{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "fecbdb8d-d692-48ba-8a88-c888e37476b5", "code": "7EW2EZ38LS", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "1200cbbe-5134-4e30-a145-1633a940af9f", "code": "250141-42-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=250141-42-5", "code_system": "CAS", "references": [ "9cbe5c53-494c-4851-9d1b-8b0488a935a5" ] }, { "uuid": "a74d6038-16c6-140a-6f9c-62b9e2ab8b65", "code": "9962298", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9962298", "code_system": "PUBCHEM", "references": [ "ce3acf84-f138-e9d2-b34b-f015308c0d29" ] }, { "uuid": "c5004b27-a9aa-4bfb-902e-76f09a097b18", "code": "Calcium fructoborate", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Calcium_fructoborate", "code_system": "WIKIPEDIA" }, { "uuid": "963afe4b-7357-f348-12ba-4aa914cc6715", "code": "DTXSID701045983", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID701045983", "code_system": "EPA CompTox", "references": [ "2bfc80f8-7516-9c0f-abb5-704bd48c83bc" ] }, { "uuid": "57ed1963-5726-0733-77cd-7009ba0548a7", "code": "2600351", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2600351/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "1456da82-3683-352f-0612-7059533d68d0" ] }, { "uuid": "feb043fe-d2b1-3773-8e43-9207c16fba96", "code": "7EW2EZ38LS", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=7EW2EZ38LS", "code_system": "DAILYMED", "references": [ "8324331d-b6cc-93c9-371c-db8d942b6258" ] }, { "uuid": "7ea80ac3-dee7-c95e-c508-cf46ab668ca2", "code": "100000163698", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "d700972f-0705-8673-1451-496801e1aca7" ] } ], "substance_class": "chemical", "names": [ { "uuid": "f72d36ef-c4e1-48e0-8f2e-bf95a0bda3ab", "name": "BORATE(1-), BIS(.BETA.-D-FRUCTOFURANOSATO(2-)-.KAPPA.O2,.KAPPA.O3)-, CALCIUM (2:1), (T-4)-", "stdName": "BORATE(1-), BIS(.BETA.-D-FRUCTOFURANOSATO(2-)-.KAPPA.O2,.KAPPA.O3)-, CALCIUM (2:1), (T-4)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "6e78c79c-74fb-4369-8d8e-f14e47afe8c4" ], "display_name": false }, { "uuid": "71faa40d-45e4-ebcc-2752-62ec0f141ef4", "name": "CALCIUM FRUCTOBORATE", "stdName": "CALCIUM FRUCTOBORATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "b858bcc7-5ab1-92aa-5a45-3f5663fb9e67" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "4d41e0f9-5313-4e01-b099-1781ef53e6a2", "name_org": "INCI" } ] }, { "uuid": "0e743d25-2b7c-bf75-9c56-a53c2eb5b7b1", "name": "Calcium fructoborate [WHO-DD]", "stdName": "CALCIUM FRUCTOBORATE [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7d001dd4-6b02-db80-05ea-00415afe287a" ], "display_name": false } ], "references": [ { "uuid": "1456da82-3683-352f-0612-7059533d68d0", "citation": "RXNORM", "doc_type": "NLM", "public_domain": true }, { "uuid": "b858bcc7-5ab1-92aa-5a45-3f5663fb9e67", "citation": "https://dsld.od.nih.gov/dsld/", "url": "https://dsld.od.nih.gov/dsld/", "doc_type": "WEB PAGE", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "ede2e844-044d-2234-7161-1ab5283ca066", "citation": "PubChem", "doc_type": "PUBCHEM", "public_domain": true, "document_date": 1607222956230, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "6e78c79c-74fb-4369-8d8e-f14e47afe8c4", "citation": "SCIFINDER", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "9cbe5c53-494c-4851-9d1b-8b0488a935a5", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "7d001dd4-6b02-db80-05ea-00415afe287a", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "ce3acf84-f138-e9d2-b34b-f015308c0d29", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "8324331d-b6cc-93c9-371c-db8d942b6258", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "3d04fd51-373c-049f-5b3f-ce8683c17067", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "2bfc80f8-7516-9c0f-abb5-704bd48c83bc", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true }, { "uuid": "d700972f-0705-8673-1451-496801e1aca7", "citation": "SMS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "fb78752c-6e15-4856-46cf-bc1bb2573695", "id": "fb78752c-6e15-4856-46cf-bc1bb2573695", "molfile": "\n Marvin 03262112042D \n\n 1 0 0 0 1 0 999 V2000\n 20.3352 -5.5971 0.0000 Ca 0 2 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 2\nM END", "smiles": "[Ca+2]", "formula": "Ca", "atropisomerism": "No", "charge": 2, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "f4916b1a-78f6-48a0-bc85-8ab5e7af7e9d" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "40.078", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "fe1eec51-1842-bcb9-4ebc-730e62ad7c7c", "id": "fe1eec51-1842-bcb9-4ebc-730e62ad7c7c", "molfile": "\n Marvin 03262112042D \n\n 27 30 0 0 1 0 999 V2000\n 13.8635 -4.5294 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1986 -5.4992 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1986 -4.5294 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8635 -5.4992 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8672 -2.9640 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1950 -7.0645 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9792 -2.7077 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0828 -7.3209 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8809 -3.0302 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.1811 -6.9983 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8166 -1.2450 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2456 -8.7836 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.1186 -3.7447 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 14.9436 -6.2839 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 14.9436 -3.7447 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 14.1186 -6.2839 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 15.1950 -2.9640 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 13.8672 -7.0645 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 14.5309 -2.4825 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 14.5309 -7.5461 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 13.2934 -3.7447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7686 -6.2839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5309 -1.6575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5309 -8.3711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5309 -5.0142 0.0000 B 0 5 0 0 0 0 0 0 0 0 0 0\n 15.6449 -3.7438 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4172 -6.2848 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 1 13 1 0 0 0 0\n 1 25 1 0 0 0 0\n 2 14 1 0 0 0 0\n 2 25 1 0 0 0 0\n 3 15 1 0 0 0 0\n 3 25 1 0 0 0 0\n 4 16 1 0 0 0 0\n 4 25 1 0 0 0 0\n 5 13 1 0 0 0 0\n 5 19 1 0 0 0 0\n 6 14 1 0 0 0 0\n 6 20 1 0 0 0 0\n 17 7 1 1 0 0 0\n 18 8 1 1 0 0 0\n 9 21 1 0 0 0 0\n 10 22 1 0 0 0 0\n 11 23 1 0 0 0 0\n 12 24 1 0 0 0 0\n 13 15 1 0 0 0 0\n 13 21 1 1 0 0 0\n 14 16 1 0 0 0 0\n 14 22 1 1 0 0 0\n 15 17 1 0 0 0 0\n 15 26 1 1 0 0 0\n 16 18 1 0 0 0 0\n 16 27 1 1 0 0 0\n 17 19 1 0 0 0 0\n 18 20 1 0 0 0 0\n 19 23 1 6 0 0 0\n 20 24 1 6 0 0 0\nM CHG 1 25 -1\nM END", "smiles": "C([C@@H]1[C@H]([C@@]2([H])[C@@](CO)(O1)O[B-]3(O2)O[C@@]4([H])[C@@H]([C@@H](CO)O[C@@]4(CO)O3)O)O)O", "formula": "C12H20BO12", "atropisomerism": "No", "charge": -1, "count": 2, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 2, "units": "MOL RATIO", "uuid": "418b8109-d046-47dc-bb8d-9ff86b7cd434" }, "defined_stereo": 8, "ez_centers": 0, "molecular_weight": "367.0915", "optical_activity": "UNSPECIFIED", "stereo_centers": 9 } ], "definition_level": "COMPLETE", "uuid": "041e1787-6793-4c37-9047-b886c9b89143", "version": "21", "structure": { "id": "7a396d4a-f9eb-e7ac-bc75-31dc94c361fd", "molfile": "9962298\n JSDraw203262112042D\n\n 55 60 0 0 1 0 0 V2000\n 38.4521 -10.5836 0.0000 Ca 0 2 0 0 0 0 0 0 0 0 0 0\n 26.2147 -8.5647 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7391 -10.3985 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7391 -8.5647 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.2147 -10.3985 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.2216 -5.6047 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7323 -13.3583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2152 -5.1200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 24.7383 -13.8432 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 24.3567 -5.7298 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.5969 -13.2331 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.1259 -2.3542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8280 -16.6090 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.6969 -7.0809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2569 -11.8823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2569 -7.0809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.6969 -11.8823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7323 -5.6047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.2216 -13.3583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.4767 -4.6942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.4767 -14.2690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.1367 -7.0809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8169 -11.8823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.4767 -3.1342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.4767 -15.8290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.4767 -9.4814 0.0000 B 0 5 0 0 0 0 0 0 0 0 0 0\n 29.5830 -7.0792 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 25.3708 -11.8840 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 26.2147 -8.5647 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7391 -10.3985 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7391 -8.5647 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.2147 -10.3985 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.2216 -5.6047 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7323 -13.3583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.2152 -5.1200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 24.7383 -13.8432 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 24.3567 -5.7298 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.5969 -13.2331 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.1259 -2.3542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.8280 -16.6090 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.6969 -7.0809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2569 -11.8823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.2569 -7.0809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.6969 -11.8823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.7323 -5.6047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.2216 -13.3583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.4767 -4.6942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.4767 -14.2690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.1367 -7.0809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8169 -11.8823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.4767 -3.1342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.4767 -15.8290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.4767 -9.4814 0.0000 B 0 5 0 0 0 0 0 0 0 0 0 0\n 29.5830 -7.0792 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 25.3708 -11.8840 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 2 14 1 0 0 0 0\n 2 26 1 0 0 0 0\n 3 15 1 0 0 0 0\n 3 26 1 0 0 0 0\n 4 16 1 0 0 0 0\n 4 26 1 0 0 0 0\n 5 17 1 0 0 0 0\n 5 26 1 0 0 0 0\n 6 14 1 0 0 0 0\n 6 20 1 0 0 0 0\n 7 15 1 0 0 0 0\n 7 21 1 0 0 0 0\n 18 8 1 1 0 0 0\n 19 9 1 1 0 0 0\n 10 22 1 0 0 0 0\n 11 23 1 0 0 0 0\n 12 24 1 0 0 0 0\n 13 25 1 0 0 0 0\n 14 16 1 0 0 0 0\n 14 22 1 1 0 0 0\n 15 17 1 0 0 0 0\n 15 23 1 1 0 0 0\n 16 18 1 0 0 0 0\n 16 27 1 1 0 0 0\n 17 19 1 0 0 0 0\n 17 28 1 1 0 0 0\n 18 20 1 0 0 0 0\n 19 21 1 0 0 0 0\n 20 24 1 6 0 0 0\n 21 25 1 6 0 0 0\n 29 41 1 0 0 0 0\n 29 53 1 0 0 0 0\n 30 42 1 0 0 0 0\n 30 53 1 0 0 0 0\n 31 43 1 0 0 0 0\n 31 53 1 0 0 0 0\n 32 44 1 0 0 0 0\n 32 53 1 0 0 0 0\n 33 41 1 0 0 0 0\n 33 47 1 0 0 0 0\n 34 42 1 0 0 0 0\n 34 48 1 0 0 0 0\n 45 35 1 1 0 0 0\n 46 36 1 1 0 0 0\n 37 49 1 0 0 0 0\n 38 50 1 0 0 0 0\n 39 51 1 0 0 0 0\n 40 52 1 0 0 0 0\n 41 43 1 0 0 0 0\n 41 49 1 1 0 0 0\n 42 44 1 0 0 0 0\n 42 50 1 1 0 0 0\n 43 45 1 0 0 0 0\n 43 54 1 1 0 0 0\n 44 46 1 0 0 0 0\n 44 55 1 1 0 0 0\n 45 47 1 0 0 0 0\n 46 48 1 0 0 0 0\n 47 51 1 6 0 0 0\n 48 52 1 6 0 0 0\nM STY 1 1 MUL\nM SAL 1 8 2 3 4 5 6 7 8 9\nM SAL 1 8 10 11 12 13 14 15 16 17\nM SAL 1 8 18 19 20 21 22 23 24 25\nM SAL 1 8 26 27 28 29 30 31 32 33\nM SAL 1 8 34 35 36 37 38 39 40 41\nM SAL 1 8 42 43 44 45 46 47 48 49\nM SAL 1 6 50 51 52 53 54 55\nM SPA 1 8 2 3 4 5 6 7 8 9\nM SPA 1 8 10 11 12 13 14 15 16 17\nM SPA 1 8 18 19 20 21 22 23 24 25\nM SPA 1 3 26 27 28\nM SDI 1 4 23.5626 -17.4032 23.5626 -1.5600\nM SDI 1 4 31.3911 -1.5600 31.3911 -17.4032\nM SMT 1 2\nM CHG 3 1 2 26 -1 53 -1\nM END", "smiles": "C([C@@H]1[C@H]([C@@]2([H])[C@@](CO)(O1)O[B-]3(O2)O[C@@]4([H])[C@@H]([C@@H](CO)O[C@@]4(CO)O3)O)O)O.C([C@@H]1[C@H]([C@@]2([H])[C@@](CO)(O1)O[B-]3(O2)O[C@@]4([H])[C@@H]([C@@H](CO)O[C@@]4(CO)O3)O)O)O.[Ca+2]", "formula": "2C12H20BO12.Ca", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 16, "ez_centers": 0, "molecular_weight": "774.2611", "optical_activity": "UNSPECIFIED", "references": [ "ede2e844-044d-2234-7161-1ab5283ca066" ], "stereo_centers": 18 }, "unii": "7EW2EZ38LS" } ] }