{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "4d26b3fe-c9f0-4877-a074-b232d8485fb6",
          "code": "A11HA32",
          "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|VITAMINS|OTHER PLAIN VITAMIN PREPARATIONS|Other plain vitamin preparations|pantethine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=A11HA32&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "c3d715ac-3146-4e24-add1-7354dc5457ee"
          ]
        },
        {
          "uuid": "361a2b7b-4fa5-44b2-8c7c-eeac4858ae03",
          "code": "QA11HA32",
          "comments": "VATC|VITAMINS|OTHER PLAIN VITAMIN PREPARATIONS|Other plain vitamin preparations|pantethine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QA11HA32&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "c3d715ac-3146-4e24-add1-7354dc5457ee"
          ]
        },
        {
          "uuid": "19736463-a960-461c-8d62-27eee6db224b",
          "code": "16816-67-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=16816-67-4",
          "code_system": "CAS",
          "references": [
            "c3d715ac-3146-4e24-add1-7354dc5457ee",
            "05684259-5673-4305-b328-aab6deae25ba"
          ]
        },
        {
          "uuid": "18a8a2e5-805c-43bb-9a6c-ff422053a309",
          "code": "C87342",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C87342",
          "code_system": "NCI_THESAURUS",
          "references": [
            "c3d715ac-3146-4e24-add1-7354dc5457ee"
          ]
        },
        {
          "uuid": "3f66f66e-6728-43c8-9f6f-7389acc530f9",
          "code": "C005425",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67005425",
          "code_system": "MESH",
          "references": [
            "c3d715ac-3146-4e24-add1-7354dc5457ee"
          ]
        },
        {
          "uuid": "f2d11dfd-073f-4615-99b8-7f02052b5df3",
          "code": "PANTETHINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Pantethine",
          "code_system": "WIKIPEDIA",
          "references": [
            "c3d715ac-3146-4e24-add1-7354dc5457ee"
          ]
        },
        {
          "uuid": "3ddb6866-559c-4d2f-8593-968a0babcc28",
          "code": "32863",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/32863/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "c3d715ac-3146-4e24-add1-7354dc5457ee"
          ]
        },
        {
          "uuid": "ce45344a-0195-4990-8ff8-52b9660f3333",
          "code": "m8385",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8385?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "c3d715ac-3146-4e24-add1-7354dc5457ee"
          ]
        },
        {
          "uuid": "9aa93247-a8fc-4024-8bc6-195661d72aa6",
          "code": "SUB14755MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "c3d715ac-3146-4e24-add1-7354dc5457ee"
          ]
        },
        {
          "uuid": "1be29cab-b922-4a5b-965e-a86be3ae9720",
          "code": "CHEMBL2104786",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2104786",
          "code_system": "ChEMBL",
          "references": [
            "c3d715ac-3146-4e24-add1-7354dc5457ee"
          ]
        },
        {
          "uuid": "6f7348f7-85c4-4f4b-a5c5-67ff6637a56b",
          "code": "240-842-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.037.114",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "c3d715ac-3146-4e24-add1-7354dc5457ee"
          ]
        },
        {
          "uuid": "536808b7-b08b-4f19-92ec-185d0ff1f33e",
          "code": "452306",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/452306",
          "code_system": "PUBCHEM",
          "references": [
            "c3d715ac-3146-4e24-add1-7354dc5457ee"
          ]
        },
        {
          "uuid": "c050725d-42f0-7531-6161-2f630a08edd4",
          "code": "DTXSID9046815",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9046815",
          "code_system": "EPA CompTox",
          "references": [
            "35b68bbc-b050-5f89-f2a8-ca35b538522c"
          ]
        },
        {
          "uuid": "3aa0f04e-5279-4889-2484-d516ff431d58",
          "code": "C1505",
          "comments": "Dietary Supplement",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1505",
          "code_system": "NCI_THESAURUS",
          "references": [
            "a83d65da-7bc8-4a56-5341-5574b70c12ed"
          ]
        },
        {
          "uuid": "9e6a26e7-0206-30c2-7452-44462d0234bb",
          "code": "3417",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3417",
          "code_system": "DRUG CENTRAL",
          "references": [
            "a83d65da-7bc8-4a56-5341-5574b70c12ed"
          ]
        },
        {
          "uuid": "ce97633b-5aed-3f95-4136-a40d97f844e5",
          "code": "DB11190",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB11190",
          "code_system": "DRUG BANK",
          "references": [
            "a83d65da-7bc8-4a56-5341-5574b70c12ed"
          ]
        },
        {
          "uuid": "49ae9ffc-2799-48f5-92df-a20127ba7635",
          "code": "7K81IL792L",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d4a0e557-f97b-ad47-6c98-fc672f2a55eb",
          "code": "313 (Number of products:16)",
          "comments": "Dietary Supplement Label Database|Vitamin|Pantethine",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=313&item=Pantethine",
          "code_system": "DSLD",
          "references": [
            "a83d65da-7bc8-4a56-5341-5574b70c12ed"
          ]
        },
        {
          "uuid": "c683ebb5-5604-a8d6-4fc7-e9d29743b47b",
          "code": "31959",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:31959",
          "code_system": "CHEBI",
          "references": [
            "a83d65da-7bc8-4a56-5341-5574b70c12ed"
          ]
        },
        {
          "uuid": "663211d5-47d8-205b-5ef1-357133e9414a",
          "code": "7K81IL792L",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=7K81IL792L",
          "code_system": "DAILYMED",
          "references": [
            "cbd5c0b0-d704-f836-a8a1-3445acab4cd0"
          ]
        },
        {
          "uuid": "b426a4c3-1e8c-464e-1a3d-47326e1664d8",
          "code": "100000079719",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "a0931bbd-d735-b980-b8e8-5aae72cdff94"
          ]
        },
        {
          "uuid": "9c4b0836-c7e1-8f98-9dd2-90890aa12728",
          "code": "759269",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=759269",
          "code_system": "NSC",
          "references": [
            "f8a6785f-866d-4dea-27cf-178ba8866b19"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "bce5d964-4048-444a-b6d3-7736b2df410f",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "b07acd88-60b9-4aec-a4de-4aeb8641c13b",
            "refuuid": "52056f80-6012-45df-9a81-dec8a64c997d",
            "name": "PANTETHINE",
            "unii": "7K81IL792L",
            "linking_id": "7K81IL792L",
            "ref_pname": "PANTETHINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1eb9c3c6-0012-4a20-9937-29e97761cb0b",
          "name": "BIS(N-PANTOTHENYLAMIDOETHYL) DISULFIDE",
          "stdName": "BIS(N-PANTOTHENYLAMIDOETHYL) DISULFIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "71455fef-7ba8-49c1-aaf4-22ab3e8bab8f"
          ],
          "display_name": false
        },
        {
          "uuid": "1915a7c6-dcb6-42dc-b998-5d5274db8f55",
          "name": "BUTANAMIDE, N,N'-(DITHIOBIS(2,1-ETHANEDIYLIMINO(3-OXO-3,1-PROPANEDIYL)))BIS(2,4-DIHYDROXY-3,3-DIMETHYL-, (2R,2'R)-",
          "stdName": "BUTANAMIDE, N,N'-(DITHIOBIS(2,1-ETHANEDIYLIMINO(3-OXO-3,1-PROPANEDIYL)))BIS(2,4-DIHYDROXY-3,3-DIMETHYL-, (2R,2'R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "71455fef-7ba8-49c1-aaf4-22ab3e8bab8f"
          ],
          "display_name": false
        },
        {
          "uuid": "70b5c449-68a5-4865-a2f6-037e9122a118",
          "name": "D-BIS(N-PANTOTHENYL-2-AMINOETHYL)-DISULFIDE",
          "stdName": "D-BIS(N-PANTOTHENYL-2-AMINOETHYL)-DISULFIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6d5ca5e2-2ec3-4303-aed9-ffbe84296295"
          ],
          "display_name": false
        },
        {
          "uuid": "c8fb6122-6b53-48f4-88e6-ecb2cee5e16d",
          "name": "D-BIS(N-PANTOTHENYL-2-AMINOETHYL)-DISULPHIDE",
          "stdName": "D-BIS(N-PANTOTHENYL-2-AMINOETHYL)-DISULPHIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "198e927a-17e1-4d4c-8c49-a76513676c7d"
          ],
          "display_name": false
        },
        {
          "uuid": "a8e5596f-f08f-4880-9a67-32f8b8c0a6d9",
          "name": "D-PANTETHINE",
          "stdName": "D-PANTETHINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ab3c72fd-e8a9-4568-bf68-f5f619e24fb3"
          ],
          "display_name": false
        },
        {
          "uuid": "263eb68c-31ca-412a-a606-2b6d07db6a4d",
          "name": "NSC-759269",
          "stdName": "NSC-759269",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f8a6785f-866d-4dea-27cf-178ba8866b19"
          ],
          "display_name": false
        },
        {
          "uuid": "e7137b1c-a987-4d6f-8591-d9dd635a8578",
          "name": "PANTETHINE",
          "stdName": "PANTETHINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "58759614-6bc9-4218-aae5-ac8411c270b4",
            "93926a3e-140e-4514-b507-64819a68db69",
            "8ca63310-dfe1-4df4-9f66-0af253b476fe",
            "738b8c35-265d-4662-8456-fcd66087252c",
            "1931f1b7-acc0-48f4-86c7-6c2706541cc7",
            "c0de5747-1a3c-4365-a923-ac397096c977",
            "85453c37-b46f-4733-b29d-af5b1a767e02",
            "cb57b896-dbce-4f54-beb1-57e2217aaf2c",
            "7769e05e-3240-4024-92cc-cb0fc7bc9d50"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "66f0344f-b2b7-4bf1-942c-357acb4c1f22",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "4640ab00-10ed-4e1d-b162-57bec5456e81",
          "name": "PANTETHINE [JAN]",
          "stdName": "PANTETHINE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9b67f867-4622-9212-a299-c1555874367c"
          ],
          "display_name": false
        },
        {
          "uuid": "df87f2ff-059f-4916-ad39-c2e50d9f0895",
          "name": "PANTETHINE [MART.]",
          "stdName": "PANTETHINE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1931f1b7-acc0-48f4-86c7-6c2706541cc7"
          ],
          "display_name": false
        },
        {
          "uuid": "98aab7de-0789-445e-8d19-f804faa53730",
          "name": "PANTETHINE [MI]",
          "stdName": "PANTETHINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "85453c37-b46f-4733-b29d-af5b1a767e02"
          ],
          "display_name": false
        },
        {
          "uuid": "4eff39a7-4343-7f69-46c9-4a1520c110dc",
          "name": "Pantethine [WHO-DD]",
          "stdName": "PANTETHINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "26aaadc2-7e5b-6df4-8c19-70c51473c60a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6d5ca5e2-2ec3-4303-aed9-ffbe84296295",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "58759614-6bc9-4218-aae5-ac8411c270b4",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "198e927a-17e1-4d4c-8c49-a76513676c7d",
          "citation": "FDA-SRS 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1931f1b7-acc0-48f4-86c7-6c2706541cc7",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "85453c37-b46f-4733-b29d-af5b1a767e02",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "738b8c35-265d-4662-8456-fcd66087252c",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8ca63310-dfe1-4df4-9f66-0af253b476fe",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "71455fef-7ba8-49c1-aaf4-22ab3e8bab8f",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ab3c72fd-e8a9-4568-bf68-f5f619e24fb3",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c3d715ac-3146-4e24-add1-7354dc5457ee",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389723000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4111783e-ebe4-4f13-b18e-3397d7cb5b2c",
          "citation": "SRS import [7K81IL792L]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7K81IL792L",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389723000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cb57b896-dbce-4f54-beb1-57e2217aaf2c",
          "citation": "PANTETHINE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c0de5747-1a3c-4365-a923-ac397096c977",
          "citation": "PANTETHINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7769e05e-3240-4024-92cc-cb0fc7bc9d50",
          "citation": "PANTETHINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "93926a3e-140e-4514-b507-64819a68db69",
          "citation": "PANTETHINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9b67f867-4622-9212-a299-c1555874367c",
          "citation": "JAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "35b68bbc-b050-5f89-f2a8-ca35b538522c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=16816-67-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a0931bbd-d735-b980-b8e8-5aae72cdff94",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "a83d65da-7bc8-4a56-5341-5574b70c12ed",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "05684259-5673-4305-b328-aab6deae25ba",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f8a6785f-866d-4dea-27cf-178ba8866b19",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "26aaadc2-7e5b-6df4-8c19-70c51473c60a",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "cbd5c0b0-d704-f836-a8a1-3445acab4cd0",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "54ef68a1-5990-4f4f-b42f-585328a8c559",
          "id": "54ef68a1-5990-4f4f-b42f-585328a8c559",
          "molfile": "\n  Marvin  01132104252D          \n\n 36 35  0  0  1  0            999 V2000\n   -3.2651  -17.9413    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   -3.2693  -17.1146    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5511  -18.3505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5553  -19.1772    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8371  -17.9371    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1231  -18.3462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4091  -17.9329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3048  -18.3421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3006  -19.1688    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0188  -17.9288    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7328  -18.3379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4468  -17.9246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1607  -18.3337    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8747  -17.9204    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5887  -18.3296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3027  -17.9163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0166  -18.3254    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7306  -17.9120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7264  -17.0853    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4446  -18.3212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1586  -17.9078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8726  -18.3171    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5865  -17.9037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5823  -17.0770    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3005  -18.3129    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   10.2963  -19.1396    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0145  -17.8995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5969  -17.1813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4236  -17.1813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7285  -18.3087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4424  -17.8953    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.9790  -18.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.3966  -19.0686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5699  -19.0686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.6930  -17.9454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -5.4070  -18.3588    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n 32  1  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 18 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  2  0  0  0  0\n 23 25  1  0  0  0  0\n 25 26  1  1  0  0  0\n 25 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 27 29  1  0  0  0  0\n 27 30  1  0  0  0  0\n 30 31  1  0  0  0  0\n 32 33  1  0  0  0  0\n 32 34  1  0  0  0  0\n 35 32  1  0  0  0  0\n 36 35  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(CO)[C@H](C(=O)NCCC(=O)NCCSSCCNC(=O)CCNC(=O)[C@@H](C(C)(C)CO)O)O",
          "formula": "C22H42N4O8S2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "90b4dcfb-e6ca-43bd-800f-ac852ce29597"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "554.7239",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "52056f80-6012-45df-9a81-dec8a64c997d",
      "version": "18",
      "structure": {
        "id": "1b5c0dba-40bc-45b8-acf5-940d02a3fd60",
        "molfile": "\n  Marvin  01132101362D          \n\n 36 35  0  0  1  0            999 V2000\n   -5.4070  -18.3588    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.6930  -17.9454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.9790  -18.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2651  -17.9413    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -2.5511  -18.3505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.8371  -17.9371    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1231  -18.3462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4091  -17.9329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3048  -18.3421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0188  -17.9288    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7328  -18.3379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4468  -17.9246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1607  -18.3337    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8747  -17.9204    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5887  -18.3296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3027  -17.9163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0166  -18.3254    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7306  -17.9120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4446  -18.3212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1586  -17.9078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8726  -18.3171    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5865  -17.9037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3005  -18.3129    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   11.0145  -17.8995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7285  -18.3087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4424  -17.8953    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.3966  -19.0686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.5699  -19.0686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.2693  -17.1146    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5553  -19.1772    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3006  -19.1688    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7264  -17.0853    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5823  -17.0770    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2963  -19.1396    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5969  -17.1813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4236  -17.1813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  4  5  1  0  0  0  0\n 18 19  1  0  0  0  0\n  9 10  1  0  0  0  0\n 19 20  1  0  0  0  0\n  2  3  1  0  0  0  0\n 20 21  1  0  0  0  0\n 10 11  1  0  0  0  0\n 21 22  1  0  0  0  0\n  5  6  1  0  0  0  0\n 22 23  1  0  0  0  0\n 11 12  1  0  0  0  0\n 23 24  1  0  0  0  0\n  1  2  1  0  0  0  0\n 24 25  1  0  0  0  0\n 12 13  1  0  0  0  0\n 25 26  1  0  0  0  0\n  6  7  1  0  0  0  0\n  3 27  1  0  0  0  0\n 13 14  1  0  0  0  0\n  3 28  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4 29  1  1  0  0  0\n 14 15  1  0  0  0  0\n  5 30  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9 31  2  0  0  0  0\n 15 16  1  0  0  0  0\n 18 32  2  0  0  0  0\n 22 33  2  0  0  0  0\n 16 17  1  0  0  0  0\n 23 34  1  1  0  0  0\n  8  9  1  0  0  0  0\n 24 35  1  0  0  0  0\n 17 18  1  0  0  0  0\n 24 36  1  0  0  0  0\nM  END",
        "smiles": "CC(C)(CO)[C@H](C(=O)NCCC(=O)NCCSSCCNC(=O)CCNC(=O)[C@@H](C(C)(C)CO)O)O",
        "formula": "C22H42N4O8S2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "554.7239",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "4111783e-ebe4-4f13-b18e-3397d7cb5b2c",
          "6d5ca5e2-2ec3-4303-aed9-ffbe84296295"
        ],
        "stereo_centers": 2
      },
      "unii": "7K81IL792L"
    }
  ]
}