{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "4807f9e7-2c10-4078-941a-a94202229538",
          "code": "3646-73-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3646-73-9",
          "code_system": "CAS",
          "references": [
            "7f62a925-c190-47b1-83c2-c16548727490",
            "68534883-fc7c-431f-83db-24c53651e3e5"
          ]
        },
        {
          "uuid": "52cd6f4c-92b1-4714-8881-ebf1b18d6e31",
          "code": "m5635",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5635?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "7f62a925-c190-47b1-83c2-c16548727490"
          ]
        },
        {
          "uuid": "1ee45056-9fc1-42b5-90a7-103f97b0f041",
          "code": "439357",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/439357",
          "code_system": "PUBCHEM",
          "references": [
            "7f62a925-c190-47b1-83c2-c16548727490"
          ]
        },
        {
          "uuid": "1d4cd9d2-62a9-b566-329a-78d4c8adcc62",
          "code": "28061",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:28061",
          "code_system": "CHEBI",
          "references": [
            "4f48109b-2515-6f65-5a84-be330931a21f"
          ]
        },
        {
          "uuid": "e8319af4-f09c-46ab-882e-1613d5621421",
          "code": "7IOF6H4H77",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c01f50de-9959-b3f1-c39e-9bf28089c6fd",
          "code": "DTXSID90189974",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90189974",
          "code_system": "EPA CompTox",
          "references": [
            "615f1589-cfe9-bf0a-afda-78b6cf0962a3"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "98e2cc18-e4a2-42c9-8fca-37e885decdc6",
          "name": ".ALPHA.-D-GALACTOPYRANOSE",
          "stdName": ".ALPHA.-D-GALACTOPYRANOSE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9cfbfcfc-e0e5-46f5-a001-6b8a2958d6ba",
            "1176d8c1-ac0d-4cc5-9da4-21940e7827b2"
          ],
          "display_name": false
        },
        {
          "uuid": "e9170387-9c19-4744-b773-58e490b21444",
          "name": "ALPHA-D-GALACTOSE",
          "stdName": "ALPHA-D-GALACTOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9cfbfcfc-e0e5-46f5-a001-6b8a2958d6ba",
            "43f0ac0c-bab5-438f-a870-2d123e8d37f1"
          ],
          "display_name": false
        },
        {
          "uuid": "d35729e4-5572-4135-a311-7472a4b34534",
          "name": "D-GALACTOSE .ALPHA.-FORM [MI]",
          "stdName": "D-GALACTOSE .ALPHA.-FORM [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9cfbfcfc-e0e5-46f5-a001-6b8a2958d6ba",
            "894cd3c9-d2de-4fa8-b190-f2a939dda925"
          ],
          "display_name": false
        },
        {
          "uuid": "03306058-e6c0-45c9-901c-1ae3b774b203",
          "name": "α-D-Galactopyranose",
          "stdName": ".ALPHA.-D-GALACTOPYRANOSE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9cfbfcfc-e0e5-46f5-a001-6b8a2958d6ba",
            "abbe042f-ccd5-4222-81fe-9d200e256bab"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "abbe042f-ccd5-4222-81fe-9d200e256bab",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "9cfbfcfc-e0e5-46f5-a001-6b8a2958d6ba",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1176d8c1-ac0d-4cc5-9da4-21940e7827b2",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "43f0ac0c-bab5-438f-a870-2d123e8d37f1",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "894cd3c9-d2de-4fa8-b190-f2a939dda925",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7f62a925-c190-47b1-83c2-c16548727490",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391021000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d9f846e1-1ece-47ef-827e-33dbd5931b36",
          "citation": "SRS import [7IOF6H4H77]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7IOF6H4H77",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391021000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fdb1d43c-7488-44d3-a5ff-7a9c60532b11",
          "citation": "wikipedia gour gum",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "633f2f56-1fa2-29ac-feb5-3d2ea9008ce8",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=3646-73-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4f48109b-2515-6f65-5a84-be330931a21f",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "68534883-fc7c-431f-83db-24c53651e3e5",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "615f1589-cfe9-bf0a-afda-78b6cf0962a3",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "692ccd82-93e3-4588-b5f5-9a2f238d3623",
          "id": "692ccd82-93e3-4588-b5f5-9a2f238d3623",
          "molfile": "\n  Marvin  01132105282D          \n\n 12 12  0  0  1  0            999 V2000\n    4.0541    0.3941    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    4.7741    0.7897    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3495    0.8273    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6206    0.4282    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    1.9046    0.8619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1828    0.4639    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6012   -0.3966    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    1.8752   -0.7896    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3040   -0.8265    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    3.2732   -1.6588    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0330   -0.4273    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    4.7464   -0.8562    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n 11  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  1  0  0  0\n  7  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  8  1  1  0  0  0\n  9  7  1  0  0  0  0\n  9 10  1  1  0  0  0\n 11  9  1  0  0  0  0\n 11 12  1  6  0  0  0\nM  END",
          "smiles": "C([C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O)O1)O)O)O)O",
          "formula": "C6H12O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "24bdc879-4a8c-4c0c-8291-ffe8b7740ea6"
          },
          "defined_stereo": 5,
          "ez_centers": 0,
          "molecular_weight": "180.1561",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "71a68453-ac64-4599-b902-0a4a4410b3dd",
      "version": "7",
      "structure": {
        "id": "5be14c9b-5bd9-4a64-8b56-809070cdce53",
        "molfile": "\n  Marvin  01132104452D          \n\n 12 12  0  0  1  0            999 V2000\n    3.3040   -0.8265    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.0330   -0.4273    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.0541    0.3941    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.3495    0.8273    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6206    0.4282    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.6012   -0.3966    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    1.9046    0.8619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1828    0.4639    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8752   -0.7896    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2732   -1.6588    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7464   -0.8562    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7741    0.7897    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  1  0  0  0\n  1  2  1  0  0  0  0\n  7  8  1  0  0  0  0\n  1  6  1  0  0  0  0\n  6  9  1  1  0  0  0\n  2  3  1  0  0  0  0\n  1 10  1  1  0  0  0\n  3  4  1  0  0  0  0\n  2 11  1  6  0  0  0\n  4  5  1  0  0  0  0\n  3 12  1  6  0  0  0\nM  END",
        "smiles": "C([C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O)O1)O)O)O)O",
        "formula": "C6H12O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 5,
        "ez_centers": 0,
        "molecular_weight": "180.1561",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "d9f846e1-1ece-47ef-827e-33dbd5931b36",
          "fdb1d43c-7488-44d3-a5ff-7a9c60532b11"
        ],
        "stereo_centers": 5
      },
      "unii": "7IOF6H4H77"
    }
  ]
}