{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c0149f43-726d-426d-b881-7db3e02d3442",
          "code": "43019-17-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=43019-17-6",
          "code_system": "CAS",
          "references": [
            "b246774a-3f40-a46d-3f78-a9f15d9a51d9"
          ]
        },
        {
          "uuid": "97607fbb-e61e-41e0-bde7-b99989b8f80f",
          "code": "7NJ9VFY9VY",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a7d5535c-7c04-925f-2c7f-3964d45e5752",
          "code": "100000076819",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "c6e02861-8bcf-e712-649f-9a6a89c7e036"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "0a70349a-5fc5-44a8-a695-8472e761657b",
          "name": "(T-4)-BIS(5-CHLORO-7-IODO-8-QUINOLINOLATO-.KAPPA.N1,.KAPPA.O8)MAGNESIUM",
          "stdName": "(T-4)-BIS(5-CHLORO-7-IODO-8-QUINOLINOLATO-.KAPPA.N1,.KAPPA.O8)MAGNESIUM",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b246774a-3f40-a46d-3f78-a9f15d9a51d9"
          ],
          "display_name": false
        },
        {
          "uuid": "cd8fc762-a68c-4410-b5c7-2fcb0464afa0",
          "name": "8-QUINOLINOL, 5-CHLORO-7-IODO-, MAGNESIUM COMPLEX",
          "stdName": "8-QUINOLINOL, 5-CHLORO-7-IODO-, MAGNESIUM COMPLEX",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b246774a-3f40-a46d-3f78-a9f15d9a51d9"
          ],
          "display_name": false
        },
        {
          "uuid": "7685378b-55aa-4509-9c8d-a3abeafdae25",
          "name": "CHINOFORM MAGNESIUM CHELATE",
          "stdName": "CHINOFORM MAGNESIUM CHELATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b246774a-3f40-a46d-3f78-a9f15d9a51d9"
          ],
          "display_name": false
        },
        {
          "uuid": "cf151601-72cf-4293-bd5f-a33a99c085ed",
          "name": "MAGNESIUM CHELATE",
          "stdName": "MAGNESIUM CHELATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b246774a-3f40-a46d-3f78-a9f15d9a51d9"
          ],
          "display_name": true
        },
        {
          "uuid": "116776c6-6641-436f-9346-dfac45413d22",
          "name": "MAGNESIUM, BIS(5-CHLORO-7-IODO-8-QUINOLINOLATO-.KAPPA.N1,.KAPPA.O8)-, (T-4)-",
          "stdName": "MAGNESIUM, BIS(5-CHLORO-7-IODO-8-QUINOLINOLATO-.KAPPA.N1,.KAPPA.O8)-, (T-4)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b246774a-3f40-a46d-3f78-a9f15d9a51d9"
          ],
          "display_name": false
        },
        {
          "uuid": "47f64eb5-8005-4cd4-8ac3-513220f9884c",
          "name": "MAGNESIUM, BIS(5-CHLORO-7-IODO-8-QUINOLINOLATO-N1,O8)-, (T-4)-",
          "stdName": "MAGNESIUM, BIS(5-CHLORO-7-IODO-8-QUINOLINOLATO-N1,O8)-, (T-4)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b246774a-3f40-a46d-3f78-a9f15d9a51d9"
          ],
          "display_name": false
        },
        {
          "uuid": "c861d893-26ba-9a92-9bab-3c5a03743ae4",
          "name": "Magnesium chelate [WHO-DD]",
          "stdName": "MAGNESIUM CHELATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8f93fcff-b8d2-c1a8-761b-7ed8996086a2"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8f93fcff-b8d2-c1a8-761b-7ed8996086a2",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b246774a-3f40-a46d-3f78-a9f15d9a51d9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c6e02861-8bcf-e712-649f-9a6a89c7e036",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "a58319a0-00bf-813d-8593-2af05d930ba2",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3dce604c-c342-fa77-6c64-c67735e56c02",
          "id": "3dce604c-c342-fa77-6c64-c67735e56c02",
          "molfile": "\n  Marvin  01132103162D          \n\n 27 32  0  0  0  0            999 V2000\n   17.8402   -3.4110    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1628   -2.9401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4163   -3.2913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.1368   -4.0675    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   15.3147   -3.9984    0.0000 Mg  0  2  0  0  0  0  0  0  0  0  0  0\n   14.9924   -3.1716    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7389   -2.8204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8081   -1.9983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.5546   -1.6472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2320   -2.1180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6236   -0.8250    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   15.1307   -1.5274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3841   -1.8786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3150   -2.7007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5593   -4.7863    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8855   -5.2624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2245   -4.7687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4898   -3.9875    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   13.5783   -5.2999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8385   -4.9348    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5502   -6.1244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2678   -6.5314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9609   -6.0839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7101   -6.4293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3838   -5.9533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3085   -5.1317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2915   -7.3560    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2 10  2  0  0  0  0\n  3  4  1  0  0  0  0\n  3  7  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 15  1  0  0  0  0\n  5 18  1  0  0  0  0\n  7  6  1  0  0  0  0\n  6 14  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  2  0  0  0  0\n  8 12  1  0  0  0  0\n 10  9  1  0  0  0  0\n  9 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 26  2  0  0  0  0\n 16 17  1  0  0  0  0\n 16 23  2  0  0  0  0\n 18 17  1  0  0  0  0\n 17 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  1  0  0  0  0\n 22 21  2  0  0  0  0\n 23 22  1  0  0  0  0\n 22 27  1  0  0  0  0\n 23 24  1  0  0  0  0\n 25 24  2  0  0  0  0\n 26 25  1  0  0  0  0\nM  CHG  3   4  -1   5   2  18  -1\nM  END",
          "smiles": "C1=Cc2c(cc(c3c2N(=C1)[Mg+2]4(N5=CC=Cc6c(cc(c(c65)[O-]4)I)Cl)[O-]3)I)Cl",
          "formula": "C18H10Cl2I2MgN2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9601e9d3-4342-4c24-8113-df0110b0c659"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "635.3047",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "af2dcbd5-2d04-477c-ba87-44dc439d45df",
      "version": "11",
      "structure": {
        "id": "221bae14-2052-8977-5b14-0647fffb7181",
        "molfile": "Magnesium, bis(5-chloro-7-iodo-8-quinolinolato-.kappa.N1,.kappa.O8)-, (T-4)-\n  Marvin  01132101552D          \n\n 27 32  0  0  0  0            999 V2000\n   17.8402   -3.4110    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1628   -2.9401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4163   -3.2913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.1368   -4.0675    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   15.3147   -3.9984    0.0000 Mg  0  2  0  0  0  0  0  0  0  0  0  0\n   14.9924   -3.1716    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7389   -2.8204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.8081   -1.9983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.5546   -1.6472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2320   -2.1180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6236   -0.8250    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   15.1307   -1.5274    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3841   -1.8786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3150   -2.7007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5593   -4.7863    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8855   -5.2624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2245   -4.7687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4898   -3.9875    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   13.5783   -5.2999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.8385   -4.9348    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5502   -6.1244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2678   -6.5314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9609   -6.0839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7101   -6.4293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3838   -5.9533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3085   -5.1317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2915   -7.3560    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  3  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n  2 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n  8 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 14 13  1  0  0  0  0\n  6 14  2  0  0  0  0\n  5 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  1  0  0  0  0\n  5 18  1  0  0  0  0\n 17 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  1  0  0  0  0\n 22 21  2  0  0  0  0\n 23 22  1  0  0  0  0\n 16 23  2  0  0  0  0\n 23 24  1  0  0  0  0\n 25 24  2  0  0  0  0\n 26 25  1  0  0  0  0\n 15 26  2  0  0  0  0\n 22 27  1  0  0  0  0\nM  CHG  3   4  -1   5   2  18  -1\nM  END",
        "smiles": "C1=Cc2c(cc(c3c2N(=C1)[Mg+2]4(N5=CC=Cc6c(cc(c(c65)[O-]4)I)Cl)[O-]3)I)Cl",
        "formula": "C18H10Cl2I2MgN2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "635.3047",
        "optical_activity": "NONE",
        "references": [
          "b246774a-3f40-a46d-3f78-a9f15d9a51d9"
        ],
        "stereo_centers": 0
      },
      "unii": "7NJ9VFY9VY"
    }
  ]
}