{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "595499fb-f379-4f0f-b1dc-2f3904a7ed58",
          "code": "N05CF02",
          "comments": "ATC|NERVOUS SYSTEM|PSYCHOLEPTICS|HYPNOTICS AND SEDATIVES|Benzodiazepine related drugs|zolpidem",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N05CF02&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "315043d6-809b-4e4a-91a3-9eacbc4325e6"
          ]
        },
        {
          "uuid": "2234689e-f054-4016-a89d-2d237039e05c",
          "code": "QN05CF02",
          "comments": "VATC|PSYCHOLEPTICS|HYPNOTICS AND SEDATIVES|Benzodiazepine related drugs|zolpidem",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN05CF02&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "315043d6-809b-4e4a-91a3-9eacbc4325e6"
          ]
        },
        {
          "uuid": "3201c8e2-d222-409d-baff-0500cd9c12bc",
          "code": "82626-48-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=82626-48-0",
          "code_system": "CAS",
          "references": [
            "315043d6-809b-4e4a-91a3-9eacbc4325e6",
            "7d2a2be9-7efe-478f-a43f-a477d801c80f"
          ]
        },
        {
          "uuid": "ffb420eb-11e9-41a1-9ebd-db20f42e4769",
          "code": "C62000",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C62000",
          "code_system": "NCI_THESAURUS",
          "references": [
            "315043d6-809b-4e4a-91a3-9eacbc4325e6"
          ]
        },
        {
          "uuid": "c5aa29e7-d689-41f9-8ae5-1d30ecd8ffd9",
          "code": "C049109",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67049109",
          "code_system": "MESH",
          "references": [
            "315043d6-809b-4e4a-91a3-9eacbc4325e6"
          ]
        },
        {
          "uuid": "87035b92-df10-4aae-abb0-5953f41ce716",
          "code": "NBK547962",
          "comments": "LiverTox|CNS|Sedative/Hypnotic|Benzodiazepine receptor blocker",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/NBK547962/",
          "code_system": "LIVERTOX",
          "references": [
            "4d283813-ef10-e405-fcfc-1163fdbf352b"
          ]
        },
        {
          "uuid": "15c3b1ee-5a57-4850-97aa-c545ace47fda",
          "code": "ZOLPIDEM",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Zolpidem",
          "code_system": "WIKIPEDIA",
          "references": [
            "315043d6-809b-4e4a-91a3-9eacbc4325e6"
          ]
        },
        {
          "uuid": "32051384-a6a3-4bdb-b351-a5dfa91b74d7",
          "code": "N0000175759",
          "comments": "Established Pharmacologic Class [EPC]|gamma-Aminobutyric Acid-ergic Agonist [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175759",
          "code_system": "NDF-RT",
          "references": [
            "315043d6-809b-4e4a-91a3-9eacbc4325e6"
          ]
        },
        {
          "uuid": "bab99136-46a1-493c-8f0a-dbfda5f3f009",
          "code": "SUB00183MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "315043d6-809b-4e4a-91a3-9eacbc4325e6"
          ]
        },
        {
          "uuid": "34eab8b0-6bba-4e3b-865a-b8eb2e82f117",
          "code": "5741",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=5741",
          "code_system": "INN",
          "references": [
            "315043d6-809b-4e4a-91a3-9eacbc4325e6"
          ]
        },
        {
          "uuid": "3638ed10-26c7-406d-ae9e-206ce73d6be4",
          "code": "2783",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule IV.|Depressants",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "315043d6-809b-4e4a-91a3-9eacbc4325e6"
          ]
        },
        {
          "uuid": "d0d2f92f-283c-4954-abbc-fe027cdc87ab",
          "code": "4348",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=4348",
          "code_system": "IUPHAR",
          "references": [
            "315043d6-809b-4e4a-91a3-9eacbc4325e6"
          ]
        },
        {
          "uuid": "df31a351-2826-46ce-b280-4e52e28cabf7",
          "code": "39993",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/39993/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "315043d6-809b-4e4a-91a3-9eacbc4325e6"
          ]
        },
        {
          "uuid": "31046db0-e4ab-4b2d-8d47-af9466a7c474",
          "code": "m11661",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11661?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "315043d6-809b-4e4a-91a3-9eacbc4325e6"
          ]
        },
        {
          "uuid": "49c2c3de-463b-42e5-8c09-3c953e16872d",
          "code": "DB00425",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00425",
          "code_system": "DRUG BANK",
          "references": [
            "315043d6-809b-4e4a-91a3-9eacbc4325e6"
          ]
        },
        {
          "uuid": "3be86519-05a5-4929-8f66-9f1ddeec6b4e",
          "code": "CHEMBL911",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL911",
          "code_system": "ChEMBL",
          "references": [
            "315043d6-809b-4e4a-91a3-9eacbc4325e6"
          ]
        },
        {
          "uuid": "efdf6fdf-5765-4b42-b66f-206fd11bba78",
          "code": "N0000007570",
          "comments": "Pyridines [Chemical/Ingredient]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000007570",
          "code_system": "NDF-RT",
          "references": [
            "315043d6-809b-4e4a-91a3-9eacbc4325e6"
          ]
        },
        {
          "uuid": "10c039ef-13d1-4685-a26b-dcc71d637dbd",
          "code": "5732",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5732",
          "code_system": "PUBCHEM",
          "references": [
            "315043d6-809b-4e4a-91a3-9eacbc4325e6"
          ]
        },
        {
          "uuid": "92af6274-d931-2b9d-87c0-6e1d9ecefc8a",
          "code": "DTXSID7045946",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7045946",
          "code_system": "EPA CompTox",
          "references": [
            "313fd1a0-04eb-8939-dd24-5012ec30bb45"
          ]
        },
        {
          "uuid": "684242a0-d068-3c53-02ae-eae002307cec",
          "code": "C29756",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Sedative and Hypnotic",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29756",
          "code_system": "NCI_THESAURUS",
          "references": [
            "4d283813-ef10-e405-fcfc-1163fdbf352b"
          ]
        },
        {
          "uuid": "44a8faa3-2c34-4c0b-b8f0-279e16b22317",
          "code": "7K383OQI23",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "53068b66-b4ef-5584-9735-ac9dd34e6465",
          "code": "Zolpidem",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM396/",
          "code_system": "LACTMED",
          "references": [
            "4d283813-ef10-e405-fcfc-1163fdbf352b"
          ]
        },
        {
          "uuid": "49de6b96-3494-cdc7-d7d5-20f402b0ef83",
          "code": "2870",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/2870",
          "code_system": "DRUG CENTRAL",
          "references": [
            "4d283813-ef10-e405-fcfc-1163fdbf352b"
          ]
        },
        {
          "uuid": "65351d68-bbab-0535-1cf7-9f9adae4caf8",
          "code": "10125",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:10125",
          "code_system": "CHEBI",
          "references": [
            "4d283813-ef10-e405-fcfc-1163fdbf352b"
          ]
        },
        {
          "uuid": "3d56ab81-7a9f-79d9-0e65-2ddbd04d0eb9",
          "code": "1724893",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1724893",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "4d283813-ef10-e405-fcfc-1163fdbf352b"
          ]
        },
        {
          "uuid": "792696d2-cd59-f754-fea2-138dd143e2e5",
          "code": "7K383OQI23",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=7K383OQI23",
          "code_system": "DAILYMED",
          "references": [
            "16e4b624-b8c2-2066-9af5-ba5d3f252370"
          ]
        },
        {
          "uuid": "09dbd327-c376-bea2-edae-ce98e74cbf9d",
          "code": "100000078817",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "0162e25e-73ff-35e5-d44f-4f31ed1f8a9b"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "2ffdbe64-9fcd-413e-abc8-784fd5dcc872",
          "citation": "D08690",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f386bd84-b455-49e7-91b1-ebc57bd6b08d",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "149dc9f8-3d4d-42a3-af4e-c10faa5b0b1d",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ae43b729-e80b-476b-aefd-9807236d4c7e",
          "citation": "USP-RS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "315043d6-809b-4e4a-91a3-9eacbc4325e6",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390006000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "84d7b11b-93c3-428c-9123-7dabd1bc836f",
          "citation": "JOURNAL OF CHROMATOGRAPHYB: BIOMEDICAL SCIENCES AND APPLICATIONS\\\\nVOLUME 675, ISSUE 1, 12 JANUARY 1996, PAGES 131?137",
          "url": "http://www.sciencedirect.com/science/article/pii/0378434795003428",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "50451266-df74-4b69-8c72-3f117ac1106a",
          "citation": "JOURNAL OF CHROMATOGRAPHYB: BIOMEDICAL SCIENCES AND APPLICATIONS\\\\nVOLUME 675,ISSUE 1, 12 JANUARY 1996, PAGES 131?137",
          "url": "http://www.sciencedirect.com/science/article/pii/0378434795003428",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8b5d777a-a695-4643-9781-dd49fc796ff9",
          "citation": "JOURNAL OF CHROMATOGRAPHYB:BIOMEDICAL SCIENCES AND APPLICATIONS\\\\nVOLUME 675, ISSUE 1, 12 JANUARY 1996, PAGES 131?137",
          "url": "http://www.sciencedirect.com/science/article/pii/0378434795003428",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "538c7104-cdc5-4467-ad8b-1e5497ccb324",
          "citation": "SRS import [7K383OQI23]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7K383OQI23",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390006000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7373b549-cd97-4f6a-a942-7bbcc1efbb26",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f4337e36-8421-4805-bdcc-5786d78bf0a6",
          "citation": "ZOLPIDEM [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "68c1cdf2-1a2f-413e-967b-c63d2eb1143a",
          "citation": "ZOLPIDEM [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "65784ee4-e519-4da1-8647-7ee7f6fb6ebc",
          "citation": "ZOLPIDEM [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "526d3dd0-9a90-4a1a-8588-e5f0c3b49e9b",
          "citation": "ZOLPIDEM CIV [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "913ec85f-8933-4991-9065-f22f2736d836",
          "citation": "ZOLPIDEM [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c68dc8b0-0f4d-421f-8fff-3274fa7092ef",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a6a56207-5a04-4d13-a810-3deed62af3d1",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8826123c-c341-4a66-b3e2-bfd97cae0c65",
          "citation": "INN Proposed List 53",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL53.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "651bbf55-9159-4f83-a525-026765818bdc",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a715374a-e28a-4b9c-a5a9-a991803b7dab",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "313fd1a0-04eb-8939-dd24-5012ec30bb45",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=82626-48-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b59f620d-f31e-22df-132e-e1986b6ebbf7",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+82626-48-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c7444c3f-e2ac-9855-f0a2-ca41930fb5f8",
          "citation": "Jan 1, 1998 - The Hardcover of the Poisoning & Toxicology Compendium: With Symptoms Index by Jerrold B. Leikin",
          "doc_type": "BOOK",
          "public_domain": true
        },
        {
          "uuid": "bbc2f3bd-6c76-55b2-83d8-8e6eac1cc1fa",
          "citation": "http://online.lexi.com/lco/action/doc/retrieve/docid/fc_dfc/5549370#f_pharmacokinetics",
          "doc_type": "LEXI-COMP",
          "public_domain": true
        },
        {
          "uuid": "72fc0a2b-3e47-018d-2031-fc61b0d3f426",
          "citation": "https://www.clinicalkey.com/pharmacology/monograph/656?sec=monphar",
          "doc_type": "CLINICAL PHARMACOLOGY",
          "public_domain": true
        },
        {
          "uuid": "e9cd3961-3fe7-ca6a-fb66-e80f87b31681",
          "citation": "Effect of zolpidem on human Cytochrome P450 activity, and on transport mediated by P-glycoprotein\nSource:\nBiopharmaceutics & drug disposition [0142-2782] von Moltke, Lisa yr:2002 vol:23 iss:9 pg:361 -367",
          "url": "http://onlinelibrary.wiley.com/doi/10.1002/bdd.329/epdf",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "39ff660b-98d8-dae2-e7fa-d9d3b6cede82",
          "citation": "ZOLPIDEM",
          "doc_type": "MICROMEDEX",
          "public_domain": true
        },
        {
          "uuid": "4d283813-ef10-e405-fcfc-1163fdbf352b",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "7d2a2be9-7efe-478f-a43f-a477d801c80f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a29ea71d-ab13-40c1-bb00-9888a041bf2d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "eea6a5da-e864-4697-8673-80e156f0e3ca",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "636a19ef-4877-42c8-8725-c6eaab7c56db",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1380e393-f5be-4099-a424-a491440e9c19",
          "citation": "Greenblatt, David J., and Thomas Roth. \"Zolpidem for insomnia.\" Expert opinion on pharmacotherapy 13.6 (2012): 879-893.",
          "url": "https://www.tandfonline.com/doi/pdf/10.1517/14656566.2012.667074?needAccess=true",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "c97cce31-ee87-456a-ac7d-9a669c375e9f",
          "citation": "Greenblatt, David J., and Thomas Roth. \"Zolpidem for insomnia.\" Expert opinion on pharmacotherapy 13.6 (2012): 879-893.",
          "url": "https://www.tandfonline.com/doi/pdf/10.1517/14656566.2012.667074?needAccess=true",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "62ca4548-6496-458b-858c-e4fdeab49752",
          "citation": "Greenblatt, David J., and Thomas Roth. \"Zolpidem for insomnia.\" Expert opinion on pharmacotherapy 13.6 (2012): 879-893.",
          "url": "https://www.tandfonline.com/doi/pdf/10.1517/14656566.2012.667074?needAccess=true",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "16e4b624-b8c2-2066-9af5-ba5d3f252370",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "4e726bad-234a-b6d3-0d52-9a90dae1be75",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "0162e25e-73ff-35e5-d44f-4f31ed1f8a9b",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5ecce502-e8d4-4421-b2a7-5abab94eb952",
          "id": "5ecce502-e8d4-4421-b2a7-5abab94eb952",
          "molfile": "\n  Marvin  01132104542D          \n\n 23 25  0  0  0  0            999 V2000\n    5.7562   -6.8963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9862   -7.3179    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9818   -8.3504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1473   -6.4446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5344   -5.6057    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0846   -6.4446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6243   -5.8122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6243   -5.0076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9101   -4.5990    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2003   -5.0076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4819   -4.5990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2323   -5.0076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2323   -5.8122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8475   -6.0918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4819   -6.2208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2003   -5.8122    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3427   -4.5990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0827   -5.0249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7926   -4.6506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7926   -3.7730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5153   -3.3814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0569   -3.3600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3427   -3.7730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  2  0  0  0  0\n 16  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 17  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 10 16  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 13 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 23 17  2  0  0  0  0\n 19 18  2  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 20 22  2  0  0  0  0\n 22 23  1  0  0  0  0\nM  END",
          "smiles": "Cc1ccc(cc1)-c2c(CC(=O)N(C)C)n3cc(C)ccc3n2",
          "formula": "C19H21N3O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "64047b63-5868-4d99-9bcc-91cc8c3489ef"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "307.3903",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "48538828-88d5-472b-8ad9-7eddab914243",
      "version": "39",
      "structure": {
        "id": "8aeb9583-775f-4e55-90a5-96be70850940",
        "molfile": "\n  Marvin  01132107132D          \n\n 23 25  0  0  0  0            999 V2000\n    2.6243   -5.8122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2003   -5.8122    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9101   -4.5990    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6243   -5.0076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2003   -5.0076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0846   -6.4446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1473   -6.4446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4819   -6.2208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4819   -4.5990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3427   -4.5990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2323   -5.8122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2323   -5.0076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9862   -7.3179    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5344   -5.6057    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0827   -5.0249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3427   -3.7730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7926   -4.6506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0569   -3.3600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7926   -3.7730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8475   -6.0918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7562   -6.8963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9818   -8.3504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5153   -3.3814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  1  2  0  0  0  0\n  5  2  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  2  1  0  0  0  0\n  9  5  1  0  0  0  0\n 10  4  1  0  0  0  0\n 11  8  2  0  0  0  0\n 12  9  2  0  0  0  0\n 13  7  1  0  0  0  0\n 14  7  2  0  0  0  0\n 15 10  1  0  0  0  0\n 16 10  2  0  0  0  0\n 17 15  2  0  0  0  0\n 18 16  1  0  0  0  0\n 19 17  1  0  0  0  0\n 20 11  1  0  0  0  0\n 21 13  1  0  0  0  0\n 22 13  1  0  0  0  0\n 23 19  1  0  0  0  0\n  5  3  2  0  0  0  0\n 11 12  1  0  0  0  0\n 19 18  2  0  0  0  0\nM  END",
        "smiles": "Cc1ccc(cc1)-c2c(CC(=O)N(C)C)n3cc(C)ccc3n2",
        "formula": "C19H21N3O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "307.3903",
        "optical_activity": "NONE",
        "references": [
          "538c7104-cdc5-4467-ad8b-1e5497ccb324",
          "7373b549-cd97-4f6a-a942-7bbcc1efbb26",
          "8826123c-c341-4a66-b3e2-bfd97cae0c65"
        ],
        "stereo_centers": 0
      },
      "unii": "7K383OQI23",
      "relationships": [
        {
          "uuid": "61a51042-f827-4b58-9a73-7f66eb4b32d5",
          "amount": {
            "uuid": "227d162b-ef51-4f61-81df-57d38eca5c8b"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "3f4f7fc9-aa21-4651-9b75-0cfdce69c5b8",
            "refuuid": "48538828-88d5-472b-8ad9-7eddab914243",
            "name": "ZOLPIDEM",
            "unii": "7K383OQI23",
            "linking_id": "7K383OQI23",
            "ref_pname": "ZOLPIDEM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "5abc328d-cf26-41fd-adbd-b7162610fd49",
          "amount": {
            "uuid": "8b88447f-70ab-4669-8d9d-7f0dc93f50ce"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "13bcd354-5062-4c26-80ee-8247aa554096",
            "refuuid": "983b246d-47ca-4477-8c90-4a71ab61c6db",
            "name": "Zolpidem tartrate",
            "unii": "WY6W63843K",
            "linking_id": "WY6W63843K",
            "ref_pname": "Zolpidem tartrate",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "2b1de65f-904f-4439-b126-bcab3d530e29",
          "amount": {
            "uuid": "249a40f3-053c-4925-99da-fd2a3ab821a4"
          },
          "type": "METABOLITE INACTIVE->PARENT",
          "references": [
            "84d7b11b-93c3-428c-9123-7dabd1bc836f"
          ],
          "related_substance": {
            "uuid": "f7b2771b-802b-4027-8da4-1ecb0e86a9f8",
            "refuuid": "d4c285af-f666-49cd-bfbe-5ccb09ac1712",
            "name": "SL-84.0877",
            "unii": "8752TT8SS0",
            "linking_id": "8752TT8SS0",
            "ref_pname": "SL-84.0877",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "83547e8e-20b4-407c-b3fa-3724a0afd53e",
          "amount": {
            "uuid": "6c349dd8-6d88-4229-a058-715ee1727a30"
          },
          "type": "METABOLITE INACTIVE->PARENT",
          "references": [
            "50451266-df74-4b69-8c72-3f117ac1106a"
          ],
          "related_substance": {
            "uuid": "d8183f3a-08ec-4e73-be42-6f654eb8709c",
            "refuuid": "faae06f7-6533-41bc-a07b-807df3b35d01",
            "name": "SL-840904",
            "unii": "39G0SF97R6",
            "linking_id": "39G0SF97R6",
            "ref_pname": "SL-840904",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "84121ef8-1454-4610-a08b-bb4d840e1689",
          "amount": {
            "uuid": "d047d915-d474-4158-83bf-38d0ba38a2f1"
          },
          "type": "METABOLITE INACTIVE->PARENT",
          "references": [
            "8b5d777a-a695-4643-9781-dd49fc796ff9"
          ],
          "related_substance": {
            "uuid": "eba85672-73eb-47ed-b5bf-9a56d2514745",
            "refuuid": "b5e96442-34ba-4eb3-a650-4e12085ca27f",
            "name": "ZOLPIDEM CARBOXYLIC ACID",
            "unii": "OGV9R9660K",
            "linking_id": "OGV9R9660K",
            "ref_pname": "ZOLPIDEM CARBOXYLIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e64a3804-f8a9-4a3a-ae7e-350ee9d1208e",
          "amount": {
            "uuid": "5c64c8ce-4ed3-4509-b7cd-04e69ce5add3"
          },
          "type": "METABOLITE INACTIVE->PARENT",
          "references": [
            "8b5d777a-a695-4643-9781-dd49fc796ff9"
          ],
          "related_substance": {
            "uuid": "c1378f68-f040-45a4-b52f-7cd086c8e4bf",
            "refuuid": "204ac4f6-e903-4b60-8e86-99f65a8ba580",
            "name": "SL-84.0853",
            "unii": "9XFN6PR11W",
            "linking_id": "9XFN6PR11W",
            "ref_pname": "SL-84.0853",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "55087415-7169-47b1-9169-784a1352b2cd",
          "amount": {
            "uuid": "ec38a5bd-8f65-4c25-9436-84ad2f56ac70"
          },
          "type": "METABOLITE->PARENT",
          "related_substance": {
            "uuid": "7572c6d7-712e-4184-90bb-bc3af8325aeb",
            "refuuid": "9f14073e-d801-4037-aa08-d09b89d6afb4",
            "name": "7-HYDROXY ZOLPIDEM",
            "unii": "PVU3XXH5HE",
            "linking_id": "PVU3XXH5HE",
            "ref_pname": "7-HYDROXY ZOLPIDEM"
          }
        },
        {
          "uuid": "a2a504fb-5f58-4bb8-b5db-ea205d3b7851",
          "amount": {
            "uuid": "7d220699-9d2d-40d9-9abc-017daa892515"
          },
          "type": "METABOLITE->PARENT",
          "related_substance": {
            "uuid": "cc60e4c0-d9ba-4550-afc2-1feae3d42667",
            "refuuid": "60b75d90-3486-468f-bea2-8c80e523c582",
            "name": "N-HYDROXYMETHYL NORZOLPIDEM",
            "unii": "N4WE2J7GT2",
            "linking_id": "N4WE2J7GT2",
            "ref_pname": "N-HYDROXYMETHYL NORZOLPIDEM"
          }
        },
        {
          "uuid": "d6d69fcf-0b23-403c-8005-d4bba4c8b059",
          "amount": {
            "uuid": "ef14dd4e-682d-4098-bea7-4fdbcfcb756f",
            "average": 22,
            "units": "%",
            "non_numeric_value": "Hepatic methylation and hydroxylation"
          },
          "type": "METABOLIC ENZYME->SUBSTRATE",
          "references": [
            "bbc2f3bd-6c76-55b2-83d8-8e6eac1cc1fa"
          ],
          "related_substance": {
            "uuid": "7a777864-7adb-4db4-b53e-243e336b5797",
            "refuuid": "50fbc0e6-a35d-4d72-849b-84bfc9d44cd5",
            "name": "CYTOCHROME P450 2C9",
            "unii": "L9DP834D1P",
            "linking_id": "L9DP834D1P",
            "ref_pname": "CYTOCHROME P450 2C9",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "7728c9e9-a75d-4ea1-a4ff-f6dc9068b2f4",
          "amount": {
            "uuid": "aa886c57-cf3f-4491-80aa-cce1b58ce576",
            "average": 14,
            "units": "%",
            "non_numeric_value": "Hepatic methylation and hydroxylation"
          },
          "type": "METABOLIC ENZYME->SUBSTRATE",
          "references": [
            "bbc2f3bd-6c76-55b2-83d8-8e6eac1cc1fa"
          ],
          "related_substance": {
            "uuid": "aa9cf9cc-635a-4487-bcbd-3377e423ab2d",
            "refuuid": "2964cc53-40a9-4b2b-b19c-d61342fadb5a",
            "name": "CYTOCHROME P450 1A2",
            "unii": "VK4SQL11C0",
            "linking_id": "VK4SQL11C0",
            "ref_pname": "CYTOCHROME P450 1A2",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "263ca420-d6a9-441d-a9d1-c0477c54f270",
          "amount": {
            "uuid": "cdcc0602-e3e1-4f2c-93a1-53a632f219f2",
            "average": 3,
            "units": "%",
            "non_numeric_value": "Hepatic methylation and hydroxylation"
          },
          "type": "METABOLIC ENZYME->SUBSTRATE",
          "references": [
            "bbc2f3bd-6c76-55b2-83d8-8e6eac1cc1fa"
          ],
          "related_substance": {
            "uuid": "31082b09-949b-47bf-b63c-f04a62c79ef3",
            "refuuid": "cc92795c-ba54-4e71-a72b-1af36b57df6b",
            "name": "CYTOCHROME P450 2D6",
            "unii": "8E4LAA4357",
            "linking_id": "8E4LAA4357",
            "ref_pname": "CYTOCHROME P450 2D6",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d56ef564-9cef-4a59-908f-0169de5d5f59",
          "amount": {
            "uuid": "416bdf95-cc11-4d7e-aefc-702add27fe04",
            "average": 3,
            "units": "%",
            "non_numeric_value": "Hepatic methylation and hydroxylation"
          },
          "type": "METABOLIC ENZYME->SUBSTRATE",
          "references": [
            "bbc2f3bd-6c76-55b2-83d8-8e6eac1cc1fa"
          ],
          "related_substance": {
            "uuid": "d4dc8e0c-feb7-4fb7-b32a-f36f6e8da53a",
            "refuuid": "4f746c19-0e0a-447a-beda-d28b91d6f23e",
            "name": "CYTOCHROME P450 2C19",
            "unii": "081I12ZA58",
            "linking_id": "081I12ZA58",
            "ref_pname": "CYTOCHROME P450 2C19",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1bc115ab-cd25-4679-b4ce-eeaed2884b0d",
          "amount": {
            "uuid": "bdf3c511-73c6-4661-b0ad-f185d392cda3",
            "average": 100,
            "units": "MICROMOLAR"
          },
          "qualification": "IC50",
          "type": "TRANSPORTER->NON-INHIBITOR",
          "references": [
            "e9cd3961-3fe7-ca6a-fb66-e80f87b31681"
          ],
          "related_substance": {
            "uuid": "662c9448-6f1c-4600-adb3-7c4b26040628",
            "refuuid": "3921aa0b-fd6d-40ec-9c07-d83e5c6f124a",
            "name": "MULTIDRUG RESISTANCE PROTEIN 1",
            "unii": "22ES734693",
            "linking_id": "22ES734693",
            "ref_pname": "MULTIDRUG RESISTANCE PROTEIN 1",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "402a18af-1159-4851-9a5b-84401d620576",
          "amount": {
            "uuid": "747cc26b-e9d1-49f9-a27a-20ba3a80e47d",
            "average": 92,
            "units": "%"
          },
          "type": "BINDER->LIGAND",
          "interaction_type": "BINDING",
          "references": [
            "72fc0a2b-3e47-018d-2031-fc61b0d3f426"
          ],
          "related_substance": {
            "uuid": "83875bcc-0af0-458b-a1b8-61c67beb8a34",
            "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30",
            "name": "PLASMA PROTEIN FRACTION (HUMAN)",
            "unii": "6D53G0FD0Z",
            "linking_id": "6D53G0FD0Z",
            "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "2a309e68-5307-4494-8570-b9c15b92c55f",
          "amount": {
            "uuid": "1e6bc010-fc2d-41fb-92f8-c6f454052cee"
          },
          "type": "TARGET->AGONIST",
          "references": [
            "1380e393-f5be-4099-a424-a491440e9c19"
          ],
          "related_substance": {
            "uuid": "ad823ff5-6976-4cc1-a2fe-e3012a151a81",
            "refuuid": "45411db4-378d-416f-a8ad-88c8ddb55cdd",
            "name": "GABAA RECEPTOR",
            "unii": "RU3465V8V1",
            "linking_id": "RU3465V8V1",
            "ref_pname": "GABAA RECEPTOR",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "31e0041d-192b-4159-8848-bb83d856c92a",
          "amount": {
            "uuid": "386ad3a7-331e-4de0-91e6-3eedcaeb0464"
          },
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "a29ea71d-ab13-40c1-bb00-9888a041bf2d"
          ],
          "related_substance": {
            "uuid": "434fc838-74b1-436e-acd4-f85bba36b9c1",
            "refuuid": "a52aa7f7-4b44-44bc-a529-499f4fe7c676",
            "name": "ZOLPIDEM HYDROCHLORIDE",
            "unii": "5XT3YJT4W8",
            "linking_id": "5XT3YJT4W8",
            "ref_pname": "ZOLPIDEM HYDROCHLORIDE"
          }
        },
        {
          "uuid": "2e0943f5-e077-419e-a76d-c1629ccb89c0",
          "amount": {
            "uuid": "3010ef87-92fb-4d25-8bc7-355610c942e3"
          },
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "636a19ef-4877-42c8-8725-c6eaab7c56db"
          ],
          "related_substance": {
            "uuid": "ee6d9a44-3d99-4d49-9448-783973acb3c0",
            "refuuid": "bd2ab298-34fb-4f06-b3bf-5b2bdfa8ac76",
            "name": "ZOLPIDEM HYDROBROMIDE",
            "unii": "MW5XV2E6AB",
            "linking_id": "MW5XV2E6AB",
            "ref_pname": "ZOLPIDEM HYDROBROMIDE"
          }
        },
        {
          "uuid": "c8a5cdf4-1998-4be0-aab0-9aac9e116c55",
          "amount": {
            "uuid": "b05a7fe7-7934-4c14-9792-5f8e8fab5708"
          },
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "eea6a5da-e864-4697-8673-80e156f0e3ca"
          ],
          "related_substance": {
            "uuid": "362b2a3f-abdc-49e6-aa24-a273d9f958f3",
            "refuuid": "7671d36c-814f-4e64-99a7-5935ccf4dd9b",
            "name": "ZOLPIDEM HYDROCHLORIDE MONOHYDRATE",
            "unii": "HL85PZ374H",
            "linking_id": "HL85PZ374H",
            "ref_pname": "ZOLPIDEM HYDROCHLORIDE MONOHYDRATE"
          }
        }
      ],
      "names": [
        {
          "uuid": "fdeb87d3-c564-4d19-bf7e-c18ffb6a6d43",
          "name": "IMIDAZO(1,2-A)PYRIDINE-3-ACETAMIDE, N,N,6-TRIMETHYL-2-(4-METHYLPHENYL)-",
          "stdName": "IMIDAZO(1,2-A)PYRIDINE-3-ACETAMIDE, N,N,6-TRIMETHYL-2-(4-METHYLPHENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c68dc8b0-0f4d-421f-8fff-3274fa7092ef"
          ],
          "display_name": false
        },
        {
          "uuid": "cd8b1683-51e0-48ca-a320-75e9bf331aa8",
          "name": "N,N,6-TRIMETHYL-2-P-TOLYL-IMIDAZO(1,2-A)PYRIDINE-3-ACETAMIDE",
          "stdName": "N,N,6-TRIMETHYL-2-P-TOLYL-IMIDAZO(1,2-A)PYRIDINE-3-ACETAMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c68dc8b0-0f4d-421f-8fff-3274fa7092ef"
          ],
          "display_name": false
        },
        {
          "uuid": "55057ac7-3f9c-42d5-babb-5265c75178d2",
          "name": "SANVAL",
          "stdName": "SANVAL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a715374a-e28a-4b9c-a5a9-a991803b7dab",
            "2ffdbe64-9fcd-413e-abc8-784fd5dcc872"
          ],
          "display_name": false
        },
        {
          "uuid": "8e935c30-9d29-4404-9e07-3df8eac34db9",
          "name": "ZOLPIDEM",
          "stdName": "ZOLPIDEM",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "149dc9f8-3d4d-42a3-af4e-c10faa5b0b1d",
            "651bbf55-9159-4f83-a525-026765818bdc",
            "a6a56207-5a04-4d13-a810-3deed62af3d1",
            "f386bd84-b455-49e7-91b1-ebc57bd6b08d",
            "65784ee4-e519-4da1-8647-7ee7f6fb6ebc",
            "913ec85f-8933-4991-9065-f22f2736d836",
            "8826123c-c341-4a66-b3e2-bfd97cae0c65",
            "f4337e36-8421-4805-bdcc-5786d78bf0a6",
            "68c1cdf2-1a2f-413e-967b-c63d2eb1143a"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "92a45410-b862-4acd-90fb-945a0b1b6787",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "52825338-2002-40ea-b46f-2687c32ec92a",
          "name": "ZOLPIDEM CIV",
          "stdName": "ZOLPIDEM CIV",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ae43b729-e80b-476b-aefd-9807236d4c7e",
            "526d3dd0-9a90-4a1a-8588-e5f0c3b49e9b"
          ],
          "display_name": false
        },
        {
          "uuid": "ffba4418-15d9-4fb0-9a4f-2d7b6d0703d0",
          "name": "ZOLPIDEM CIV [USP-RS]",
          "stdName": "ZOLPIDEM CIV [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ae43b729-e80b-476b-aefd-9807236d4c7e"
          ],
          "display_name": false
        },
        {
          "uuid": "8836d507-5bfb-4471-acf1-c1f9bfc615b4",
          "name": "ZOLPIDEM [MI]",
          "stdName": "ZOLPIDEM [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "651bbf55-9159-4f83-a525-026765818bdc"
          ],
          "display_name": false
        },
        {
          "uuid": "dcef188a-33f8-49d8-8c85-5b73c1e4e15f",
          "name": "ZOLPIDEM [VANDF]",
          "stdName": "ZOLPIDEM [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "149dc9f8-3d4d-42a3-af4e-c10faa5b0b1d"
          ],
          "display_name": false
        },
        {
          "uuid": "73481a99-d313-9c26-3f85-a18a8ce7b9d0",
          "name": "Zolpidem [WHO-DD]",
          "stdName": "ZOLPIDEM [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4e726bad-234a-b6d3-0d52-9a90dae1be75"
          ],
          "display_name": false
        },
        {
          "uuid": "065fc531-49a0-4615-87b9-fa8220f4949d",
          "name": "zolpidem [INN]",
          "stdName": "ZOLPIDEM [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8826123c-c341-4a66-b3e2-bfd97cae0c65"
          ],
          "display_name": false
        }
      ],
      "properties": [
        {
          "uuid": "cf3f99ab-4620-48bd-b064-22689867f1b6",
          "name": "Biological Half-life",
          "value": {
            "uuid": "359d9b6d-2797-4ec0-9f89-9befb79369f1",
            "average": 2,
            "units": "hours"
          },
          "defining": false,
          "parameters": [
            {
              "uuid": "da3bc76c-1766-4669-8e86-7ff3ad9e6632",
              "name": "SPECIAL POPULATIONS",
              "type": "PHARMACOKINETIC",
              "value": {
                "uuid": "8fda4f33-78d1-47ff-bfff-af4c5d8124b5",
                "average": 4,
                "units": "hours",
                "references": [],
                "non_numeric_value": "Renal failure"
              },
              "references": []
            },
            {
              "uuid": "aacafb69-edda-411b-a817-fe4897d0300a",
              "name": "SPECIAL POPULATIONS",
              "type": "PHARMACOKINETIC",
              "value": {
                "uuid": "41140b74-42cc-4d1e-8311-ec711e627b22",
                "average": 10,
                "units": "hours",
                "references": [],
                "non_numeric_value": "Cirrhosis"
              },
              "references": []
            },
            {
              "uuid": "16845cde-a019-4ed1-b355-dcf033ac5dce",
              "name": "SPECIAL POPULATIONS",
              "type": "PHARMACOKINETIC",
              "value": {
                "uuid": "9ef3617b-e131-4d19-b8cc-f6d4aee9457d",
                "average": 1.8,
                "units": "hours",
                "references": [],
                "non_numeric_value": "Children 2 to 6 years"
              },
              "references": []
            },
            {
              "uuid": "e4c1a0b1-2c09-4b64-91cc-9d53f811e478",
              "name": "SPECIAL POPULATIONS",
              "type": "PHARMACOKINETIC",
              "value": {
                "uuid": "07764d13-5499-4b5e-9ba0-f158b8ff01c6",
                "average": 2.3,
                "units": "hours",
                "references": [],
                "non_numeric_value": "Children greater than 6 years and Adolescents"
              },
              "references": []
            }
          ],
          "property_type": "PHARMACOKINETIC",
          "references": [
            "c7444c3f-e2ac-9855-f0a2-ca41930fb5f8",
            "bbc2f3bd-6c76-55b2-83d8-8e6eac1cc1fa"
          ]
        },
        {
          "uuid": "bc85c2ef-f59f-4884-9741-8b2c4e78d340",
          "name": "ORAL BIOAVAILABILITY",
          "value": {
            "uuid": "445e6baf-2530-4545-91ae-a07de082e2e6",
            "average": 70,
            "units": "%"
          },
          "defining": false,
          "property_type": "PHARMACOKINETIC",
          "references": [
            "c7444c3f-e2ac-9855-f0a2-ca41930fb5f8"
          ]
        },
        {
          "uuid": "102aa241-b71d-4b01-bd5b-20a456f98b32",
          "name": "Route of Elimination",
          "value": {
            "uuid": "c374fe85-aa64-40e4-930e-c6e2c7c79bb6",
            "units": "%",
            "high_limit": 60,
            "low_limit": 48,
            "non_numeric_value": "In urine primarily as metabolites"
          },
          "defining": false,
          "property_type": "PHARMACOKINETIC",
          "references": [
            "bbc2f3bd-6c76-55b2-83d8-8e6eac1cc1fa"
          ]
        },
        {
          "uuid": "b08895c9-1842-45e8-a1ba-6f2b4ebb55e5",
          "name": "Route of Elimination",
          "value": {
            "uuid": "50c5214d-1d58-4106-8c51-64c691d5dd89",
            "units": "%",
            "high_limit": 42,
            "low_limit": 29,
            "non_numeric_value": "In feces primarily as metabolites"
          },
          "defining": false,
          "property_type": "PHARMACOKINETIC",
          "references": [
            "bbc2f3bd-6c76-55b2-83d8-8e6eac1cc1fa"
          ]
        },
        {
          "uuid": "dea4ef91-95ed-4278-8399-62821188757e",
          "name": "Volume of Distribution",
          "value": {
            "uuid": "b3c6344a-8f09-4cfd-97a3-fd9d5b697375",
            "average": 0.54,
            "units": "Liters/Kilogram",
            "non_numeric_value": "Adults"
          },
          "defining": false,
          "parameters": [
            {
              "uuid": "5345faa0-dea2-469b-b600-3e27dc0ebe44",
              "name": "SPECIAL POPULATIONS",
              "type": "PHARMACOKINETIC",
              "value": {
                "uuid": "7a8c2397-23b8-4877-8e43-5dc03c5ef9f0",
                "average": 1.8,
                "high": 2.6,
                "low": 1,
                "units": "Liters/Kilogram",
                "references": [],
                "non_numeric_value": "Children 2 to 6 years"
              },
              "references": []
            },
            {
              "uuid": "d080e79f-6733-4a38-82ed-f1faf96f9c2e",
              "name": "SPECIAL POPULATIONS",
              "type": "PHARMACOKINETIC",
              "value": {
                "uuid": "410842e9-e29a-4b6b-aaa0-58f8c124d7c3",
                "average": 2.2,
                "high": 3.9,
                "low": 0.5,
                "units": "Liters/Kilogram",
                "references": [],
                "non_numeric_value": "Children greater than 6 to 12 years"
              },
              "references": []
            },
            {
              "uuid": "72ee60ad-baa6-4136-96ef-cc50aeac69b1",
              "name": "SPECIAL POPULATIONS",
              "type": "PHARMACOKINETIC",
              "value": {
                "uuid": "2a9807f9-d682-493c-a0b3-6dcd4db1e0ed",
                "average": 1.2,
                "high": 1.6,
                "low": 0.8,
                "units": "Liters/Kilogram",
                "references": [],
                "non_numeric_value": "Adolescents"
              },
              "references": []
            }
          ],
          "property_type": "PHARMACOKINETIC",
          "references": [
            "bbc2f3bd-6c76-55b2-83d8-8e6eac1cc1fa"
          ]
        },
        {
          "uuid": "140e5bb1-bd01-4d3d-aee9-9c50695c9aca",
          "name": "MAXIMUM TOLERATED DOSE",
          "value": {
            "uuid": "d5ee7ad1-86bd-44a7-9fe3-2ad7a2d73f92",
            "average": 10,
            "units": "mg/day",
            "non_numeric_value": "IMMEDIATE-RELEASE TABLET"
          },
          "defining": false,
          "parameters": [
            {
              "uuid": "373d8faf-f6ac-4a12-ba96-0841e81afc6a",
              "name": "EXTENDED-RELEASE TABLET",
              "value": {
                "uuid": "529988b1-328a-456c-8563-f0617af3d8eb",
                "average": 12.5,
                "units": "mg/day",
                "references": []
              },
              "references": []
            },
            {
              "uuid": "1dd67890-0025-47e4-bace-70607af0657d",
              "name": "ORAL SPRAY, SL TABLET",
              "value": {
                "uuid": "9b7fa509-6d16-45c5-b1a4-a25c95c62999",
                "average": 10,
                "units": "mg/day",
                "references": []
              },
              "references": []
            }
          ],
          "property_type": "TOXICITY",
          "references": [
            "39ff660b-98d8-dae2-e7fa-d9d3b6cede82"
          ]
        }
      ]
    }
  ]
}