{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1acab0c1-d21a-4d37-a503-4fbc9b889864",
          "code": "94-51-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=94-51-9",
          "code_system": "CAS",
          "references": [
            "ba32e328-67a7-4037-981c-86117ab7bd5b",
            "9a9f8c7c-a226-4a7d-bcf9-23d76102d4ed"
          ]
        },
        {
          "uuid": "8141a1fc-1b78-4367-a22d-21ee4a85284d",
          "code": "202-340-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.002.128",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "ba32e328-67a7-4037-981c-86117ab7bd5b"
          ]
        },
        {
          "uuid": "17fd1986-ff71-4629-a524-e43c33afaea7",
          "code": "66752",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/66752",
          "code_system": "PUBCHEM",
          "references": [
            "ba32e328-67a7-4037-981c-86117ab7bd5b"
          ]
        },
        {
          "uuid": "07d31ba2-7851-4056-9043-d6b54cb8c3ce",
          "code": "7Q260QET02",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "1f00526a-6813-81fc-2ae6-2f90cef9dfb1",
          "code": "DTXSID20912333",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20912333",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "8ea916ab-7c03-4b5b-8293-4a2828ca4b94",
          "name": "1-PROPANOL, 3,3'-OXYBIS-, 1,1'-DIBENZOATE",
          "stdName": "1-PROPANOL, 3,3'-OXYBIS-, 1,1'-DIBENZOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8d7b0732-9f61-427e-8ed9-4541607f1118"
          ],
          "display_name": false
        },
        {
          "uuid": "722c713b-322e-4bce-8ccc-380e98bbec39",
          "name": "1-PROPANOL, 3,3'-OXYBIS-, DIBENZOATE",
          "stdName": "1-PROPANOL, 3,3'-OXYBIS-, DIBENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8d7b0732-9f61-427e-8ed9-4541607f1118"
          ],
          "display_name": false
        },
        {
          "uuid": "3b6a2b33-0ee5-409f-b0a4-ab7b49d99a50",
          "name": "1-PROPANOL, 3,3'-OXYDI-, DIBENZOATE",
          "stdName": "1-PROPANOL, 3,3'-OXYDI-, DIBENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8d7b0732-9f61-427e-8ed9-4541607f1118"
          ],
          "display_name": false
        },
        {
          "uuid": "053fb2df-8821-4e3a-be0f-b7c822c38ebd",
          "name": "3,3'-OXYBIS(1-PROPANOL) DIBENZOATE",
          "stdName": "3,3'-OXYBIS(1-PROPANOL) DIBENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "99213d62-b5d7-41d5-9f1d-2b8ef242cf6e"
          ],
          "display_name": false
        },
        {
          "uuid": "17197684-22d5-4353-b93c-d48687794ff9",
          "name": "3,3'-OXYBIS-1-PROPANOL DIBENZOATE",
          "stdName": "3,3'-OXYBIS-1-PROPANOL DIBENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4cecd41c-25b0-4a92-ad85-dd42decaa9d2"
          ],
          "display_name": true
        },
        {
          "uuid": "ea7e4cea-03ff-4b79-b95e-2beb14bb00d9",
          "name": "DI(1,3-PROPYLENE GLYCOL) DIBENZOATE",
          "stdName": "DI(1,3-PROPYLENE GLYCOL) DIBENZOATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4cecd41c-25b0-4a92-ad85-dd42decaa9d2"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "99213d62-b5d7-41d5-9f1d-2b8ef242cf6e",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8d7b0732-9f61-427e-8ed9-4541607f1118",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4cecd41c-25b0-4a92-ad85-dd42decaa9d2",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ba32e328-67a7-4037-981c-86117ab7bd5b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391110000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7a048f41-7e0c-43f4-b958-046eedf750e7",
          "citation": "SRS import [7Q260QET02]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7Q260QET02",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391110000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "675f57d9-2c45-4fb5-a955-fb69cab53679",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9a9f8c7c-a226-4a7d-bcf9-23d76102d4ed",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "33885649-0e26-4610-81cb-7ebbf1e9db54",
          "id": "33885649-0e26-4610-81cb-7ebbf1e9db54",
          "molfile": "\n  Marvin  01132102452D          \n\n 25 26  0  0  0  0            999 V2000\n   11.0496   -6.5123    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0496   -5.6874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3150   -5.2511    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5962   -5.6446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8616   -5.2083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1385   -5.5996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4039   -5.1632    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6788   -5.5504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9527   -5.1166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2252   -5.5077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4953   -5.0714    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7676   -5.4625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7676   -6.2789    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0417   -5.0288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3166   -5.4159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5813   -4.9796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5813   -4.1586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3041   -3.7675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0417   -4.2037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7726   -5.2962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7726   -4.4799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4948   -4.0888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2248   -4.5249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2248   -5.3430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5072   -5.7324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  3  2  1  0  0  0  0\n 20  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 12  1  0  0  0  0\n 15 14  1  0  0  0  0\n 19 14  2  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 25 20  2  0  0  0  0\n 22 21  2  0  0  0  0\n 23 22  1  0  0  0  0\n 23 24  2  0  0  0  0\n 24 25  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)C(=O)OCCCOCCCOC(=O)c2ccccc2",
          "formula": "C20H22O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "18fa4fe9-4bcb-4303-bdd1-6b6a4360858e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "342.3864",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "891034e8-c39f-401c-a195-75a72f3edd76",
      "version": "3",
      "structure": {
        "id": "4f8ac656-e012-41ee-bbfc-4033cc8277fa",
        "molfile": "\n  Marvin  01132104092D          \n\n 25 26  0  0  0  0            999 V2000\n   11.0496   -5.6874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0496   -6.5123    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7726   -5.2962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7726   -4.4799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4948   -4.0888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2248   -4.5249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2248   -5.3430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5072   -5.7324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3150   -5.2511    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5962   -5.6446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8616   -5.2083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1385   -5.5996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4039   -5.1632    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6788   -5.5504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9527   -5.1166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2252   -5.5077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4953   -5.0714    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7676   -5.4625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7676   -6.2789    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0417   -5.0288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3166   -5.4159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5813   -4.9796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5813   -4.1586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3041   -3.7675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0417   -4.2037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  1  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  3  1  0  0  0  0\n  9  1  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  2  0  0  0  0\n 20 18  1  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  2  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  2  0  0  0  0\n 25 20  1  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)C(=O)OCCCOCCCOC(=O)c2ccccc2",
        "formula": "C20H22O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "342.3864",
        "optical_activity": "NONE",
        "references": [
          "7a048f41-7e0c-43f4-b958-046eedf750e7",
          "675f57d9-2c45-4fb5-a955-fb69cab53679"
        ],
        "stereo_centers": 0
      },
      "unii": "7Q260QET02"
    }
  ]
}