{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "c1462089-8a57-4b6c-827e-5f21ae7ab012", "code": "126-53-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=126-53-4", "code_system": "CAS", "references": [ "e7e71d24-281d-41a8-a46b-89aebb6350fa", "e60dbe7f-9745-4474-8c83-999fe41d65e9" ] }, { "uuid": "37896de3-c46a-43b1-9330-31fae9583041", "code": "204-791-5", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.004.356", "code_system": "ECHA (EC/EINECS)", "references": [ "e7e71d24-281d-41a8-a46b-89aebb6350fa" ] }, { "uuid": "5d5ce5fc-cab9-4bfa-9ff3-b4ff3d629f66", "code": "31350", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/31350", "code_system": "PUBCHEM", "references": [ "e7e71d24-281d-41a8-a46b-89aebb6350fa" ] }, { "uuid": "12e28756-3552-c5f2-0119-ed7943510637", "code": "DTXSID50155039", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50155039", "code_system": "EPA CompTox", "references": [ "6df44012-2de4-8667-b756-1070be3f848e" ] }, { "uuid": "88a43c21-844d-445b-a689-df2f009e7eaf", "code": "7QCU1321U4", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "056fa78e-a8dc-4bb6-040a-3004d712d522", "code": "5647", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=5647", "code_system": "NSC", "references": [ "818fc54f-ea8e-3509-3159-1987a583880d" ] } ], "substance_class": "chemical", "names": [ { "uuid": "8641dd62-8b02-46ab-bbac-2615a224f0ca", "name": "GLYCEROL TRIPELARGONATE", "stdName": "GLYCEROL TRIPELARGONATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "731cc724-2874-4e49-b06a-5e147ccb9ab5", "d78284f8-9141-46da-862d-d77460355453" ], "display_name": false }, { "uuid": "77fbaf15-3ea7-4949-a64b-d289fed1665f", "name": "GLYCERYL TRIPELARGONATE", "stdName": "GLYCERYL TRIPELARGONATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "731cc724-2874-4e49-b06a-5e147ccb9ab5", "d78284f8-9141-46da-862d-d77460355453" ], "display_name": false }, { "uuid": "92a9b4c7-1582-4b9d-a0a8-c37901e00326", "name": "NONANOIC ACID, 1,1',1''-(1,2,3-PROPANETRIYL) ESTER", "stdName": "NONANOIC ACID, 1,1',1''-(1,2,3-PROPANETRIYL) ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "731cc724-2874-4e49-b06a-5e147ccb9ab5", "d78284f8-9141-46da-862d-d77460355453" ], "display_name": false }, { "uuid": "13a2d5a4-fbed-4bfc-8106-03730b45f523", "name": "NONANOIC ACID, 1,2,3-PROPANETRIYL ESTER", "stdName": "NONANOIC ACID, 1,2,3-PROPANETRIYL ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "731cc724-2874-4e49-b06a-5e147ccb9ab5", "d78284f8-9141-46da-862d-d77460355453" ], "display_name": false }, { "uuid": "cb03ce26-66d1-4fed-9ce1-38e93d57ff06", "name": "NONANOIN, TRI-", "stdName": "NONANOIN, TRI-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "731cc724-2874-4e49-b06a-5e147ccb9ab5", "d78284f8-9141-46da-862d-d77460355453" ], "display_name": false }, { "uuid": "5f12ea7b-158f-4aef-80ec-e9d6a34114b7", "name": "NSC-5647", "stdName": "NSC-5647", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "731cc724-2874-4e49-b06a-5e147ccb9ab5", "d78284f8-9141-46da-862d-d77460355453" ], "display_name": false }, { "uuid": "b3317381-813d-402b-aee0-e9c18a85ba77", "name": "TRINONANOIN", "stdName": "TRINONANOIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "731cc724-2874-4e49-b06a-5e147ccb9ab5", "d78284f8-9141-46da-862d-d77460355453" ], "display_name": false }, { "uuid": "b11e8685-c580-4cd3-90bb-8893dd8e65f4", "name": "TRIPELARGOIN", "stdName": "TRIPELARGOIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "731cc724-2874-4e49-b06a-5e147ccb9ab5", "d78284f8-9141-46da-862d-d77460355453" ], "display_name": false }, { "uuid": "bf8a95a6-9bf9-453d-96d7-af95a121b12b", "name": "TRIPELARGONIN", "stdName": "TRIPELARGONIN", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "731cc724-2874-4e49-b06a-5e147ccb9ab5", "d78284f8-9141-46da-862d-d77460355453" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "0cfcd6aa-c0f5-4924-8ecb-e71d85a7d497", "name_org": "INCI" } ] } ], "references": [ { "uuid": "d78284f8-9141-46da-862d-d77460355453", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "731cc724-2874-4e49-b06a-5e147ccb9ab5", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e7e71d24-281d-41a8-a46b-89aebb6350fa", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493389676000, "tags": [ "NOMEN" ] }, { "uuid": "5e0b61ca-c534-4450-9116-084ea7af7725", "citation": "SRS import [7QCU1321U4]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7QCU1321U4", "doc_type": "SRS", "public_domain": true, "document_date": 1493389676000, "tags": [ "NOMEN" ] }, { "uuid": "6df44012-2de4-8667-b756-1070be3f848e", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=126-53-4", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "caaf7505-d4fd-5982-8afc-d7110012c614", "citation": "PCPC", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true }, { "uuid": "e60dbe7f-9745-4474-8c83-999fe41d65e9", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "818fc54f-ea8e-3509-3159-1987a583880d", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "cbddd83d-8b08-45d8-9c7f-1f5ae0085542", "id": "cbddd83d-8b08-45d8-9c7f-1f5ae0085542", "molfile": "\n Marvin 01132110322D \n\n 36 35 0 0 0 0 999 V2000\n 14.9679 -7.5278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2486 -7.1101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5293 -7.5123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8256 -7.1101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0805 -7.4968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4025 -7.0637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6729 -7.4659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9846 -7.0637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2499 -7.4504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2499 -8.2625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5306 -7.0483 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8577 -7.4375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1385 -7.0328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1385 -6.1821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4501 -5.7618 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4656 -4.9524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1694 -4.5657 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7464 -4.5657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7773 -3.7381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0580 -3.3050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0580 -2.4800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3414 -2.0804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3542 -1.2246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6504 -0.8069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6659 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4321 -7.4375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7180 -7.0019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7180 -6.1666 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9833 -7.3937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2950 -6.9606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5602 -7.3937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8410 -6.9606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1217 -7.3628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4334 -6.9606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7141 -7.3499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -6.9142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 10 9 2 0 0 0 0\n 9 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 14 13 1 0 0 0 0\n 13 26 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 2 0 0 0 0\n 18 16 1 0 0 0 0\n 19 18 1 0 0 0 0\n 20 19 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 1 0 0 0 0\n 24 23 1 0 0 0 0\n 25 24 1 0 0 0 0\n 26 27 1 0 0 0 0\n 28 27 2 0 0 0 0\n 29 27 1 0 0 0 0\n 30 29 1 0 0 0 0\n 31 30 1 0 0 0 0\n 32 31 1 0 0 0 0\n 33 32 1 0 0 0 0\n 34 33 1 0 0 0 0\n 35 34 1 0 0 0 0\n 36 35 1 0 0 0 0\nM END", "smiles": "CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC)OC(=O)CCCCCCCC", "formula": "C30H56O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "fa7a4b68-ef1b-4ad0-b04e-ab67edefd77d" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "512.7632", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "dea54a2b-2532-4bab-b20b-75c51a496688", "version": "6", "structure": { "id": "6f972a25-53ac-4186-8176-0f0e95fb39bd", "molfile": "\n Marvin 01132105472D \n\n 36 35 0 0 0 0 999 V2000\n 5.7180 -7.0019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2499 -7.4504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4656 -4.9524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4321 -7.4375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7180 -6.1666 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1694 -4.5657 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2499 -8.2625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5306 -7.0483 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4501 -5.7618 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1385 -7.0328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1385 -6.1821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8577 -7.4375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9833 -7.3937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9846 -7.0637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7464 -4.5657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2950 -6.9606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6729 -7.4659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7773 -3.7381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2486 -7.1101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7141 -7.3499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6504 -0.8069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5293 -7.5123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3542 -1.2246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4334 -6.9606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8410 -6.9606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1217 -7.3628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8256 -7.1101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0805 -7.4968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0580 -3.3050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0580 -2.4800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3414 -2.0804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4025 -7.0637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5602 -7.3937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -6.9142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9679 -7.5278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6659 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 8 1 0 0 0 0\n 3 9 1 0 0 0 0\n 4 1 1 0 0 0 0\n 5 1 2 0 0 0 0\n 6 3 2 0 0 0 0\n 7 2 2 0 0 0 0\n 8 12 1 0 0 0 0\n 9 11 1 0 0 0 0\n 10 4 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 10 1 0 0 0 0\n 13 1 1 0 0 0 0\n 14 2 1 0 0 0 0\n 15 3 1 0 0 0 0\n 16 13 1 0 0 0 0\n 17 14 1 0 0 0 0\n 18 15 1 0 0 0 0\n 19 22 1 0 0 0 0\n 20 24 1 0 0 0 0\n 21 23 1 0 0 0 0\n 22 27 1 0 0 0 0\n 23 31 1 0 0 0 0\n 24 26 1 0 0 0 0\n 25 33 1 0 0 0 0\n 26 25 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 32 1 0 0 0 0\n 29 18 1 0 0 0 0\n 30 29 1 0 0 0 0\n 31 30 1 0 0 0 0\n 32 17 1 0 0 0 0\n 33 16 1 0 0 0 0\n 34 20 1 0 0 0 0\n 35 19 1 0 0 0 0\n 36 21 1 0 0 0 0\nM END", "smiles": "CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC)OC(=O)CCCCCCCC", "formula": "C30H56O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "512.7632", "optical_activity": "NONE", "references": [ "5e0b61ca-c534-4450-9116-084ea7af7725", "d78284f8-9141-46da-862d-d77460355453" ], "stereo_centers": 0 }, "unii": "7QCU1321U4" } ] }