{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1b0349bc-cfe4-4629-8f8c-86491f6981fa",
          "code": "7646-88-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=7646-88-0",
          "code_system": "CAS",
          "references": [
            "2ed37550-fbb3-40dd-ab81-699728531793",
            "68345c9a-2a85-492f-afd4-2ce167d8a452"
          ]
        },
        {
          "uuid": "6978bc4e-a085-4591-a1de-55fade2f9b16",
          "code": "76801",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:1227",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "2ed37550-fbb3-40dd-ab81-699728531793"
          ]
        },
        {
          "uuid": "90884ddd-b738-453d-91d2-e58cc25287ce",
          "code": "231-593-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.028.721",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "2ed37550-fbb3-40dd-ab81-699728531793"
          ]
        },
        {
          "uuid": "de703012-9c47-4c5d-8cb3-1f3702eef1b9",
          "code": "24289",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/24289",
          "code_system": "PUBCHEM",
          "references": [
            "2ed37550-fbb3-40dd-ab81-699728531793"
          ]
        },
        {
          "uuid": "1523941d-0b1d-446b-acf0-019acfb910ee",
          "code": "7PL9R555XT",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "9ab2ff84-e720-dc22-8d23-9f892315ba25",
          "code": "DTXSID80897273",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80897273",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "7c8bb594-99a9-545e-644c-a622b728051a",
          "code": "TCA-ammonium",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/TCA-ammonium.html",
          "code_system": "ALANWOOD",
          "references": [
            "c2318b87-8771-ce06-c33d-e39802ae1ee9"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ce187c38-50e5-4e06-85c9-9c805ce770d2",
          "name": "ACETIC ACID, 2,2,2-TRICHLORO-, AMMONIUM SALT (1:1)",
          "stdName": "ACETIC ACID, 2,2,2-TRICHLORO-, AMMONIUM SALT (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b8bedc5f-4288-4222-8e96-36d093fb20fd",
            "624eb6b5-2a91-4b7c-b03f-abf067e31e1c"
          ],
          "display_name": false
        },
        {
          "uuid": "50307870-9a9d-4cb3-8460-fae7f5080d0c",
          "name": "AMMONIUM TRICHLOROACETATE",
          "stdName": "AMMONIUM TRICHLOROACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b8bedc5f-4288-4222-8e96-36d093fb20fd",
            "624eb6b5-2a91-4b7c-b03f-abf067e31e1c"
          ],
          "display_name": true
        },
        {
          "uuid": "97da052c-0252-4370-bfbc-fbac7fcdd1f4",
          "name": "TCA AMMONIUM",
          "stdName": "TCA AMMONIUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b8bedc5f-4288-4222-8e96-36d093fb20fd",
            "ec138fe9-67ae-4749-acb5-4ad549cd23fb"
          ],
          "display_name": false
        },
        {
          "uuid": "05a1398f-5675-41ae-a89c-1de303be7369",
          "name": "TCA-AMMONIUM",
          "stdName": "TCA-AMMONIUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b8bedc5f-4288-4222-8e96-36d093fb20fd",
            "624eb6b5-2a91-4b7c-b03f-abf067e31e1c",
            "5b04fe4f-3d9b-4e6c-8ef9-3273c051133e"
          ],
          "display_name": false
        },
        {
          "uuid": "24982ee8-8bda-4e82-8ccc-31f0108ce812",
          "name": "TCA-AMMONIUM [ISO]",
          "stdName": "TCA-AMMONIUM [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b8bedc5f-4288-4222-8e96-36d093fb20fd",
            "624eb6b5-2a91-4b7c-b03f-abf067e31e1c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "624eb6b5-2a91-4b7c-b03f-abf067e31e1c",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b8bedc5f-4288-4222-8e96-36d093fb20fd",
          "citation": "ISO",
          "doc_type": "ISO",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ec138fe9-67ae-4749-acb5-4ad549cd23fb",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2ed37550-fbb3-40dd-ab81-699728531793",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391739000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "71662ee1-7d00-4556-a6d8-5ed0c835e1d1",
          "citation": "SRS import [7PL9R555XT]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7PL9R555XT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391739000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "397b98a2-b0e0-4bbf-8c9f-93e8abc53407",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5b04fe4f-3d9b-4e6c-8ef9-3273c051133e",
          "citation": "TCA-AMMONIUM [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c2318b87-8771-ce06-c33d-e39802ae1ee9",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "68345c9a-2a85-492f-afd4-2ce167d8a452",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d6b2d329-5cbf-46d9-9e8a-4fe73cf597af",
          "id": "d6b2d329-5cbf-46d9-9e8a-4fe73cf597af",
          "molfile": "\n  Marvin  01132111082D          \n\n  1  0  0  0  0  0            999 V2000\n    9.1013   -5.0309    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "N",
          "formula": "H3N",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1fa8ed23-31c8-4970-b7f7-3131a27bf449"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "17.0305",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "52262dcc-083a-43d6-8c04-95004e10f61a",
          "id": "52262dcc-083a-43d6-8c04-95004e10f61a",
          "molfile": "\n  Marvin  01132104172D          \n\n  7  6  0  0  0  0            999 V2000\n    7.2360   -4.0353    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2360   -4.8603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9504   -5.2727    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5215   -5.2727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8070   -4.8603    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.5215   -6.0977    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.8070   -5.6853    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  4  7  1  0  0  0  0\nM  END",
          "smiles": "C(=O)(C(Cl)(Cl)Cl)O",
          "formula": "C2HCl3O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "77c0346e-76b4-4bbd-a879-82beda754a00"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "163.387",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f60685f6-db4b-45a5-bf7c-0f437c71f0a5",
      "version": "6",
      "structure": {
        "id": "62cb6e58-2221-4831-a294-fdc7e13f9431",
        "molfile": "\n  Marvin  01132105072D          \n\n  8  6  0  0  0  0            999 V2000\n    9.1013   -5.0309    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    7.2360   -4.8603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2360   -4.0353    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9504   -5.2727    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.5215   -5.2727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8070   -4.8603    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.5215   -6.0977    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.8070   -5.6853    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  5  8  1  0  0  0  0\nM  CHG  2   1   1   4  -1\nM  END",
        "smiles": "C(=O)(C(Cl)(Cl)Cl)[O-].[NH4+]",
        "formula": "C2Cl3O2.H4N",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "180.4176",
        "optical_activity": "NONE",
        "references": [
          "397b98a2-b0e0-4bbf-8c9f-93e8abc53407",
          "71662ee1-7d00-4556-a6d8-5ed0c835e1d1"
        ],
        "stereo_centers": 0
      },
      "unii": "7PL9R555XT"
    }
  ]
}