{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ecdf9521-5149-4eb5-8000-fb5b74be16bd",
          "code": "N0000175080",
          "comments": "Cellular or Molecular Interactions [MoA]|Enzyme Interactions [MoA]|Enzyme Inhibitors [MoA]|Steroid Synthesis Inhibitors [MoA]|Sex Hormone Synthesis Inhibitors [MoA]|Estrogen Synthesis Inhibitors [MoA]|Aromatase Inhibitors [MoA]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175080",
          "code_system": "NDF-RT",
          "references": [
            "e392ad1e-14a4-41cf-a96c-6aa836f6ae94"
          ]
        },
        {
          "uuid": "8ef2f37a-a12b-421e-8a69-a39a933ea3fd",
          "code": "N0000175563",
          "comments": "Established Pharmacologic Class [EPC]|Aromatase Inhibitor [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175563",
          "code_system": "NDF-RT",
          "references": [
            "e392ad1e-14a4-41cf-a96c-6aa836f6ae94"
          ]
        },
        {
          "uuid": "90ded9fc-e674-430f-bb7b-5b362a8ee94d",
          "code": "L02BG04",
          "comments": "ATC|ANTINEOPLASTIC AND IMMUNOMODULATING AGENTS|ENDOCRINE THERAPY|HORMONE ANTAGONISTS AND RELATED AGENTS|Enzyme inhibitors|letrozole",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=L02BG04&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "e392ad1e-14a4-41cf-a96c-6aa836f6ae94"
          ]
        },
        {
          "uuid": "5157d32f-a766-401a-abba-a7c65ccf4e43",
          "code": "QL02BG04",
          "comments": "VATC|ENDOCRINE THERAPY|HORMONE ANTAGONISTS AND RELATED AGENTS|Aromatase inhibitors|letrozole",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QL02BG04&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "e392ad1e-14a4-41cf-a96c-6aa836f6ae94"
          ]
        },
        {
          "uuid": "59431ce6-7164-47ca-b6be-2118e2cf4c49",
          "code": "112809-51-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=112809-51-5",
          "code_system": "CAS",
          "references": [
            "e392ad1e-14a4-41cf-a96c-6aa836f6ae94",
            "d249bc1a-1ea9-42d2-94bf-7d05ea1b8bd5"
          ]
        },
        {
          "uuid": "2bca3900-8312-4e2b-9d9a-f1429cefabe2",
          "code": "C1527",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1527",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e392ad1e-14a4-41cf-a96c-6aa836f6ae94"
          ]
        },
        {
          "uuid": "862ff932-a63f-4d60-989a-401618553308",
          "code": "C067431",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67067431",
          "code_system": "MESH",
          "references": [
            "e392ad1e-14a4-41cf-a96c-6aa836f6ae94"
          ]
        },
        {
          "uuid": "38986d43-518e-4f3f-b780-c724679bb8e9",
          "code": "NBK548381",
          "comments": "LiverTox|Antineoplastic|Breast Cancer|Antiestrogen",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/NBK548381/",
          "code_system": "LIVERTOX",
          "references": [
            "e6be533a-d2d6-4561-b9d1-febcc8a66fc5"
          ]
        },
        {
          "uuid": "b82c8402-25e4-45f1-8f16-7b3883e22d69",
          "code": "LETROZOLE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Letrozole",
          "code_system": "WIKIPEDIA",
          "references": [
            "e392ad1e-14a4-41cf-a96c-6aa836f6ae94"
          ]
        },
        {
          "uuid": "d0c19f63-514a-4425-b0c2-da08acee0124",
          "code": "SUB08444MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "e392ad1e-14a4-41cf-a96c-6aa836f6ae94"
          ]
        },
        {
          "uuid": "fcaed3a0-7ccf-4d5b-a0b8-9e278161cbd0",
          "code": "7118",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=7118",
          "code_system": "INN",
          "references": [
            "e392ad1e-14a4-41cf-a96c-6aa836f6ae94"
          ]
        },
        {
          "uuid": "4174b786-e8d9-45ff-a946-2e79cd5e996c",
          "code": "5209",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=5209",
          "code_system": "IUPHAR",
          "references": [
            "e392ad1e-14a4-41cf-a96c-6aa836f6ae94"
          ]
        },
        {
          "uuid": "2caddd98-b3d0-4b03-a3a1-05c85805821f",
          "code": "72965",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/72965/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "e392ad1e-14a4-41cf-a96c-6aa836f6ae94"
          ]
        },
        {
          "uuid": "10a71fcb-867c-4252-91ee-ba93775fc759",
          "code": "m6772",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6772?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "e392ad1e-14a4-41cf-a96c-6aa836f6ae94"
          ]
        },
        {
          "uuid": "5494e9e6-9a95-4a75-93fb-2da264ea0f76",
          "code": "DB01006",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB01006",
          "code_system": "DRUG BANK",
          "references": [
            "e392ad1e-14a4-41cf-a96c-6aa836f6ae94"
          ]
        },
        {
          "uuid": "250ce10e-f67f-4554-83c3-b6b3d21f7888",
          "code": "CHEMBL1444",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1444",
          "code_system": "ChEMBL",
          "references": [
            "e392ad1e-14a4-41cf-a96c-6aa836f6ae94"
          ]
        },
        {
          "uuid": "c9ab1bb3-a89b-435a-b156-1a056317d197",
          "code": "3902",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3902",
          "code_system": "PUBCHEM",
          "references": [
            "e392ad1e-14a4-41cf-a96c-6aa836f6ae94"
          ]
        },
        {
          "uuid": "ba45bfc1-d834-1090-fc7f-2d5a661d9f57",
          "code": "7461",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7461",
          "code_system": "HSDB",
          "references": [
            "f88b544d-1368-0cfe-a13c-ce8881d58d5a"
          ]
        },
        {
          "uuid": "a9d3640f-e772-d625-c63b-584b8927cdd2",
          "code": "DTXSID4023202",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4023202",
          "code_system": "EPA CompTox",
          "references": [
            "4f17f8b2-b3e6-9831-e980-d4a37969518d"
          ]
        },
        {
          "uuid": "f4f472a5-2fe1-fbcf-6ef2-f50c1e955e2e",
          "code": "C2018",
          "comments": "Pharmacologic Substance[C1909]|Antineoplastic Agent[C274]|Antineoplastic Protein Inhibitor[C129824]|Antineoplastic Enzyme Inhibitor[C129825]|Aromatase Inhibitor[C1740]|Non-Steroidal Aromatase Inhibitor",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2018",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e6be533a-d2d6-4561-b9d1-febcc8a66fc5"
          ]
        },
        {
          "uuid": "a7a46dec-cdf6-4fba-a7d1-7ad849633ac5",
          "code": "7LKK855W8I",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "dff49529-79ac-75f5-311c-b8acf95c5a87",
          "code": "Letrozole",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM1344/",
          "code_system": "LACTMED",
          "references": [
            "e6be533a-d2d6-4561-b9d1-febcc8a66fc5"
          ]
        },
        {
          "uuid": "4a28ca34-b823-8cd6-f7ae-a4df4aacd336",
          "code": "1556",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1556",
          "code_system": "DRUG CENTRAL",
          "references": [
            "e6be533a-d2d6-4561-b9d1-febcc8a66fc5"
          ]
        },
        {
          "uuid": "78a550e0-6434-8f39-c696-9248b3103ff2",
          "code": "6413",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:6413",
          "code_system": "CHEBI",
          "references": [
            "e6be533a-d2d6-4561-b9d1-febcc8a66fc5"
          ]
        },
        {
          "uuid": "d4daf92d-7f91-9723-4c2d-512f82ee1826",
          "code": "1356971",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1356971",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "e6be533a-d2d6-4561-b9d1-febcc8a66fc5"
          ]
        },
        {
          "uuid": "42e74419-269a-60ce-aa6a-82b7581db2ef",
          "code": "EE-48",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/EE-48/relevant/1/",
          "code_system": "USAN",
          "references": [
            "428729b9-dcbf-9487-305b-67876e4729ef"
          ]
        },
        {
          "uuid": "c36893c1-63f9-892e-7634-3a33b947482a",
          "code": "7LKK855W8I",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=7LKK855W8I",
          "code_system": "DAILYMED",
          "references": [
            "1d6f8df3-f1be-de66-7a17-a789a096dd78"
          ]
        },
        {
          "uuid": "95269f26-c7b4-2463-3e88-68794c562b23",
          "code": "100000092486",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "6bfa6119-f24f-b4ae-8a70-bfac954d67f9"
          ]
        },
        {
          "uuid": "f02d38c3-aaa3-445c-fc01-5f6e70df57f1",
          "code": "759652",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=759652",
          "code_system": "NSC",
          "references": [
            "44d7c758-4e11-a178-e197-f988edbec03a"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "a221b900-5f70-408e-91f8-61a17ed1c3e6",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "3d30f401-fedb-4bfa-891c-63488415ef06",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3e296615-7440-48ea-8c6c-c8550543e83e",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "68d4980f-dac7-4505-9c13-0e2cc90d6b22",
          "citation": "INN Proposed List 70",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL70.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e88e2476-2054-4947-abcb-2a7327122365",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b87a78e4-6e3a-4ab3-8bc2-e64dc6f5689d",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5f10569b-055a-4102-ad8b-65b6dfc35632",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e27b902e-1904-4980-9acf-661dca573bde",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4b839b0b-4da0-42e0-9e0e-a59e12dd4e6b",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c177b780-d2ec-4a7b-b7f9-a6c2cfef7e0b",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3964a9f4-8c13-46dd-889b-0ad8652d2051",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "512391ab-1112-4b82-873f-d4f263da2dee",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e07927db-ea71-41d5-8108-c9b6a1ac575d",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6f2b5eb6-8d42-40b9-9d09-c4f41682a282",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "72b0726b-3337-40f1-a074-adf880282442",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e392ad1e-14a4-41cf-a96c-6aa836f6ae94",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390522000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "68039fd1-507c-4133-8642-318bdc69c70a",
          "citation": "EP 7.8 LETROZOLE MONOGRAPH",
          "doc_type": "EUROPEAN PHARMACOPEIA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9f9efacd-6dec-4ddd-8a0c-7cab20150e2c",
          "citation": "USP 36 LETROZOLE MONOGRAPH",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "66a2c2f9-ed64-4752-8c7c-5d41f950bea0",
          "citation": "JOURNAL OF CHROMATOGRAPHY B: BIOMEDICAL SCIENCES AND APPLICATIONS, VOLUME 683, ISSUE 2, 30 AUGUST 1996, PAGES 251?258",
          "url": "http://www.sciencedirect.com/science/article/pii/0378434796001181#",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "708b7ffc-3d6d-4b8d-a74f-80e422b5f320",
          "citation": "http://www.accessdata.fda.gov/spl/data/effc4ce8-4df7-4c94-86fd-a457323fba9b/effc4ce8-4df7-4c94-86fd-a457323fba9b.xml",
          "url": "http://www.accessdata.fda.gov/spl/data/effc4ce8-4df7-4c94-86fd-a457323fba9b/effc4ce8-4df7-4c94-86fd-a457323fba9b.xml",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "27db752a-3aec-4ea0-ba7f-0dca4bafe0be",
          "citation": "SRS import [7LKK855W8I]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7LKK855W8I",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390522000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "392b8082-2ebf-4492-aec5-0dd44db712e9",
          "citation": "LETROZOLE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1fca2694-91a3-4031-a2ca-a0e50e4f5665",
          "citation": "LETROZOLE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e2596de2-3911-484a-bcf6-ebe370998fec",
          "citation": "LETROZOLE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0f1ac61f-e0d4-4bfc-a2c1-b6153929d0be",
          "citation": "LETROZOLE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "36897414-dfe9-4adc-8f7b-252705470e36",
          "citation": "LETROZOLE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c86b37ba-48aa-4700-bfa3-bbbc2215fa18",
          "citation": "LETROZOLE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d171154e-5e42-4fd5-bede-96e9340733ea",
          "citation": "LETROZOLE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "89aea5ba-650b-45af-addc-d86be76ed87e",
          "citation": "LETROZOLE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "634ba2cb-7f16-4a05-8589-3dea1b2900a0",
          "citation": "LETROZOLE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "48c79aa0-5392-4b6b-8a47-fb314801d9ae",
          "citation": "LETROZOLE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1683d1ea-219c-4664-be19-24c30759fe5c",
          "citation": "LETROZOLE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c1952ad6-9528-458c-8650-e736fadee5b6",
          "citation": "LETROZOLE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a44b9cc5-26b3-5c9d-b674-382c26aadcb0",
          "citation": "SCIFINDER",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "4f17f8b2-b3e6-9831-e980-d4a37969518d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=112809-51-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f88b544d-1368-0cfe-a13c-ce8881d58d5a",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+112809-51-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e66e859f-86e7-92ef-43e4-4736e3ef7d95",
          "citation": "Drug Information Handbook, 2016-2017 - 25th edition;  Lexicomp Drug Reference Handbook;  ISBN13: 9781591953531",
          "doc_type": "BOOK",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e6be533a-d2d6-4561-b9d1-febcc8a66fc5",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "d249bc1a-1ea9-42d2-94bf-7d05ea1b8bd5",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "428729b9-dcbf-9487-305b-67876e4729ef",
          "citation": "USAD COUN",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "51c96e1c-078e-6c88-9039-5456e3eb9553",
          "citation": "Precht, Jana C., et al. \"The letrozole phase 1 metabolite carbinol as a novel probe drug for UGT2B7.\" Drug Metabolism and Disposition 41.11 (2013): 1906-1913.",
          "url": "http://dmd.aspetjournals.org/content/dmd/41/11/1906.full.pdf",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "27eff28e-f3a0-d6a4-7280-0b28c650b235",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "ea4b0d6d-55ac-aa02-f50a-2086416479c3",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "44d7c758-4e11-a178-e197-f988edbec03a",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "1d6f8df3-f1be-de66-7a17-a789a096dd78",
          "citation": "https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=63e54b62-a30d-4a56-9215-75e7a0b0bf02",
          "url": "https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=63e54b62-a30d-4a56-9215-75e7a0b0bf02",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "c06feaa6-24d9-a198-ceb4-acc9f72125ed",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "6bfa6119-f24f-b4ae-8a70-bfac954d67f9",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "ec11533e-c5e9-4972-83d0-1020584361fd",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "fe7f7722-334e-4abc-8565-19b14d863619",
          "id": "fe7f7722-334e-4abc-8565-19b14d863619",
          "molfile": "\n  Marvin  01132113102D          \n\n 22 24  0  0  0  0            999 V2000\n    6.6629   -9.4312    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9479   -9.0200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2276   -8.6062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5126   -8.9991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8055   -8.6062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8055   -7.7734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5126   -7.3491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2276   -7.7734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0591   -7.3805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3441   -7.7969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6369   -7.3962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9612   -7.8284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9612   -8.6534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6684   -9.0541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3598   -8.6298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2462   -9.0671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4688   -9.4784    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0591   -6.5398    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2891   -6.0291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6269   -5.3219    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4441   -5.3219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8055   -6.0134    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  3  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  8  2  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  2  0  0  0  0\n  6  9  1  0  0  0  0\n  8  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n  9 18  1  0  0  0  0\n 11 10  1  0  0  0  0\n 15 10  2  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 16 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 17 16  3  0  0  0  0\n 19 18  1  0  0  0  0\n 22 18  1  0  0  0  0\n 20 19  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  2  0  0  0  0\nM  END",
          "smiles": "c1cc(ccc1C#N)C(c2ccc(cc2)C#N)n3cncn3",
          "formula": "C17H11N5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "521b43fc-db27-46a2-a136-62a968d0860c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "285.3034",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1ef97fd8-908f-4512-8611-0e87327d31bf",
      "version": "47",
      "structure": {
        "id": "1bf8e971-6421-4971-b24d-7e18bacc8940",
        "molfile": "\n  Marvin  01132101382D          \n\n 22 24  0  0  0  0            999 V2000\n    3.0591   -6.5398    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6269   -5.3219    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8055   -6.0134    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2891   -6.0291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6629   -9.4312    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4688   -9.4784    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4441   -5.3219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0591   -7.3805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2462   -9.0671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9479   -9.0200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8055   -7.7734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3441   -7.7969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8055   -8.6062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3598   -8.6298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5126   -7.3491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6369   -7.3962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2276   -8.6062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9612   -8.6534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5126   -8.9991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9612   -7.8284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2276   -7.7734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6684   -9.0541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  4  2  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5 10  3  0  0  0  0\n  6  9  3  0  0  0  0\n  7  3  2  0  0  0  0\n  8  1  1  0  0  0  0\n  9 18  1  0  0  0  0\n 10 17  1  0  0  0  0\n 11  8  1  0  0  0  0\n 12  8  1  0  0  0  0\n 13 11  1  0  0  0  0\n 14 12  2  0  0  0  0\n 15 11  2  0  0  0  0\n 16 12  1  0  0  0  0\n 17 21  2  0  0  0  0\n 18 20  1  0  0  0  0\n 19 13  2  0  0  0  0\n 20 16  2  0  0  0  0\n 21 15  1  0  0  0  0\n 22 14  1  0  0  0  0\n  2  7  1  0  0  0  0\n 22 18  2  0  0  0  0\n 17 19  1  0  0  0  0\nM  END",
        "smiles": "c1cc(ccc1C#N)C(c2ccc(cc2)C#N)n3cncn3",
        "formula": "C17H11N5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "285.3034",
        "optical_activity": "NONE",
        "references": [
          "3d30f401-fedb-4bfa-891c-63488415ef06",
          "27db752a-3aec-4ea0-ba7f-0dca4bafe0be",
          "68d4980f-dac7-4505-9c13-0e2cc90d6b22"
        ],
        "stereo_centers": 0
      },
      "unii": "7LKK855W8I",
      "relationships": [
        {
          "uuid": "feca0ba4-cd6e-434e-80b0-311ab3d934e3",
          "amount": {
            "uuid": "941feda5-5485-4a1a-a757-414eaba17f79"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "c25b8f3f-c8ea-44e9-8995-0bb367376a21",
            "refuuid": "1ef97fd8-908f-4512-8611-0e87327d31bf",
            "name": "Letrozole",
            "unii": "7LKK855W8I",
            "linking_id": "7LKK855W8I",
            "ref_pname": "Letrozole",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "32ab89db-89a7-4c08-9d81-8de8936ef4ac",
          "amount": {
            "uuid": "92b47fb2-5771-423e-bd95-f85effa06c90",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.3
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "68039fd1-507c-4133-8642-318bdc69c70a"
          ],
          "related_substance": {
            "uuid": "ba43cd83-4cce-4df0-aec3-7973138cbd80",
            "refuuid": "d26d62b2-877e-46dc-9759-b173cdf5c981",
            "name": "4,4'-(1H-1,3,4-Triazol-1-ylmethylene)dibenzonitrile",
            "unii": "7VSW8QP34K",
            "linking_id": "7VSW8QP34K",
            "ref_pname": "4,4'-(1H-1,3,4-Triazol-1-ylmethylene)dibenzonitrile",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1436d9d8-5d30-45dc-821b-791e753250eb",
          "amount": {
            "uuid": "a53b79a0-e5e6-4975-a9d4-5d73aca83c75",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.3
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "9f9efacd-6dec-4ddd-8a0c-7cab20150e2c"
          ],
          "related_substance": {
            "uuid": "b4ef759e-3a03-4388-a340-f27716da787f",
            "refuuid": "d26d62b2-877e-46dc-9759-b173cdf5c981",
            "name": "4,4'-(1H-1,3,4-Triazol-1-ylmethylene)dibenzonitrile",
            "unii": "7VSW8QP34K",
            "linking_id": "7VSW8QP34K",
            "ref_pname": "4,4'-(1H-1,3,4-Triazol-1-ylmethylene)dibenzonitrile",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6788ff03-9402-4077-949f-f22e122967ea",
          "amount": {
            "uuid": "72dabc48-803a-4a33-af83-07f003cf0c0c",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.2
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "68039fd1-507c-4133-8642-318bdc69c70a"
          ],
          "related_substance": {
            "uuid": "08d8b563-bb97-47f3-b6fa-f9c26a00be2b",
            "refuuid": "7571d9e9-c2ad-4971-be19-774fdf8f07da",
            "name": "4,4',4''-Methanetriyltribenzonitrile",
            "unii": "95R62HNG30",
            "linking_id": "95R62HNG30",
            "ref_pname": "4,4',4''-Methanetriyltribenzonitrile",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "67460eda-cc5e-40cc-9e9b-571280124a5b",
          "amount": {
            "uuid": "58804960-a5c7-456b-ad11-d3590465fcc3",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.2
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "9f9efacd-6dec-4ddd-8a0c-7cab20150e2c"
          ],
          "related_substance": {
            "uuid": "45d6915a-77f0-4c0d-8d3d-b24422d8c4ac",
            "refuuid": "7571d9e9-c2ad-4971-be19-774fdf8f07da",
            "name": "4,4',4''-Methanetriyltribenzonitrile",
            "unii": "95R62HNG30",
            "linking_id": "95R62HNG30",
            "ref_pname": "4,4',4''-Methanetriyltribenzonitrile",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "30374524-583e-47d2-a1ff-1c6fd5704b73",
          "amount": {
            "uuid": "b8237860-601f-446f-88c3-ca7d165b2c9e",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 102,
            "low_limit": 97.5
          },
          "qualification": "EP",
          "type": "BASIS OF STRENGTH->SUBSTANCE",
          "interaction_type": "ASSAY (HPLC)",
          "references": [
            "68039fd1-507c-4133-8642-318bdc69c70a"
          ],
          "related_substance": {
            "uuid": "7be19cc9-af25-46e6-a6d3-114a8c1cb58c",
            "refuuid": "1ef97fd8-908f-4512-8611-0e87327d31bf",
            "name": "Letrozole",
            "unii": "7LKK855W8I",
            "linking_id": "7LKK855W8I",
            "ref_pname": "Letrozole",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a4c4cbc9-2bc8-4946-a8f2-f441c9e7a4a4",
          "amount": {
            "uuid": "c0352c7a-6b59-4d0c-9490-1d58ddd7d83a",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 102,
            "low_limit": 98
          },
          "qualification": "USP",
          "type": "BASIS OF STRENGTH->SUBSTANCE",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "9f9efacd-6dec-4ddd-8a0c-7cab20150e2c"
          ],
          "related_substance": {
            "uuid": "cdbd442d-1a89-4b31-9e5d-e1c764ced451",
            "refuuid": "1ef97fd8-908f-4512-8611-0e87327d31bf",
            "name": "Letrozole",
            "unii": "7LKK855W8I",
            "linking_id": "7LKK855W8I",
            "ref_pname": "Letrozole",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "255af794-2e76-4da4-bb5e-da02aa14cbf0",
          "amount": {
            "uuid": "a0db83e4-90cf-4405-91f6-f58f6ccbd297"
          },
          "qualification": "URINE",
          "type": "METABOLITE->PARENT",
          "interaction_type": "MAJOR",
          "references": [
            "708b7ffc-3d6d-4b8d-a74f-80e422b5f320"
          ],
          "related_substance": {
            "uuid": "0a2b61a6-4806-4bf3-88cf-318992fe9b88",
            "refuuid": "637de078-0465-4585-a967-76301c589143",
            "name": "CGP-4645 GLUCURONIDE",
            "unii": "SV3F5P90JR",
            "linking_id": "SV3F5P90JR",
            "ref_pname": "CGP-4645 GLUCURONIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f9db0e74-1762-4aad-b740-ddd5b05ae316",
          "amount": {
            "uuid": "cfe7a24b-d84b-407b-9876-8644018d2925"
          },
          "type": "METABOLIC ENZYME->SUBSTRATE",
          "references": [
            "51c96e1c-078e-6c88-9039-5456e3eb9553"
          ],
          "related_substance": {
            "uuid": "54fb29dc-3397-4c8d-b4c7-fee120b4dfcc",
            "refuuid": "e720bbda-7ff3-4519-9e1c-8a4880de5e0f",
            "name": "URIDINE DIPHOSPHATE GLUCURONOSYLTRANSFERASE 2B7",
            "unii": "0M77ZW789J",
            "linking_id": "0M77ZW789J",
            "ref_pname": "URIDINE DIPHOSPHATE GLUCURONOSYLTRANSFERASE 2B7",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "5c4cf8a9-0b9c-4625-bb04-7665fee41aca",
          "amount": {
            "uuid": "5238a584-11fa-4713-9a75-8b9ff4ea2153"
          },
          "type": "METABOLIC ENZYME->SUBSTRATE",
          "references": [
            "51c96e1c-078e-6c88-9039-5456e3eb9553"
          ],
          "related_substance": {
            "uuid": "b73e9bb1-d240-499f-ac32-20885469411d",
            "refuuid": "660246ec-9ab8-48a7-935b-3c32fc934075",
            "name": "CYTOCHROME P450 2A6",
            "unii": "246D9TQ2XG",
            "linking_id": "246D9TQ2XG",
            "ref_pname": "CYTOCHROME P450 2A6",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "edafc142-168b-4f43-917e-077c04b968fa",
          "amount": {
            "uuid": "35c4d7d5-1ba8-4058-abca-f7d51b7aa3f7"
          },
          "type": "METABOLIC ENZYME->SUBSTRATE",
          "references": [
            "51c96e1c-078e-6c88-9039-5456e3eb9553"
          ],
          "related_substance": {
            "uuid": "b7dbcc7b-2223-4e81-a05c-7759ae66cc1f",
            "refuuid": "4275827d-e329-4907-95b5-7d690692872a",
            "name": "CYTOCHROME P450 3A4",
            "unii": "PUO0521HZV",
            "linking_id": "PUO0521HZV",
            "ref_pname": "CYTOCHROME P450 3A4",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "fee22711-2792-4748-9e09-4f0bd2bfb642",
          "amount": {
            "uuid": "71d59547-2f5e-4556-a0b8-e7765aa4f31a"
          },
          "comments": "Competitive inhibitor of the aromatase enzyme system; it inhibits the conversion of androgens to estrogens. Inhibits the aromatase enzyme by competitively binding to the heme of the cytochrome P450 subunit of the enzyme, resulting in a reduction of estrogen biosynthesis in all tissues. ",
          "type": "TARGET->INHIBITOR",
          "references": [
            "1d6f8df3-f1be-de66-7a17-a789a096dd78"
          ],
          "related_substance": {
            "uuid": "c94a4d53-4226-49f8-9857-db0cad49337c",
            "refuuid": "70e8c0ca-1be9-4f92-9bd1-8a4e425ade20",
            "name": "CYTOCHROME P450 19A1",
            "unii": "CWT22I5484",
            "linking_id": "CWT22I5484",
            "ref_pname": "CYTOCHROME P450 19A1",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "b7d00b98-e71f-4b79-a62f-cab972cd522f",
          "name": "4,4′-(1H-1,2,4-Triazol-1-ylmethylene)bis[benzonitrile]",
          "stdName": "4,4'-(1H-1,2,4-TRIAZOL-1-YLMETHYLENE)BIS(BENZONITRILE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ec11533e-c5e9-4972-83d0-1020584361fd"
          ],
          "display_name": false
        },
        {
          "uuid": "157b264b-35cc-4b1a-9607-6318ed890a91",
          "name": "4,4′-(1H-1,2,4-Triazol-1-ylmethylene)dibenzonitrile",
          "stdName": "4,4'-(1H-1,2,4-TRIAZOL-1-YLMETHYLENE)DIBENZONITRILE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3e296615-7440-48ea-8c6c-c8550543e83e"
          ],
          "display_name": false
        },
        {
          "uuid": "de00a42c-0463-43b0-add7-1d098d16e2cf",
          "name": "Benzonitrile, 4,4′-(1H-1,2,4-triazol-1-ylmethylene)bis-",
          "stdName": "BENZONITRILE, 4,4'-(1H-1,2,4-TRIAZOL-1-YLMETHYLENE)BIS-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3e296615-7440-48ea-8c6c-c8550543e83e"
          ],
          "display_name": false
        },
        {
          "uuid": "478e2967-46fa-4d53-9711-28fa16951843",
          "name": "CGS-20267",
          "stdName": "CGS-20267",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a221b900-5f70-408e-91f8-61a17ed1c3e6"
          ],
          "display_name": false
        },
        {
          "uuid": "00875345-7e75-4163-92d0-a9c75d323dac",
          "name": "CGS20267",
          "stdName": "CGS20267",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3e296615-7440-48ea-8c6c-c8550543e83e"
          ],
          "display_name": false
        },
        {
          "uuid": "3a8e464d-fe28-4b72-b584-f259c4fecd52",
          "name": "FEMARA",
          "stdName": "FEMARA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3e296615-7440-48ea-8c6c-c8550543e83e"
          ],
          "display_name": false
        },
        {
          "uuid": "4b4edc4c-3f5f-49d6-80a3-bc8e94f84451",
          "name": "KISQALI FEMARA CO-PACK COMPONENT LETROZOLE",
          "stdName": "KISQALI FEMARA CO-PACK COMPONENT LETROZOLE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a44b9cc5-26b3-5c9d-b674-382c26aadcb0"
          ],
          "display_name": false
        },
        {
          "uuid": "2bed4868-24ca-4e9d-b7a6-5130de3cc560",
          "name": "Letrozole",
          "stdName": "LETROZOLE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1683d1ea-219c-4664-be19-24c30759fe5c",
            "d171154e-5e42-4fd5-bede-96e9340733ea",
            "1fca2694-91a3-4031-a2ca-a0e50e4f5665",
            "e2596de2-3911-484a-bcf6-ebe370998fec",
            "6f2b5eb6-8d42-40b9-9d09-c4f41682a282",
            "e07927db-ea71-41d5-8108-c9b6a1ac575d",
            "36897414-dfe9-4adc-8f7b-252705470e36",
            "c1952ad6-9528-458c-8650-e736fadee5b6",
            "3964a9f4-8c13-46dd-889b-0ad8652d2051",
            "72b0726b-3337-40f1-a074-adf880282442",
            "e88e2476-2054-4947-abcb-2a7327122365",
            "392b8082-2ebf-4492-aec5-0dd44db712e9",
            "c177b780-d2ec-4a7b-b7f9-a6c2cfef7e0b",
            "0f1ac61f-e0d4-4bfc-a2c1-b6153929d0be",
            "e27b902e-1904-4980-9acf-661dca573bde",
            "634ba2cb-7f16-4a05-8589-3dea1b2900a0",
            "b87a78e4-6e3a-4ab3-8bc2-e64dc6f5689d",
            "48c79aa0-5392-4b6b-8a47-fb314801d9ae",
            "89aea5ba-650b-45af-addc-d86be76ed87e",
            "3d30f401-fedb-4bfa-891c-63488415ef06",
            "512391ab-1112-4b82-873f-d4f263da2dee",
            "c86b37ba-48aa-4700-bfa3-bbbc2215fa18",
            "68d4980f-dac7-4505-9c13-0e2cc90d6b22",
            "4b839b0b-4da0-42e0-9e0e-a59e12dd4e6b",
            "5f10569b-055a-4102-ad8b-65b6dfc35632"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "f28bde65-9d1a-4e71-a46c-36546f7c8fed",
              "name_org": "INN"
            },
            {
              "uuid": "970f08c5-6c12-4bae-a165-9d2cbc110a35",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "a4624314-4e38-c755-49d3-d30e333c1545",
          "name": "Letrozole [EP IMPURITY]",
          "stdName": "LETROZOLE [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b87a78e4-6e3a-4ab3-8bc2-e64dc6f5689d"
          ],
          "display_name": false
        },
        {
          "uuid": "ac665563-1d24-057c-1a98-7f30ee970cab",
          "name": "Letrozole [EP MONOGRAPH]",
          "stdName": "LETROZOLE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ea4b0d6d-55ac-aa02-f50a-2086416479c3"
          ],
          "display_name": false
        },
        {
          "uuid": "e6c49d68-03b2-41ac-9572-b5ff44542a47",
          "name": "Letrozole [HSDB]",
          "stdName": "LETROZOLE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "512391ab-1112-4b82-873f-d4f263da2dee"
          ],
          "display_name": false
        },
        {
          "uuid": "e3c2d511-94bb-47eb-8b2a-3f0e0df871ab",
          "name": "Letrozole [INN]",
          "stdName": "LETROZOLE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68d4980f-dac7-4505-9c13-0e2cc90d6b22"
          ],
          "display_name": false
        },
        {
          "uuid": "9691378b-7972-4318-b66a-24cfc2697578",
          "name": "Letrozole [JAN]",
          "stdName": "LETROZOLE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e27b902e-1904-4980-9acf-661dca573bde"
          ],
          "display_name": false
        },
        {
          "uuid": "4c38ff86-943a-42d0-8886-a4dadaf3dfe2",
          "name": "Letrozole [MART.]",
          "stdName": "LETROZOLE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c177b780-d2ec-4a7b-b7f9-a6c2cfef7e0b"
          ],
          "display_name": false
        },
        {
          "uuid": "8dabcbe2-e7df-49ec-8c1f-8b9a11e0a7d7",
          "name": "Letrozole [MI]",
          "stdName": "LETROZOLE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3964a9f4-8c13-46dd-889b-0ad8652d2051"
          ],
          "display_name": false
        },
        {
          "uuid": "1be23a73-1b87-4a43-92d0-d50da40b931e",
          "name": "Letrozole [ORANGE BOOK]",
          "stdName": "LETROZOLE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4b839b0b-4da0-42e0-9e0e-a59e12dd4e6b"
          ],
          "display_name": false
        },
        {
          "uuid": "37420db3-6f77-4d66-a73a-4d00561e06b5",
          "name": "Letrozole [USAN]",
          "stdName": "LETROZOLE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e88e2476-2054-4947-abcb-2a7327122365"
          ],
          "display_name": false
        },
        {
          "uuid": "1c12eba8-792e-dc5c-9283-1e602c9541a1",
          "name": "Letrozole [USP MONOGRAPH]",
          "stdName": "LETROZOLE [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "27eff28e-f3a0-d6a4-7280-0b28c650b235"
          ],
          "display_name": false
        },
        {
          "uuid": "5dc431ee-8692-474d-a62c-733b4b656097",
          "name": "Letrozole [USP-RS]",
          "stdName": "LETROZOLE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e07927db-ea71-41d5-8108-c9b6a1ac575d"
          ],
          "display_name": false
        },
        {
          "uuid": "d8e34871-9cdb-bce6-1e48-142f9c96105d",
          "name": "Letrozole [WHO-DD]",
          "stdName": "LETROZOLE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c06feaa6-24d9-a198-ceb4-acc9f72125ed"
          ],
          "display_name": false
        },
        {
          "uuid": "defd1823-5681-8da3-16de-0684ec03630c",
          "name": "NSC-759652",
          "stdName": "NSC-759652",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "44d7c758-4e11-a178-e197-f988edbec03a"
          ],
          "display_name": false
        }
      ],
      "properties": [
        {
          "uuid": "b0950b4d-52c2-4e5d-a517-b11f60a0a30f",
          "name": "Volume of Distribution",
          "value": {
            "uuid": "da5ae783-d737-4d69-a0fb-235b116c6f63",
            "average": 1.9,
            "units": "Liters/Kilogram"
          },
          "defining": false,
          "property_type": "PHARMACOKINETIC",
          "references": [
            "e66e859f-86e7-92ef-43e4-4736e3ef7d95"
          ]
        }
      ]
    }
  ]
}