{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "08a6df84-daef-4cc0-933f-e00244868e7e",
          "code": "7360-38-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=7360-38-5",
          "code_system": "CAS",
          "references": [
            "4a2e2d7a-25ad-419d-bc41-1284f0eed5b8",
            "0e4f33ad-c769-45f6-afe5-2b94414ec96a"
          ]
        },
        {
          "uuid": "bb587fe9-d76e-4372-adab-27746f1702bb",
          "code": "230-896-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.028.087",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "4a2e2d7a-25ad-419d-bc41-1284f0eed5b8"
          ]
        },
        {
          "uuid": "a19c44a6-2fd6-4404-a5aa-6a67f9d3a264",
          "code": "110973",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/110973",
          "code_system": "PUBCHEM",
          "references": [
            "4a2e2d7a-25ad-419d-bc41-1284f0eed5b8"
          ]
        },
        {
          "uuid": "b406d0bf-f345-4022-8de5-2f8166e0bc85",
          "code": "1368189",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1368189/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "4a2e2d7a-25ad-419d-bc41-1284f0eed5b8"
          ]
        },
        {
          "uuid": "63dd3756-920d-7b09-8c08-412f265f8cba",
          "code": "DB14102",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB14102",
          "code_system": "DRUG BANK",
          "references": [
            "47be8ad4-03fc-6cfc-4026-f7d51f6f2a69"
          ]
        },
        {
          "uuid": "91a7211d-8a79-47ad-933b-ed53197e8c89",
          "code": "7K3W1BIU6K",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ceb8eb8c-5e02-168b-6121-076f82b5d3b7",
          "code": "DTXSID00864043",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00864043",
          "code_system": "EPA CompTox",
          "references": [
            "47be8ad4-03fc-6cfc-4026-f7d51f6f2a69"
          ]
        },
        {
          "uuid": "d709642f-59be-8f8f-d55d-581585b4caf8",
          "code": "7K3W1BIU6K",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=7K3W1BIU6K",
          "code_system": "DAILYMED",
          "references": [
            "6a79e922-0301-2efc-b2e0-47d08ce1d130"
          ]
        },
        {
          "uuid": "1afaea35-dbb2-5bbc-cc4d-0ccd62f00ed6",
          "code": "300000056185",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "12a0acb9-956d-70e2-4010-0d8aedccba46"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "bb12b755-5008-4c9f-8440-fc3850605aec",
          "name": "2-ETHYLHEXANOIC ACID, 1,2,3-PROPANETRIYL ESTER",
          "stdName": "2-ETHYLHEXANOIC ACID, 1,2,3-PROPANETRIYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a510b7f-92d4-428f-87f7-70ad04c3b30e",
            "68ce3f24-50cd-4299-96a9-619df5fcd027"
          ],
          "display_name": false
        },
        {
          "uuid": "a37a544b-7d72-434d-ba54-187ea23b5a3c",
          "name": "CRODAMOL GTEH",
          "stdName": "CRODAMOL GTEH",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a510b7f-92d4-428f-87f7-70ad04c3b30e",
            "68ce3f24-50cd-4299-96a9-619df5fcd027"
          ],
          "display_name": false
        },
        {
          "uuid": "6ada956e-594f-47f2-af91-85345e9c2321",
          "name": "GLYCERYL TRI(2-ETHYLHEXANOATE)",
          "stdName": "GLYCERYL TRI(2-ETHYLHEXANOATE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a510b7f-92d4-428f-87f7-70ad04c3b30e",
            "68ce3f24-50cd-4299-96a9-619df5fcd027"
          ],
          "display_name": false
        },
        {
          "uuid": "7ea93343-9ae0-4151-8808-b201de2be4ab",
          "name": "GLYCERYL TRIS(2-ETHYLHEXANOATE)",
          "stdName": "GLYCERYL TRIS(2-ETHYLHEXANOATE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b07aca15-10a6-4ea5-aa24-6190ea2281ea",
            "7a510b7f-92d4-428f-87f7-70ad04c3b30e"
          ],
          "display_name": false
        },
        {
          "uuid": "8a73a951-5a6d-411f-90b9-8d0c7629c0b3",
          "name": "HEXALAN",
          "stdName": "HEXALAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a510b7f-92d4-428f-87f7-70ad04c3b30e",
            "68ce3f24-50cd-4299-96a9-619df5fcd027"
          ],
          "display_name": false
        },
        {
          "uuid": "41cfd19f-f946-45be-bfc5-a788ec179d45",
          "name": "HEXANOIC ACID, 2-ETHYL-, 1,2,3-PROPANETRIYL ESTER",
          "stdName": "HEXANOIC ACID, 2-ETHYL-, 1,2,3-PROPANETRIYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a510b7f-92d4-428f-87f7-70ad04c3b30e",
            "68ce3f24-50cd-4299-96a9-619df5fcd027"
          ],
          "display_name": false
        },
        {
          "uuid": "87d41dc5-9f91-43d0-bcdd-623faedb481d",
          "name": "TRIETHYLHEXANOIN",
          "stdName": "TRIETHYLHEXANOIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7a510b7f-92d4-428f-87f7-70ad04c3b30e",
            "06f315f3-6659-46a2-8046-439e922ad621",
            "eaabd927-65ae-4fc4-b129-b38b419cc4ff",
            "53cbee8f-77f1-4909-a60f-845efbb7479b"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "fbf314a5-7d35-49fc-8326-bd583a3623ed",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "42402c20-d14a-4186-b75c-e95d259962f9",
          "name": "TRIOCTANOIN",
          "stdName": "TRIOCTANOIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aa4ebd21-52a6-4162-bf89-3fde8c6a2659",
            "68ce3f24-50cd-4299-96a9-619df5fcd027"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "53cbee8f-77f1-4909-a60f-845efbb7479b",
          "citation": "PCPC_DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7a510b7f-92d4-428f-87f7-70ad04c3b30e",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "68ce3f24-50cd-4299-96a9-619df5fcd027",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aa4ebd21-52a6-4162-bf89-3fde8c6a2659",
          "citation": "DL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eaabd927-65ae-4fc4-b129-b38b419cc4ff",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b07aca15-10a6-4ea5-aa24-6190ea2281ea",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4a2e2d7a-25ad-419d-bc41-1284f0eed5b8",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390911000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "062a995f-84fd-4b6e-b3ef-46db325c68c0",
          "citation": "SRS import [7K3W1BIU6K]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7K3W1BIU6K",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390911000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "06f315f3-6659-46a2-8046-439e922ad621",
          "citation": "TRIETHYLHEXANOIN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "47be8ad4-03fc-6cfc-4026-f7d51f6f2a69",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "0e4f33ad-c769-45f6-afe5-2b94414ec96a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6a79e922-0301-2efc-b2e0-47d08ce1d130",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "12a0acb9-956d-70e2-4010-0d8aedccba46",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "17b04889-75e6-4d8b-b309-b02052f0a12e",
          "id": "17b04889-75e6-4d8b-b309-b02052f0a12e",
          "molfile": "\n  Marvin  01132101252D          \n\n 33 32  0  0  0  0            999 V2000\n    0.0000   -2.4813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7175   -2.0617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4297   -2.4813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1472   -2.0617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8621   -2.4813    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    2.8621   -3.3050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1472   -3.7168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5821   -2.0617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5821   -1.2381    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2918   -2.4813    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0144   -2.0617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7267   -2.4813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4441   -2.0617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1590   -2.4813    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8790   -2.0617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8790   -1.2381    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5887   -2.4813    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    8.5887   -3.3050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8790   -3.7168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3114   -2.0617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3114   -1.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0236   -0.8263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0236    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7267   -3.3050    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0144   -3.7168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2918   -3.3050    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0144   -4.5482    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    5.7267   -4.9600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7267   -5.7837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2918   -4.9600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2918   -5.7837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5821   -6.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5821   -7.0243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5  8  1  0  0  0  0\n  7  6  1  0  0  0  0\n  9  8  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 12 24  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 15  1  0  0  0  0\n 18 17  1  0  0  0  0\n 20 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 25  1  0  0  0  0\n 26 25  2  0  0  0  0\n 27 25  1  0  0  0  0\n 28 27  1  0  0  0  0\n 30 27  1  0  0  0  0\n 29 28  1  0  0  0  0\n 31 30  1  0  0  0  0\n 32 31  1  0  0  0  0\n 33 32  1  0  0  0  0\nM  END",
          "smiles": "CCCCC(CC)C(=O)OCC(COC(=O)C(CC)CCCC)OC(=O)C(CC)CCCC",
          "formula": "C27H50O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d1c8bbbe-d409-4321-abf2-fa2ffb09c119"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "470.6833",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c8664e94-3ae0-423c-8ce7-ed64c5705ec9",
      "version": "8",
      "structure": {
        "id": "bf218615-24a1-4ee2-8b28-805b6b2d67e4",
        "molfile": "\n  Marvin  01132109532D          \n\n 33 32  0  0  0  0            999 V2000\n    5.0144   -3.7168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5821   -2.0617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8790   -2.0617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7267   -3.3050    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2918   -2.4813    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1590   -2.4813    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2918   -3.3050    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8790   -1.2381    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5821   -1.2381    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7267   -2.4813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0144   -4.5482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5887   -2.4813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8621   -2.4813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0144   -2.0617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4441   -2.0617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7267   -4.9600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2918   -4.9600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5887   -3.3050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8621   -3.3050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3114   -2.0617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1472   -2.0617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2918   -5.7837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3114   -1.2381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4297   -2.4813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5821   -6.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7175   -2.0617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0236   -0.8263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7267   -5.7837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8790   -3.7168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1472   -3.7168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5821   -7.0243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.4813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0236    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  5  1  0  0  0  0\n  3  6  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5 14  1  0  0  0  0\n  6 15  1  0  0  0  0\n  7  1  2  0  0  0  0\n  8  3  2  0  0  0  0\n  9  2  2  0  0  0  0\n 10  4  1  0  0  0  0\n 11  1  1  0  0  0  0\n 12  3  1  0  0  0  0\n 13  2  1  0  0  0  0\n 14 10  1  0  0  0  0\n 15 10  1  0  0  0  0\n 16 11  1  0  0  0  0\n 17 11  1  0  0  0  0\n 18 12  1  0  0  0  0\n 19 13  1  0  0  0  0\n 20 12  1  0  0  0  0\n 21 13  1  0  0  0  0\n 22 17  1  0  0  0  0\n 23 20  1  0  0  0  0\n 24 21  1  0  0  0  0\n 25 22  1  0  0  0  0\n 26 24  1  0  0  0  0\n 27 23  1  0  0  0  0\n 28 16  1  0  0  0  0\n 29 18  1  0  0  0  0\n 30 19  1  0  0  0  0\n 31 25  1  0  0  0  0\n 32 26  1  0  0  0  0\n 33 27  1  0  0  0  0\nM  END",
        "smiles": "CCCCC(CC)C(=O)OCC(COC(=O)C(CC)CCCC)OC(=O)C(CC)CCCC",
        "formula": "C27H50O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "470.6833",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "062a995f-84fd-4b6e-b3ef-46db325c68c0",
          "68ce3f24-50cd-4299-96a9-619df5fcd027"
        ],
        "stereo_centers": 4
      },
      "unii": "7K3W1BIU6K"
    }
  ]
}