{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f67c00c1-f068-4b43-bfca-1ec54621e400",
          "code": "514-99-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=514-99-8",
          "code_system": "CAS",
          "references": [
            "8dbd5b10-e39d-479f-9922-ddb5a0ff87a3",
            "86298359-dae5-4e04-9ded-51a731debe8d"
          ]
        },
        {
          "uuid": "29f5da38-c015-4e15-991e-ee4268762313",
          "code": "208-191-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.007.448",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "8dbd5b10-e39d-479f-9922-ddb5a0ff87a3"
          ]
        },
        {
          "uuid": "591ac16f-7897-4685-9246-ad1efa1954ca",
          "code": "7F5M346MU6",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "4939189c-db98-53de-050e-2d6a51093156",
          "code": "10877344",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10877344",
          "code_system": "PUBCHEM",
          "references": [
            "2977016f-58e9-e565-1a82-86586c262ffe"
          ]
        },
        {
          "uuid": "196460eb-30d4-434c-f43e-fabac2e605d6",
          "code": "DTXSID40862088",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40862088",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "c373423e-3350-48b2-9d04-caf8d88a9551",
          "citation": "EC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "905db121-aacc-4248-96a8-1c3a74e431c8",
          "citation": "EC FLAVOURING SUBSTANCES",
          "doc_type": "EC FLAVOURING SUBSTANCES",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "94e8f9c3-cc8c-4f0a-a34f-f18da40c0660",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8dbd5b10-e39d-479f-9922-ddb5a0ff87a3",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392509000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "86298359-dae5-4e04-9ded-51a731debe8d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "2977016f-58e9-e565-1a82-86586c262ffe",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0c35d6e7-2e0b-49a4-aaec-07d561db5bce",
          "id": "0c35d6e7-2e0b-49a4-aaec-07d561db5bce",
          "molfile": "\n  Marvin  03022108522D          \n\n 11 12  0  0  1  0            999 V2000\n   11.4748   -3.9822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2873   -3.8389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0051   -3.0636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0018   -3.4264    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   13.7162   -3.8389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4307   -3.4264    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1451   -3.8389    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7162   -4.6639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0018   -5.0764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2873   -4.6639    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   13.0018   -4.2514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  2 10  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4 11  1  1  0  0  0\n  5  6  1  0  0  0  0\n  5  8  1  0  0  0  0\n  6  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  1  0  0  0\nM  END",
          "smiles": "CC1(C)[C@H]2CCC(CO)[C@@H]1C2",
          "formula": "C10H18O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "EPIMERIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b3380eaf-b0c3-4c35-8d61-21d5cb76e996"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "154.2497",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "febe02b4-e912-487f-8513-28247ef0ef4a",
      "version": "8",
      "structure": {
        "id": "593ffe37-ca41-45c0-9ffa-d6f02ff849a4",
        "molfile": "\n   JSDraw203022108522D\n\n 11 12  0  0  0  0              0 V2000\n   21.6979   -7.5300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.2342   -7.2590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.7006   -5.7930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.5852   -6.4790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.9361   -7.2590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.2871   -6.4790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.6381   -7.2590    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   25.9361   -8.8190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.5852   -9.5990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.2342   -8.8190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.5852   -8.0390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  5  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n  2 10  1  0  0  0  0\n  4 11  1  1  0  0  0\n 10 11  1  1  0  0  0\nM  END",
        "smiles": "CC1(C)[C@H]2CCC(CO)[C@@H]1C2",
        "formula": "C10H18O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "154.2497",
        "optical_activity": "( + / - )",
        "references": [
          "94e8f9c3-cc8c-4f0a-a34f-f18da40c0660"
        ],
        "stereo_centers": 3
      },
      "unii": "7F5M346MU6",
      "relationships": [
        {
          "uuid": "46dc45ce-fd9d-456a-85f6-dc1cdf9dd365",
          "type": "SUBSTANCE->SUB_ALTERNATE",
          "related_substance": {
            "uuid": "bcce2f2f-9b12-4272-8d8d-edace8b77070",
            "refuuid": "6b888b91-3fbb-48be-ae06-c1b5d03f3e18",
            "name": "ALTERNATIVE DEFINITION for [MYRTANOL]",
            "linking_id": "6b888b91-3fbb-48be-ae06-c1b5d03f3e18",
            "ref_pname": "NO NAME"
          }
        }
      ],
      "names": [
        {
          "uuid": "c1e0e3f1-aefe-46ad-b072-9a4d85caf3bd",
          "name": "10-PINANOL",
          "stdName": "10-PINANOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "94e8f9c3-cc8c-4f0a-a34f-f18da40c0660",
            "905db121-aacc-4248-96a8-1c3a74e431c8"
          ],
          "display_name": false
        },
        {
          "uuid": "10fc6097-7074-4015-a4a4-70fca1f6a73a",
          "name": "BICYCLO(3.1.1)HEPTANE-2-METHANOL, 6,6-DIMETHYL-",
          "stdName": "BICYCLO(3.1.1)HEPTANE-2-METHANOL, 6,6-DIMETHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "94e8f9c3-cc8c-4f0a-a34f-f18da40c0660",
            "905db121-aacc-4248-96a8-1c3a74e431c8"
          ],
          "display_name": false
        },
        {
          "uuid": "e23e2050-d165-4a76-891c-258e90a24aec",
          "name": "DIHYDROMYRTENOL",
          "stdName": "DIHYDROMYRTENOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "94e8f9c3-cc8c-4f0a-a34f-f18da40c0660",
            "905db121-aacc-4248-96a8-1c3a74e431c8"
          ],
          "display_name": false
        },
        {
          "uuid": "085b3c8a-3975-44e6-ac67-543e04ad904b",
          "name": "MYRTANOL",
          "stdName": "MYRTANOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "905db121-aacc-4248-96a8-1c3a74e431c8",
            "c373423e-3350-48b2-9d04-caf8d88a9551"
          ],
          "display_name": true
        }
      ],
      "modifications": {
        "uuid": "17ed7489-7a0a-4f7f-b136-c0460e3dc983"
      }
    }
  ]
}