{
"meta": {
"disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
"terms": "https://open.fda.gov/terms/",
"license": "https://open.fda.gov/license/",
"last_updated": "2025-09-19",
"results": {
"skip": 0,
"limit": 1,
"total": 1
}
},
"results": [
{
"codes": [
{
"uuid": "50e4c187-4256-42af-8bb5-bc0ddcd4f1a0",
"code": "7F7M86G3AM",
"type": "PRIMARY",
"code_system": "FDA UNII"
},
{
"uuid": "384a2a77-055f-42ee-aa57-fac25c2f5e88",
"code": "160057-45-4",
"type": "PRIMARY",
"url": "https://commonchemistry.cas.org/detail?cas_rn=160057-45-4",
"code_system": "CAS",
"references": [
"6ca71a1d-67e5-4135-a2a5-28274ba589e5",
"d1e38eee-4f84-49f5-b1cd-2583278723b6"
]
},
{
"uuid": "cf419f6f-9e7c-28b1-9987-5a975035bbfa",
"code": "DTXSID901021816",
"type": "PRIMARY",
"url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID901021816",
"code_system": "EPA CompTox"
},
{
"uuid": "65c2da9f-9789-ae52-d605-4f9ac24a48c9",
"code": "101044057",
"type": "PRIMARY",
"url": "https://pubchem.ncbi.nlm.nih.gov/compound/101044057",
"code_system": "PUBCHEM",
"references": [
"5389c9bc-b2e5-5dd0-4337-cfbc34c752c4"
]
}
],
"substance_class": "chemical",
"names": [
{
"uuid": "6f9bab3c-cf69-450d-89af-4784530ddd5d",
"name": "Isostearyl N-acetyl-L-glutamine",
"stdName": "ISOSTEARYL N-ACETYL-L-GLUTAMINE",
"type": "cn",
"languages": [
"en"
],
"preferred": false,
"references": [
"4cd3db93-369b-45c4-aeac-e1bd8e031474"
],
"display_name": false
},
{
"uuid": "508375a4-5238-424e-bb6d-308efecd3192",
"name": "Isostearyl acetyl glutaminate",
"stdName": "ISOSTEARYL ACETYL GLUTAMINATE",
"type": "of",
"languages": [
"en"
],
"preferred": false,
"references": [
"9be3e93a-e0b8-487a-bbdb-fcceef653a50",
"b701e420-30ed-4f0a-9508-dcbd33f986da",
"da04d16e-799b-4c3a-a5d7-4f61ff5fee75"
],
"display_name": true,
"name_orgs": [
{
"uuid": "f87d5005-7658-4c07-ab68-866262c64f94",
"name_org": "INCI"
}
]
},
{
"uuid": "e375d098-6ba6-4bf7-a9cc-f29c0acb4cde",
"name": "L-Glutamine, N2-acetyl-, 5,7,7-trimethyl-2-(1,3,3-trimethylbutyl)octyl ester",
"stdName": "L-GLUTAMINE, N2-ACETYL-, 5,7,7-TRIMETHYL-2-(1,3,3-TRIMETHYLBUTYL)OCTYL ESTER",
"type": "sys",
"languages": [
"en"
],
"preferred": false,
"references": [
"da04d16e-799b-4c3a-a5d7-4f61ff5fee75",
"4cd3db93-369b-45c4-aeac-e1bd8e031474"
],
"display_name": false
},
{
"uuid": "7beb7d5d-9169-44e6-8740-ed24131e2919",
"name": "N2-Acetyl-L-glutamine 5,7,7-trimethyl-2-(1,3,3-trimethylbutyl)octyl ester",
"stdName": "N2-ACETYL-L-GLUTAMINE 5,7,7-TRIMETHYL-2-(1,3,3-TRIMETHYLBUTYL)OCTYL ESTER",
"type": "sys",
"languages": [
"en"
],
"preferred": false,
"references": [
"da04d16e-799b-4c3a-a5d7-4f61ff5fee75"
],
"display_name": false
},
{
"uuid": "a8d846f2-8fd1-4eb4-9a3a-3a04188836f4",
"name": "NAGIS",
"stdName": "NAGIS",
"type": "bn",
"languages": [
"en"
],
"preferred": false,
"references": [
"b701e420-30ed-4f0a-9508-dcbd33f986da",
"da04d16e-799b-4c3a-a5d7-4f61ff5fee75"
],
"display_name": false
},
{
"uuid": "006886f3-a7c2-4e26-8104-a52ef79be35d",
"name": "[2-(4,4-Dimethylpentan-2-yl)-5,7,7-trimethyloctyl] (2S)-2-acetamido-5-amino-5-oxopentanoate",
"stdName": "(2-(4,4-DIMETHYLPENTAN-2-YL)-5,7,7-TRIMETHYLOCTYL) (2S)-2-ACETAMIDO-5-AMINO-5-OXOPENTANOATE",
"type": "sys",
"languages": [
"en"
],
"preferred": false,
"references": [
"5389c9bc-b2e5-5dd0-4337-cfbc34c752c4"
],
"display_name": false
}
],
"references": [
{
"uuid": "4cd3db93-369b-45c4-aeac-e1bd8e031474",
"citation": "STN",
"doc_type": "SRS",
"public_domain": true,
"tags": [
"NOMEN",
"PUBLIC_DOMAIN_RELEASE",
"AUTO_SELECTED"
]
},
{
"uuid": "da04d16e-799b-4c3a-a5d7-4f61ff5fee75",
"citation": "STN (SCIFINDER)",
"doc_type": "STN (SCIFINDER)",
"public_domain": true,
"tags": [
"NOMEN"
]
},
{
"uuid": "b701e420-30ed-4f0a-9508-dcbd33f986da",
"citation": "PCPC-DB",
"doc_type": "SRS",
"public_domain": true,
"tags": [
"NOMEN"
]
},
{
"uuid": "6ca71a1d-67e5-4135-a2a5-28274ba589e5",
"citation": "SRS CODE IMPORT",
"doc_type": "SRS",
"public_domain": true,
"document_date": 1493393334000,
"tags": [
"NOMEN"
]
},
{
"uuid": "9be3e93a-e0b8-487a-bbdb-fcceef653a50",
"citation": "ISOSTEARYL ACETYL GLUTAMINATE [INCI]",
"doc_type": "SRS_LOCATOR",
"public_domain": true
},
{
"uuid": "d1e38eee-4f84-49f5-b1cd-2583278723b6",
"citation": "STN",
"doc_type": "STN (SCIFINDER)",
"public_domain": true
},
{
"uuid": "5389c9bc-b2e5-5dd0-4337-cfbc34c752c4",
"citation": "PUBCHEM",
"doc_type": "PUBCHEM",
"public_domain": true
}
],
"definition_type": "PRIMARY",
"moieties": [
{
"uuid": "f29e7d5a-c18b-41e0-801e-5a7157405731",
"id": "f29e7d5a-c18b-41e0-801e-5a7157405731",
"molfile": "\n Marvin 01132112352D \n\n 31 30 0 0 1 0 999 V2000\n 15.3854 -9.5158 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 15.5287 -10.3283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3039 -10.6105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4472 -11.4229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.2224 -11.7051 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8152 -11.9532 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0174 -8.9856 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7926 -9.2678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9359 -10.0802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4246 -8.7375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6102 -9.2337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9783 -9.7640 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4669 -8.4212 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6917 -8.1391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6917 -7.3142 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 12.9772 -6.9016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2628 -7.3142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5483 -6.9016 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 11.5483 -6.0767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8340 -7.3142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1195 -6.9017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1195 -6.0767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4050 -6.4892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4050 -7.3142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4062 -6.9016 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 15.1206 -7.3142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4062 -6.0767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1206 -5.6642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8351 -6.0767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8351 -5.2517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1206 -4.8392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 7 1 1 0 0 0\n 11 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 4 6 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 10 2 0 0 0 0\n 11 12 2 0 0 0 0\n 13 11 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 1 0 0 0 0\n 15 16 1 0 0 0 0\n 15 25 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 21 23 1 0 0 0 0\n 21 24 1 0 0 0 0\n 25 26 1 0 0 0 0\n 25 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 28 30 1 0 0 0 0\n 28 31 1 0 0 0 0\nM END",
"smiles": "CC(CCC(COC(=O)[C@H](CCC(=O)N)NC(=O)C)C(C)CC(C)(C)C)CC(C)(C)C",
"formula": "C25H48N2O4",
"atropisomerism": "No",
"charge": 0,
"count": 1,
"stereochemistry": "MIXED",
"count_amount": {
"type": "MOL RATIO",
"average": 1,
"units": "MOL RATIO",
"uuid": "b57cf6f0-4494-4c97-b1a5-ffe2904c5357"
},
"defined_stereo": 1,
"ez_centers": 0,
"molecular_weight": "440.6606",
"optical_activity": "UNSPECIFIED",
"stereo_centers": 4
}
],
"definition_level": "COMPLETE",
"uuid": "184db840-c129-418b-8d20-cb1b66bacf0c",
"version": "8",
"structure": {
"id": "45a717cf-e9df-4b8f-aff0-0e1732b8c270",
"molfile": "\n Marvin 01132103402D \n\n 31 30 0 0 1 0 999 V2000\n 13.6917 -7.3142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4062 -6.9016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1206 -7.3142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4062 -6.0767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1206 -5.6642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8351 -6.0767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8351 -5.2517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1206 -4.8392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9772 -6.9016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2628 -7.3142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5483 -6.9016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5483 -6.0767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8340 -7.3142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1195 -6.9017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1195 -6.0767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4050 -6.4892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4050 -7.3142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6917 -8.1391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4669 -8.4212 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6102 -9.2337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9783 -9.7640 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.3854 -9.5158 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 16.0174 -8.9856 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7926 -9.2678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4246 -8.7375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.9359 -10.0802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5287 -10.3283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3039 -10.6105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4472 -11.4229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8152 -11.9532 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.2224 -11.7051 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 7 1 0 0 0 0\n 5 8 1 0 0 0 0\n 1 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 14 16 1 0 0 0 0\n 14 17 1 0 0 0 0\n 1 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 2 0 0 0 0\n 20 22 1 0 0 0 0\n 22 23 1 1 0 0 0\n 23 24 1 0 0 0 0\n 24 25 2 0 0 0 0\n 24 26 1 0 0 0 0\n 22 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 2 0 0 0 0\n 29 31 1 0 0 0 0\nM END",
"smiles": "CC(CCC(COC(=O)[C@H](CCC(=O)N)NC(=O)C)C(C)CC(C)(C)C)CC(C)(C)C",
"formula": "C25H48N2O4",
"atropisomerism": "No",
"charge": 0,
"count": 1,
"stereochemistry": "MIXED",
"defined_stereo": 1,
"ez_centers": 0,
"molecular_weight": "440.6606",
"optical_activity": "UNSPECIFIED",
"references": [
"4cd3db93-369b-45c4-aeac-e1bd8e031474",
"da04d16e-799b-4c3a-a5d7-4f61ff5fee75"
],
"stereo_centers": 4
},
"unii": "7F7M86G3AM"
}
]
}