{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "70110c1d-fdbe-4bcc-b8a7-7ac4ffaf7b10", "code": "66227-09-6", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=66227-09-6", "code_system": "CAS", "references": [ "dd68f37d-d673-402b-b741-ca7f56fc48e7", "9f779dae-6170-442b-a2fb-c744f50d4ea5" ] }, { "uuid": "93ec0443-583b-4266-8fd3-65792723a5a8", "code": "266-265-1", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.060.222", "code_system": "ECHA (EC/EINECS)", "references": [ "dd68f37d-d673-402b-b741-ca7f56fc48e7" ] }, { "uuid": "9b29b164-14da-4dee-977f-2162bff585aa", "code": "47875", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/47875", "code_system": "PUBCHEM", "references": [ "dd68f37d-d673-402b-b741-ca7f56fc48e7" ] }, { "uuid": "758db3b7-081d-93e9-5ea3-6326f61077aa", "code": "DTXSID80216420", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80216420", "code_system": "EPA CompTox", "references": [ "1606e247-d39a-0d7b-2053-c877a733c48b" ] }, { "uuid": "8e14f9bb-b64f-413c-9869-f3e9fb538438", "code": "7G36W93Z8B", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "bd1bd8cf-a40f-4528-9acd-6fae52e9b3ae", "name": "PROPYL-3-TERT-BUTYLPHENOXYACETATE", "stdName": "PROPYL-3-TERT-BUTYLPHENOXYACETATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "a8cdbf48-8c3f-42cb-900a-09f38830b6b7" ], "display_name": true } ], "references": [ { "uuid": "a8cdbf48-8c3f-42cb-900a-09f38830b6b7", "citation": "ICSAS BATCH 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "dd68f37d-d673-402b-b741-ca7f56fc48e7", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390934000, "tags": [ "NOMEN" ] }, { "uuid": "ad3bc5f9-5c08-4ced-a4ee-2cdc30fe2ae6", "citation": "SRS import [7G36W93Z8B]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7G36W93Z8B", "doc_type": "SRS", "public_domain": true, "document_date": 1493390934000, "tags": [ "NOMEN" ] }, { "uuid": "461080ac-138a-4561-9255-c6f207b64ea0", "citation": "CHEMID 2010", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1606e247-d39a-0d7b-2053-c877a733c48b", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=66227-09-6", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "9f779dae-6170-442b-a2fb-c744f50d4ea5", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "99f2f37e-832e-4608-aad6-62007eeaf6ac", "id": "99f2f37e-832e-4608-aad6-62007eeaf6ac", "molfile": "\n Marvin 01132108002D \n\n 18 18 0 0 0 0 999 V2000\n 10.3689 -3.5428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6554 -3.9599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9419 -3.5475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2284 -3.9646 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5147 -3.5522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5147 -2.7275 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8012 -3.9691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0877 -3.5567 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3751 -3.9744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6584 -3.5658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9501 -3.9784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9501 -4.8057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6561 -5.2185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3751 -4.8053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6561 -6.0403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4808 -6.0403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8267 -6.0403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6561 -6.8651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 5 6 2 0 0 0 0\n 7 5 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 14 9 2 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 15 17 1 0 0 0 0\n 15 18 1 0 0 0 0\nM END", "smiles": "CCCOC(=O)COc1cccc(c1)C(C)(C)C", "formula": "C15H22O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "97e76e0a-323c-4f21-b321-b1cc7106121f" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "250.3339", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "51099f2a-893e-451d-93bb-f2724ee5589c", "version": "3", "structure": { "id": "cdf0c000-75d5-485d-a49e-39cda05a0a49", "molfile": "\n Marvin 01132110382D \n\n 18 18 0 0 0 0 999 V2000\n 7.5147 -2.7275 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5147 -3.5522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8012 -3.9691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0877 -3.5567 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3751 -3.9744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3751 -4.8053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6561 -5.2185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9501 -4.8057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9501 -3.9784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6584 -3.5658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6561 -6.0403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4808 -6.0403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8267 -6.0403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6561 -6.8651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2284 -3.9646 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9419 -3.5475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6554 -3.9599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3689 -3.5428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 2 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 2 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 2 0 0 0 0\n 10 9 1 0 0 0 0\n 5 10 2 0 0 0 0\n 7 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 13 1 0 0 0 0\n 11 14 1 0 0 0 0\n 2 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\nM END", "smiles": "CCCOC(=O)COc1cccc(c1)C(C)(C)C", "formula": "C15H22O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "250.3339", "optical_activity": "NONE", "references": [ "ad3bc5f9-5c08-4ced-a4ee-2cdc30fe2ae6", "461080ac-138a-4561-9255-c6f207b64ea0" ], "stereo_centers": 0 }, "unii": "7G36W93Z8B" } ] }