{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5b1e49cc-9602-4ed7-a7ea-2ceb705e5ac6",
          "code": "57967-68-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=57967-68-7",
          "code_system": "CAS",
          "references": [
            "40134101-f3a7-47ac-ae89-5db787a7ab61",
            "81de3f68-ee18-47f7-88e0-6d69292f99ea"
          ]
        },
        {
          "uuid": "20c6e53a-19e1-4109-9377-17ce7e75b8e5",
          "code": "261-044-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.055.477",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "40134101-f3a7-47ac-ae89-5db787a7ab61"
          ]
        },
        {
          "uuid": "dd2591b4-6278-46a4-94ca-3b93dc39b6a9",
          "code": "23624156",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/23624156",
          "code_system": "PUBCHEM",
          "references": [
            "40134101-f3a7-47ac-ae89-5db787a7ab61"
          ]
        },
        {
          "uuid": "896a5d72-e17a-8423-6617-3e938f32dd37",
          "code": "DTXSID6052241",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6052241",
          "code_system": "EPA CompTox",
          "references": [
            "67da617f-9477-1ab8-c8ac-ebb3b8f1a124"
          ]
        },
        {
          "uuid": "058a8e7b-73ed-4c84-aeb4-43fb34a04c65",
          "code": "7J27MR4WQ2",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c01de5bf-12b5-417b-9826-6c0c40e7ee05",
          "name": "(2.ALPHA.,5.ALPHA.(R*))-2,6,10,10-TETRAMETHYL-1-OXASPIRO(4.5)DECAN-6-OL",
          "stdName": "(2.ALPHA.,5.ALPHA.(R*))-2,6,10,10-TETRAMETHYL-1-OXASPIRO(4.5)DECAN-6-OL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "db24a7a6-ccc0-4543-9352-740768c9c321"
          ],
          "display_name": false
        },
        {
          "uuid": "1e1b3a08-d8ca-4875-b979-45664cf92bb2",
          "name": "1-OXASPIRO(4.5)DECAN-6-OL, 2,6,10,10-TETRAMETHYL-, (2.ALPHA.,5.ALPHA.(S*))-",
          "stdName": "1-OXASPIRO(4.5)DECAN-6-OL, 2,6,10,10-TETRAMETHYL-, (2.ALPHA.,5.ALPHA.(S*))-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "207adff0-fc59-4242-a891-5d2ff6ef9e51"
          ],
          "display_name": false
        },
        {
          "uuid": "d40ae738-85d7-4441-9de0-14f46f2ca021",
          "name": "1-OXASPIRO(4.5)DECAN-6-OL, 2,6,10,10-TETRAMETHYL-, (2R,5S,6S)-REL-",
          "stdName": "1-OXASPIRO(4.5)DECAN-6-OL, 2,6,10,10-TETRAMETHYL-, (2R,5S,6S)-REL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "207adff0-fc59-4242-a891-5d2ff6ef9e51"
          ],
          "display_name": false
        },
        {
          "uuid": "d3f2d82d-5161-4cc0-9886-922be0495281",
          "name": "6-HYDROXYDIHYDROTHEASPIRANE, (2R,5S,6S)-",
          "stdName": "6-HYDROXYDIHYDROTHEASPIRANE, (2R,5S,6S)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "63cd44cc-4bbd-41d2-9174-c26c0e58baa6"
          ],
          "display_name": true
        },
        {
          "uuid": "3d7c2398-ac24-4f58-a7d1-37a593fa1124",
          "name": "FEMA NO. 3549, (2R,5S,6S)-",
          "stdName": "FEMA NO. 3549, (2R,5S,6S)-",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "63cd44cc-4bbd-41d2-9174-c26c0e58baa6"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "63cd44cc-4bbd-41d2-9174-c26c0e58baa6",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "207adff0-fc59-4242-a891-5d2ff6ef9e51",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "db24a7a6-ccc0-4543-9352-740768c9c321",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "40134101-f3a7-47ac-ae89-5db787a7ab61",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390830000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7adf8288-8b38-4dc4-8784-8b7c16748107",
          "citation": "SRS import [7J27MR4WQ2]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7J27MR4WQ2",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390830000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fd750885-b869-4a67-a446-aadfdfcf0828",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "67da617f-9477-1ab8-c8ac-ebb3b8f1a124",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=57967-68-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "81de3f68-ee18-47f7-88e0-6d69292f99ea",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1903609f-3228-4d2c-a19f-619129a47b8d",
          "id": "1903609f-3228-4d2c-a19f-619129a47b8d",
          "molfile": "\n  Marvin  01132101292D          \n\n 15 16  0  0  1  0            999 V2000\n    6.5626   -4.9622    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.8980   -4.2084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9750   -5.6766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4230   -6.2897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6693   -5.9541    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.7555   -5.1337    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9549   -5.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4245   -4.9096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3673   -4.8271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2403   -5.9541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2403   -6.7791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9549   -7.1916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6693   -6.7791    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.9515   -7.5544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4943   -6.7791    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  6  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  6  0  0  0\n  5  7  1  0  0  0  0\n 13  5  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n 10  7  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  1  0  0  0\nM  END",
          "smiles": "C[C@@H]1CC[C@@]2(C(C)(C)CCC[C@]2(C)O)O1",
          "formula": "C13H24O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d3fbe5f4-5633-4b12-8143-fc03eb728eef"
          },
          "defined_stereo": 3,
          "ez_centers": 0,
          "molecular_weight": "212.329",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "d4e94e8a-9e69-488f-a59b-25474d15a55c",
      "version": "3",
      "structure": {
        "id": "c5a91ff2-7361-42de-a24a-0af57f02f57a",
        "molfile": "\n  Marvin  01132110132D          \n\n 15 16  0  0  0  0            999 V2000\n    4.2403   -5.9541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9549   -5.5417    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    4.4245   -4.9096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3673   -4.8271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6693   -5.9541    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.7555   -5.1337    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5626   -4.9622    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.8980   -4.2084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9750   -5.6766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4230   -6.2897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6693   -6.7791    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.9515   -7.5544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4943   -6.7791    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9549   -7.1916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2403   -6.7791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  2  1  1  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  6  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  5 10  1  0  0  0  0\n 11  5  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  1  0  0  0\n 14 11  1  0  0  0  0\n 15 14  1  0  0  0  0\n  1 15  1  0  0  0  0\nM  END",
        "smiles": "C[C@@H]1CC[C@@]2(C(C)(C)CCC[C@]2(C)O)O1",
        "formula": "C13H24O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 3,
        "ez_centers": 0,
        "molecular_weight": "212.329",
        "optical_activity": "( + / - )",
        "references": [
          "fd750885-b869-4a67-a446-aadfdfcf0828",
          "7adf8288-8b38-4dc4-8784-8b7c16748107"
        ],
        "stereo_centers": 3
      },
      "unii": "7J27MR4WQ2"
    }
  ]
}