{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "18b54d4c-e6ff-4c20-b0a0-16b59769a9ac",
          "code": "20721-50-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=20721-50-0",
          "code_system": "CAS",
          "references": [
            "29a0832e-f7e2-4e88-84ef-490b51b06eaf",
            "6a3182d9-c8cf-4a43-a1dc-01ac2349a962"
          ]
        },
        {
          "uuid": "07fc6aac-d962-4c41-80b0-4690fee01831",
          "code": "243-987-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.039.973",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "29a0832e-f7e2-4e88-84ef-490b51b06eaf"
          ]
        },
        {
          "uuid": "64efd406-ec2d-4f1c-87f4-8de19513194b",
          "code": "1016649-25-4",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1016649-25-4",
          "code_system": "CAS",
          "references": [
            "29a0832e-f7e2-4e88-84ef-490b51b06eaf",
            "55229902-95cc-42df-a075-8f809894f85a"
          ]
        },
        {
          "uuid": "1534b7d9-a911-446c-8517-dc009764f25e",
          "code": "12222-69-4",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=12222-69-4",
          "code_system": "CAS",
          "references": [
            "29a0832e-f7e2-4e88-84ef-490b51b06eaf",
            "4687d735-2903-4e4e-a9a1-2f8da21af2dc"
          ]
        },
        {
          "uuid": "ea75a22e-085f-2a39-c002-a91f41ea3aef",
          "code": "DTXSID7066645",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7066645",
          "code_system": "EPA CompTox",
          "references": [
            "2a13b11d-4e6a-0d69-95ef-84964060f47d"
          ]
        },
        {
          "uuid": "312bcf63-da53-4d57-b701-f08b4c672977",
          "code": "7GKC99M24T",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "646b020d-1b02-4706-9f59-91e7009bab4e",
          "name": "4-(4'-ANILINOAZO)-N,N-BIS(2-HYDROXYETHYL)ANILINE",
          "stdName": "4-(4'-ANILINOAZO)-N,N-BIS(2-HYDROXYETHYL)ANILINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "472de4ce-fdb8-434f-8acb-345fec3f7705"
          ],
          "display_name": false
        },
        {
          "uuid": "579f4d01-6926-49be-93d5-468e193eef9b",
          "name": "4-AMINO-4'-(BIS(.BETA.-HYDROXYETHYL)AMINO)AZOBENZENE",
          "stdName": "4-AMINO-4'-(BIS(.BETA.-HYDROXYETHYL)AMINO)AZOBENZENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "472de4ce-fdb8-434f-8acb-345fec3f7705"
          ],
          "display_name": false
        },
        {
          "uuid": "960c8a0a-834c-4bc0-b410-678a837d0782",
          "name": "C.I. DISPERSE BLACK 9",
          "stdName": "C.I. DISPERSE BLACK 9",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b38008af-6f61-4dc6-8e11-c349e49e2d42"
          ],
          "display_name": false
        },
        {
          "uuid": "4ed73082-449f-4ac0-bdc3-9717a1f1ac57",
          "name": "COLOREX DBL9",
          "stdName": "COLOREX DBL9",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7cde4270-91f3-42e3-b9be-c6b93a5c813b"
          ],
          "display_name": false
        },
        {
          "uuid": "3d1df151-9feb-40e0-b331-59e031174079",
          "name": "DISPERSE BLACK 9",
          "stdName": "DISPERSE BLACK 9",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "89d8d10d-1a72-4a1a-adea-d2a008d990a7",
            "b38008af-6f61-4dc6-8e11-c349e49e2d42",
            "7cde4270-91f3-42e3-b9be-c6b93a5c813b"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "f9b5edea-7545-4a25-a00d-400a8f937799",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "b21defbd-1871-46e0-bc97-1e6a7946c826",
          "name": "ETHANOL, 2,2'-((4-(2-(4-AMINOPHENYL)DIAZENYL)PHENYL)IMINO)BIS-",
          "stdName": "ETHANOL, 2,2'-((4-(2-(4-AMINOPHENYL)DIAZENYL)PHENYL)IMINO)BIS-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "472de4ce-fdb8-434f-8acb-345fec3f7705"
          ],
          "display_name": false
        },
        {
          "uuid": "0d58cf98-db97-4040-a66d-e40939e79e57",
          "name": "LOWADENE BLACK 9",
          "stdName": "LOWADENE BLACK 9",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7cde4270-91f3-42e3-b9be-c6b93a5c813b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b38008af-6f61-4dc6-8e11-c349e49e2d42",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7cde4270-91f3-42e3-b9be-c6b93a5c813b",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "472de4ce-fdb8-434f-8acb-345fec3f7705",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "29a0832e-f7e2-4e88-84ef-490b51b06eaf",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392075000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ed2564f0-6386-4fe9-814c-8af4c6f17588",
          "citation": "SRS import [7GKC99M24T]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7GKC99M24T",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392075000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "89d8d10d-1a72-4a1a-adea-d2a008d990a7",
          "citation": "DISPERSE BLACK 9 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2a13b11d-4e6a-0d69-95ef-84964060f47d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=20721-50-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4687d735-2903-4e4e-a9a1-2f8da21af2dc",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "55229902-95cc-42df-a075-8f809894f85a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "6a3182d9-c8cf-4a43-a1dc-01ac2349a962",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "31f35f6c-2662-4689-aa57-741e0ba15e90",
          "id": "31f35f6c-2662-4689-aa57-741e0ba15e90",
          "molfile": "\n  Marvin  01132102402D          \n\n 22 23  0  0  0  0            999 V2000\n    0.0000   -0.7380    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8335   -0.7380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2416   -0.0260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0665   -0.0260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4832   -0.7380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0665   -1.4587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2416   -1.4587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3081   -0.7380    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7162   -1.4587    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5584   -1.4500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9752   -0.7380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8000   -0.7380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2081   -1.4500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7914   -2.1707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9665   -2.1707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0417   -1.4500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4498   -0.7207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2746   -0.7207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6827    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4671   -2.1620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0590   -2.8913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4758   -3.6033    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  7  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  8  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 15  2  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  2  0  0  0  0\n 13 16  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 20  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 21  1  0  0  0  0\nM  END",
          "smiles": "c1cc(ccc1N)/N=N/c2ccc(cc2)N(CCO)CCO",
          "formula": "C16H20N4O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9afed068-34e2-49a2-ab0c-d255b50eca30"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "300.3562",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "8bae33bc-ff11-46d6-b91e-10e1123d353d",
      "version": "5",
      "structure": {
        "id": "e5595a56-bc45-410e-93f0-0a38c18e3e35",
        "molfile": "\n  Marvin  01132111522D          \n\n 22 23  0  0  0  0            999 V2000\n    3.3081   -0.7380    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7162   -1.4587    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2081   -1.4500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0417   -1.4500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7914   -2.1707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8000   -0.7380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5584   -1.4500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4832   -0.7380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8335   -0.7380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9752   -0.7380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9665   -2.1707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.7380    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0665   -0.0260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0665   -1.4587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2416   -0.0260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2416   -1.4587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6827    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4758   -3.6033    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4671   -2.1620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4498   -0.7207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0590   -2.8913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2746   -0.7207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  1  8  1  0  0  0  0\n  2  7  1  0  0  0  0\n  3  5  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  6  2  0  0  0  0\n  4 19  1  0  0  0  0\n  4 20  1  0  0  0  0\n  5 11  2  0  0  0  0\n  6 10  1  0  0  0  0\n  7 10  2  0  0  0  0\n  7 11  1  0  0  0  0\n  8 13  1  0  0  0  0\n  8 14  2  0  0  0  0\n  9 16  2  0  0  0  0\n  9 12  1  0  0  0  0\n  9 15  1  0  0  0  0\n 13 15  2  0  0  0  0\n 14 16  1  0  0  0  0\n 17 22  1  0  0  0  0\n 18 21  1  0  0  0  0\n 19 21  1  0  0  0  0\n 20 22  1  0  0  0  0\nM  END",
        "smiles": "c1cc(ccc1N)/N=N/c2ccc(cc2)N(CCO)CCO",
        "formula": "C16H20N4O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "300.3562",
        "optical_activity": "NONE",
        "references": [
          "ed2564f0-6386-4fe9-814c-8af4c6f17588",
          "b38008af-6f61-4dc6-8e11-c349e49e2d42"
        ],
        "stereo_centers": 0
      },
      "unii": "7GKC99M24T"
    }
  ]
}