{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9d5a40b8-c085-446f-ad3b-73073ebc8c3b",
          "code": "2425-85-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2425-85-6",
          "code_system": "CAS",
          "references": [
            "095100c8-e91d-4bf4-9447-d931ff4b2246",
            "925202cc-eb4e-4e2e-bdd4-4d2f41258745"
          ]
        },
        {
          "uuid": "6af729eb-2330-409a-985c-a8f0db11c351",
          "code": "219-372-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.017.612",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "095100c8-e91d-4bf4-9447-d931ff4b2246"
          ]
        },
        {
          "uuid": "994c3f9b-531f-70f6-e2f5-a0d7c5cdbf83",
          "code": "4357",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/4357",
          "code_system": "HSDB",
          "references": [
            "4bba2fb8-4111-1ace-9538-9fa2f904293d"
          ]
        },
        {
          "uuid": "e77f57b0-3c77-667f-9dcc-cd2327190997",
          "code": "DTXSID8021226",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8021226",
          "code_system": "EPA CompTox",
          "references": [
            "4dba5793-3017-8500-4d61-8b1f6822c035"
          ]
        },
        {
          "uuid": "16300dc3-a623-4728-8261-a5cd3bb659c8",
          "code": "7K26S08256",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c12fe8de-6010-ff2e-622a-3d26dd2c0d11",
          "code": "45193",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=45193",
          "code_system": "NSC",
          "references": [
            "bf2f348f-20e5-d661-74d4-98cf36d42369"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "88229b6c-69d6-4e9d-8e65-6d99e889bd7a",
          "name": "1-((4-METHYL-2-NITROPHENYL)AZO)-2-NAPHTHALENOL",
          "stdName": "1-((4-METHYL-2-NITROPHENYL)AZO)-2-NAPHTHALENOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6d6bec6b-0eda-4fff-bcac-a5a7f47f1541",
            "96c5259e-dff6-4536-98dc-1c82cdcefa86"
          ],
          "display_name": false
        },
        {
          "uuid": "39aca4ba-46ed-42aa-8d02-5b4c0e441768",
          "name": "1-(O-NITRO-P-TOLYLAZO)-2-NAPHTHOL",
          "stdName": "1-(O-NITRO-P-TOLYLAZO)-2-NAPHTHOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6d6bec6b-0eda-4fff-bcac-a5a7f47f1541",
            "96c5259e-dff6-4536-98dc-1c82cdcefa86"
          ],
          "display_name": false
        },
        {
          "uuid": "900250b2-4fda-4015-8008-75bc365b2819",
          "name": "2-NAPHTHALENOL, 1-((4-METHYL-2-NITROPHENYL)AZO)-",
          "stdName": "2-NAPHTHALENOL, 1-((4-METHYL-2-NITROPHENYL)AZO)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6d6bec6b-0eda-4fff-bcac-a5a7f47f1541",
            "96c5259e-dff6-4536-98dc-1c82cdcefa86"
          ],
          "display_name": false
        },
        {
          "uuid": "1691e3e9-4728-4d2d-a620-4086c7b9af29",
          "name": "2-NAPHTHALENOL, 1-(2-(4-METHYL-2-NITROPHENYL)DIAZENYL)-",
          "stdName": "2-NAPHTHALENOL, 1-(2-(4-METHYL-2-NITROPHENYL)DIAZENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "530424cf-e9dd-4692-85cd-374fb4d4067c",
            "96c5259e-dff6-4536-98dc-1c82cdcefa86"
          ],
          "display_name": false
        },
        {
          "uuid": "2b40768d-57ce-43d5-b541-13d17188b5a4",
          "name": "C.I. PIGMENT RED 3 [HSDB]",
          "stdName": "C.I. PIGMENT RED 3 [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "82b7227d-072a-482d-8be0-948ad72c0f6a",
            "96c5259e-dff6-4536-98dc-1c82cdcefa86"
          ],
          "display_name": false
        },
        {
          "uuid": "2b9807f1-a71b-4a35-8df3-27aeca393709",
          "name": "CI 12120",
          "stdName": "CI 12120",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "1f447b38-360c-4e13-ae6a-f789ac8d1b63",
            "6d6bec6b-0eda-4fff-bcac-a5a7f47f1541",
            "96c5259e-dff6-4536-98dc-1c82cdcefa86"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "e145992e-c45f-43ea-9a4d-26c8ba95801b",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "7e304241-def3-497c-907a-f8f4c595a32f",
          "name": "CI PIGMENT RED 3",
          "stdName": "CI PIGMENT RED 3",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d02cbfff-168e-402a-8aca-f5e2a404b1a2"
          ],
          "display_name": false
        },
        {
          "uuid": "de2b4435-681e-84bb-eeea-62cdab188520",
          "name": "CI PIGMENT RED 3 [IARC]",
          "stdName": "CI PIGMENT RED 3 [IARC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7338b0d0-6af3-9a35-8164-546d6c1285d4"
          ],
          "display_name": false
        },
        {
          "uuid": "6f4df0dc-f8ab-42a4-98b0-0d647926f66c",
          "name": "ELJON FAST SCARLET RN",
          "stdName": "ELJON FAST SCARLET RN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e16bf0d4-c9ae-467a-b11f-8a2165ff9d7a",
            "96c5259e-dff6-4536-98dc-1c82cdcefa86"
          ],
          "display_name": false
        },
        {
          "uuid": "6daae951-9b14-48cd-b3f9-b14b65056bcc",
          "name": "HANSA RED B",
          "stdName": "HANSA RED B",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6d6bec6b-0eda-4fff-bcac-a5a7f47f1541",
            "96c5259e-dff6-4536-98dc-1c82cdcefa86"
          ],
          "display_name": false
        },
        {
          "uuid": "8703c558-a57c-4964-957f-b07ebf928a24",
          "name": "NCI-C60366",
          "stdName": "NCI-C60366",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e16bf0d4-c9ae-467a-b11f-8a2165ff9d7a",
            "96c5259e-dff6-4536-98dc-1c82cdcefa86"
          ],
          "display_name": false
        },
        {
          "uuid": "1a6115e7-fb8a-45d1-87e3-0a41df4212a6",
          "name": "NSC-45193",
          "stdName": "NSC-45193",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e16bf0d4-c9ae-467a-b11f-8a2165ff9d7a",
            "96c5259e-dff6-4536-98dc-1c82cdcefa86"
          ],
          "display_name": false
        },
        {
          "uuid": "5c59d04a-0937-4799-ab25-35104bc17ec3",
          "name": "PIGMENT RED 3",
          "stdName": "PIGMENT RED 3",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6d6bec6b-0eda-4fff-bcac-a5a7f47f1541",
            "96c5259e-dff6-4536-98dc-1c82cdcefa86"
          ],
          "display_name": true
        },
        {
          "uuid": "5a150810-0dbf-4ea6-a6c0-e6b1d2020a1d",
          "name": "TOLUIDINE RED",
          "stdName": "TOLUIDINE RED",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "774af2b6-9b22-4ae2-9968-219838034772",
            "96c5259e-dff6-4536-98dc-1c82cdcefa86"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "d02cbfff-168e-402a-8aca-f5e2a404b1a2",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "6d6bec6b-0eda-4fff-bcac-a5a7f47f1541",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "96c5259e-dff6-4536-98dc-1c82cdcefa86",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "530424cf-e9dd-4692-85cd-374fb4d4067c",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "82b7227d-072a-482d-8be0-948ad72c0f6a",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e16bf0d4-c9ae-467a-b11f-8a2165ff9d7a",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "774af2b6-9b22-4ae2-9968-219838034772",
          "citation": "SIGMA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "095100c8-e91d-4bf4-9447-d931ff4b2246",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390888000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "39b5e945-01de-4285-ab3e-84ec89879540",
          "citation": "SRS import [7K26S08256]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7K26S08256",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390888000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "abbdafbb-5da7-479c-a94e-682580342175",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1f447b38-360c-4e13-ae6a-f789ac8d1b63",
          "citation": "CI 12120 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4bba2fb8-4111-1ace-9538-9fa2f904293d",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+2425-85-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4dba5793-3017-8500-4d61-8b1f6822c035",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2425-85-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7338b0d0-6af3-9a35-8164-546d6c1285d4",
          "citation": "IARC",
          "doc_type": "IARC",
          "public_domain": true
        },
        {
          "uuid": "925202cc-eb4e-4e2e-bdd4-4d2f41258745",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "bf2f348f-20e5-d661-74d4-98cf36d42369",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "fe1d5579-19bb-4f34-9fd2-63e2f62ddaec",
          "id": "fe1d5579-19bb-4f34-9fd2-63e2f62ddaec",
          "molfile": "\n  Marvin  01132113092D          \n\n 23 25  0  0  0  0            999 V2000\n   11.0079   -5.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1829   -5.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7705   -6.0691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9455   -6.0691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5329   -5.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7079   -5.3547    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2954   -4.6402    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4705   -4.6402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0580   -3.9258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4705   -3.2113    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2329   -3.9258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8204   -4.6402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2329   -5.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8204   -6.0691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2329   -6.7836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0580   -6.7836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4705   -6.0691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0580   -5.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9455   -4.6402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7705   -4.6402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5329   -3.9258    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    7.7079   -3.9258    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.9455   -3.2113    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n 20  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n 19  5  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 18  2  0  0  0  0\n  9 10  1  0  0  0  0\n 11  9  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 13 14  1  0  0  0  0\n 18 13  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  2  0  0  0  0\nM  CHG  2  21   1  22  -1\nM  END",
          "smiles": "Cc1ccc(c(c1)[N+](=O)[O-])/N=N/c2c3ccccc3ccc2O",
          "formula": "C17H13N3O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "202d9a12-6ea5-48df-b109-15f72b354d93"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "307.3041",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "7a32f291-adab-42b8-a410-c9591453fef0",
      "version": "8",
      "structure": {
        "id": "5f01a014-9b12-45ef-a1a1-4436054411a5",
        "molfile": "\n  Marvin  01132104552D          \n\n 23 25  0  0  0  0            999 V2000\n    8.9455   -4.6402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7705   -4.6402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1829   -5.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7705   -6.0691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9455   -6.0691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5329   -5.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7079   -5.3547    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2954   -4.6402    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4705   -4.6402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0580   -5.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2329   -5.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8204   -4.6402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2329   -3.9258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0580   -3.9258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4705   -3.2113    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8204   -6.0691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2329   -6.7836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0580   -6.7836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4705   -6.0691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0079   -5.3547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5329   -3.9258    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    7.7079   -3.9258    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.9455   -3.2113    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  1  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n  9 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 11 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 10 19  1  0  0  0  0\n  3 20  1  0  0  0  0\n  1 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  2  0  0  0  0\nM  CHG  2  21   1  22  -1\nM  END",
        "smiles": "Cc1ccc(c(c1)[N+](=O)[O-])/N=N/c2c3ccccc3ccc2O",
        "formula": "C17H13N3O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "307.3041",
        "optical_activity": "NONE",
        "references": [
          "39b5e945-01de-4285-ab3e-84ec89879540",
          "abbdafbb-5da7-479c-a94e-682580342175"
        ],
        "stereo_centers": 0
      },
      "unii": "7K26S08256"
    }
  ]
}