{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "6c4864d3-1aac-4a6e-acce-c4ed9e741d4a",
          "code": "16655-82-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=16655-82-6",
          "code_system": "CAS",
          "references": [
            "7f288f13-d35b-444e-8ef8-028a909827f8",
            "1389e396-34d4-4bac-b048-0fb189bd8f2d"
          ]
        },
        {
          "uuid": "bceee828-a1ab-493c-85ed-9138c054ae69",
          "code": "27975",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/27975",
          "code_system": "PUBCHEM",
          "references": [
            "7f288f13-d35b-444e-8ef8-028a909827f8"
          ]
        },
        {
          "uuid": "3b6763d1-d6f5-e445-6c3a-ff6023593ec9",
          "code": "DTXSID2037506",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2037506",
          "code_system": "EPA CompTox",
          "references": [
            "55384793-7951-ba89-310a-1510adb40c70"
          ]
        },
        {
          "uuid": "76ac6fb2-4667-4905-99c2-e17840f777eb",
          "code": "7J7N7A61BJ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "9e67b618-904a-47af-b184-70906b1a0344",
          "amount": {
            "uuid": "0de0216f-59dc-4a3a-ad02-bc83c2465534"
          },
          "type": "PARENT->METABOLITE",
          "references": [
            "cca60605-1826-4536-917e-a4431decb4ea"
          ],
          "related_substance": {
            "uuid": "a5a965cf-f36f-43cd-92cd-22b3a491eb37",
            "refuuid": "f400fd57-7a89-4640-a76a-824334e6bc5d",
            "name": "CARBOFURAN",
            "unii": "SKF77S6Y67",
            "linking_id": "SKF77S6Y67",
            "ref_pname": "CARBOFURAN",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "0077d174-dd38-4964-9886-2c897783405d",
          "name": "3,7-BENZOFURANDIOL, 2,3-DIHYDRO-2,2-DIMETHYL-, 7-(METHYLCARBAMATE)",
          "stdName": "3,7-BENZOFURANDIOL, 2,3-DIHYDRO-2,2-DIMETHYL-, 7-(METHYLCARBAMATE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "15c81b7a-e992-41d0-bc9e-985c849b2f24",
            "9425ba66-4494-4f9f-977a-dda49a374d8c"
          ],
          "display_name": false
        },
        {
          "uuid": "982d4be4-a009-45d1-b21e-b0f064bec298",
          "name": "3-HYDROXYCARBOFURAN",
          "stdName": "3-HYDROXYCARBOFURAN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b44a06d8-09c7-4db7-bc95-edc32c2f08f4",
            "9425ba66-4494-4f9f-977a-dda49a374d8c"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "15c81b7a-e992-41d0-bc9e-985c849b2f24",
          "citation": "chemid",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "9425ba66-4494-4f9f-977a-dda49a374d8c",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b44a06d8-09c7-4db7-bc95-edc32c2f08f4",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7f288f13-d35b-444e-8ef8-028a909827f8",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392272000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "db824dcf-502a-4054-88e7-93c298365026",
          "citation": "SRS import [7J7N7A61BJ]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7J7N7A61BJ",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392272000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "55384793-7951-ba89-310a-1510adb40c70",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=16655-82-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "cca60605-1826-4536-917e-a4431decb4ea",
          "citation": "J Agric Food Chem 1980;28(4):719",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1389e396-34d4-4bac-b048-0fb189bd8f2d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e60e3e95-c15d-46f2-a1d8-d13d88132fcd",
          "id": "e60e3e95-c15d-46f2-a1d8-d13d88132fcd",
          "molfile": "\n  Marvin  01132111552D          \n\n 17 18  0  0  0  0            999 V2000\n    4.1286    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4168   -0.4081    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4168   -1.2433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1286   -1.6467    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7002   -1.6467    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7002   -2.4724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4168   -2.8900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4168   -3.7110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7002   -4.1286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9836   -3.7110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2006   -3.9625    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    0.9444   -4.7455    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7166   -3.2981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -3.7110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.8900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2006   -2.6290    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9836   -2.8900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n 17  6  2  0  0  0  0\n  7  8  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 10 11  1  0  0  0  0\n 17 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 11  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 16 13  1  0  0  0  0\n 17 16  1  0  0  0  0\nM  END",
          "smiles": "CC1(C)C(c2cccc(c2O1)OC(=O)NC)O",
          "formula": "C12H15NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "cce7d6dd-9d36-45ee-a858-56d5f5a9c4e1"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "237.2523",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "988161d3-917e-4571-9395-f0ab03d065b0",
      "version": "4",
      "structure": {
        "id": "fbf67567-10da-4697-bdfd-54a0f0679d02",
        "molfile": "\n  Marvin  01132113032D          \n\n 17 18  0  0  0  0            999 V2000\n    1.9836   -2.8900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2006   -2.6290    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4168   -1.2433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7002   -2.4724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9836   -3.7110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7166   -3.2981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7002   -1.6467    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2006   -3.9625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1286   -1.6467    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4168   -0.4081    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7002   -4.1286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4168   -2.8900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -3.7110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.8900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4168   -3.7110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1286    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9444   -4.7455    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  4  1  0  0  0  0\n  1  5  2  0  0  0  0\n  2  6  1  0  0  0  0\n  3  7  1  0  0  0  0\n  3  9  2  0  0  0  0\n  3 10  1  0  0  0  0\n  4  7  1  0  0  0  0\n  4 12  2  0  0  0  0\n  5  8  1  0  0  0  0\n  5 11  1  0  0  0  0\n  6 13  1  0  0  0  0\n  6 14  1  0  0  0  0\n  6  8  1  0  0  0  0\n  8 17  1  0  0  0  0\n 10 16  1  0  0  0  0\n 11 15  2  0  0  0  0\n 12 15  1  0  0  0  0\nM  END",
        "smiles": "CC1(C)C(c2cccc(c2O1)OC(=O)NC)O",
        "formula": "C12H15NO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "237.2523",
        "optical_activity": "( + / - )",
        "references": [
          "b44a06d8-09c7-4db7-bc95-edc32c2f08f4",
          "db824dcf-502a-4054-88e7-93c298365026"
        ],
        "stereo_centers": 1
      },
      "unii": "7J7N7A61BJ"
    }
  ]
}