{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "12ba33f1-bb5c-428a-8ac4-81fc945d9fdd",
          "code": "A03AA04",
          "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|DRUGS FOR FUNCTIONAL GASTROINTESTINAL DISORDERS|DRUGS FOR FUNCTIONAL BOWEL DISORDERS|Synthetic anticholinergics, esters with tertiary amino group|mebeverine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=A03AA04&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "5c3c9e23-fa4e-41f5-a30a-519bb950c498"
          ]
        },
        {
          "uuid": "e04aefa8-f143-4676-b3bc-226879b0028a",
          "code": "QA03AA04",
          "comments": "VATC|DRUGS FOR FUNCTIONAL GASTROINTESTINAL DISORDERS|DRUGS FOR FUNCTIONAL GASTROINTESTINAL DISORDERS|Synthetic anticholinergics, esters with tertiary amino group|mebeverine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QA03AA04&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "5c3c9e23-fa4e-41f5-a30a-519bb950c498"
          ]
        },
        {
          "uuid": "3f20f6b8-585f-430f-a447-59d7a5846fff",
          "code": "3625-06-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3625-06-7",
          "code_system": "CAS",
          "references": [
            "5c3c9e23-fa4e-41f5-a30a-519bb950c498",
            "6f848124-8d98-467e-8c65-30fb94b5033f"
          ]
        },
        {
          "uuid": "f1db9e88-d871-4fd9-874d-6500b61ac98c",
          "code": "C83909",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C83909",
          "code_system": "NCI_THESAURUS",
          "references": [
            "5c3c9e23-fa4e-41f5-a30a-519bb950c498"
          ]
        },
        {
          "uuid": "d0a4c79c-6a91-4d16-8eac-5818cb028847",
          "code": "C005096",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67005096",
          "code_system": "MESH",
          "references": [
            "5c3c9e23-fa4e-41f5-a30a-519bb950c498"
          ]
        },
        {
          "uuid": "d42dfa79-0475-4333-b48e-15a8e11b8612",
          "code": "MEBEVERINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Mebeverine",
          "code_system": "WIKIPEDIA",
          "references": [
            "5c3c9e23-fa4e-41f5-a30a-519bb950c498"
          ]
        },
        {
          "uuid": "85a3bdc9-302a-43ec-a7a1-0d8d80507301",
          "code": "SUB08662MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "5c3c9e23-fa4e-41f5-a30a-519bb950c498"
          ]
        },
        {
          "uuid": "d91cf516-ae98-4840-9b16-5a3fe885f70a",
          "code": "1191",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1191",
          "code_system": "INN",
          "references": [
            "5c3c9e23-fa4e-41f5-a30a-519bb950c498"
          ]
        },
        {
          "uuid": "40d75e16-b4e0-4f0a-a770-942533e075cb",
          "code": "29410",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/29410/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "5c3c9e23-fa4e-41f5-a30a-519bb950c498"
          ]
        },
        {
          "uuid": "a4043762-79c1-4d4c-a77e-bced3fb67811",
          "code": "m7108",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7108?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "5c3c9e23-fa4e-41f5-a30a-519bb950c498"
          ]
        },
        {
          "uuid": "7f3f1809-1e3a-4ac8-ac10-c20c58f0c49f",
          "code": "CHEMBL282121",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL282121",
          "code_system": "ChEMBL",
          "references": [
            "5c3c9e23-fa4e-41f5-a30a-519bb950c498"
          ]
        },
        {
          "uuid": "6bb9d850-94f5-4798-a31b-616863e7dea5",
          "code": "222-830-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.020.756",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "5c3c9e23-fa4e-41f5-a30a-519bb950c498"
          ]
        },
        {
          "uuid": "4ab23c74-9394-43a2-bebf-1d2cabdbe30b",
          "code": "4031",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/4031",
          "code_system": "PUBCHEM",
          "references": [
            "5c3c9e23-fa4e-41f5-a30a-519bb950c498"
          ]
        },
        {
          "uuid": "08a7b71c-132e-23fa-3236-410b2d9d65a8",
          "code": "DTXSID6023238",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6023238",
          "code_system": "EPA CompTox",
          "references": [
            "483cc9d3-31c3-0f24-d077-4932e4f0a78d"
          ]
        },
        {
          "uuid": "0a53211e-390e-69e0-861c-5a243dd8b2fd",
          "code": "C66880",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Anticholinergic Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C66880",
          "code_system": "NCI_THESAURUS",
          "references": [
            "5bb4a544-c038-95ce-6acd-285050473fec"
          ]
        },
        {
          "uuid": "23036d85-a313-4072-9227-24bb9bf3799b",
          "code": "7F80CC3NNV",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "2645aeb0-4fb2-f4e1-16c8-2401341b6d26",
          "code": "1642",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1642",
          "code_system": "DRUG CENTRAL",
          "references": [
            "5bb4a544-c038-95ce-6acd-285050473fec"
          ]
        },
        {
          "uuid": "e0230bb2-2dab-526f-5b62-c7b548ebbbc4",
          "code": "DB12554",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB12554",
          "code_system": "DRUG BANK",
          "references": [
            "5bb4a544-c038-95ce-6acd-285050473fec"
          ]
        },
        {
          "uuid": "7541c62b-5900-1e32-fe1b-bade01e1d1a5",
          "code": "100000081730",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "e51a760f-8f17-d0f5-f65c-a8f17ab11357"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "64076a68-1f5c-47cc-9ea6-a048bd0044b3",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "a24bf3bd-ff10-40f7-afbd-75dddaca3728",
            "refuuid": "0b643d20-d6b4-497b-9901-06753f5a3b75",
            "name": "MEBEVERINE",
            "unii": "7F80CC3NNV",
            "linking_id": "7F80CC3NNV",
            "ref_pname": "MEBEVERINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6c1ba274-5e1c-4e98-94d9-cdc31007c2f5",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "a7ffc261-2ad1-4609-ab4a-e6022185ed96",
            "refuuid": "9ff4813b-f5a7-493c-a7c9-944c2cd52425",
            "name": "MEBEVERINE HYDROCHLORIDE",
            "unii": "15VZ5AL4JN",
            "linking_id": "15VZ5AL4JN",
            "ref_pname": "MEBEVERINE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0161c76a-4631-4f29-9d2a-9d10afd8e188",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "2bd7af7f-2afe-499b-9165-1d567de242fd",
            "refuuid": "7ef9828b-1e60-4b84-b592-9360cde2b4af",
            "name": "MEBEVERINE EMBONATE",
            "unii": "LO53AXD8GP",
            "linking_id": "LO53AXD8GP",
            "ref_pname": "MEBEVERINE EMBONATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d3951b49-5bb8-4ace-ba78-9c0d7d8c8c1d",
          "name": "4-(ETHYL(P-METHOXY-.ALPHA.-METHYLPHENETHYL)AMINO)BUTYL VERATRATE",
          "stdName": "4-(ETHYL(P-METHOXY-.ALPHA.-METHYLPHENETHYL)AMINO)BUTYL VERATRATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d4e8ba50-80b7-4643-8c33-293af7dff222"
          ],
          "display_name": false
        },
        {
          "uuid": "743169cd-83fb-4f08-8dac-438ce0c055b4",
          "name": "ARLUY",
          "stdName": "ARLUY",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "64090948-5813-4039-88db-6442858c9e6e",
            "10a696ae-2caa-4342-a57d-a1404c01615b"
          ],
          "display_name": false
        },
        {
          "uuid": "7b79f50b-1d69-496f-a355-38a6cb21b50a",
          "name": "BENZOIC ACID, 3,4-DIMETHOXY-, 4-(ETHYL(2-(4-METHOXYPHENYL)-1-METHYLETHYL)AMINO)BUTYL ESTER",
          "stdName": "BENZOIC ACID, 3,4-DIMETHOXY-, 4-(ETHYL(2-(4-METHOXYPHENYL)-1-METHYLETHYL)AMINO)BUTYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c87a41a6-71cf-4e7e-956d-a9790f9307a3"
          ],
          "display_name": false
        },
        {
          "uuid": "d59545ea-654d-4d11-bc37-8362d37f36e6",
          "name": "MEBEVERINE",
          "stdName": "MEBEVERINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a6fe26b-ed51-43aa-a926-aa2e9820301e",
            "aea59bb3-eacb-4c26-aee1-bb19ec09ec10",
            "8d24f127-8b34-47a1-ab5e-6e7c38ce8dea",
            "fe836eea-8743-477c-881e-0d372cff8f23",
            "5b8258b9-6e9a-408f-ac70-45ff575a8e9e",
            "f1e1ac45-3dda-4f59-b0d4-a88b0e99b4b8",
            "d1f066b0-8c39-4d8e-8299-e31131b03b41"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "86e4ca05-d4cb-4faa-ab91-dbee39b706ff",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "06d4ac02-6e2a-4648-9b6f-34b1f50fff77",
          "name": "MEBEVERINE [MI]",
          "stdName": "MEBEVERINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d1f066b0-8c39-4d8e-8299-e31131b03b41"
          ],
          "display_name": false
        },
        {
          "uuid": "2e4e1d2d-52ca-ca8d-7840-f87c66d222fb",
          "name": "Mebeverine [WHO-DD]",
          "stdName": "MEBEVERINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a5f8519f-d672-2e86-d59c-05e28cc9a2e1"
          ],
          "display_name": false
        },
        {
          "uuid": "ae2f514b-06bd-4562-8d18-2c66cb41d1c8",
          "name": "VERATRIC ACID, 4-((ETHYL(P-METHOXY-.ALPHA.-METHYLPHENETHYL))AMINO)BUTYL ESTER",
          "stdName": "VERATRIC ACID, 4-((ETHYL(P-METHOXY-.ALPHA.-METHYLPHENETHYL))AMINO)BUTYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "be9a9070-33ec-4f80-8004-ee7b4ece2ffd"
          ],
          "display_name": false
        },
        {
          "uuid": "e84b7e0b-fa6a-4f51-90c9-ca36594342c3",
          "name": "mebeverine [INN]",
          "stdName": "MEBEVERINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aea59bb3-eacb-4c26-aee1-bb19ec09ec10"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "fe836eea-8743-477c-881e-0d372cff8f23",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c87a41a6-71cf-4e7e-956d-a9790f9307a3",
          "citation": "USP Dicitonary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d4e8ba50-80b7-4643-8c33-293af7dff222",
          "citation": "USAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "be9a9070-33ec-4f80-8004-ee7b4ece2ffd",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aea59bb3-eacb-4c26-aee1-bb19ec09ec10",
          "citation": "INN Proposed List 14",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL14.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d1f066b0-8c39-4d8e-8299-e31131b03b41",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "64090948-5813-4039-88db-6442858c9e6e",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "10a696ae-2caa-4342-a57d-a1404c01615b",
          "citation": "D08160",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f1e1ac45-3dda-4f59-b0d4-a88b0e99b4b8",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5c3c9e23-fa4e-41f5-a30a-519bb950c498",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390812000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e3a2a44c-582c-4106-9934-635cc08d22f2",
          "citation": "SRS import [7F80CC3NNV]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7F80CC3NNV",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390812000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "200e06dd-b313-40dc-8678-568ab97ad2ad",
          "citation": "USP Dictionary 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5b8258b9-6e9a-408f-ac70-45ff575a8e9e",
          "citation": "MEBEVERINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6a6fe26b-ed51-43aa-a926-aa2e9820301e",
          "citation": "MEBEVERINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8d24f127-8b34-47a1-ab5e-6e7c38ce8dea",
          "citation": "MEBEVERINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "483cc9d3-31c3-0f24-d077-4932e4f0a78d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=3625-06-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5bb4a544-c038-95ce-6acd-285050473fec",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "6f848124-8d98-467e-8c65-30fb94b5033f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a5f8519f-d672-2e86-d59c-05e28cc9a2e1",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "e51a760f-8f17-d0f5-f65c-a8f17ab11357",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8b8a192f-a8f6-4cfa-a034-6d7908825c57",
          "id": "8b8a192f-a8f6-4cfa-a034-6d7908825c57",
          "molfile": "\n  Marvin  01132107152D          \n\n 31 32  0  0  0  0            999 V2000\n    4.1695   -2.8528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8898   -2.4423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8898   -1.6135    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1695   -1.2160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4621   -1.6290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7495   -1.2030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0292   -1.6290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3167   -1.2030    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5964   -1.6135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5964   -2.4423    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1136   -1.2160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1136   -0.3898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8365    0.0207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5464   -0.4027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2667    0.0207    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2667    0.8442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5464   -1.2160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2667   -1.6135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2667   -2.4423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8365   -1.6135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5997   -1.2160    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    5.5997   -0.4027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3226   -1.6135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0326   -1.2160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7425   -1.6290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4525   -1.2030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4654   -0.3898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1857    0.0129    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1857    0.8442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7425    0.0129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0326   -0.3898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n 21  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11  9  1  0  0  0  0\n 12 11  1  0  0  0  0\n 20 11  2  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 14 17  2  0  0  0  0\n 16 15  1  0  0  0  0\n 18 17  1  0  0  0  0\n 17 20  1  0  0  0  0\n 19 18  1  0  0  0  0\n 21 22  1  0  0  0  0\n 23 21  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 31 24  2  0  0  0  0\n 26 25  2  0  0  0  0\n 27 26  1  0  0  0  0\n 28 27  1  0  0  0  0\n 30 27  2  0  0  0  0\n 29 28  1  0  0  0  0\n 30 31  1  0  0  0  0\nM  END",
          "smiles": "CCN(CCCCOC(=O)c1ccc(c(c1)OC)OC)C(C)Cc2ccc(cc2)OC",
          "formula": "C25H35NO5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a24447dc-da8a-43ac-b2bc-9e9f967ffe94"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "429.5501",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "0b643d20-d6b4-497b-9901-06753f5a3b75",
      "version": "10",
      "structure": {
        "id": "e7e07ff1-01a5-445f-9ef9-6bd29f01a331",
        "molfile": "\n  Marvin  01132112002D          \n\n 31 32  0  0  0  0            999 V2000\n    0.5964   -1.6135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1136   -1.2160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8365   -1.6135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5464   -1.2160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5464   -0.4027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5997   -1.2160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8898   -1.6135    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5964   -2.4423    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3226   -1.6135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1136   -0.3898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8365    0.0207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0326   -1.2160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3167   -1.2030    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4654   -0.3898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2667   -1.6135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7425   -1.6290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0326   -0.3898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2667    0.0207    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7425    0.0129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4525   -1.2030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1857    0.0129    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8898   -2.4423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1695   -1.2160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5997   -0.4027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0292   -1.6290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2667   -2.4423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2667    0.8442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1857    0.8442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4621   -1.6290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7495   -1.2030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1695   -2.8528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5 11  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7 23  1  0  0  0  0\n  8  1  2  0  0  0  0\n  9  6  1  0  0  0  0\n 10  2  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12  9  1  0  0  0  0\n 13  1  1  0  0  0  0\n 14 20  2  0  0  0  0\n 15  4  1  0  0  0  0\n 16 12  2  0  0  0  0\n 17 12  1  0  0  0  0\n 18  5  1  0  0  0  0\n 19 17  2  0  0  0  0\n 20 16  1  0  0  0  0\n 21 14  1  0  0  0  0\n 22  7  1  0  0  0  0\n 23 29  1  0  0  0  0\n  6 24  1  0  0  0  0\n 25 13  1  0  0  0  0\n 26 15  1  0  0  0  0\n 27 18  1  0  0  0  0\n 28 21  1  0  0  0  0\n 29 30  1  0  0  0  0\n 30 25  1  0  0  0  0\n 31 22  1  0  0  0  0\n  5  4  2  0  0  0  0\n 19 14  1  0  0  0  0\nM  END",
        "smiles": "CCN(CCCCOC(=O)c1ccc(c(c1)OC)OC)C(C)Cc2ccc(cc2)OC",
        "formula": "C25H35NO5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "429.5501",
        "optical_activity": "( + / - )",
        "references": [
          "e3a2a44c-582c-4106-9934-635cc08d22f2",
          "200e06dd-b313-40dc-8678-568ab97ad2ad",
          "aea59bb3-eacb-4c26-aee1-bb19ec09ec10"
        ],
        "stereo_centers": 1
      },
      "unii": "7F80CC3NNV"
    }
  ]
}