{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b7bb6978-b5de-4fc3-adb3-dcc10764fa36",
          "code": "103185-28-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=103185-28-0",
          "code_system": "CAS",
          "references": [
            "167a48f4-6cec-4628-8edf-40cb677dc79a",
            "c1932327-8143-4fa2-b3a1-0efdff3ed857"
          ]
        },
        {
          "uuid": "e1f2423c-f02c-41cc-a501-75b3b912e797",
          "code": "1860611",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1860611/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "167a48f4-6cec-4628-8edf-40cb677dc79a"
          ]
        },
        {
          "uuid": "4fad6e6e-09ee-bc1c-15e2-d85091f725a1",
          "code": "688035",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/688035",
          "code_system": "PUBCHEM",
          "references": [
            "d87d2d9f-e565-2403-3b9a-98ff6a781893"
          ]
        },
        {
          "uuid": "5484bfd3-b376-4349-bff6-2b1de52a5b58",
          "code": "7PZ73W4ZNR",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3c4824b7-a4fc-4b18-db62-4ee7d6efae22",
          "code": "7PZ73W4ZNR",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=7PZ73W4ZNR",
          "code_system": "DAILYMED",
          "references": [
            "4ab8fa4e-70af-ca4c-7f05-11b3413257a6"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "dd0d636e-3d1a-460e-99dc-995d9be7e7d3",
          "name": "1,2-BENZENEDIOL, 4,4'-((2R,3R)-2,3-DIMETHYL-1,4-BUTANEDIYL)BIS-, REL-",
          "stdName": "1,2-BENZENEDIOL, 4,4'-((2R,3R)-2,3-DIMETHYL-1,4-BUTANEDIYL)BIS-, REL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d5160655-6033-400b-b0c0-e8a2ca9084e1",
            "dc6e77a2-a9a2-45fc-9f8e-b3388f4425e3"
          ],
          "display_name": false
        },
        {
          "uuid": "cfdf4ebe-9664-48b4-bb7e-719bf77c6ce3",
          "name": "1,2-BENZENEDIOL, 4,4'-(2,3-DIMETHYL-1,4-BUTANEDIYL)BIS-, (R*,R*)-",
          "stdName": "1,2-BENZENEDIOL, 4,4'-(2,3-DIMETHYL-1,4-BUTANEDIYL)BIS-, (R*,R*)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d5160655-6033-400b-b0c0-e8a2ca9084e1",
            "dc6e77a2-a9a2-45fc-9f8e-b3388f4425e3"
          ],
          "display_name": false
        },
        {
          "uuid": "ebcb231a-ad6c-405b-a2c1-137a7a94c52a",
          "name": "NORDIHYDROGUAIARETIC ACID, (±)-",
          "stdName": "NORDIHYDROGUAIARETIC ACID, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d5160655-6033-400b-b0c0-e8a2ca9084e1",
            "6e600f2f-052f-4a4c-8ae5-c6b33f5efd94"
          ],
          "display_name": true
        },
        {
          "uuid": "d727ddee-f238-4bf8-9711-e1b57faf57fd",
          "name": "NORDIHYDROGUAIARETIC ACID, DL-",
          "stdName": "NORDIHYDROGUAIARETIC ACID, DL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d5160655-6033-400b-b0c0-e8a2ca9084e1",
            "dc6e77a2-a9a2-45fc-9f8e-b3388f4425e3"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "d87d2d9f-e565-2403-3b9a-98ff6a781893",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "dc6e77a2-a9a2-45fc-9f8e-b3388f4425e3",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d5160655-6033-400b-b0c0-e8a2ca9084e1",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6e600f2f-052f-4a4c-8ae5-c6b33f5efd94",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "167a48f4-6cec-4628-8edf-40cb677dc79a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393364000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0960275f-6235-4dba-9501-9d85e949cae2",
          "citation": "SRS import [7PZ73W4ZNR]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7PZ73W4ZNR",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393364000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "97811d28-1060-0721-76f2-16f0cb31fb2b",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "c1932327-8143-4fa2-b3a1-0efdff3ed857",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4ab8fa4e-70af-ca4c-7f05-11b3413257a6",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d3a03f6a-2452-45ae-a158-3ea0dba6e3e8",
          "id": "d3a03f6a-2452-45ae-a158-3ea0dba6e3e8",
          "molfile": "\n  Marvin  01132110562D          \n\n 22 23  0  0  0  0            999 V2000\n    7.8261   -5.0711    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.8261   -4.2461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5405   -5.4836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2549   -5.0711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2549   -4.2461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9694   -3.8336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6838   -4.2461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3984   -3.8336    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6838   -5.0711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3984   -5.4835    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9694   -5.4836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1116   -5.4836    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.1116   -6.3085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3971   -5.0711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6826   -5.4836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6826   -6.3085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9683   -6.7210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2538   -6.3085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5393   -6.7210    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2538   -5.4836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5393   -5.0711    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9683   -5.0711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n 12  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4 11  2  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  7  9  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11  9  1  0  0  0  0\n 12 13  1  1  0  0  0\n 14 12  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 22 15  2  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 18 20  2  0  0  0  0\n 21 20  1  0  0  0  0\n 20 22  1  0  0  0  0\nM  END",
          "smiles": "C[C@@H](Cc1ccc(c(c1)O)O)[C@@H](C)Cc2ccc(c(c2)O)O",
          "formula": "C18H22O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ab55bc2d-8e5d-4ec0-a754-880d6b9754d5"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "302.3656",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6892139e-89b4-41fc-ab7c-4b3f0dd0a660",
      "version": "9",
      "structure": {
        "id": "a3313cb6-6194-4c22-9370-9dad69df1923",
        "molfile": "\n  Marvin  01132108292D          \n\n 22 23  0  0  0  0            999 V2000\n   10.6838   -5.0711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6838   -4.2461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9694   -3.8336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2549   -4.2461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2549   -5.0711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9694   -5.4836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5405   -5.4836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8261   -5.0711    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.1116   -5.4836    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.3971   -5.0711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6826   -5.4836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9683   -5.0711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2538   -5.4836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5393   -5.0711    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2538   -6.3085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9683   -6.7210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6826   -6.3085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5393   -6.7210    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1116   -6.3085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8261   -4.2461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3984   -3.8336    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3984   -5.4835    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  1  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 13  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 11  2  0  0  0  0\n 18 15  1  0  0  0  0\n  9 19  1  1  0  0  0\n  8 20  1  1  0  0  0\n 21  2  1  0  0  0  0\n 22  1  1  0  0  0  0\nM  END",
        "smiles": "C[C@@H](Cc1ccc(c(c1)O)O)[C@@H](C)Cc2ccc(c(c2)O)O",
        "formula": "C18H22O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "302.3656",
        "optical_activity": "( + / - )",
        "references": [
          "0960275f-6235-4dba-9501-9d85e949cae2",
          "dc6e77a2-a9a2-45fc-9f8e-b3388f4425e3"
        ],
        "stereo_centers": 2
      },
      "modifications": {
        "uuid": "d0a4b7ab-816f-4e0a-b936-ab66ab4522e0"
      },
      "unii": "7PZ73W4ZNR"
    }
  ]
}