{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a63bd6ba-f300-4324-b7e8-2c1e465c34bb",
          "code": "59000-59-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=59000-59-8",
          "code_system": "CAS",
          "references": [
            "11bf47a2-e5b7-4948-91d9-70f7a1c6aa44",
            "2cd45685-90bf-454e-ab52-3c80db061eaf"
          ]
        },
        {
          "uuid": "d1b80d5f-3a56-4474-980c-634a2e9f4ca4",
          "code": "69168344",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/69168344",
          "code_system": "PUBCHEM",
          "references": [
            "11bf47a2-e5b7-4948-91d9-70f7a1c6aa44"
          ]
        },
        {
          "uuid": "37fa9a32-564e-edba-4a3f-e868eb17fdba",
          "code": "DTXSID10207745",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10207745",
          "code_system": "EPA CompTox",
          "references": [
            "a7a70217-2701-fc99-580c-bb77a3d76ed6"
          ]
        },
        {
          "uuid": "a758ec85-9357-42c4-a46c-193780ced594",
          "code": "7FB1F45YO8",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "358edc5e-def7-46b1-beb7-b1f6c7fc2ae0",
          "name": "(3.BETA.,5.ALPHA.)-3-CHOLESTANYL BUTYRATE",
          "stdName": "(3.BETA.,5.ALPHA.)-3-CHOLESTANYL BUTYRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30bfdd2f-9288-4410-bb80-d17def0d6567",
            "a94423de-1af8-44ba-bf49-7c75e0413fb9"
          ],
          "display_name": false
        },
        {
          "uuid": "046e62d2-8f03-4ac6-a3e0-92ed5d0b9fe7",
          "name": "CHOLESTAN-3-OL, 3-BUTANOATE, (3.BETA.,5.ALPHA.)-",
          "stdName": "CHOLESTAN-3-OL, 3-BUTANOATE, (3.BETA.,5.ALPHA.)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30bfdd2f-9288-4410-bb80-d17def0d6567",
            "a94423de-1af8-44ba-bf49-7c75e0413fb9"
          ],
          "display_name": false
        },
        {
          "uuid": "4cdf200d-5abe-423b-8908-eec48713a4f3",
          "name": "CHOLESTAN-3-OL, BUTANOATE, (3.BETA.,5.ALPHA.)-",
          "stdName": "CHOLESTAN-3-OL, BUTANOATE, (3.BETA.,5.ALPHA.)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30bfdd2f-9288-4410-bb80-d17def0d6567",
            "a94423de-1af8-44ba-bf49-7c75e0413fb9"
          ],
          "display_name": false
        },
        {
          "uuid": "63087af7-312e-4b37-abb9-53e7c3b5c60d",
          "name": "CHOLESTANOL BUTYRATE",
          "stdName": "CHOLESTANOL BUTYRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30bfdd2f-9288-4410-bb80-d17def0d6567",
            "a94423de-1af8-44ba-bf49-7c75e0413fb9"
          ],
          "display_name": false
        },
        {
          "uuid": "659da8e0-b84c-4b45-a812-079d29067412",
          "name": "DIHYDROCHOLESTERYL BUTYRATE",
          "stdName": "DIHYDROCHOLESTERYL BUTYRATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c359c092-e6d2-41a4-a440-e64528824a85",
            "2da54db9-eb37-47fb-8d79-aaa6f4cbec6e",
            "a94423de-1af8-44ba-bf49-7c75e0413fb9"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "deaff38c-0483-4274-948c-c0242a9aa247",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "2da54db9-eb37-47fb-8d79-aaa6f4cbec6e",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a94423de-1af8-44ba-bf49-7c75e0413fb9",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "30bfdd2f-9288-4410-bb80-d17def0d6567",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "11bf47a2-e5b7-4948-91d9-70f7a1c6aa44",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391494000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7e78562b-21d0-4b31-b838-f499336d81de",
          "citation": "SRS import [7FB1F45YO8]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7FB1F45YO8",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391494000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c359c092-e6d2-41a4-a440-e64528824a85",
          "citation": "DIHYDROCHOLESTERYL BUTYRATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fd23e058-2b67-5ba0-5b00-aa4671fcfa93",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=59000-59-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2cd45685-90bf-454e-ab52-3c80db061eaf",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a7a70217-2701-fc99-580c-bb77a3d76ed6",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "170c399f-a1ff-4640-916a-365e2c71dcd4",
          "id": "170c399f-a1ff-4640-916a-365e2c71dcd4",
          "molfile": "\n  Marvin  01132101232D          \n\n 33 36  0  0  1  0            999 V2000\n    8.4722  -10.2367    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.7307   -9.8751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1561   -9.7754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0986   -8.9524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7825   -8.4911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7250   -7.6681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4089   -7.2067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9835   -7.3064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5297  -11.0597    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    9.0146  -11.7271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5297  -12.3946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7451  -12.1397    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.0306  -12.5521    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.0306  -13.3771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3161  -13.7897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6017  -13.3771    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    4.8872  -13.7897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1727  -13.3771    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    4.1727  -12.5521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8872  -12.1397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6017  -12.5521    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.6017  -11.7271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3161  -12.1397    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.3161  -11.3147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0306  -10.9021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7451  -11.3147    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.8313  -10.4941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4583  -13.7897    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4583  -14.6147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7438  -15.0272    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1728  -15.0271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1728  -15.8521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8872  -16.2647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  9  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9 10  1  1  0  0  0\n  9 26  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  1  0  0  0\n 12 13  1  0  0  0  0\n 26 12  1  0  0  0  0\n 13 14  1  6  0  0  0\n 13 23  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  1  0  0  0\n 21 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 28  1  1  0  0  0\n 19 20  1  0  0  0  0\n 21 20  1  0  0  0  0\n 21 22  1  1  0  0  0\n 23 21  1  0  0  0  0\n 23 24  1  1  0  0  0\n 24 25  1  0  0  0  0\n 26 25  1  0  0  0  0\n 26 27  1  1  0  0  0\n 28 29  1  0  0  0  0\n 29 30  2  0  0  0  0\n 29 31  1  0  0  0  0\n 31 32  1  0  0  0  0\n 32 33  1  0  0  0  0\nM  END",
          "smiles": "CCCC(=O)O[C@H]1CC[C@@]2(C)[C@@H](CC[C@H]3[C@@H]4CC[C@H]([C@H](C)CCCC(C)C)[C@@]4(C)CC[C@@H]32)C1",
          "formula": "C31H54O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ff35b7c6-e737-4d0f-b0c0-3918f05e8c0e"
          },
          "defined_stereo": 9,
          "ez_centers": 0,
          "molecular_weight": "458.7604",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 9
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "cf4626e8-9fec-4723-9cea-177bcdf89ef6",
      "version": "6",
      "structure": {
        "id": "175c156e-101a-4b46-993e-26234671a372",
        "molfile": "\n  Marvin  01132101242D          \n\n 38 41  0  0  1  0            999 V2000\n    7.7451  -11.3147    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.7451  -12.1397    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.0306  -12.5521    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.3161  -12.1397    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.6017  -12.5521    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.6017  -13.3771    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.8872  -13.7897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1727  -13.3771    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.1727  -12.5521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8872  -12.1397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4583  -13.7897    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6017  -14.2021    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3161  -13.7897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0306  -13.3771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6017  -11.7271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3161  -12.9647    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3161  -11.3147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0306  -10.9021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0306  -11.7271    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5297  -12.3946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0146  -11.7271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5297  -11.0597    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.4722  -10.2367    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.1561   -9.7754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0986   -8.9524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7825   -8.4911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7250   -7.6681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4089   -7.2067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9835   -7.3064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7307   -9.8751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2442  -10.6472    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8313  -12.9601    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8313  -10.4941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4583  -14.6147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1728  -15.0271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1728  -15.8521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8872  -16.2647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7438  -15.0272    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10  5  1  0  0  0  0\n  8 11  1  1  0  0  0\n  6 12  1  6  0  0  0\n  6 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14  3  1  0  0  0  0\n  5 15  1  1  0  0  0\n  4 16  1  6  0  0  0\n 17  4  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18  1  1  0  0  0  0\n  3 19  1  1  0  0  0\n 20  2  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22  1  1  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  1  0  0  0  0\n 27 26  1  0  0  0  0\n 28 27  1  0  0  0  0\n 29 27  1  0  0  0  0\n 23 30  1  6  0  0  0\n 22 31  1  6  0  0  0\n  2 32  1  6  0  0  0\n  1 33  1  1  0  0  0\n 11 34  1  0  0  0  0\n 34 35  1  0  0  0  0\n 35 36  1  0  0  0  0\n 36 37  1  0  0  0  0\n 34 38  2  0  0  0  0\nM  END",
        "smiles": "CCCC(=O)O[C@H]1CC[C@@]2(C)[C@@]([H])(CC[C@@]3([H])[C@]4([H])CC[C@]([H])([C@H](C)CCCC(C)C)[C@@]4(C)CC[C@@]32[H])C1",
        "formula": "C31H54O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 9,
        "ez_centers": 0,
        "molecular_weight": "458.7604",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "30bfdd2f-9288-4410-bb80-d17def0d6567",
          "7e78562b-21d0-4b31-b838-f499336d81de"
        ],
        "stereo_centers": 9
      },
      "unii": "7FB1F45YO8"
    }
  ]
}