{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3a85d6e3-4f4d-48e2-bd43-1f33f64d53eb",
          "code": "83-86-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=83-86-3",
          "code_system": "CAS",
          "references": [
            "4208ae4d-4865-4be9-b1fe-9547003af98a",
            "d8e3b5f4-5433-47c3-88d5-f5cc23cf969e"
          ]
        },
        {
          "uuid": "17eae17e-5d02-49e2-954a-8ff275dba775",
          "code": "C87652",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C87652",
          "code_system": "NCI_THESAURUS",
          "references": [
            "4208ae4d-4865-4be9-b1fe-9547003af98a"
          ]
        },
        {
          "uuid": "4984a9c4-ec0c-49e2-82ea-1802634bc115",
          "code": "D010833",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68010833",
          "code_system": "MESH",
          "references": [
            "4208ae4d-4865-4be9-b1fe-9547003af98a"
          ]
        },
        {
          "uuid": "b310b808-ba7e-42f0-9264-6e38122d95f4",
          "code": "PHYTIC ACID",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Phytic_acid",
          "code_system": "WIKIPEDIA",
          "references": [
            "4208ae4d-4865-4be9-b1fe-9547003af98a"
          ]
        },
        {
          "uuid": "4b008b64-b250-4b2b-b6ec-654a3b980d9a",
          "code": "SUB07856MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "4208ae4d-4865-4be9-b1fe-9547003af98a"
          ]
        },
        {
          "uuid": "78d67f17-eee4-4749-98a7-e56741fa2f3c",
          "code": "1472",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1472",
          "code_system": "INN",
          "references": [
            "4208ae4d-4865-4be9-b1fe-9547003af98a"
          ]
        },
        {
          "uuid": "887f9189-f1e5-48d2-ba9f-26f23f8275a9",
          "code": "8302",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/8302/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "4208ae4d-4865-4be9-b1fe-9547003af98a"
          ]
        },
        {
          "uuid": "cba5b9a8-de45-4dd6-b1e5-bb67061ccdf0",
          "code": "m8769",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8769?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "4208ae4d-4865-4be9-b1fe-9547003af98a"
          ]
        },
        {
          "uuid": "ea58e44f-4de4-4651-9c7e-fa041ac28ff5",
          "code": "CHEMBL1233511",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1233511",
          "code_system": "ChEMBL",
          "references": [
            "4208ae4d-4865-4be9-b1fe-9547003af98a"
          ]
        },
        {
          "uuid": "174b1008-32f8-40e8-b4ac-2cff12cc8542",
          "code": "201-506-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.369",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "4208ae4d-4865-4be9-b1fe-9547003af98a"
          ]
        },
        {
          "uuid": "1879e276-ae5c-71ce-3458-87d21d78a2a5",
          "code": "C275",
          "comments": "Pharmacologic Substance[C1909]|Protective Agent[C26170]|Antioxidant",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C275",
          "code_system": "NCI_THESAURUS",
          "references": [
            "4e193db4-6809-c7d5-cbc5-b1f37354f143"
          ]
        },
        {
          "uuid": "ca6cd1e4-75a4-99da-a634-c4165f7993c8",
          "code": "EU/3/12/1008",
          "comments": "EU ORPHAN DRUG|Positive|Treatment of sickle cell disease",
          "type": "PRIMARY",
          "url": "https://www.ema.europa.eu/en/medicines/human/orphan-designations/eu3121008",
          "code_system": "EU-Orphan Drug",
          "references": [
            "4e193db4-6809-c7d5-cbc5-b1f37354f143"
          ]
        },
        {
          "uuid": "3add10ee-a2a3-4f62-ac43-cee7fee30aba",
          "code": "7IGF0S7R8I",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c40bf529-ee94-1bbf-c804-1784772bf5c6",
          "code": "3465",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3465",
          "code_system": "DRUG CENTRAL",
          "references": [
            "4e193db4-6809-c7d5-cbc5-b1f37354f143"
          ]
        },
        {
          "uuid": "9395b53b-fef9-52c8-07e0-784b4ffb84ba",
          "code": "478 (Number of products:51)",
          "comments": "Dietary Supplement Label Database|TBD|IP-6",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=478&item=IP-6",
          "code_system": "DSLD",
          "references": [
            "4e193db4-6809-c7d5-cbc5-b1f37354f143"
          ]
        },
        {
          "uuid": "aa3bd8bd-6bdb-9dda-62e8-4c71a22bbe44",
          "code": "DB14981",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB14981",
          "code_system": "DRUG BANK",
          "references": [
            "4e193db4-6809-c7d5-cbc5-b1f37354f143"
          ]
        },
        {
          "uuid": "9b4f148c-9004-df71-7b45-57eee6792ea2",
          "code": "17401",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:17401",
          "code_system": "CHEBI",
          "references": [
            "4e193db4-6809-c7d5-cbc5-b1f37354f143"
          ]
        },
        {
          "uuid": "c6b67446-756a-cd2d-87bf-7f3479ac1692",
          "code": "1537910",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1537910",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "4e193db4-6809-c7d5-cbc5-b1f37354f143"
          ]
        },
        {
          "uuid": "6baa31df-9090-6301-5024-0176afbfaa0b",
          "code": "100000084487",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "6d4fc6fd-394e-21c9-6e80-bc9b7ca28b4a"
          ]
        },
        {
          "uuid": "1cf631d1-efbd-5fc5-0809-6bef1ebe97da",
          "code": "DTXSID40889331",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40889331",
          "code_system": "EPA CompTox",
          "references": [
            "4e193db4-6809-c7d5-cbc5-b1f37354f143"
          ]
        },
        {
          "uuid": "c1e3d28c-0241-db8b-3fd7-e71f2cc7f915",
          "code": "7IGF0S7R8I",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=7IGF0S7R8I",
          "code_system": "DAILYMED",
          "references": [
            "7b1d3e35-4d03-f284-d0b7-e1a25bd9f3e6"
          ]
        },
        {
          "uuid": "c52fbd8a-70ad-3d0d-efac-fde3d634a979",
          "code": "381",
          "type": "PRIMARY",
          "url": "https://www.cfsanappsexternal.fda.gov/scripts/fdcc/index.cfm?set=GRASNotices&id=381",
          "code_system": "GRAS Notification (GRN No.)",
          "references": [
            "4e193db4-6809-c7d5-cbc5-b1f37354f143"
          ]
        },
        {
          "uuid": "71788705-741f-7837-e31c-cfe532966e55",
          "code": "269896",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=269896",
          "code_system": "NSC",
          "references": [
            "d59f3843-da42-e536-acc3-1f9a19647b81"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "47430d25-3b0e-4d18-a07b-e52886547b5b",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "47504103-dc1a-44ba-8c29-924e6b7cca87",
            "refuuid": "5d78f04d-a4a9-44e1-88ca-3d1765bf5cd7",
            "name": "FYTIC ACID",
            "unii": "7IGF0S7R8I",
            "linking_id": "7IGF0S7R8I",
            "ref_pname": "FYTIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "effd3598-466c-42cb-b628-1d940d0b4b0a",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "e75aa73f-19c6-4315-837b-2319936e5eca",
            "refuuid": "74ad7d18-0399-42f1-8b33-a6cc954f509f",
            "name": "PHYTATE SODIUM",
            "unii": "88496G1ERL",
            "linking_id": "88496G1ERL",
            "ref_pname": "PHYTATE SODIUM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ab97320d-10f8-477c-8e2e-138d1bb912a1",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "153984f7-d877-4f7d-ba0a-80ee3936a524",
            "refuuid": "32551777-c305-44b7-bac5-b036e7a258f3",
            "name": "PHYTIN",
            "unii": "N1DEP08LNK",
            "linking_id": "N1DEP08LNK",
            "ref_pname": "PHYTIN",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "75870a39-b242-4cb7-80a4-82e8263256c6",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "78c129af-0545-4b8f-b1ce-adb8db1c99fe",
            "refuuid": "f58e98ef-ae7a-4b7a-a5ac-0efe40a84abf",
            "name": "CALCIUM PHYTATE",
            "unii": "L1WK0T5S7Z",
            "linking_id": "L1WK0T5S7Z",
            "ref_pname": "CALCIUM PHYTATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "000cff56-a9dc-4804-b1fe-d4046fa202db",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "bda3073a-0be9-4f60-8112-96d8e00f7245",
            "refuuid": "851a2e8d-2825-4000-af98-89b347a62feb",
            "name": "PHYTATE PERSODIUM",
            "unii": "3F6PM8J684",
            "linking_id": "3F6PM8J684",
            "ref_pname": "PHYTATE PERSODIUM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "02b93862-c739-40e3-88f8-c031a39c61de",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "567085e1-437f-4641-a686-4cbdada1cee1",
            "refuuid": "13696d83-5d18-4ca4-a6b2-2f3245df8b46",
            "name": "MAGNESIUM PHYTATE",
            "unii": "8HKG5O763Y",
            "linking_id": "8HKG5O763Y",
            "ref_pname": "MAGNESIUM PHYTATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "3837d39b-c8c7-434b-9bc1-24dfde673914",
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "351be096-4659-486e-b808-fe3c2b8e98f7"
          ],
          "related_substance": {
            "uuid": "092cd305-ed9a-41df-856b-b197a4753817",
            "refuuid": "ced44782-e3ad-4802-80c7-6dca7d2ff8e2",
            "name": "ZINC PHYTATE",
            "unii": "CQP897CO3I",
            "linking_id": "CQP897CO3I",
            "ref_pname": "ZINC PHYTATE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3db573bc-61fb-4078-b884-0dcf89840594",
          "name": "ALKALOVERT",
          "stdName": "ALKALOVERT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a6a7a60f-57cc-4bc3-8ff4-3f8aabf50477",
            "8cbfb6db-ea47-48a3-8160-70accac8d893"
          ],
          "display_name": false
        },
        {
          "uuid": "0ce72b30-6e8b-4a92-bfbc-6adb7ab88f7e",
          "name": "DERMOFEEL PA-3",
          "stdName": "DERMOFEEL PA-3",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a6a7a60f-57cc-4bc3-8ff4-3f8aabf50477",
            "8cbfb6db-ea47-48a3-8160-70accac8d893"
          ],
          "display_name": false
        },
        {
          "uuid": "2949e369-453b-45ee-a6e1-adf0a8c34671",
          "name": "EXFODERM",
          "stdName": "EXFODERM",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a6a7a60f-57cc-4bc3-8ff4-3f8aabf50477",
            "8cbfb6db-ea47-48a3-8160-70accac8d893"
          ],
          "display_name": false
        },
        {
          "uuid": "2b6bf817-30df-4617-8f5c-2e84900c28e8",
          "name": "FYTIC ACID",
          "stdName": "FYTIC ACID",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "295149a0-fb47-46d9-ba6c-2f9267d67eff",
            "ace4178c-5db7-4357-aee1-a384015aa404",
            "3936b643-38cc-4958-8dfc-698b534597bb",
            "0656a4c3-e927-4c4f-a39e-e321ffceef08",
            "8cbfb6db-ea47-48a3-8160-70accac8d893",
            "83c4f583-c995-4814-9f37-7956be40a5ef",
            "efc4d7e7-93b6-4ac1-ac1b-74323327849e",
            "f449dabb-9e11-400e-9da2-21533fe24d6c"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "e32e1f00-3b09-4479-afb3-758bdf6b927a",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "f5883bd1-6a67-4bc2-9591-bf4aca3f3a22",
          "name": "FYTIC ACID [MART.]",
          "stdName": "FYTIC ACID [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3936b643-38cc-4958-8dfc-698b534597bb",
            "8cbfb6db-ea47-48a3-8160-70accac8d893"
          ],
          "display_name": false
        },
        {
          "uuid": "159e0402-ca49-ea75-928b-2f3f2bdf83ea",
          "name": "Fytic acid [WHO-DD]",
          "stdName": "FYTIC ACID [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e8e0aabc-f3b1-9f99-a4ae-a726ec3f1662"
          ],
          "display_name": false
        },
        {
          "uuid": "5f82b16a-50bb-4108-bffa-39f6a18d3a96",
          "name": "INOSITOL HEXAPHOSPHATE",
          "stdName": "INOSITOL HEXAPHOSPHATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bdb3dbfc-39b1-4b28-ad80-b7be945ff43b",
            "8cbfb6db-ea47-48a3-8160-70accac8d893"
          ],
          "display_name": false
        },
        {
          "uuid": "82ae2eeb-1b0d-48ad-a9e8-5acff18ff073",
          "name": "INOSITOL HEXAPHOSPHORIC ACID",
          "stdName": "INOSITOL HEXAPHOSPHORIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "286467a4-cfa5-49b1-8d04-704857a8666e",
            "8cbfb6db-ea47-48a3-8160-70accac8d893"
          ],
          "display_name": false
        },
        {
          "uuid": "ba752e50-2ab6-4b6b-a904-2e0cd20f43e3",
          "name": "INOSITOLHEXAPHOSPHORIC ACID",
          "stdName": "INOSITOLHEXAPHOSPHORIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c7502842-ed62-40cf-bfb5-be6624ff177c",
            "8cbfb6db-ea47-48a3-8160-70accac8d893"
          ],
          "display_name": false
        },
        {
          "uuid": "b7b50b1e-05bf-4e25-b5be-7fca93fa956e",
          "name": "IP-6",
          "stdName": "IP-6",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "286467a4-cfa5-49b1-8d04-704857a8666e",
            "8cbfb6db-ea47-48a3-8160-70accac8d893"
          ],
          "display_name": false
        },
        {
          "uuid": "923e47cc-c170-418c-a4e1-265efb1ce53a",
          "name": "IP6",
          "stdName": "IP6",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "286467a4-cfa5-49b1-8d04-704857a8666e",
            "8cbfb6db-ea47-48a3-8160-70accac8d893"
          ],
          "display_name": false
        },
        {
          "uuid": "0c2820b8-5990-46a5-869d-cd8447a2dc18",
          "name": "MYO-INOSITOL HEXAKIS(DIHYDROGEN PHOSPHATE)",
          "stdName": "MYO-INOSITOL HEXAKIS(DIHYDROGEN PHOSPHATE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c7502842-ed62-40cf-bfb5-be6624ff177c",
            "8cbfb6db-ea47-48a3-8160-70accac8d893"
          ],
          "display_name": false
        },
        {
          "uuid": "ce4fe071-b6ec-42d7-bb5e-3cfb991860e8",
          "name": "NSC-269896",
          "stdName": "NSC-269896",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8cbfb6db-ea47-48a3-8160-70accac8d893",
            "b7a86f3c-8230-4d36-84ee-cf2319c4b153"
          ],
          "display_name": false
        },
        {
          "uuid": "91babd57-c3e7-45b7-94f7-e3dfb17d35bd",
          "name": "PHYTIC ACID",
          "stdName": "PHYTIC ACID",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "10fe579d-ac4c-43fb-9c01-0b3411dc0005",
            "e31c2a78-caae-47a3-ba49-3a2a90af9d92",
            "6dfb9c77-d974-4989-bba7-fac718d803be",
            "6e3b9abe-dd9a-455b-a6d6-45b3a3502975",
            "3bc9cd74-a188-4595-b2d7-215912d50a1d",
            "c7502842-ed62-40cf-bfb5-be6624ff177c",
            "8cbfb6db-ea47-48a3-8160-70accac8d893"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "5c8be5cb-8718-419a-96da-5ac3a2fbb3d6",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "92ff1c84-2091-4597-9731-5cfa6c4ef598",
          "name": "PHYTIC ACID SOLUTION",
          "stdName": "PHYTIC ACID SOLUTION",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b7d71aee-e21f-43de-9b56-39f366b9b85a",
            "8cbfb6db-ea47-48a3-8160-70accac8d893",
            "d73e7397-7467-4d6f-a210-0fa63dee93ab"
          ],
          "display_name": false
        },
        {
          "uuid": "09d6bdf5-af15-4a5c-96df-327f38710180",
          "name": "PHYTIC ACID SOLUTION [USP-RS]",
          "stdName": "PHYTIC ACID SOLUTION [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b7d71aee-e21f-43de-9b56-39f366b9b85a",
            "8cbfb6db-ea47-48a3-8160-70accac8d893"
          ],
          "display_name": false
        },
        {
          "uuid": "72ad0697-9b3b-41a8-9b52-58459cb71a8a",
          "name": "PHYTIC ACID [MI]",
          "stdName": "PHYTIC ACID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e3b9abe-dd9a-455b-a6d6-45b3a3502975",
            "8cbfb6db-ea47-48a3-8160-70accac8d893"
          ],
          "display_name": false
        },
        {
          "uuid": "f3d938ef-a3fb-4c30-9aab-f7ac154cbc5d",
          "name": "fytic acid [INN]",
          "stdName": "FYTIC ACID [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ace4178c-5db7-4357-aee1-a384015aa404",
            "8cbfb6db-ea47-48a3-8160-70accac8d893",
            "0656a4c3-e927-4c4f-a39e-e321ffceef08"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c7502842-ed62-40cf-bfb5-be6624ff177c",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e31c2a78-caae-47a3-ba49-3a2a90af9d92",
          "citation": "MERCK DL",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8cbfb6db-ea47-48a3-8160-70accac8d893",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ace4178c-5db7-4357-aee1-a384015aa404",
          "citation": "INN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0656a4c3-e927-4c4f-a39e-e321ffceef08",
          "citation": "INN Proposed List 13",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL13.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6e3b9abe-dd9a-455b-a6d6-45b3a3502975",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3936b643-38cc-4958-8dfc-698b534597bb",
          "citation": "MART",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6dfb9c77-d974-4989-bba7-fac718d803be",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "efc4d7e7-93b6-4ac1-ac1b-74323327849e",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "286467a4-cfa5-49b1-8d04-704857a8666e",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bdb3dbfc-39b1-4b28-ad80-b7be945ff43b",
          "citation": "NCT02081287",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a6a7a60f-57cc-4bc3-8ff4-3f8aabf50477",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b7d71aee-e21f-43de-9b56-39f366b9b85a",
          "citation": "USP-RS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b7a86f3c-8230-4d36-84ee-cf2319c4b153",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4208ae4d-4865-4be9-b1fe-9547003af98a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390632000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "171ccfdd-495b-4c03-9ff1-ff8c112fefa5",
          "citation": "SRS import [7IGF0S7R8I]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7IGF0S7R8I",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390632000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "295149a0-fb47-46d9-ba6c-2f9267d67eff",
          "citation": "FYTIC ACID [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "10fe579d-ac4c-43fb-9c01-0b3411dc0005",
          "citation": "PHYTIC ACID [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "83c4f583-c995-4814-9f37-7956be40a5ef",
          "citation": "FYTIC ACID [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3bc9cd74-a188-4595-b2d7-215912d50a1d",
          "citation": "PHYTIC ACID [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f449dabb-9e11-400e-9da2-21533fe24d6c",
          "citation": "FYTIC ACID [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d73e7397-7467-4d6f-a210-0fa63dee93ab",
          "citation": "PHYTIC ACID SOLUTION [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4e193db4-6809-c7d5-cbc5-b1f37354f143",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "351be096-4659-486e-b808-fe3c2b8e98f7",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d8e3b5f4-5433-47c3-88d5-f5cc23cf969e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d59f3843-da42-e536-acc3-1f9a19647b81",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "7b1d3e35-4d03-f284-d0b7-e1a25bd9f3e6",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "e8e0aabc-f3b1-9f99-a4ae-a726ec3f1662",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "6d4fc6fd-394e-21c9-6e80-bc9b7ca28b4a",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d996790f-8e83-4f3f-a4a0-4fe0294fbdb7",
          "id": "d996790f-8e83-4f3f-a4a0-4fe0294fbdb7",
          "molfile": "\n  Marvin  01132111172D          \n\n 36 36  0  0  0  0            999 V2000\n   10.7157   -3.6758    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8927   -3.6758    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8927   -4.4987    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8927   -2.8481    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0741   -3.6758    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2512   -3.6754    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.8412   -4.3883    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.2491   -5.0988    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6548   -5.8099    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0627   -6.5205    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9375   -6.2185    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3630   -5.3979    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0161   -4.3883    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.5988   -5.0988    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1841   -5.8099    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7669   -6.5205    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4758   -5.3888    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8969   -6.2231    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6010   -3.6754    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.7692   -3.6665    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9512   -3.6665    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1241   -3.6665    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9512   -2.8394    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9512   -4.4938    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0161   -2.9621    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.5988   -2.2430    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1801   -1.5255    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7630   -0.8066    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9015   -1.1124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4633   -1.9468    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8412   -2.9621    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.2491   -2.2430    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6508   -1.5210    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0633   -0.8021    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3676   -1.9330    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9295   -1.1217    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  2  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  1  0  0  0\n  7  6  1  0  0  0  0\n  6 31  1  0  0  0  0\n  7  8  1  6  0  0  0\n 13  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n  9 12  2  0  0  0  0\n 13 14  1  1  0  0  0\n 13 19  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 15 18  2  0  0  0  0\n 19 20  1  6  0  0  0\n 25 19  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  1  0  0  0  0\n 21 24  2  0  0  0  0\n 25 26  1  1  0  0  0\n 31 25  1  0  0  0  0\n 26 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 27 29  1  0  0  0  0\n 27 30  2  0  0  0  0\n 31 32  1  1  0  0  0\n 32 33  1  0  0  0  0\n 33 34  1  0  0  0  0\n 33 35  1  0  0  0  0\n 33 36  2  0  0  0  0\nM  END",
          "smiles": "[C@@H]1([C@@H]([C@H]([C@@H]([C@H]([C@H]1OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O",
          "formula": "C6H18O24P6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3f33db61-a504-47fe-8bf2-7a08b7d60194"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "660.0356",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5d78f04d-a4a9-44e1-88ca-3d1765bf5cd7",
      "version": "22",
      "structure": {
        "id": "0b6c3091-d744-49a4-bd63-f9f0f81ef321",
        "molfile": "\n  Marvin  01132100502D          \n\n 36 36  0  0  1  0            999 V2000\n    5.7630   -0.8066    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1801   -1.5255    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9015   -1.1124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4633   -1.9468    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5988   -2.2430    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0161   -2.9621    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.8412   -2.9621    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.2512   -3.6754    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.8412   -4.3883    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.2491   -5.0988    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6548   -5.8099    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0627   -6.5205    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9375   -6.2185    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3630   -5.3979    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0161   -4.3883    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.5988   -5.0988    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1841   -5.8099    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7669   -6.5205    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4758   -5.3888    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8969   -6.2231    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6010   -3.6754    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.7692   -3.6665    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9512   -3.6665    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9512   -4.4938    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1241   -3.6665    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9512   -2.8394    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0741   -3.6758    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8927   -3.6758    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7157   -3.6758    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8927   -4.4987    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8927   -2.8481    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2491   -2.2430    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6508   -1.5210    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0633   -0.8021    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3676   -1.9330    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9295   -1.1217    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  2  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  1  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  6  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 11 14  2  0  0  0  0\n 15  9  1  0  0  0  0\n 15 16  1  1  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  1  0  0  0  0\n 17 20  2  0  0  0  0\n 15 21  1  0  0  0  0\n 21 22  1  6  0  0  0\n 22 23  1  0  0  0  0\n 23 24  2  0  0  0  0\n 23 25  1  0  0  0  0\n 23 26  1  0  0  0  0\n  6 21  1  0  0  0  0\n  8 27  1  1  0  0  0\n 27 28  1  0  0  0  0\n 28 29  1  0  0  0  0\n 28 30  1  0  0  0  0\n 28 31  2  0  0  0  0\n  7 32  1  1  0  0  0\n 32 33  1  0  0  0  0\n 33 34  1  0  0  0  0\n 33 35  1  0  0  0  0\n 33 36  2  0  0  0  0\nM  END",
        "smiles": "[C@@H]1([C@@H]([C@H]([C@@H]([C@H]([C@H]1OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O",
        "formula": "C6H18O24P6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "660.0356",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "c7502842-ed62-40cf-bfb5-be6624ff177c",
          "171ccfdd-495b-4c03-9ff1-ff8c112fefa5",
          "0656a4c3-e927-4c4f-a39e-e321ffceef08"
        ],
        "stereo_centers": 0
      },
      "unii": "7IGF0S7R8I"
    }
  ]
}