{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "75a42345-ec59-4788-b336-96b4b40c637e", "code": "2478-29-7", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=2478-29-7", "code_system": "CAS", "references": [ "66070082-1584-4d32-a717-fd1a1e25b9cb", "2bcf5fa0-d615-4450-a14a-a960827e7bac" ] }, { "uuid": "2483f650-a5f7-4c1f-8fe8-c961e22e2b49", "code": "219-608-4", "type": "PRIMARY", "code_system": "ECHA (EC/EINECS)", "references": [ "66070082-1584-4d32-a717-fd1a1e25b9cb" ] }, { "uuid": "b0e07b62-1cfc-40a9-a21c-3a11c67b0dfd", "code": "64784", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/64784", "code_system": "PUBCHEM", "references": [ "66070082-1584-4d32-a717-fd1a1e25b9cb" ] }, { "uuid": "6c0d80ca-28f8-4da0-863a-c8f06a1bef60", "code": "7LB6MR3885", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "c6ce7c25-141b-7895-747d-e5496c303229", "code": "DTXSID60883851", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60883851", "code_system": "EPA CompTox" } ], "substance_class": "chemical", "names": [ { "uuid": "6fe079d5-e812-4321-9baf-67a49af4a248", "name": "1-HEXADECANAMINIUM, N,N,N-TRIMETHYL-, SALT WITH 1,2-BENZISOTHIAZOL-3(2H)-ONE 1,1-DIOXIDE (1:1)", "stdName": "1-HEXADECANAMINIUM, N,N,N-TRIMETHYL-, SALT WITH 1,2-BENZISOTHIAZOL-3(2H)-ONE 1,1-DIOXIDE (1:1)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "fc877f2c-a205-413a-80aa-2b0cd8aca02d", "f5d73b41-e297-4c66-9d44-3110783da180" ], "display_name": false }, { "uuid": "f2812e9f-43c8-4bfe-9924-ee1abddeef94", "name": "CETRIMONIUM SACCHARINATE", "stdName": "CETRIMONIUM SACCHARINATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "80e94a2e-db67-45fc-9fe1-bfe8f448fc7d", "96bff6db-f5b9-4fed-829e-aeb54f67040d", "f5d73b41-e297-4c66-9d44-3110783da180" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "3b35cfe8-a531-482d-b55b-235a5e694ea2", "name_org": "INCI" } ] }, { "uuid": "b76c08fc-5be9-492a-abae-cfeb8aacd918", "name": "CETYLTRIMETHYLAMMONIUM BENZOSULFIMIDE", "stdName": "CETYLTRIMETHYLAMMONIUM BENZOSULFIMIDE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "fc877f2c-a205-413a-80aa-2b0cd8aca02d", "f5d73b41-e297-4c66-9d44-3110783da180" ], "display_name": false }, { "uuid": "72979ebf-f5af-45a1-a6c6-a8cad1620a8d", "name": "CETYLTRIMETHYLAMMONIUM SACCHARINATE", "stdName": "CETYLTRIMETHYLAMMONIUM SACCHARINATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "fc877f2c-a205-413a-80aa-2b0cd8aca02d", "f5d73b41-e297-4c66-9d44-3110783da180" ], "display_name": false }, { "uuid": "51b9a9b3-a643-4984-b56c-97692ea8c0ae", "name": "HEXADECYLTRIMETHYLAMMONIUM, SALT WITH 1,2-BENZISOTHIAZOL-3(2H)-ONE1,1-DIOXIDE (1:1)", "stdName": "HEXADECYLTRIMETHYLAMMONIUM, SALT WITH 1,2-BENZISOTHIAZOL-3(2H)-ONE1,1-DIOXIDE (1:1)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "70d2a6be-68ab-4a6d-98de-d4228368fc7f", "f5d73b41-e297-4c66-9d44-3110783da180" ], "display_name": false }, { "uuid": "f5d00272-e769-47ae-9d5a-40feda0aaccf", "name": "PIONIN B 611S", "stdName": "PIONIN B 611S", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "fc877f2c-a205-413a-80aa-2b0cd8aca02d", "f5d73b41-e297-4c66-9d44-3110783da180" ], "display_name": false } ], "references": [ { "uuid": "80e94a2e-db67-45fc-9fe1-bfe8f448fc7d", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "f5d73b41-e297-4c66-9d44-3110783da180", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "fc877f2c-a205-413a-80aa-2b0cd8aca02d", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "70d2a6be-68ab-4a6d-98de-d4228368fc7f", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "66070082-1584-4d32-a717-fd1a1e25b9cb", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391989000, "tags": [ "NOMEN" ] }, { "uuid": "85963835-8103-46ab-a7ea-8103312ed7d5", "citation": "SRS import [7LB6MR3885]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7LB6MR3885", "doc_type": "SRS", "public_domain": true, "document_date": 1493391989000, "tags": [ "NOMEN" ] }, { "uuid": "96bff6db-f5b9-4fed-829e-aeb54f67040d", "citation": "CETRIMONIUM SACCHARINATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "2bcf5fa0-d615-4450-a14a-a960827e7bac", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "7c398e12-bb40-4add-903f-dc28a0dba23a", "id": "7c398e12-bb40-4add-903f-dc28a0dba23a", "molfile": "\n Marvin 01132106272D \n\n 12 13 0 0 0 0 999 V2000\n 2.5287 -2.7975 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2285 -2.0072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6868 -1.3118 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1969 -0.6638 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7385 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8923 -0.2212 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4383 -0.9483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7112 -0.5532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -0.9957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0158 -1.8017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7586 -2.1969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4383 -1.7701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0 0 0 0\n 2 3 1 0 0 0 0\n 12 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 2 0 0 0 0\n 4 6 2 0 0 0 0\n 7 4 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 12 2 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 11 10 2 0 0 0 0\n 12 11 1 0 0 0 0\nM END", "smiles": "c1ccc2c(c1)C(=O)NS2(=O)=O", "formula": "C7H5NO3S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "c56534e1-47db-4cea-9287-121a180b1fdc" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "183.1859", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "a15218b6-7e52-44fc-b8dd-19d569726cad", "id": "a15218b6-7e52-44fc-b8dd-19d569726cad", "molfile": "\n Marvin 01132108232D \n\n 20 19 0 0 0 0 999 V2000\n 5.0141 -1.5349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7304 -1.1256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4296 -1.5349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1459 -1.1256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8451 -1.5349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5614 -1.1256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2606 -1.5349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9769 -1.1256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6762 -1.5349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3925 -1.1256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0917 -1.5349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8080 -1.1256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5072 -1.5349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2235 -1.1256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9228 -1.5349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6391 -1.1256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3383 -1.5349 0.0000 N 0 3 0 0 0 0 0 0 0 3 0 0\n 17.0546 -1.9442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9290 -2.2512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7476 -0.8186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 19 1 0 0 0 0\n 17 20 1 0 0 0 0\nM CHG 1 17 1\nM END", "smiles": "CCCCCCCCCCCCCCCC[N+](C)(C)C", "formula": "C19H42N", "atropisomerism": "No", "charge": 1, "count": 1, "stereochemistry": "RACEMIC", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "08badb02-5d1c-4327-b973-df21331b2104" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "284.5442", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "433a51c7-48c5-417d-a10e-69bf5efa1694", "version": "5", "structure": { "id": "24acb13d-2de5-4741-854c-6ab2fc0dff82", "molfile": "\n Marvin 01132102022D \n\n 32 32 0 0 0 0 999 V2000\n 1.5520 -1.0233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5520 -1.9101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3706 -0.7163 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7674 -0.5969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4047 -2.1659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8186 -2.3706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8993 -1.4155 0.0000 N 0 5 0 0 0 0 0 0 0 0 0 0\n 1.8760 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1210 -0.2387 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.0744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.7287 -3.0187 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0171 -1.9442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0141 -1.5349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7304 -1.1256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4296 -1.5349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1459 -1.1256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8451 -1.5349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5614 -1.1256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2606 -1.5349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9769 -1.1256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6762 -1.5349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.3925 -1.1256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.0917 -1.5349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8080 -1.1256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5072 -1.5349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2235 -1.1256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9228 -1.5349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6391 -1.1256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3383 -1.5349 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 17.0546 -1.9442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9290 -2.2512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7476 -0.8186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 1 3 1 0 0 0 0\n 1 4 1 0 0 0 0\n 2 5 1 0 0 0 0\n 2 6 1 0 0 0 0\n 3 9 2 0 0 0 0\n 3 7 1 0 0 0 0\n 3 8 2 0 0 0 0\n 4 10 2 0 0 0 0\n 5 11 2 0 0 0 0\n 5 7 1 0 0 0 0\n 6 12 2 0 0 0 0\n 10 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 29 31 1 0 0 0 0\n 29 32 1 0 0 0 0\nM CHG 2 7 -1 29 1\nM END", "smiles": "CCCCCCCCCCCCCCCC[N+](C)(C)C.c1ccc2c(c1)C(=O)[N-]S2(=O)=O", "formula": "C19H42N.C7H4NO3S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "466.7221", "optical_activity": "NONE", "references": [ "85963835-8103-46ab-a7ea-8103312ed7d5", "70d2a6be-68ab-4a6d-98de-d4228368fc7f" ], "stereo_centers": 0 }, "unii": "7LB6MR3885" } ] }