-c8d0-4f55-8d60-0be6e2fce04a",
          "name": "J24.789H",
          "stdName": "J24.789H",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9f5bf132-256c-4068-89f8-4a9adb5534a3"
          ],
          "display_name": false
        },
        {
          "uuid": "43a8c789-c920-493b-b51d-d897a4997354",
          "name": "RAC-.ALPHA.-TOCOPHEROL",
          "stdName": "RAC-.ALPHA.-TOCOPHEROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e21811ed-0bfe-4367-948a-04e898263877"
          ],
          "display_name": false
        },
        {
          "uuid": "982f9e6f-e91a-4d83-beae-2b04ad816768",
          "name": "RONOTEC DF 120",
          "stdName": "RONOTEC DF 120",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e21811ed-0bfe-4367-948a-04e898263877"
          ],
          "display_name": false
        },
        {
          "uuid": "4b79b824-bd8f-4c74-90c8-47cd9867b672",
          "name": "RRR-ALPHA-TOCOPHEROL",
          "stdName": "RRR-ALPHA-TOCOPHEROL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6ee807dd-f8a6-43ad-ba5e-4ac96b848363"
          ],
          "display_name": false
        },
        {
          "uuid": "8adcdb18-5e26-4cb2-984d-0da22fc3016e",
          "name": "TOCOPHEROL, DL-ALPHA",
          "stdName": "TOCOPHEROL, DL-ALPHA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0000344b-fb94-41ad-beb4-b6c202e6a77e"
          ],
          "display_name": false
        },
        {
          "uuid": "147603bd-fd55-4633-ba96-fcdd2c187c96",
          "name": "TOCOPHEROL,DL-ALPHA [VANDF]",
          "stdName": "TOCOPHEROL,DL-ALPHA [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0329f3f2-06f4-4bc0-a748-927e86c32b63"
          ],
          "display_name": false
        },
        {
          "uuid": "fd4b7eed-48bb-4c63-b611-bcaf2237c94f",
          "name": "UVINUL 2000AO",
          "stdName": "UVINUL 2000AO",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e21811ed-0bfe-4367-948a-04e898263877"
          ],
          "display_name": false
        },
        {
          "uuid": "6e571161-a333-4896-89db-c37e00f3f285",
          "name": "VITAMIN E DL-ALPHA",
          "stdName": "VITAMIN E DL-ALPHA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0000344b-fb94-41ad-beb4-b6c202e6a77e"
          ],
          "display_name": false
        },
        {
          "uuid": "2fea2227-8e03-4a6c-8dae-46ea7b407b4d",
          "name": "all-rac-α-TOCOPHERYL ACETATE IMPURITY C [EP IMPURITY]",
          "stdName": "ALL-RAC-.ALPHA.-TOCOPHERYL ACETATE IMPURITY C [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "17cba186-0ce2-4b93-8bc9-8f5bbe26a164"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b323454e-8b9a-451a-a707-3e7b0503162b",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "178304c4-85d2-435a-aef9-4328c38086b2",
          "citation": "USP DICTIONARY 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9148bcd4-20a4-4e1c-9b27-64ea5c5f8c87",
          "citation": "Merck Index 14th Edition",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "082c879a-ea77-4477-8955-8864bd1b6f34",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4ecc6301-035f-4321-a6e0-e6c83ccd7046",
          "citation": "MART",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0000344b-fb94-41ad-beb4-b6c202e6a77e",
          "citation": "rxnorm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0329f3f2-06f4-4bc0-a748-927e86c32b63",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "18505b79-cfdc-40fb-b5ae-1475a771cc5a",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9f5bf132-256c-4068-89f8-4a9adb5534a3",
          "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J24.789H",
          "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J24.789H",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "52fe56a7-54c7-4e85-b86e-bfcdaf0efa0b",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "341e1e32-46a3-4d3c-b6dc-989d8ebebf7d",
          "citation": "http://www.fao.org/ag/agn/jecfa-additives/specs/Monograph1/additive-467-m1.pdf",
          "url": "http://www.fao.org/ag/agn/jecfa-additives/specs/Monograph1/additive-467-m1.pdf",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6ee807dd-f8a6-43ad-ba5e-4ac96b848363",
          "citation": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=3",
          "url": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=3",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "27320e14-3a9c-46ce-9eed-5f2d7cabfcd1",
          "citation": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=387",
          "url": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=387",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e21811ed-0bfe-4367-948a-04e898263877",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4ae61c1d-2d9f-426c-85e6-a429bcfc9969",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390554000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a3f5dd1b-1249-4b2e-8e2d-36ee5d45ffda",
          "citation": "SRS import [7QWA1RIO01]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7QWA1RIO01",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390554000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "510c2384-988a-4c37-b1c8-c8dca6c255aa",
          "citation": "ALL-RAC-ALPHA-TOCOPHEROL [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1f43a227-d785-4496-9aa9-64bf8bccec63",
          "citation": "DL-ALPHA TOCOPHEROL [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "39f07821-72b1-4383-8491-67667c5f138b",
          "citation": ".ALPHA.-TOCOPHEROL, DL- [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "693c1de6-fee0-4ffd-81d6-1702af07c94b",
          "citation": "TOCOPHEROL,DL-ALPHA [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1987be8d-b19f-4ad4-9e44-d428a525619e",
          "citation": "DL-.ALPHA.-TOCOPHEROL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d3f4d5e6-da9a-44d4-abef-e7a6e03d4638",
          "citation": "DL-ALPHA TOCOPHEROL [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8dfed88f-10d1-0385-bbbf-2f13a79e4b72",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+10191-41-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "42b2af5f-e421-8a40-c625-734565e419f6",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=10191-41-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ac90b5a3-d650-b96c-9913-a8360451d807",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "17cba186-0ce2-4b93-8bc9-8f5bbe26a164",
          "citation": "11.2",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5f39e70d-f106-40b2-aaed-f2a95dc139c6",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "057b1935-e1e5-8799-9ee1-6261f0e1ca3e",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "99d1dcd5-8f87-3628-348a-a0f88bd14372",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "9ec36a80-34f1-1e59-fae0-83df1e4ffe32",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1033ba4c-3012-4d8a-808b-e2319789179e",
          "id": "1033ba4c-3012-4d8a-808b-e2319789179e",
          "molfile": "\n  Marvin  01132101042D          \n\n 31 32  0  0  0  0            999 V2000\n   10.1212   -1.2297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4172   -1.6343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4172   -2.4697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6879   -1.2297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9942   -1.6343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2649   -1.2297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5609   -1.6343    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    6.5583   -2.4440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8419   -1.2297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1379   -1.6343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4184   -1.2297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7149   -1.6343    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    3.7123   -2.4440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9954   -1.2297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2919   -1.6343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5725   -1.2297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8690   -1.6343    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    0.8664   -0.9050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8690   -2.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1366   -2.8795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5540   -2.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2864   -2.8795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2864   -3.6917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9904   -2.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7093   -2.8795    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9904   -1.6343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7093   -1.2297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2864   -1.2297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2864   -0.4020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5540   -1.6343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1366   -1.2297    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 17 31  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 21  1  0  0  0  0\n 21 30  2  0  0  0  0\n 23 22  1  0  0  0  0\n 24 22  2  0  0  0  0\n 25 24  1  0  0  0  0\n 24 26  1  0  0  0  0\n 27 26  1  0  0  0  0\n 26 28  2  0  0  0  0\n 29 28  1  0  0  0  0\n 28 30  1  0  0  0  0\n 31 30  1  0  0  0  0\nM  END",
          "smiles": "CC(C)CCCC(C)CCCC(C)CCCC1(C)CCc2c(C)c(c(C)c(C)c2O1)O",
          "formula": "C29H50O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c3ba8044-2d3b-484c-9645-e3358575d580"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "430.7072",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f8483c15-c651-47ad-ae24-f0472b11af2a",
      "version": "19",
      "structure": {
        "id": "5ac51901-f7c4-42b2-ac67-9512ae5dd7fd",
        "molfile": "\n  Marvin  01132104422D          \n\n 31 32  0  0  0  0            999 V2000\n   11.0031   -3.6575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0031   -4.4979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2709   -3.2529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5672   -4.4979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2709   -4.9025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5672   -3.6575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6937   -3.2529    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6937   -4.9025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4259   -3.6575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4259   -4.4979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8482   -4.9025    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2709   -2.4254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2709   -5.7145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8482   -3.2529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1295   -3.2529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8486   -3.6575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.5501   -3.6575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6942   -3.6575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.2436   -3.2529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9750   -3.2529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3980   -3.2529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5522   -3.2529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.8208   -3.2529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.1170   -3.6575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2714   -3.6575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.9729   -3.6575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.6767   -3.2529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.9729   -4.4927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4233   -2.9282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2688   -4.4670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.1144   -4.4670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  1  1  0  0  0  0\n  4  6  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  3  2  0  0  0  0\n  7  1  1  0  0  0  0\n  8  2  1  0  0  0  0\n  9  7  1  0  0  0  0\n 10  8  1  0  0  0  0\n 11  4  1  0  0  0  0\n 12  3  1  0  0  0  0\n 13  5  1  0  0  0  0\n 14  6  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 23  1  0  0  0  0\n 18 20  1  0  0  0  0\n 19 17  1  0  0  0  0\n 20 25  1  0  0  0  0\n 21 18  1  0  0  0  0\n 22 16  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 21  1  0  0  0  0\n 25 22  1  0  0  0  0\n 26 19  1  0  0  0  0\n 27 26  1  0  0  0  0\n 28 26  1  0  0  0  0\n  9 15  1  0  0  0  0\n  4  5  2  0  0  0  0\n  9 29  1  0  0  0  0\n  9 10  1  0  0  0  0\n 25 30  1  0  0  0  0\n 24 31  1  0  0  0  0\nM  END",
        "smiles": "CC(C)CCCC(C)CCCC(C)CCCC1(C)CCc2c(C)c(c(C)c(C)c2O1)O",
        "formula": "C29H50O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "430.7072",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "a3f5dd1b-1249-4b2e-8e2d-36ee5d45ffda",
          "9148bcd4-20a4-4e1c-9b27-64ea5c5f8c87"
        ],
        "stereo_centers": 3
      },
      "unii": "7QWA1RIO01"
    }
  ]
}