{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "de195608-a95b-4f83-a366-b8018ecdec24",
          "code": "C04AC07",
          "comments": "ATC|CARDIOVASCULAR SYSTEM|PERIPHERAL VASODILATORS|PERIPHERAL VASODILATORS|Nicotinic acid and derivatives|ciclonicate",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=C04AC07&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "e0da2668-fcb5-4957-898b-46550470b77a"
          ]
        },
        {
          "uuid": "401bb204-4380-44aa-a2c4-194d77375d1d",
          "code": "QC04AC07",
          "comments": "VATC|PERIPHERAL VASODILATORS|PERIPHERAL VASODILATORS|Nicotinic acid and derivatives|ciclonicate",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QC04AC07&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "e0da2668-fcb5-4957-898b-46550470b77a"
          ]
        },
        {
          "uuid": "bf4e5c0f-4f06-4ef2-8010-2b7aea31c174",
          "code": "53449-58-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=53449-58-4",
          "code_system": "CAS",
          "references": [
            "e0da2668-fcb5-4957-898b-46550470b77a",
            "d36f15da-0bb7-41ad-b6b1-fef6bb5959e2"
          ]
        },
        {
          "uuid": "7ec42a91-18cc-41da-bf7f-7593ff850743",
          "code": "C032821",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67032821",
          "code_system": "MESH",
          "references": [
            "e0da2668-fcb5-4957-898b-46550470b77a"
          ]
        },
        {
          "uuid": "9fcc55cf-8f68-41a7-92a2-bef4947b1c95",
          "code": "CICLONICATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Ciclonicate",
          "code_system": "WIKIPEDIA",
          "references": [
            "e0da2668-fcb5-4957-898b-46550470b77a"
          ]
        },
        {
          "uuid": "58e34716-8ce3-4243-a9b3-3c3b535773b3",
          "code": "SUB06243MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "e0da2668-fcb5-4957-898b-46550470b77a"
          ]
        },
        {
          "uuid": "dffbdd41-01dc-4501-9e71-881ffff48c39",
          "code": "3808",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=3808",
          "code_system": "INN",
          "references": [
            "e0da2668-fcb5-4957-898b-46550470b77a"
          ]
        },
        {
          "uuid": "140a0619-a771-4f6a-bac5-6e108b25132b",
          "code": "m3538",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3538?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "e0da2668-fcb5-4957-898b-46550470b77a"
          ]
        },
        {
          "uuid": "ebcb57d3-c40a-4e04-b14c-e2fd04a3a0c0",
          "code": "CHEMBL2104521",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2104521",
          "code_system": "ChEMBL",
          "references": [
            "e0da2668-fcb5-4957-898b-46550470b77a"
          ]
        },
        {
          "uuid": "4c61731e-c951-4870-aa1b-222e0b44cf3b",
          "code": "258-561-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.053.221",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "e0da2668-fcb5-4957-898b-46550470b77a"
          ]
        },
        {
          "uuid": "32ec1ea0-554c-457f-ad81-1e68c31745a8",
          "code": "10444661",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10444661",
          "code_system": "PUBCHEM",
          "references": [
            "e0da2668-fcb5-4957-898b-46550470b77a"
          ]
        },
        {
          "uuid": "3b009021-5a24-f6e1-7c87-ca8d7dfb3fa4",
          "code": "C167024",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C167024",
          "code_system": "NCI_THESAURUS",
          "references": [
            "1d0a8487-3a6e-a8ea-0ca0-2a3e139f011a"
          ]
        },
        {
          "uuid": "112c7001-616d-4170-99f5-d8117040de29",
          "code": "7H634NXI03",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "fa9f96b6-38c5-bbae-c34e-9ee9716a6a2c",
          "code": "3908",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3908",
          "code_system": "DRUG CENTRAL",
          "references": [
            "7c829a1f-7448-2206-4dca-dd0e006ff738"
          ]
        },
        {
          "uuid": "45f9c6f3-b6f0-7a16-8e19-b71c22b7d52a",
          "code": "DB13709",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB13709",
          "code_system": "DRUG BANK",
          "references": [
            "7c829a1f-7448-2206-4dca-dd0e006ff738"
          ]
        },
        {
          "uuid": "06ebe34e-dafa-3a09-a995-07fd14cd1a69",
          "code": "100000081888",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "f28ee15c-e230-345f-d3c2-f0d29bece84e"
          ]
        },
        {
          "uuid": "74e1de83-cce1-6058-d332-0b38ee2f037b",
          "code": "DTXSID001023827",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID001023827",
          "code_system": "EPA CompTox",
          "references": [
            "7c829a1f-7448-2206-4dca-dd0e006ff738"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "b502ddf7-1979-4b2d-af0b-155dfc8dde7f",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "f0e6c9e4-2d81-4e82-8ead-f92e6d004fd7",
            "refuuid": "34d1dd51-abd3-4bc0-bfbd-f1ade76a9293",
            "name": "CICLONICATE",
            "unii": "7H634NXI03",
            "linking_id": "7H634NXI03",
            "ref_pname": "CICLONICATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6210e4e9-cc09-4668-8943-8948d62f7659",
          "name": "CICLONICATE",
          "stdName": "CICLONICATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3665a67c-2d3f-4eda-9aac-88cffc49eab3",
            "60e60e70-4aab-4937-9926-ef1c67ebb2ad",
            "6e3bab2c-9ee3-4ef5-b4d3-f3d1b741b163",
            "6a91c831-1c7e-4231-ab13-fd2d18383f28",
            "11d6d9e4-3118-4fb6-a85d-a2e5d2eee427",
            "22c9a6db-a366-4056-a183-77cddae2186a",
            "af3dc6a0-e98f-408a-8749-414fb3bb7261",
            "5a37a3a5-cf24-4b52-86a9-905b1cb40e00",
            "c3f7c956-8aa4-4f48-96cb-1382e86c1359",
            "14a1e2e4-c91c-411f-884f-5ccee3830375"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "e1ac08f6-5d4d-4046-954f-c05060ac8fd4",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "0870645f-9bf4-4b3d-82d5-8f3fe78af88d",
          "name": "CICLONICATE [MART.]",
          "stdName": "CICLONICATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "af3dc6a0-e98f-408a-8749-414fb3bb7261"
          ],
          "display_name": false
        },
        {
          "uuid": "71581aff-ca51-433e-976d-0381c808b4fb",
          "name": "CICLONICATE [MI]",
          "stdName": "CICLONICATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c3f7c956-8aa4-4f48-96cb-1382e86c1359",
            "60e60e70-4aab-4937-9926-ef1c67ebb2ad"
          ],
          "display_name": false
        },
        {
          "uuid": "cbcdc9c7-74dd-b99b-a830-8065e2e6054e",
          "name": "Ciclonicate [WHO-DD]",
          "stdName": "CICLONICATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cbe6339e-40a7-5268-8bdc-02ba9dd29aad"
          ],
          "display_name": false
        },
        {
          "uuid": "5cd10d2f-baf2-4767-a844-7d165166bc6f",
          "name": "TRANS-3,3,5-TRIMETHYLCYCLOHEXYL NICOTINATE",
          "stdName": "TRANS-3,3,5-TRIMETHYLCYCLOHEXYL NICOTINATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3665a67c-2d3f-4eda-9aac-88cffc49eab3"
          ],
          "display_name": false
        },
        {
          "uuid": "e088b9de-5f00-426d-8228-bcd9d2b309c4",
          "name": "ciclonicate [INN]",
          "stdName": "CICLONICATE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "11d6d9e4-3118-4fb6-a85d-a2e5d2eee427"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3665a67c-2d3f-4eda-9aac-88cffc49eab3",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "11d6d9e4-3118-4fb6-a85d-a2e5d2eee427",
          "citation": "INN Proposed List 33",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL33.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "af3dc6a0-e98f-408a-8749-414fb3bb7261",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "60e60e70-4aab-4937-9926-ef1c67ebb2ad",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c3f7c956-8aa4-4f48-96cb-1382e86c1359",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "22c9a6db-a366-4056-a183-77cddae2186a",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e0da2668-fcb5-4957-898b-46550470b77a",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390737000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1db9c958-32aa-4d4f-98f4-fdee3f43e2f8",
          "citation": "SRS import [7H634NXI03]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7H634NXI03",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390737000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e1183cb1-ab56-4d75-99e4-e162e0170058",
          "citation": "INN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "14a1e2e4-c91c-411f-884f-5ccee3830375",
          "citation": "CICLONICATE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6a91c831-1c7e-4231-ab13-fd2d18383f28",
          "citation": "CICLONICATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5a37a3a5-cf24-4b52-86a9-905b1cb40e00",
          "citation": "CICLONICATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6e3bab2c-9ee3-4ef5-b4d3-f3d1b741b163",
          "citation": "CICLONICATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f28ee15c-e230-345f-d3c2-f0d29bece84e",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "1d0a8487-3a6e-a8ea-0ca0-2a3e139f011a",
          "citation": "NCIT",
          "doc_type": "NCI THESAURUS",
          "public_domain": true
        },
        {
          "uuid": "d36f15da-0bb7-41ad-b6b1-fef6bb5959e2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "7c829a1f-7448-2206-4dca-dd0e006ff738",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "cbe6339e-40a7-5268-8bdc-02ba9dd29aad",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3eb5770c-31e0-4f31-bc29-af4d1464138a",
          "id": "3eb5770c-31e0-4f31-bc29-af4d1464138a",
          "molfile": "\n  Marvin  01132103192D          \n\n 18 19  0  0  0  0            999 V2000\n    2.5518   -4.3778    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    2.5459   -3.5500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8351   -4.7926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8417   -5.6167    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    2.5586   -6.0276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2690   -5.6145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6750   -6.3250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0625   -5.3959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2687   -4.7887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1250   -6.0250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4167   -5.6209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4125   -4.7959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2950   -6.0380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0104   -5.6289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7222   -6.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7234   -6.8690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0086   -7.2819    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2921   -6.8686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  9  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4 10  1  6  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  6  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 13 11  1  0  0  0  0\n 13 14  1  0  0  0  0\n 18 13  2  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\nM  END",
          "smiles": "C[C@@H]1C[C@H](CC(C)(C)C1)OC(=O)c2cccnc2",
          "formula": "C15H21NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "66728168-549d-4ee4-afe1-6ad821d64980"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "247.3333",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "34d1dd51-abd3-4bc0-bfbd-f1ade76a9293",
      "version": "13",
      "structure": {
        "id": "7605ac69-1015-444c-8461-64307ea466ba",
        "molfile": "\n  Marvin  01132106072D          \n\n 18 19  0  0  0  0            999 V2000\n   -1.7222   -6.0417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7234   -6.8690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0086   -7.2819    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2921   -6.8686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2950   -6.0380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0104   -5.6289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4167   -5.6209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4125   -4.7959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8417   -5.6167    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.5586   -6.0276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2690   -5.6145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2687   -4.7887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5518   -4.3778    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    1.8351   -4.7926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6750   -6.3250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0625   -5.3959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5459   -3.5500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1250   -6.0250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  7  8  2  0  0  0  0\n  4  5  1  0  0  0  0\n  9 10  1  0  0  0  0\n  2  3  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  1  1  0  0  0  0\n  1  2  2  0  0  0  0\n  5  7  1  0  0  0  0\n  9 14  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n  3  4  2  0  0  0  0\n 11 15  1  0  0  0  0\n  7 18  1  0  0  0  0\n 11 16  1  0  0  0  0\n 13 17  1  1  0  0  0\n  9 18  1  6  0  0  0\nM  END",
        "smiles": "C[C@@H]1C[C@H](CC(C)(C)C1)OC(=O)c2cccnc2",
        "formula": "C15H21NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "247.3333",
        "optical_activity": "( + / - )",
        "references": [
          "e1183cb1-ab56-4d75-99e4-e162e0170058",
          "1db9c958-32aa-4d4f-98f4-fdee3f43e2f8",
          "11d6d9e4-3118-4fb6-a85d-a2e5d2eee427"
        ],
        "stereo_centers": 2
      },
      "unii": "7H634NXI03"
    }
  ]
}