{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d6cd283d-68ff-44fa-ba1d-86285e56281f",
          "code": "B01AA01",
          "comments": "ATC|BLOOD AND BLOOD FORMING ORGANS|ANTITHROMBOTIC AGENTS|ANTITHROMBOTIC AGENTS|Vitamin K antagonists|dicoumarol",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=B01AA01&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "f43fd871-3fb7-41fa-a61c-a060f9355cac"
          ]
        },
        {
          "uuid": "c3b95487-dd00-49ea-af61-ab4b386b77a5",
          "code": "QB01AA01",
          "comments": "VATC|ANTITHROMBOTIC AGENTS|ANTITHROMBOTIC AGENTS|Vitamin K antagonists|dicoumarol",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QB01AA01&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "f43fd871-3fb7-41fa-a61c-a060f9355cac"
          ]
        },
        {
          "uuid": "ca356bde-8487-464f-b866-c6b129f46643",
          "code": "66-76-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=66-76-2",
          "code_system": "CAS",
          "references": [
            "f43fd871-3fb7-41fa-a61c-a060f9355cac",
            "ca24cd42-06e2-44b5-810c-4960111dcda3"
          ]
        },
        {
          "uuid": "c8867538-db8a-4f2d-8e6f-2319264d8c03",
          "code": "C310",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C310",
          "code_system": "NCI_THESAURUS",
          "references": [
            "f43fd871-3fb7-41fa-a61c-a060f9355cac"
          ]
        },
        {
          "uuid": "3cb1163f-fd16-451d-90eb-0a752b3f632f",
          "code": "D001728",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68001728",
          "code_system": "MESH",
          "references": [
            "f43fd871-3fb7-41fa-a61c-a060f9355cac"
          ]
        },
        {
          "uuid": "248fa487-458b-4c27-acb3-f770c15de721",
          "code": "DICOUMAROL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Dicoumarol",
          "code_system": "WIKIPEDIA",
          "references": [
            "f43fd871-3fb7-41fa-a61c-a060f9355cac"
          ]
        },
        {
          "uuid": "0cdabe8e-bf0e-4162-8e1d-370124715bc5",
          "code": "SUB07101MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "f43fd871-3fb7-41fa-a61c-a060f9355cac"
          ]
        },
        {
          "uuid": "8a1d7594-eb16-4800-a8ab-91d50107083d",
          "code": "2897",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2897",
          "code_system": "INN",
          "references": [
            "f43fd871-3fb7-41fa-a61c-a060f9355cac"
          ]
        },
        {
          "uuid": "65c0ca42-df9a-488a-915e-79e6a713059a",
          "code": "6808",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=6808",
          "code_system": "IUPHAR",
          "references": [
            "f43fd871-3fb7-41fa-a61c-a060f9355cac"
          ]
        },
        {
          "uuid": "2ea1736d-5c1a-49f7-8b2d-165322080655",
          "code": "DICUMAROL",
          "comments": "Description: A white or creamy white, crystalline powder; odour, characteristic, faint.Solubility: Practically insoluble in water, ethanol (~750 g/l) TS and ether R.Category: Anticoagulant.Storage: Dicoumarol should be kept in a well-closed container, protected from light.Definition: Dicoumarol contains not less than 98.5% and not more than 101.0% of C19H12O6, calculated with reference to the dried substance.",
          "type": "PRIMARY",
          "url": "http://apps.who.int/phint/pdf/b/Jb.6.1.136.pdf",
          "code_system": "WHO INTERNATIONAL PHARMACOPEIA",
          "references": [
            "f43fd871-3fb7-41fa-a61c-a060f9355cac"
          ]
        },
        {
          "uuid": "9c663cbf-7b12-454a-be7f-ea88dfc3d66a",
          "code": "1598",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1598/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "f43fd871-3fb7-41fa-a61c-a060f9355cac"
          ]
        },
        {
          "uuid": "f8e209af-2659-41e8-9826-670ba846a8dc",
          "code": "m4370",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4370?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "f43fd871-3fb7-41fa-a61c-a060f9355cac"
          ]
        },
        {
          "uuid": "1128d4f4-89ff-4288-b367-51690357c04d",
          "code": "DB00266",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00266",
          "code_system": "DRUG BANK",
          "references": [
            "f43fd871-3fb7-41fa-a61c-a060f9355cac"
          ]
        },
        {
          "uuid": "a785723f-0152-4008-89f7-37e20b63a768",
          "code": "CHEMBL1466",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1466",
          "code_system": "ChEMBL",
          "references": [
            "f43fd871-3fb7-41fa-a61c-a060f9355cac"
          ]
        },
        {
          "uuid": "8f6010e0-a374-4f39-ab6a-3df310cdc58f",
          "code": "200-632-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.575",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f43fd871-3fb7-41fa-a61c-a060f9355cac"
          ]
        },
        {
          "uuid": "622c302f-e322-4ec5-af92-b648d3178ff8",
          "code": "54676038",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/54676038",
          "code_system": "PUBCHEM",
          "references": [
            "f43fd871-3fb7-41fa-a61c-a060f9355cac"
          ]
        },
        {
          "uuid": "1fd053f2-07d1-a61c-a789-f320dd1835e7",
          "code": "3223",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3223",
          "code_system": "HSDB",
          "references": [
            "068c6708-3520-037f-400b-e0b18c06af7f"
          ]
        },
        {
          "uuid": "fa07443e-4af4-e0dc-a5a7-426231b2ec16",
          "code": "DTXSID8021729",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8021729",
          "code_system": "EPA CompTox",
          "references": [
            "5d07041b-c14c-3432-cb3c-a2b1c41a3588"
          ]
        },
        {
          "uuid": "d3495428-9172-48d2-541b-86cf9c8b84cd",
          "code": "C263",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Blood or Body Fluid[C78275]|Anticoagulant Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C263",
          "code_system": "NCI_THESAURUS",
          "references": [
            "5f331503-948d-498a-4026-c066a9a29ff0"
          ]
        },
        {
          "uuid": "72655247-183e-d6e9-4b1d-feaa9f9cff73",
          "code": "C45597",
          "comments": "Drug or Chemical by Structure[C1913]|Organic Chemical[C718]|Ring Compound[C1933]|Heterocyclic Compound[C542]|Coumarin Compound",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C45597",
          "code_system": "NCI_THESAURUS",
          "references": [
            "5f331503-948d-498a-4026-c066a9a29ff0"
          ]
        },
        {
          "uuid": "36a1cd4c-4a66-4485-a1bf-25744719a0f6",
          "code": "7QID3E7BG7",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e83c72e2-25c1-e08d-ce98-e87c97a17af7",
          "code": "867",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/867",
          "code_system": "DRUG CENTRAL",
          "references": [
            "5f331503-948d-498a-4026-c066a9a29ff0"
          ]
        },
        {
          "uuid": "27989d17-d1dd-b531-b5e6-bcfdb1312adb",
          "code": "4513",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:4513",
          "code_system": "CHEBI",
          "references": [
            "5f331503-948d-498a-4026-c066a9a29ff0"
          ]
        },
        {
          "uuid": "652c417b-fd7b-0c47-4fed-b07090037928",
          "code": "100000082921",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "72a5687b-8cea-a0a2-6d21-5299e65beb2f"
          ]
        },
        {
          "uuid": "c0885deb-b4c6-b08f-d33c-122dd52b5f6c",
          "code": "41834",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=41834",
          "code_system": "NSC",
          "references": [
            "a7cf346b-f76d-18cb-3c7c-d3f562220cb7"
          ]
        },
        {
          "uuid": "15c71801-ac41-059d-482d-c2fd68d64984",
          "code": "17860",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=17860",
          "code_system": "NSC",
          "references": [
            "a7cf346b-f76d-18cb-3c7c-d3f562220cb7"
          ]
        },
        {
          "uuid": "66b517ad-ea60-085f-a069-ce71487aa96b",
          "code": "dicoumarol",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/dicoumarol.html",
          "code_system": "ALANWOOD",
          "references": [
            "1045eeb1-f0b0-1efc-2179-d6542ba379f8"
          ]
        },
        {
          "uuid": "507e6038-3082-fd33-cdcd-d4390a4576a3",
          "code": "221570",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=221570",
          "code_system": "NSC",
          "references": [
            "a7cf346b-f76d-18cb-3c7c-d3f562220cb7"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "70f6b963-8802-427e-bfdd-9b6218cd9ef1",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "d49bbef3-abd5-41b1-b689-d2eb4fd9de05",
            "refuuid": "78e8d463-9777-41b0-8796-493dddbdc96b",
            "name": "DICUMAROL",
            "unii": "7QID3E7BG7",
            "linking_id": "7QID3E7BG7",
            "ref_pname": "DICUMAROL",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "abc2b316-5dcf-43ef-b363-4a9d2367b0b3",
          "name": "2H-1-BENZOPYRAN-2-ONE), 3,3'-METHYLENEBIS(4-HYDROXY-",
          "stdName": "2H-1-BENZOPYRAN-2-ONE), 3,3'-METHYLENEBIS(4-HYDROXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3099d8f3-9faf-4ec4-9358-60544166bc4a"
          ],
          "display_name": false
        },
        {
          "uuid": "4b3c8821-2a02-4a8c-9afe-c1ff498c1186",
          "name": "3,3'-METHYLENEBIS(4-HYDROXYCOUMARIN)",
          "stdName": "3,3'-METHYLENEBIS(4-HYDROXYCOUMARIN)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3099d8f3-9faf-4ec4-9358-60544166bc4a"
          ],
          "display_name": false
        },
        {
          "uuid": "a2a7671f-ecbf-44ed-9891-0d603651ec26",
          "name": "DICOUMAROL",
          "stdName": "DICOUMAROL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a4e8a65f-4b1a-43ea-893c-5862c05cbd86",
            "d26a9c3a-5932-4d02-b682-88a4738573ef",
            "7e2a81b5-a5ca-43b4-a64f-74b5ca9816e0",
            "372de5b8-b519-4bdd-bc45-b88b125da874",
            "c520064d-3730-480a-bbb6-810526fb516d",
            "8346b5cc-6011-40ac-9ed7-df27aeb0ee86",
            "cd3689c1-5a39-47e8-8e07-a93ccd22742e",
            "8a7111ce-fa3f-445d-a30f-cca782069cdc",
            "dc7f93a9-9c13-477b-a1c3-ecfa03bbab24"
          ],
          "display_name": false,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "00a11d6e-b947-4ca4-b977-1d7e783f9863",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "82e8a3c7-a73d-4fa5-9150-d25096fc8352",
          "name": "DICOUMAROL [MART.]",
          "stdName": "DICOUMAROL [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "372de5b8-b519-4bdd-bc45-b88b125da874"
          ],
          "display_name": false
        },
        {
          "uuid": "5fab379c-d4bd-442a-b790-d8114a38744b",
          "name": "DICOUMAROL [WHO-IP]",
          "stdName": "DICOUMAROL [WHO-IP]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a4e8a65f-4b1a-43ea-893c-5862c05cbd86"
          ],
          "display_name": false
        },
        {
          "uuid": "5f28ab91-94b4-4c09-90ba-8af3f564b980",
          "name": "DICOUMAROLUM [WHO-IP LATIN]",
          "stdName": "DICOUMAROLUM [WHO-IP LATIN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a4e8a65f-4b1a-43ea-893c-5862c05cbd86"
          ],
          "display_name": false
        },
        {
          "uuid": "d10c830c-bc30-4544-ba76-f1ec902d38cd",
          "name": "DICUMAROL",
          "stdName": "DICUMAROL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fcad12a0-8c93-48a1-96ad-fb96b890b3fb",
            "e3b8dc24-95dc-4448-92ac-010fc77be6e2",
            "3f953bdc-3404-4ca3-b28a-2a643c85fb26",
            "c5b57a80-e052-4f22-a6c5-ce7743fcd029",
            "e8165fb6-0320-4d39-8dba-916264ee20cf",
            "932cc1ae-bf0d-49b1-bacd-dc9d2ff6b87b",
            "8522775c-bd36-4243-9aad-50f445ea0657",
            "d453b07a-3223-4d1f-86dc-900fc637b1c7",
            "f7260bf3-b208-4c25-931b-50b006faf833",
            "12deacb6-5c88-4601-8776-b22ff9eeb4c5",
            "7defbbda-babc-4bc9-abd1-9610ae44a2a3",
            "cfba7c06-d611-486e-83e7-8d31d96d5190",
            "00e826a5-1421-4a84-86c7-1b3aaeb05637"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "e812d4a2-8226-4a50-b9c8-675e70f30c80",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "8b9974e9-bf27-49da-bd2b-bbc45b60d6cf",
          "name": "DICUMAROL [HSDB]",
          "stdName": "DICUMAROL [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "932cc1ae-bf0d-49b1-bacd-dc9d2ff6b87b"
          ],
          "display_name": false
        },
        {
          "uuid": "a8e423de-ae4b-41c3-a95d-c2cd5aa687ec",
          "name": "DICUMAROL [MI]",
          "stdName": "DICUMAROL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8522775c-bd36-4243-9aad-50f445ea0657"
          ],
          "display_name": false
        },
        {
          "uuid": "56290aae-2df9-45d6-b6cf-3d2109e62cf1",
          "name": "DICUMAROL [ORANGE BOOK]",
          "stdName": "DICUMAROL [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c5b57a80-e052-4f22-a6c5-ce7743fcd029"
          ],
          "display_name": false
        },
        {
          "uuid": "8417ff65-d38e-4fbd-af08-7a841bbc0037",
          "name": "DICUMAROL [USAN]",
          "stdName": "DICUMAROL [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d453b07a-3223-4d1f-86dc-900fc637b1c7"
          ],
          "display_name": false
        },
        {
          "uuid": "cd575163-e5f0-4d9a-b13f-d6d334fd8226",
          "name": "DICUMAROL [VANDF]",
          "stdName": "DICUMAROL [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3f953bdc-3404-4ca3-b28a-2a643c85fb26"
          ],
          "display_name": false
        },
        {
          "uuid": "ce624bd1-d20c-1968-0933-383ad62c8017",
          "name": "Dicoumarol [WHO-DD]",
          "stdName": "DICOUMAROL [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0f747fbb-e064-39d7-b6b6-adbf85f539c0"
          ],
          "display_name": false
        },
        {
          "uuid": "caa20f9e-5f12-405e-aac8-492bac343e71",
          "name": "NSC-17860",
          "stdName": "NSC-17860",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4736f634-6e06-4a3a-a3e2-599598a9531b"
          ],
          "display_name": false
        },
        {
          "uuid": "a6d05e42-3d93-4338-b3d0-df6bf0d104cf",
          "name": "NSC-221570",
          "stdName": "NSC-221570",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4736f634-6e06-4a3a-a3e2-599598a9531b"
          ],
          "display_name": false
        },
        {
          "uuid": "d4f9a3be-050a-4655-91d3-00fd63c8bbc6",
          "name": "NSC-41834",
          "stdName": "NSC-41834",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4736f634-6e06-4a3a-a3e2-599598a9531b"
          ],
          "display_name": false
        },
        {
          "uuid": "2e1156f6-ebe6-4d79-9847-99227923413a",
          "name": "dicoumarol [INN]",
          "stdName": "DICOUMAROL [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dc7f93a9-9c13-477b-a1c3-ecfa03bbab24",
            "c520064d-3730-480a-bbb6-810526fb516d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f7260bf3-b208-4c25-931b-50b006faf833",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "848a8dbf-3c7a-4ceb-9725-e97970598824",
          "citation": "ACD9.0(USAN 2006)",
          "doc_type": "ACD",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3099d8f3-9faf-4ec4-9358-60544166bc4a",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c520064d-3730-480a-bbb6-810526fb516d",
          "citation": "INN Proposed List 23",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL23.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "dc7f93a9-9c13-477b-a1c3-ecfa03bbab24",
          "citation": "INN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d453b07a-3223-4d1f-86dc-900fc637b1c7",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c5b57a80-e052-4f22-a6c5-ce7743fcd029",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "372de5b8-b519-4bdd-bc45-b88b125da874",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8522775c-bd36-4243-9aad-50f445ea0657",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "932cc1ae-bf0d-49b1-bacd-dc9d2ff6b87b",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cfba7c06-d611-486e-83e7-8d31d96d5190",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8346b5cc-6011-40ac-9ed7-df27aeb0ee86",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3f953bdc-3404-4ca3-b28a-2a643c85fb26",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a4e8a65f-4b1a-43ea-893c-5862c05cbd86",
          "citation": "WHO-IP",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4736f634-6e06-4a3a-a3e2-599598a9531b",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f43fd871-3fb7-41fa-a61c-a060f9355cac",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389685000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "91118821-50e6-4c18-8960-8f7485583c5a",
          "citation": "SRS import [7QID3E7BG7]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7QID3E7BG7",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389685000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7e2a81b5-a5ca-43b4-a64f-74b5ca9816e0",
          "citation": "DICOUMAROL [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7defbbda-babc-4bc9-abd1-9610ae44a2a3",
          "citation": "DICUMAROL [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e8165fb6-0320-4d39-8dba-916264ee20cf",
          "citation": "DICUMAROL [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8a7111ce-fa3f-445d-a30f-cca782069cdc",
          "citation": "DICOUMAROL [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fcad12a0-8c93-48a1-96ad-fb96b890b3fb",
          "citation": "DICUMAROL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e3b8dc24-95dc-4448-92ac-010fc77be6e2",
          "citation": "DICUMAROL [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "00e826a5-1421-4a84-86c7-1b3aaeb05637",
          "citation": "DICUMAROL [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cd3689c1-5a39-47e8-8e07-a93ccd22742e",
          "citation": "DICOUMAROL [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "12deacb6-5c88-4601-8776-b22ff9eeb4c5",
          "citation": "DICUMAROL [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d26a9c3a-5932-4d02-b682-88a4738573ef",
          "citation": "DICOUMAROL [WHO-IP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "068c6708-3520-037f-400b-e0b18c06af7f",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+66-76-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5d07041b-c14c-3432-cb3c-a2b1c41a3588",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=66-76-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "72a5687b-8cea-a0a2-6d21-5299e65beb2f",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "5f331503-948d-498a-4026-c066a9a29ff0",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "ca24cd42-06e2-44b5-810c-4960111dcda3",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "1045eeb1-f0b0-1efc-2179-d6542ba379f8",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "a7cf346b-f76d-18cb-3c7c-d3f562220cb7",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "0f747fbb-e064-39d7-b6b6-adbf85f539c0",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "2b6f989c-162b-4e32-9106-b3c7eaca72c0",
          "id": "2b6f989c-162b-4e32-9106-b3c7eaca72c0",
          "molfile": "\n  Marvin  01132102212D          \n\n 25 28  0  0  0  0            999 V2000\n    3.7988    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2926   -0.5372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0191   -0.1254    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7277   -0.5372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4644   -0.1254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1781   -0.5372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1756   -1.3609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4491   -1.7728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7277   -1.3533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0114   -1.7574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0114   -2.5812    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2849   -1.3456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5839   -1.7523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8856   -1.3456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8932   -0.5168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2872    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1668   -0.1074    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4351   -0.5168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7316   -0.0947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0026   -0.5014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.3353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7163   -1.7447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4351   -1.3430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1591   -1.7523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1514   -2.5709    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 12  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4  9  2  0  0  0  0\n  6  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  2  0  0  0  0\n 10 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 24 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 15  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 18 23  2  0  0  0  0\n 20 19  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 25 24  2  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)c(=O)c(Cc3c(=O)c4ccccc4oc3O)c(O)o2",
          "formula": "C19H12O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4f51599d-3a47-443e-81ee-af639c416353"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "336.2957",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "78e8d463-9777-41b0-8796-493dddbdc96b",
      "version": "19",
      "structure": {
        "id": "706d0a33-0cf4-4b9c-89ca-b271cb8d8229",
        "molfile": "\n  Marvin  01132105502D          \n\n 25 28  0  0  0  0            999 V2000\n    4.2849   -1.3456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8856   -1.3456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0114   -1.7574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1591   -1.7523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2926   -0.5372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8932   -0.5168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5839   -1.7523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1668   -0.1074    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0191   -0.1254    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7277   -1.3533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4351   -1.3430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4351   -0.5168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7277   -0.5372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7988    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2872    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0114   -2.5812    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1514   -2.5709    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4491   -1.7728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7163   -1.7447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4644   -0.1254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7316   -0.0947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.3353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1756   -1.3609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0026   -0.5014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1781   -0.5372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  7  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  2  2  0  0  0  0\n  5  1  1  0  0  0  0\n  6  2  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9  5  1  0  0  0  0\n 10  3  1  0  0  0  0\n 11  4  1  0  0  0  0\n 12  8  1  0  0  0  0\n 13  9  1  0  0  0  0\n 14  5  2  0  0  0  0\n 15  6  2  0  0  0  0\n 16  3  1  0  0  0  0\n 17  4  1  0  0  0  0\n 18 10  2  0  0  0  0\n 19 11  2  0  0  0  0\n 20 13  2  0  0  0  0\n 21 12  2  0  0  0  0\n 22 19  1  0  0  0  0\n 23 18  1  0  0  0  0\n 24 21  1  0  0  0  0\n 25 20  1  0  0  0  0\n 13 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 25 23  2  0  0  0  0\n 24 22  2  0  0  0  0\nM  END",
        "smiles": "c1ccc2c(c1)c(c(Cc3c(c4ccccc4oc3=O)O)c(=O)o2)O",
        "formula": "C19H12O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "336.2957",
        "optical_activity": "NONE",
        "references": [
          "f7260bf3-b208-4c25-931b-50b006faf833",
          "91118821-50e6-4c18-8960-8f7485583c5a",
          "c520064d-3730-480a-bbb6-810526fb516d"
        ],
        "stereo_centers": 0
      },
      "unii": "7QID3E7BG7"
    }
  ]
}