{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "620cd0cc-3a4b-4e57-a78f-26eeffb194ed", "code": "220410-74-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=220410-74-2", "code_system": "CAS", "references": [ "3b76bfa6-9491-482b-a0ec-34a1e24ad98c", "bde2e654-3f20-49f3-97a0-eb45423acfe9" ] }, { "uuid": "0ed0c4a4-a69a-479b-9ac1-79ba7f0a29b5", "code": "1368375", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1368375/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "3b76bfa6-9491-482b-a0ec-34a1e24ad98c" ] }, { "uuid": "d5434900-c813-e77a-387b-fe97c8e06cad", "code": "DTXSID1074387", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1074387", "code_system": "EPA CompTox", "references": [ "b0eda7c0-76f8-0aff-4f86-85003db2a7b6" ] }, { "uuid": "f7cd8d80-6ccc-468a-9afb-ed6929bbed24", "code": "1368376", "type": "ALTERNATIVE", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1368376/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "122c2ca8-504b-97b0-62ac-a7cec02f136e" ] }, { "uuid": "6c8ec87e-fe7e-007d-62a4-970128d77119", "code": "22182978", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/22182978", "code_system": "PUBCHEM", "references": [ "6f138498-74fa-53bd-4c12-e5ceb21417c1" ] }, { "uuid": "629b6623-c646-449e-be05-f277d65fdbce", "code": "7NW772I64Y", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "1ba36ac0-3e1c-1575-9ca5-3e296b4b9ad1", "code": "7NW772I64Y", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=7NW772I64Y", "code_system": "DAILYMED", "references": [ "0d446cf9-a871-1b5d-c2d7-aae749ae5f2c" ] } ], "relationships": [ { "uuid": "d2018fcb-8f71-4c36-8fd6-88d7770b6eff", "type": "PARENT->SALT/SOLVATE", "related_substance": { "uuid": "3d47f902-97eb-41bb-b7fb-d562ac97e703", "refuuid": "7495c063-0afe-4404-b6dc-1327ce06fa4e", "name": "Anhydrous citric acid", "unii": "XF417D3PSL", "linking_id": "XF417D3PSL", "ref_pname": "Anhydrous citric acid", "substance_class": "reference" } }, { "uuid": "5af3de53-b2c8-4b95-8c97-f5826f886ca9", "type": "SUB_CONCEPT->SUBSTANCE", "references": [ "122c2ca8-504b-97b0-62ac-a7cec02f136e" ], "related_substance": { "uuid": "d9f33dab-d8df-4fff-8b98-65e32cf526a2", "refuuid": "3c504d7e-a62b-405e-a15f-ad8770ab239e", "name": "TRIS(TETRAMETHYLHYDROXYPIPERIDINOL)", "linking_id": "3c504d7e-a62b-405e-a15f-ad8770ab239e", "ref_pname": "TRIS(TETRAMETHYLHYDROXYPIPERIDINOL)", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "557ad63e-9717-4ed3-8293-3cedc67459d1", "name": "4-PIPERIDINOL, 1-HYDROXY-2,2,6,6-TETRAMETHYL-, 2-HYDROXY-1,2,3-PROPANETRICARBOXYLATE (3:1)", "stdName": "4-PIPERIDINOL, 1-HYDROXY-2,2,6,6-TETRAMETHYL-, 2-HYDROXY-1,2,3-PROPANETRICARBOXYLATE (3:1)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "9b29f3cf-4bca-4350-9229-1892c0395277", "a70b9739-eb9b-465b-b00f-e28d9a3a11c7" ], "display_name": false }, { "uuid": "c03277f3-e44b-442d-8fcf-787ce39032a2", "name": "4-PIPERIDINOL, 1-HYDROXY-2,2,6,6-TETRAMETHYL-, 2-HYDROXY-1,2,3-PROPANETRICARBOXYLATE (3:1) (SALT)", "stdName": "4-PIPERIDINOL, 1-HYDROXY-2,2,6,6-TETRAMETHYL-, 2-HYDROXY-1,2,3-PROPANETRICARBOXYLATE (3:1) (SALT)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "9b29f3cf-4bca-4350-9229-1892c0395277", "a70b9739-eb9b-465b-b00f-e28d9a3a11c7" ], "display_name": false }, { "uuid": "efb3ac07-8961-4566-a1c4-96864108665a", "name": "TINOGUARD Q", "stdName": "TINOGUARD Q", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "9b29f3cf-4bca-4350-9229-1892c0395277", "a70b9739-eb9b-465b-b00f-e28d9a3a11c7" ], "display_name": false }, { "uuid": "4dcee419-0a98-4006-ba3f-d42b0fd40073", "name": "TRIS(TETRAMETHYLHYDROXYPIPERIDINOL) CITRATE", "stdName": "TRIS(TETRAMETHYLHYDROXYPIPERIDINOL) CITRATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "a7b2a2b9-0aa6-4a42-af1b-73f0d6c74649", "9b29f3cf-4bca-4350-9229-1892c0395277", "a70b9739-eb9b-465b-b00f-e28d9a3a11c7", "e17c2a38-5a5a-4535-8309-0ea1dce7a9e0" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "241e46e8-a23e-4bb0-9e54-70769f5162d3", "name_org": "INCI" } ] } ], "references": [ { "uuid": "9b29f3cf-4bca-4350-9229-1892c0395277", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "a70b9739-eb9b-465b-b00f-e28d9a3a11c7", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e17c2a38-5a5a-4535-8309-0ea1dce7a9e0", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3b76bfa6-9491-482b-a0ec-34a1e24ad98c", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390967000, "tags": [ "NOMEN" ] }, { "uuid": "b0e35052-6647-4e0e-ac05-bbc78a015e2d", "citation": "SRS import [7NW772I64Y]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7NW772I64Y", "doc_type": "SRS", "public_domain": true, "document_date": 1493390967000, "tags": [ "NOMEN" ] }, { "uuid": "a7b2a2b9-0aa6-4a42-af1b-73f0d6c74649", "citation": "TRIS(TETRAMETHYLHYDROXYPIPERIDINOL) CITRATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "b0eda7c0-76f8-0aff-4f86-85003db2a7b6", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=220410-74-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "122c2ca8-504b-97b0-62ac-a7cec02f136e", "citation": "RXNORM", "doc_type": "NLM", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "6f138498-74fa-53bd-4c12-e5ceb21417c1", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "bde2e654-3f20-49f3-97a0-eb45423acfe9", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "0d446cf9-a871-1b5d-c2d7-aae749ae5f2c", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "3c839575-47ba-4088-9a19-b35a9bd8fa90", "id": "3c839575-47ba-4088-9a19-b35a9bd8fa90", "molfile": "\n Marvin 01132103122D \n\n 12 12 0 0 0 0 999 V2000\n 0.8812 -3.4762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5966 -3.8910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1592 -4.2774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5966 -3.0657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3073 -2.6554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3073 -1.8300 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0226 -3.0657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0226 -3.8910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8480 -3.8910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6048 -4.4731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3073 -4.3014 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3073 -5.1268 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 2 1 0 0 0 0\n 2 11 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 7 5 1 0 0 0 0\n 8 7 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 10 1 0 0 0 0\n 11 8 1 0 0 0 0\n 11 12 1 0 0 0 0\nM END", "smiles": "CC1(C)CC(CC(C)(C)N1O)O", "formula": "C9H19NO2", "atropisomerism": "No", "charge": 0, "count": 3, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 3, "units": "MOL RATIO", "uuid": "5081bf3c-24f7-4d9e-a068-c3b0588c99d6" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "173.253", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "5e51aca1-d12a-462d-9285-6e0f404a0c17", "id": "5e51aca1-d12a-462d-9285-6e0f404a0c17", "molfile": "\n Marvin 01132104532D \n\n 13 12 0 0 0 0 999 V2000\n 5.3846 -3.6740 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0957 -3.2589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0957 -2.4379 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8066 -3.6740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5222 -3.2589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5222 -2.4379 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2379 -3.6740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9489 -3.2589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7447 -3.4769 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9489 -2.4379 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7357 -4.0592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4513 -4.4697 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1533 -4.6415 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 2 0 0 0 0\n 2 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 7 1 0 0 0 0\n 5 11 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 10 2 0 0 0 0\n 11 12 1 0 0 0 0\n 11 13 2 0 0 0 0\nM END", "smiles": "C(C(=O)O)C(CC(=O)O)(C(=O)O)O", "formula": "C6H8O7", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "48addf1e-691e-4259-ba49-0db11632c418" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "192.1238", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "d5571251-fe3e-4de1-b6b1-ad93eb3aabb5", "version": "9", "structure": { "id": "80f216c8-9517-4482-97ba-3208746a147a", "molfile": "\n Marvin 01132106422D \n\n 49 48 0 0 0 0 999 V2000\n 5.3846 -3.6740 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0957 -3.2589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8066 -3.6740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5222 -3.2589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2379 -3.6740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9489 -3.2589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7447 -3.4769 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9489 -2.4379 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7357 -4.0592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.4513 -4.4697 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1533 -4.6415 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5222 -2.4379 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0957 -2.4379 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8815 -3.4772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5971 -3.8922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1595 -4.2787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3080 -4.3027 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3080 -5.1283 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0235 -3.8922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8492 -3.8922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6059 -4.4744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0235 -3.0666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3080 -2.6562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3080 -1.8305 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5971 -3.0666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8815 -3.4772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5971 -3.8922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1595 -4.2787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3080 -4.3027 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3080 -5.1283 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0235 -3.8922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8492 -3.8922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6059 -4.4744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0235 -3.0666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3080 -2.6562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3080 -1.8305 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5971 -3.0666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8815 -3.4772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5971 -3.8922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1595 -4.2787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3080 -4.3027 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3080 -5.1283 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0235 -3.8922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8492 -3.8922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6059 -4.4744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0235 -3.0666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3080 -2.6562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3080 -1.8305 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5971 -3.0666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4 12 1 0 0 0 0\n 2 13 2 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 8 2 0 0 0 0\n 4 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 9 11 2 0 0 0 0\n 15 14 1 0 0 0 0\n 15 16 1 0 0 0 0\n 15 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 19 21 1 0 0 0 0\n 19 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 25 23 1 0 0 0 0\n 25 15 1 0 0 0 0\n 39 38 1 0 0 0 0\n 39 40 1 0 0 0 0\n 39 41 1 0 0 0 0\n 49 39 1 0 0 0 0\n 41 42 1 0 0 0 0\n 41 43 1 0 0 0 0\n 43 44 1 0 0 0 0\n 43 45 1 0 0 0 0\n 43 46 1 0 0 0 0\n 46 47 1 0 0 0 0\n 47 48 1 0 0 0 0\n 49 47 1 0 0 0 0\n 27 26 1 0 0 0 0\n 27 28 1 0 0 0 0\n 27 29 1 0 0 0 0\n 37 27 1 0 0 0 0\n 29 30 1 0 0 0 0\n 29 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 31 33 1 0 0 0 0\n 31 34 1 0 0 0 0\n 34 35 1 0 0 0 0\n 35 36 1 0 0 0 0\n 37 35 1 0 0 0 0\nM STY 1 1 MUL\nM SCN 1 1 HT \nM SAL 1 15 14 15 16 17 18 19 20 21 22 23 24 25 26 27 28\nM SAL 1 15 29 30 31 32 33 34 35 36 37 38 39 40 41 42 43\nM SAL 1 6 44 45 46 47 48 49\nM SPA 1 12 14 15 16 17 18 19 20 21 22 23 24 25\nM SDI 1 4 0.4615 -5.5483 0.4615 -1.4105\nM SDI 1 4 4.2692 -1.4105 4.2692 -5.5483\nM SMT 1 3\nM END", "smiles": "CC1(C)CC(CC(C)(C)N1O)O.CC1(C)CC(CC(C)(C)N1O)O.CC1(C)CC(CC(C)(C)N1O)O.C(C(=O)O)C(CC(=O)O)(C(=O)O)O", "formula": "3C9H19NO2.C6H8O7", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "711.8828", "optical_activity": "NONE", "references": [ "b0e35052-6647-4e0e-ac05-bbc78a015e2d", "9b29f3cf-4bca-4350-9229-1892c0395277" ], "stereo_centers": 0 }, "unii": "7NW772I64Y" } ] }