{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a15e91ce-536b-433a-93d4-f358dbb5f80b",
          "code": "620-79-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=620-79-1",
          "code_system": "CAS",
          "references": [
            "7f0a4a1d-1fd0-4fb5-ae71-7ca3d798a9c0",
            "98f81629-9b5c-4a32-afab-ccb5545d7ef8"
          ]
        },
        {
          "uuid": "df8217a3-2465-40e7-9d5f-cb150ee8e0a1",
          "code": "21 CFR 172.515",
          "comments": "PART 172 -- FOOD ADDITIVES PERMITTED FOR DIRECT ADDITION TO FOOD FOR HUMAN CONSUMPTION|Subpart F--Flavoring Agents and Related Substances|Sec. 172.515 Synthetic flavoring substances and adjuvants.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfCFR/CFRSearch.cfm?fr=172.515",
          "code_system": "CFR",
          "references": [
            "7f0a4a1d-1fd0-4fb5-ae71-7ca3d798a9c0"
          ]
        },
        {
          "uuid": "ca29685c-aab7-4bde-a800-c89abd4fc695",
          "code": "210-651-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.009.685",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "7f0a4a1d-1fd0-4fb5-ae71-7ca3d798a9c0"
          ]
        },
        {
          "uuid": "2ace9fb6-24bc-4405-8809-ad1fb000aa8f",
          "code": "246929",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/246929",
          "code_system": "PUBCHEM",
          "references": [
            "7f0a4a1d-1fd0-4fb5-ae71-7ca3d798a9c0"
          ]
        },
        {
          "uuid": "b3963e25-8bbe-4d8e-b779-8ff6909f1b28",
          "code": "7K3AI5O6H2",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "94fe5c36-eee8-6a47-bae9-cd4ec2a9928b",
          "code": "DTXSID00862307",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00862307",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "5d9a7d18-42d8-d831-77e8-62d35efecbbd",
          "code": "60581",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=60581",
          "code_system": "NSC",
          "references": [
            "504c6d81-8640-3bd6-5844-9858405d4fdb"
          ]
        },
        {
          "uuid": "37f8136f-2029-4d6e-a512-2471afb09f29",
          "code": "768",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/768/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "cf772aec-7984-d1ac-b008-78f0d3649b74"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d28701e2-6c4a-44bd-a117-d2f434ba8ac4",
          "name": "(±)-ETHYL .ALPHA.-BENZYLACETOACETATE",
          "stdName": "(+/-)-ETHYL .ALPHA.-BENZYLACETOACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fd11d38e-93e5-42f0-a11c-0c96ed0e6a7c"
          ],
          "display_name": false
        },
        {
          "uuid": "fa641041-321e-4ec1-9889-46867d06f794",
          "name": "ETHYL .ALPHA.-ACETYLHYDROCINNAMATE",
          "stdName": "ETHYL .ALPHA.-ACETYLHYDROCINNAMATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "83677a9b-ba8e-465b-9c00-0ee70a997f3c"
          ],
          "display_name": false
        },
        {
          "uuid": "d93cceaa-26aa-4806-a288-58eac9ecfb1b",
          "name": "ETHYL .ALPHA.-BENZYLACETOACETATE",
          "stdName": "ETHYL .ALPHA.-BENZYLACETOACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b6ea7839-e544-48d0-b914-14cf33b8f325"
          ],
          "display_name": true
        },
        {
          "uuid": "cd59af48-4249-4ac7-8ccc-83ae908cab38",
          "name": "ETHYL 2-ACETYL-3-PHENYLPROPANOATE [FHFI]",
          "stdName": "ETHYL 2-ACETYL-3-PHENYLPROPANOATE [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "62a143e6-13c9-4eda-b950-5c9d8a60f474"
          ],
          "display_name": false
        },
        {
          "uuid": "36faf732-c37b-4c04-a572-119cf9fd8501",
          "name": "ETHYL 2-ACETYL-3-PHENYLPROPIONATE",
          "stdName": "ETHYL 2-ACETYL-3-PHENYLPROPIONATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92cc551a-3960-4f82-b386-455229b5801f"
          ],
          "display_name": false
        },
        {
          "uuid": "799e142c-60ea-4c2c-80cd-d5efdc011982",
          "name": "ETHYL-3-OXO-2-BENZYLBUTANOATE",
          "stdName": "ETHYL-3-OXO-2-BENZYLBUTANOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "83677a9b-ba8e-465b-9c00-0ee70a997f3c"
          ],
          "display_name": false
        },
        {
          "uuid": "7a5ffca3-aa6a-4e2c-92c1-944c1cb72b1f",
          "name": "ETHYLBENZYL ACETOACETATE",
          "stdName": "ETHYLBENZYL ACETOACETATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "83677a9b-ba8e-465b-9c00-0ee70a997f3c"
          ],
          "display_name": false
        },
        {
          "uuid": "66f2eb89-096f-4d74-a781-1f2da751c2ec",
          "name": "FEMA NO. 2416",
          "stdName": "FEMA NO. 2416",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c9c346ee-15c6-4411-8df8-6be077e8f78e",
            "47956d6d-90dd-4592-85ec-768617258c27"
          ],
          "display_name": false
        },
        {
          "uuid": "a77ecef6-f712-4047-a323-fae295948f37",
          "name": "NSC-60581",
          "stdName": "NSC-60581",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b6ea7839-e544-48d0-b914-14cf33b8f325"
          ],
          "display_name": false
        },
        {
          "uuid": "df80638f-2874-4941-b1b7-636c4d4efdd0",
          "name": "SPICY ACETOACETATE",
          "stdName": "SPICY ACETOACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1c749345-c752-4cf1-ae66-72a113999882"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "47956d6d-90dd-4592-85ec-768617258c27",
          "citation": "CHEMID FEMA BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c9c346ee-15c6-4411-8df8-6be077e8f78e",
          "citation": "CHEMID BATCH 2010",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1c749345-c752-4cf1-ae66-72a113999882",
          "citation": "GRAS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fd11d38e-93e5-42f0-a11c-0c96ed0e6a7c",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "83677a9b-ba8e-465b-9c00-0ee70a997f3c",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b6ea7839-e544-48d0-b914-14cf33b8f325",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "62a143e6-13c9-4eda-b950-5c9d8a60f474",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "92cc551a-3960-4f82-b386-455229b5801f",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7f0a4a1d-1fd0-4fb5-ae71-7ca3d798a9c0",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390987000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "46dfbb7a-e4f9-4d66-a21f-81495916e6c2",
          "citation": "SRS import [7K3AI5O6H2]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7K3AI5O6H2",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390987000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "54e2d3e9-a742-49d9-a147-0991f6ff79f6",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "98f81629-9b5c-4a32-afab-ccb5545d7ef8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "504c6d81-8640-3bd6-5844-9858405d4fdb",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "cf772aec-7984-d1ac-b008-78f0d3649b74",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c6b3750c-9932-4438-8b82-f33d46f713bd",
          "id": "c6b3750c-9932-4438-8b82-f33d46f713bd",
          "molfile": "\n  Marvin  01132110162D          \n\n 16 16  0  0  0  0            999 V2000\n    5.6726   -4.5635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9581   -4.9759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2437   -4.5632    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2439   -3.7381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5295   -3.3254    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9585   -3.3258    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    5.6728   -3.7385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3874   -3.3262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3876   -2.5012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1023   -2.0889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8166   -2.5016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8164   -3.3266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1018   -3.7389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9587   -2.5008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2443   -2.0881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6733   -2.0885    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  2  0  0  0  0\n  6  4  1  0  0  0  0\n  6  7  1  0  0  0  0\n 14  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 13  2  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 15 14  1  0  0  0  0\n 14 16  2  0  0  0  0\nM  END",
          "smiles": "CCOC(=O)C(Cc1ccccc1)C(=O)C",
          "formula": "C13H16O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "736e672f-5385-4981-a364-3479283dbbfd"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "220.2648",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "998c1ec6-532a-4c5d-89d8-81e0b3b20752",
      "version": "5",
      "structure": {
        "id": "d80e2737-ef39-44ef-ae65-698623f38e9d",
        "molfile": "\n  Marvin  01132111122D          \n\n 16 16  0  0  0  0            999 V2000\n    4.2443   -2.0881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9587   -2.5008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9585   -3.3258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2439   -3.7381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2437   -4.5632    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9581   -4.9759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6726   -4.5635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5295   -3.3254    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6728   -3.7385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3874   -3.3262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3876   -2.5012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1023   -2.0889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8166   -2.5016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8164   -3.3266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1018   -3.7389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6733   -2.0885    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  4  8  2  0  0  0  0\n  3  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  2  0  0  0  0\n 10 15  1  0  0  0  0\n  2 16  2  0  0  0  0\nM  END",
        "smiles": "CCOC(=O)C(Cc1ccccc1)C(=O)C",
        "formula": "C13H16O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "220.2648",
        "optical_activity": "( + / - )",
        "references": [
          "54e2d3e9-a742-49d9-a147-0991f6ff79f6",
          "46dfbb7a-e4f9-4d66-a21f-81495916e6c2"
        ],
        "stereo_centers": 1
      },
      "unii": "7K3AI5O6H2"
    }
  ]
}