{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "23318e96-5954-435e-93d8-e5e678c3ca3e",
          "code": "C05CA03",
          "comments": "ATC|CARDIOVASCULAR SYSTEM|VASOPROTECTIVES|CAPILLARY STABILIZING AGENTS|Bioflavonoids|diosmin",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=C05CA03&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "c70659b3-9213-41d5-8add-3796eb813240"
          ]
        },
        {
          "uuid": "2da32e41-6204-492a-a0ff-66a33e9820a9",
          "code": "QC05CA53",
          "comments": "VATC|VASOPROTECTIVES|CAPILLARY STABILIZING AGENTS|Bioflavonoids|diosmin, combinations",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QC05CA53&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "c70659b3-9213-41d5-8add-3796eb813240"
          ]
        },
        {
          "uuid": "cf15304e-82b1-4973-a282-0423b1bbcb80",
          "code": "QC05CA03",
          "comments": "VATC|VASOPROTECTIVES|CAPILLARY STABILIZING AGENTS|Bioflavonoids|diosmin",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QC05CA03&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "c70659b3-9213-41d5-8add-3796eb813240"
          ]
        },
        {
          "uuid": "fb303f44-ad9d-4d05-8937-3ddd4b0a19dd",
          "code": "520-27-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=520-27-4",
          "code_system": "CAS",
          "references": [
            "c70659b3-9213-41d5-8add-3796eb813240",
            "938c3f21-833b-484d-be7d-ca13b6a01104"
          ]
        },
        {
          "uuid": "d0295333-3b57-4c71-9702-e89d12a2daf0",
          "code": "C81663",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C81663",
          "code_system": "NCI_THESAURUS",
          "references": [
            "c70659b3-9213-41d5-8add-3796eb813240"
          ]
        },
        {
          "uuid": "3cfdc88f-c881-4cc5-b68b-551ece1da513",
          "code": "D004145",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68004145",
          "code_system": "MESH",
          "references": [
            "c70659b3-9213-41d5-8add-3796eb813240"
          ]
        },
        {
          "uuid": "f936154d-a1d1-4356-bd3c-e932d6129cdc",
          "code": "DIOSMIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Diosmin",
          "code_system": "WIKIPEDIA",
          "references": [
            "c70659b3-9213-41d5-8add-3796eb813240"
          ]
        },
        {
          "uuid": "955a6801-fab1-4089-87fc-60a24b802e9c",
          "code": "C05CA53",
          "comments": "ATC|CARDIOVASCULAR SYSTEM|VASOPROTECTIVES|CAPILLARY STABILIZING AGENTS|Bioflavonoids|diosmin, combinations",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=C05CA53&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "c70659b3-9213-41d5-8add-3796eb813240"
          ]
        },
        {
          "uuid": "cb2f03ab-a233-486c-9cb2-c4541a0df64d",
          "code": "SUB07198MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "c70659b3-9213-41d5-8add-3796eb813240"
          ]
        },
        {
          "uuid": "783e6bc0-fa28-46a7-a2ad-c6d1daae30d5",
          "code": "9000-18-4",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=9000-18-4",
          "code_system": "CAS",
          "references": [
            "c70659b3-9213-41d5-8add-3796eb813240",
            "85ce0c2e-d004-4851-8497-0bb6b8c9a792"
          ]
        },
        {
          "uuid": "d13a66a5-e1ae-4c48-a4b5-5aa1b7556b84",
          "code": "28680-33-3",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=28680-33-3",
          "code_system": "CAS",
          "references": [
            "c70659b3-9213-41d5-8add-3796eb813240",
            "516ad243-6e00-46d5-9d15-4ea064daecfb"
          ]
        },
        {
          "uuid": "0011df4a-f4a1-4763-9253-bbe97917abbd",
          "code": "4370",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=4370",
          "code_system": "INN",
          "references": [
            "c70659b3-9213-41d5-8add-3796eb813240"
          ]
        },
        {
          "uuid": "49b6695d-3c27-4507-9337-b6519cc7788c",
          "code": "3489",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/3489/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "c70659b3-9213-41d5-8add-3796eb813240"
          ]
        },
        {
          "uuid": "f530028a-803a-4844-b47c-ac02b5d01642",
          "code": "m4595",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4595?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "c70659b3-9213-41d5-8add-3796eb813240"
          ]
        },
        {
          "uuid": "2e8b2b5f-e7c9-428e-9b30-540ddf97aa0a",
          "code": "DB08995",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB08995",
          "code_system": "DRUG BANK",
          "references": [
            "c70659b3-9213-41d5-8add-3796eb813240"
          ]
        },
        {
          "uuid": "53968d5d-fdf4-4f6c-a545-b65fdea576d0",
          "code": "CHEMBL231884",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL231884",
          "code_system": "ChEMBL",
          "references": [
            "c70659b3-9213-41d5-8add-3796eb813240"
          ]
        },
        {
          "uuid": "c9c94cd2-c0d3-4e63-ad02-dc5f74bfb137",
          "code": "208-289-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.007.537",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "c70659b3-9213-41d5-8add-3796eb813240"
          ]
        },
        {
          "uuid": "731dbe39-fbd9-4fad-8479-41f20596c87c",
          "code": "5281613",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5281613",
          "code_system": "PUBCHEM",
          "references": [
            "c70659b3-9213-41d5-8add-3796eb813240"
          ]
        },
        {
          "uuid": "95204dd5-7d73-566b-a9d7-f9835391b190",
          "code": "DTXSID4045892",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4045892",
          "code_system": "EPA CompTox",
          "references": [
            "1b9ea743-b4c1-7e84-873b-707871b91dd6"
          ]
        },
        {
          "uuid": "d38649b6-9534-edf1-dba3-288a618e1499",
          "code": "582417",
          "comments": "ORPHAN DRUG|Designated|Treatment of systemic sclerosis",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=582417",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "fd0271b3-8b3d-1034-03da-b84d3a2f0e9f",
          "code": "C306",
          "comments": "Pharmacologic Substance[C1909]|Protective Agent[C26170]|Antioxidant[C275]|Bioflavonoid",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C306",
          "code_system": "NCI_THESAURUS",
          "references": [
            "be11fdbd-c0fd-78ee-4d43-2a43d0b29d4b"
          ]
        },
        {
          "uuid": "4c8690dd-5392-40d3-b8ae-c4b50784c951",
          "code": "7QM776WJ5N",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d3c4709e-dc6f-60d9-d9a7-9be3ea6d033c",
          "code": "3157",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3157",
          "code_system": "DRUG CENTRAL",
          "references": [
            "be11fdbd-c0fd-78ee-4d43-2a43d0b29d4b"
          ]
        },
        {
          "uuid": "223b21f5-83bc-a1ca-64ed-7f727eb763cd",
          "code": "226 (Number of products:24)",
          "comments": "Dietary Supplement Label Database|Botanical|Diosmin",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=226&item=Diosmin",
          "code_system": "DSLD",
          "references": [
            "be11fdbd-c0fd-78ee-4d43-2a43d0b29d4b"
          ]
        },
        {
          "uuid": "4710aa39-621b-133f-a2e9-58ea74b4fe30",
          "code": "1394 (Number of products:104)",
          "comments": "Dietary Supplement Label Database|Botanical|Flavonoid",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=1394&item=Flavonoid",
          "code_system": "DSLD",
          "references": [
            "be11fdbd-c0fd-78ee-4d43-2a43d0b29d4b"
          ]
        },
        {
          "uuid": "3f0a8ce7-3cf1-97ec-f995-7e4622a2d462",
          "code": "4631",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:4631",
          "code_system": "CHEBI",
          "references": [
            "be11fdbd-c0fd-78ee-4d43-2a43d0b29d4b"
          ]
        },
        {
          "uuid": "d3fc9e94-a4fa-cb05-a144-129576f5a3b3",
          "code": "1213318",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1213318",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "be11fdbd-c0fd-78ee-4d43-2a43d0b29d4b"
          ]
        },
        {
          "uuid": "497b819c-178f-3c38-dabc-e2022a74690b",
          "code": "100000092048",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "738636d0-a73b-348c-6ea2-b67384642386"
          ]
        },
        {
          "uuid": "0f628fac-bc83-edcb-1b45-5e8c80faa91c",
          "code": "7QM776WJ5N",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=7QM776WJ5N",
          "code_system": "DAILYMED",
          "references": [
            "dc339003-5e8f-56b7-977c-e0328bd04ec5"
          ]
        },
        {
          "uuid": "c0219266-8e26-c9cb-f7fc-7bf9f294d338",
          "code": "758417",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=758417",
          "code_system": "NSC",
          "references": [
            "d51c3f86-a14e-7cba-2b1d-34229fdcdb9b"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "916ed7a7-d817-451e-9a63-de321d8b2659",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "10ee01aa-563a-477d-b8aa-d9ffb9e7e2f3",
            "refuuid": "22ad8423-31b3-479b-9e46-5d5391878816",
            "name": "Diosmin",
            "unii": "7QM776WJ5N",
            "linking_id": "7QM776WJ5N",
            "ref_pname": "Diosmin",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ab45c74a-a5e1-4cda-9897-2d88fffc5bd5",
          "type": "PARENT->CONSTITUENT ALWAYS PRESENT",
          "references": [
            "34c97437-4c21-49c6-b0d0-d83c44a99104"
          ],
          "related_substance": {
            "uuid": "93912955-ed3a-4e60-b5f5-e2ee4d976983",
            "refuuid": "c1f4d2fb-83bd-4a8f-be47-30fdebaba6a8",
            "name": "AGATHOSMA BETULINA LEAF",
            "unii": "369DDH39Z0",
            "linking_id": "369DDH39Z0",
            "ref_pname": "AGATHOSMA BETULINA LEAF",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "8b9b2584-101b-4db4-8d09-398232d27111",
          "comments": "NMT 3%",
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "references": [
            "cab1721b-b578-4be6-8a6b-a1843614376a"
          ],
          "related_substance": {
            "uuid": "7da06ce6-83dd-4634-8fe0-f48464b724c2",
            "refuuid": "c7499481-4d9e-4587-a3b1-a93bfd5de6fc",
            "name": "DIOSMETIN",
            "unii": "TWZ37241OT",
            "linking_id": "TWZ37241OT",
            "ref_pname": "DIOSMETIN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "bb3ea2be-9c03-404e-ae68-527d55157669",
          "comments": "NMT 1%",
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "references": [
            "cab1721b-b578-4be6-8a6b-a1843614376a"
          ],
          "related_substance": {
            "uuid": "a209715a-4a75-462a-adc2-2a6664180040",
            "refuuid": "7752c454-1b10-4c7f-9219-50016c22dcc7",
            "name": "3-HYDROXY-4-METHOXYACETOPHENONE",
            "unii": "286G943O33",
            "linking_id": "286G943O33",
            "ref_pname": "3-HYDROXY-4-METHOXYACETOPHENONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "bfcde28f-432e-4a17-af2d-82e7a8da615b",
          "comments": "NMT 5%",
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "references": [
            "cab1721b-b578-4be6-8a6b-a1843614376a"
          ],
          "related_substance": {
            "uuid": "00fe64c1-d1c3-4e09-9cad-6760c7c1063f",
            "refuuid": "507c5427-c8fd-4863-a97c-f681a3a5614c",
            "name": "HESPERIDIN",
            "unii": "E750O06Y6O",
            "linking_id": "E750O06Y6O",
            "ref_pname": "HESPERIDIN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "79fc685e-7e69-4696-8e10-0ff89f5e7d27",
          "comments": "NMT 3%",
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "references": [
            "cab1721b-b578-4be6-8a6b-a1843614376a"
          ],
          "related_substance": {
            "uuid": "5aaa221d-e044-4ee0-aca4-68fc2bdf8727",
            "refuuid": "c2d94778-cfae-41db-b865-042fb4c939eb",
            "name": "LINARIN",
            "unii": "HBH2I685IU",
            "linking_id": "HBH2I685IU",
            "ref_pname": "LINARIN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "4ce7ef21-d654-4d6e-a592-4c439597e9ed",
          "comments": "NMT 3%",
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "references": [
            "cab1721b-b578-4be6-8a6b-a1843614376a"
          ],
          "related_substance": {
            "uuid": "5ca6d254-b5d4-42c5-8862-7c6f939f3397",
            "refuuid": "684408f2-ef76-47b0-82d7-25144aa0ac44",
            "name": "ISORHOIFOLIN",
            "unii": "0B66T65281",
            "linking_id": "0B66T65281",
            "ref_pname": "ISORHOIFOLIN",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "8e8ef272-187c-4e62-bcf4-9cb8b3a9ce34",
          "name": "7-((6-O-(6-DEOXY-GA-L-MANNOPYRANOSYL)-.BETA.-D-GLUCOPYRANOSYL)OXY)-5-HYDROXY-2-(3-HYDROXY-4-METHOXYPHENYL)-4H-1-BENZOPYRAN-4-ONE",
          "stdName": "7-((6-O-(6-DEOXY-GA-L-MANNOPYRANOSYL)-.BETA.-D-GLUCOPYRANOSYL)OXY)-5-HYDROXY-2-(3-HYDROXY-4-METHOXYPHENYL)-4H-1-BENZOPYRAN-4-ONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "434a972d-7d10-40ff-8b6d-be1025b9e320",
            "6d56f8b7-054c-426a-88f9-010fc580f3ed"
          ],
          "display_name": false
        },
        {
          "uuid": "fab05644-42e7-4794-b5ab-86d6fe12a629",
          "name": "BAROSMIN",
          "stdName": "BAROSMIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3faeb874-a713-4caf-bd74-56c7e78fbcd0",
            "6d56f8b7-054c-426a-88f9-010fc580f3ed"
          ],
          "display_name": false
        },
        {
          "uuid": "784b6338-2cf6-477f-b907-846b538d9896",
          "name": "BUCHU RESIN",
          "stdName": "BUCHU RESIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3faeb874-a713-4caf-bd74-56c7e78fbcd0",
            "6d56f8b7-054c-426a-88f9-010fc580f3ed"
          ],
          "display_name": false
        },
        {
          "uuid": "b66001e4-753d-4fd6-959a-acdf1410a957",
          "name": "DAFLON",
          "stdName": "DAFLON",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dba63c5f-3522-493b-aa5a-261292fffa10",
            "49644154-3cc9-4fc1-9ee5-6a17ee520ace"
          ],
          "display_name": false
        },
        {
          "uuid": "89e1b49f-92bf-4bbd-b5cd-edf2ea04d973",
          "name": "DIOSMETIN 7-RUTINOSIDE",
          "stdName": "DIOSMETIN 7-RUTINOSIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3faeb874-a713-4caf-bd74-56c7e78fbcd0",
            "6d56f8b7-054c-426a-88f9-010fc580f3ed"
          ],
          "display_name": false
        },
        {
          "uuid": "10dda962-478a-42fb-806b-ca4afc51f556",
          "name": "DIOSMIN [DSC]",
          "stdName": "DIOSMIN [DSC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2ea8a2da-e437-40ea-8164-09a750bb8306",
            "6d56f8b7-054c-426a-88f9-010fc580f3ed"
          ],
          "display_name": false
        },
        {
          "uuid": "0e43b3f5-bacf-9b95-b2a4-0a0da3e0d9e8",
          "name": "DIOSMIN [EP MONOGRAPH]",
          "stdName": "DIOSMIN [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30ffc0a5-7325-8370-2af6-2e5871da3468"
          ],
          "display_name": false
        },
        {
          "uuid": "7ac3e61e-a726-4f7d-a17b-e349047a6c4d",
          "name": "DIOSMIN [MART.]",
          "stdName": "DIOSMIN [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "caccb596-cea5-45ac-b679-69f786eb210d"
          ],
          "display_name": false
        },
        {
          "uuid": "d295ae2b-3f7d-4f07-af9a-b2f7744141d6",
          "name": "DIOSMIN [MI]",
          "stdName": "DIOSMIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6d56f8b7-054c-426a-88f9-010fc580f3ed",
            "abaf923b-211e-4d99-9cb8-b194528b876e"
          ],
          "display_name": false
        },
        {
          "uuid": "820f489b-d658-49dd-93b1-3a344851c08f",
          "name": "DIOSMIN [USP-RS]",
          "stdName": "DIOSMIN [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6d56f8b7-054c-426a-88f9-010fc580f3ed",
            "a2ca61b0-2f7c-46b8-b441-19a28a5805fb"
          ],
          "display_name": false
        },
        {
          "uuid": "c98d5dad-d104-4a33-bd90-88807ef017d6",
          "name": "DIOSMINE",
          "stdName": "DIOSMINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "20dd6795-c3ed-417f-ba10-1e88e3fb59ce",
            "2881a2f9-735a-4690-b705-318d80312a0a",
            "6d56f8b7-054c-426a-88f9-010fc580f3ed",
            "6c061713-f42f-4e8b-ac6a-e8fe36a660cb",
            "b7d6c654-0714-4f9c-be26-725fffb0bd5d"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "5fc297ad-ae28-4018-95fc-fdbfd1b25c77",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "247c599e-1960-40fe-981e-9624fa82794a",
          "name": "DIOSVEN",
          "stdName": "DIOSVEN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3faeb874-a713-4caf-bd74-56c7e78fbcd0",
            "6d56f8b7-054c-426a-88f9-010fc580f3ed"
          ],
          "display_name": false
        },
        {
          "uuid": "86fd830b-5ae0-47e8-8ae5-36d689b74117",
          "name": "DIOVEN",
          "stdName": "DIOVEN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3faeb874-a713-4caf-bd74-56c7e78fbcd0",
            "6d56f8b7-054c-426a-88f9-010fc580f3ed"
          ],
          "display_name": false
        },
        {
          "uuid": "72b871c6-3583-485d-8a1c-dbd8f5f678af",
          "name": "DIOVENOR",
          "stdName": "DIOVENOR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3faeb874-a713-4caf-bd74-56c7e78fbcd0",
            "6d56f8b7-054c-426a-88f9-010fc580f3ed"
          ],
          "display_name": false
        },
        {
          "uuid": "cd70c50d-1764-4af1-906d-b8a1d571c30f",
          "name": "Diosmin",
          "stdName": "DIOSMIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "45dc43ad-214a-4369-9669-50c6d0e65f03",
            "3522df8b-016b-43cd-b502-772a4aabf312",
            "dd27fb8b-80ea-4bb9-a7fa-a06a62d804d3",
            "3af85287-5b76-41a6-a185-0aa7151e0431",
            "aa0167c3-cabd-407a-8fd3-62c6074572d8",
            "434a972d-7d10-40ff-8b6d-be1025b9e320",
            "e4a3d7c5-852c-41db-89db-bc1da9e2f2e3",
            "60788c9b-40d9-4ed4-8caf-832b77d93ec1",
            "bd49da2f-6405-492e-bfe1-19e620dc390e",
            "2ea8a2da-e437-40ea-8164-09a750bb8306",
            "a75052a0-4d9b-414c-98cf-8feb2ee82474",
            "57de9f67-d981-458a-90bf-5360386e6c89",
            "6d56f8b7-054c-426a-88f9-010fc580f3ed",
            "caccb596-cea5-45ac-b679-69f786eb210d",
            "abaf923b-211e-4d99-9cb8-b194528b876e",
            "a2ca61b0-2f7c-46b8-b441-19a28a5805fb"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "af82256b-75d9-480e-83b7-09722a4aacda",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "52ce898a-8ee0-7a86-df5a-6be79e5a3c42",
          "name": "Diosmin [WHO-DD]",
          "stdName": "DIOSMIN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7da62c1b-119a-57a6-56ee-95f9fb530421"
          ],
          "display_name": false
        },
        {
          "uuid": "5a1eb424-b0c9-5222-9360-a290775e5506",
          "name": "FLEBAVEN",
          "stdName": "FLEBAVEN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1b9ea743-b4c1-7e84-873b-707871b91dd6"
          ],
          "display_name": false
        },
        {
          "uuid": "59f5a4fd-1286-ef0b-9986-ef49ed9b5e0e",
          "name": "FLEBAVENA",
          "stdName": "FLEBAVENA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1b9ea743-b4c1-7e84-873b-707871b91dd6"
          ],
          "display_name": false
        },
        {
          "uuid": "a98802cd-79a0-4919-a0a1-3f35fefd6266",
          "name": "FLEBOSMIL",
          "stdName": "FLEBOSMIL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3faeb874-a713-4caf-bd74-56c7e78fbcd0",
            "6d56f8b7-054c-426a-88f9-010fc580f3ed"
          ],
          "display_name": false
        },
        {
          "uuid": "b3208ad7-f3a2-4883-8ac7-2f1226281926",
          "name": "FLEBOSTEN",
          "stdName": "FLEBOSTEN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3faeb874-a713-4caf-bd74-56c7e78fbcd0",
            "6d56f8b7-054c-426a-88f9-010fc580f3ed"
          ],
          "display_name": false
        },
        {
          "uuid": "3d4be9c0-25e8-40f2-9c5a-6d6afe802c7a",
          "name": "HEMERVEN",
          "stdName": "HEMERVEN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3faeb874-a713-4caf-bd74-56c7e78fbcd0",
            "6d56f8b7-054c-426a-88f9-010fc580f3ed"
          ],
          "display_name": false
        },
        {
          "uuid": "6da51448-21f7-4079-a58c-8eadbbcf744a",
          "name": "INSUVEN",
          "stdName": "INSUVEN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3faeb874-a713-4caf-bd74-56c7e78fbcd0",
            "6d56f8b7-054c-426a-88f9-010fc580f3ed"
          ],
          "display_name": false
        },
        {
          "uuid": "a8f4dd55-1343-4204-a640-7501102f276d",
          "name": "LITOSMIL",
          "stdName": "LITOSMIL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3faeb874-a713-4caf-bd74-56c7e78fbcd0",
            "6d56f8b7-054c-426a-88f9-010fc580f3ed"
          ],
          "display_name": false
        },
        {
          "uuid": "b756efd7-71cd-12e9-ca39-68392a190deb",
          "name": "NSC-758417",
          "stdName": "NSC-758417",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d51c3f86-a14e-7cba-2b1d-34229fdcdb9b"
          ],
          "display_name": false
        },
        {
          "uuid": "89919f97-3073-4d57-8a6b-4fdab2483fb4",
          "name": "TOVENE",
          "stdName": "TOVENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3faeb874-a713-4caf-bd74-56c7e78fbcd0",
            "6d56f8b7-054c-426a-88f9-010fc580f3ed"
          ],
          "display_name": false
        },
        {
          "uuid": "0d8bbd31-51b7-4468-af2b-fe8f462127ff",
          "name": "VARINON",
          "stdName": "VARINON",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3faeb874-a713-4caf-bd74-56c7e78fbcd0",
            "6d56f8b7-054c-426a-88f9-010fc580f3ed"
          ],
          "display_name": false
        },
        {
          "uuid": "6257dd13-e295-4d30-bbc8-cf8c3ac64d0c",
          "name": "VEN-DETREX",
          "stdName": "VEN-DETREX",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3faeb874-a713-4caf-bd74-56c7e78fbcd0",
            "6d56f8b7-054c-426a-88f9-010fc580f3ed"
          ],
          "display_name": false
        },
        {
          "uuid": "9f167d44-eb8d-48d1-b822-41792f8a7374",
          "name": "VENOSMINE",
          "stdName": "VENOSMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3faeb874-a713-4caf-bd74-56c7e78fbcd0",
            "6d56f8b7-054c-426a-88f9-010fc580f3ed"
          ],
          "display_name": false
        },
        {
          "uuid": "cfe31393-86a0-4bd0-93da-e6c8f30a6dd2",
          "name": "diosmin [INN]",
          "stdName": "DIOSMIN [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e4a3d7c5-852c-41db-89db-bc1da9e2f2e3",
            "73f2388d-878f-494f-88f5-0c41fb341d38"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "20dd6795-c3ed-417f-ba10-1e88e3fb59ce",
          "citation": "http://www.chemicalregister.com/Diosmine/Suppliers/pid19751.htm",
          "url": "http://www.chemicalregister.com/Diosmine/Suppliers/pid19751.htm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2881a2f9-735a-4690-b705-318d80312a0a",
          "citation": "DMF 17084",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "434a972d-7d10-40ff-8b6d-be1025b9e320",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6d56f8b7-054c-426a-88f9-010fc580f3ed",
          "citation": "INN",
          "doc_type": "INN",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e4a3d7c5-852c-41db-89db-bc1da9e2f2e3",
          "citation": "INN 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dd27fb8b-80ea-4bb9-a7fa-a06a62d804d3",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "caccb596-cea5-45ac-b679-69f786eb210d",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "abaf923b-211e-4d99-9cb8-b194528b876e",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dba63c5f-3522-493b-aa5a-261292fffa10",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "49644154-3cc9-4fc1-9ee5-6a17ee520ace",
          "citation": "D07858",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b7d6c654-0714-4f9c-be26-725fffb0bd5d",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a2ca61b0-2f7c-46b8-b441-19a28a5805fb",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "60788c9b-40d9-4ed4-8caf-832b77d93ec1",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3faeb874-a713-4caf-bd74-56c7e78fbcd0",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2ea8a2da-e437-40ea-8164-09a750bb8306",
          "citation": "USP-DSC, VOL.2, 2015",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c70659b3-9213-41d5-8add-3796eb813240",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390150000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "34c97437-4c21-49c6-b0d0-d83c44a99104",
          "citation": "HERBAL MEDICINES 4TH ED 2013",
          "doc_type": "BOOK",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cab1721b-b578-4be6-8a6b-a1843614376a",
          "citation": "USP-DSC, VOL.2, 2015",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d1b6b2f0-c9a1-4f62-9a34-295e65efd03d",
          "citation": "SRS import [7QM776WJ5N]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7QM776WJ5N",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390150000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aa0167c3-cabd-407a-8fd3-62c6074572d8",
          "citation": "DIOSMIN [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bd49da2f-6405-492e-bfe1-19e620dc390e",
          "citation": "DIOSMIN [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "45dc43ad-214a-4369-9669-50c6d0e65f03",
          "citation": "DIOSMIN [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "57de9f67-d981-458a-90bf-5360386e6c89",
          "citation": "DIOSMIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6c061713-f42f-4e8b-ac6a-e8fe36a660cb",
          "citation": "DIOSMINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3522df8b-016b-43cd-b502-772a4aabf312",
          "citation": "DIOSMIN [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3af85287-5b76-41a6-a185-0aa7151e0431",
          "citation": "DIOSMIN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a75052a0-4d9b-414c-98cf-8feb2ee82474",
          "citation": "DIOSMIN [DSC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1b9ea743-b4c1-7e84-873b-707871b91dd6",
          "citation": "http://apps.who.int/trialsearch/Trial2.aspx?TrialID=EUCTR2017-004804-23-SI",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=520-27-4",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "738636d0-a73b-348c-6ea2-b67384642386",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "be11fdbd-c0fd-78ee-4d43-2a43d0b29d4b",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "73f2388d-878f-494f-88f5-0c41fb341d38",
          "citation": "INN Proposed List 38",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL38.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "516ad243-6e00-46d5-9d15-4ea064daecfb",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "85ce0c2e-d004-4851-8497-0bb6b8c9a792",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "938c3f21-833b-484d-be7d-ca13b6a01104",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d51c3f86-a14e-7cba-2b1d-34229fdcdb9b",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "30ffc0a5-7325-8370-2af6-2e5871da3468",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "dc339003-5e8f-56b7-977c-e0328bd04ec5",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "7da62c1b-119a-57a6-56ee-95f9fb530421",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "97c57e99-e509-4c8c-9fc8-c965edba2705",
          "id": "97c57e99-e509-4c8c-9fc8-c965edba2705",
          "molfile": "\n  Marvin  01132107532D          \n\n 43 47  0  0  1  0            999 V2000\n    2.9241   -2.8356    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    3.3418   -2.1230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3286   -3.5473    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9073   -4.2644    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    3.3173   -4.9840    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1452   -4.9840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5570   -5.7009    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.3804   -5.7009    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7954   -6.4146    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.6187   -6.4146    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3323   -6.8341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3323   -7.6622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0446   -8.0785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0446   -8.8973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7615   -7.6622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7615   -6.8389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0446   -6.4225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4739   -6.4134    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1908   -6.8389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1908   -7.6668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4739   -8.0739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4739   -8.8973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9032   -6.4225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9032   -5.5945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6201   -5.1829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3326   -5.5945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0541   -5.1783    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7738   -5.5898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3326   -6.4272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0494   -6.8389    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6109   -6.8389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3804   -7.1256    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.7944   -7.8383    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5570   -7.1256    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    4.1457   -7.8399    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1440   -6.4146    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    3.3206   -6.4146    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0905   -4.2644    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    1.6750   -4.9744    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6835   -3.5390    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    0.8555   -3.5390    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1003   -2.8356    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    1.6900   -2.1114    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n 42  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  1  0  0  0\n 38  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  1  0  0  0\n  7  8  1  0  0  0  0\n 36  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  1  0  0  0\n 32  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 17 11  2  0  0  0  0\n 12 13  2  0  0  0  0\n 14 13  1  0  0  0  0\n 13 15  1  0  0  0  0\n 16 15  2  0  0  0  0\n 15 21  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 16  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 23 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  2  0  0  0  0\n 24 23  1  0  0  0  0\n 31 23  2  0  0  0  0\n 25 24  2  0  0  0  0\n 26 25  1  0  0  0  0\n 27 26  1  0  0  0  0\n 26 29  2  0  0  0  0\n 27 28  1  0  0  0  0\n 30 29  1  0  0  0  0\n 29 31  1  0  0  0  0\n 32 33  1  6  0  0  0\n 32 34  1  0  0  0  0\n 34 35  1  1  0  0  0\n 34 36  1  0  0  0  0\n 36 37  1  6  0  0  0\n 38 39  1  6  0  0  0\n 38 40  1  0  0  0  0\n 40 41  1  6  0  0  0\n 40 42  1  0  0  0  0\n 42 43  1  1  0  0  0\nM  END",
          "smiles": "C[C@H]1[C@@H]([C@H]([C@H]([C@H](OC[C@@H]2[C@H]([C@@H]([C@H]([C@H](Oc3cc(c4c(=O)cc(-c5ccc(c(c5)O)OC)oc4c3)O)O2)O)O)O)O1)O)O)O",
          "formula": "C28H32O15",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f1866d8a-8633-4d09-8e73-0ce1ee69ebff"
          },
          "defined_stereo": 10,
          "ez_centers": 0,
          "molecular_weight": "608.5458",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 10
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "22ad8423-31b3-479b-9e46-5d5391878816",
      "version": "27",
      "structure": {
        "id": "0519ee13-ef99-4e56-b4fd-ee791d0070ec",
        "molfile": "\n  Marvin  01132100342D          \n\n 43 47  0  0  1  0            999 V2000\n    4.5570   -7.1256    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.1457   -7.8399    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3804   -7.1256    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.7944   -7.8383    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7954   -6.4146    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.6187   -6.4146    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3323   -6.8341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3323   -7.6622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0446   -8.0785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0446   -8.8973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7615   -7.6622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4739   -8.0739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1908   -7.6668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1908   -6.8389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4739   -6.4134    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7615   -6.8389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0446   -6.4225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9032   -6.4225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9032   -5.5945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6201   -5.1829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3326   -5.5945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3326   -6.4272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0494   -6.8389    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6109   -6.8389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0541   -5.1783    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7738   -5.5898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4739   -8.8973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3804   -5.7009    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5570   -5.7009    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.1440   -6.4146    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.3206   -6.4146    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1452   -4.9840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3173   -4.9840    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9073   -4.2644    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.3286   -3.5473    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9241   -2.8356    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.1003   -2.8356    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    1.6835   -3.5390    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.0905   -4.2644    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    1.6750   -4.9744    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8555   -3.5390    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6900   -2.1114    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3418   -2.1230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  3  4  1  6  0  0  0\n  3  5  1  0  0  0  0\n  5  6  1  1  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10  9  1  0  0  0  0\n  9 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 11  2  0  0  0  0\n 17 16  1  0  0  0  0\n 17  7  2  0  0  0  0\n 18 14  1  0  0  0  0\n 19 18  2  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  2  0  0  0  0\n 21 22  1  0  0  0  0\n 23 22  1  0  0  0  0\n 22 24  2  0  0  0  0\n 24 18  1  0  0  0  0\n 25 21  1  0  0  0  0\n 25 26  1  0  0  0  0\n 27 12  2  0  0  0  0\n  5 28  1  0  0  0  0\n 28 29  1  0  0  0  0\n 29 30  1  0  0  0  0\n 30 31  1  6  0  0  0\n  1 30  1  0  0  0  0\n 29 32  1  1  0  0  0\n 32 33  1  0  0  0  0\n 34 33  1  1  0  0  0\n 34 35  1  0  0  0  0\n 35 36  1  0  0  0  0\n 36 37  1  0  0  0  0\n 37 38  1  0  0  0  0\n 38 39  1  0  0  0  0\n 34 39  1  0  0  0  0\n 39 40  1  6  0  0  0\n 38 41  1  6  0  0  0\n 37 42  1  1  0  0  0\n 36 43  1  6  0  0  0\nM  END",
        "smiles": "C[C@H]1[C@@H]([C@H]([C@H]([C@H](OC[C@@H]2[C@H]([C@@H]([C@H]([C@H](Oc3cc(c4c(=O)cc(-c5ccc(c(c5)O)OC)oc4c3)O)O2)O)O)O)O1)O)O)O",
        "formula": "C28H32O15",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 10,
        "ez_centers": 0,
        "molecular_weight": "608.5458",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "d1b6b2f0-c9a1-4f62-9a34-295e65efd03d",
          "434a972d-7d10-40ff-8b6d-be1025b9e320",
          "73f2388d-878f-494f-88f5-0c41fb341d38"
        ],
        "stereo_centers": 10
      },
      "unii": "7QM776WJ5N"
    }
  ]
}