{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "f4ccd49d-4951-9483-4fb1-46678dfaefb7", "code": "88191", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:88191", "code_system": "CHEBI", "references": [ "f9c0818d-7f12-4509-eb7d-879e67100c33" ] }, { "uuid": "a2983fee-79bc-454c-a706-4ef4cd1310f5", "code": "2610-11-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=2610-11-9", "code_system": "CAS", "references": [ "acd894d9-f2aa-450f-8371-ba5957378e31", "6aa88825-2516-446a-a604-291de14ee4ea" ] }, { "uuid": "a5d1c033-3340-4bc7-b4ab-684382f320ce", "code": "C062246", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67062246", "code_system": "MESH", "references": [ "acd894d9-f2aa-450f-8371-ba5957378e31" ] }, { "uuid": "5f398634-8b43-4ec9-9672-86899f9b43d3", "code": "220-028-9", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.018.209", "code_system": "ECHA (EC/EINECS)", "references": [ "acd894d9-f2aa-450f-8371-ba5957378e31" ] }, { "uuid": "3b8ea0b8-c623-fdef-3988-a2c7780806a5", "code": "DTXSID5041726", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5041726", "code_system": "EPA CompTox", "references": [ "35a1b18f-ccf0-9146-886d-836ef0c2aec3" ] }, { "uuid": "19737cdc-f12e-4380-b523-594761ca5d11", "code": "7E49Q56PNB", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "95449d3d-dc59-ba0a-2d41-3307ff1b0b80", "code": "326198", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=326198", "code_system": "NSC", "references": [ "ace85e20-0116-bc7d-1824-becd7d70028b" ] }, { "uuid": "b706d3de-92db-3957-e5b4-4fa1a81f3398", "code": "7E49Q56PNB", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=(7E49Q56PNB)", "code_system": "DAILYMED", "references": [ "54873ff4-0f14-5c99-913e-4027c91e1f78" ] } ], "substance_class": "chemical", "names": [ { "uuid": "6ffa2be9-4391-4666-86f2-5763c83742c1", "name": "2-NAPHTHALENESULFONIC ACID, 7-(BENZOYLAMINO)-4-HYDROXY-3-((4-((4-SULFOPHENYL)AZO)PHENYL)AZO)-, DISODIUM SALT", "stdName": "2-NAPHTHALENESULFONIC ACID, 7-(BENZOYLAMINO)-4-HYDROXY-3-((4-((4-SULFOPHENYL)AZO)PHENYL)AZO)-, DISODIUM SALT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c001e6ac-2256-4089-80ef-e88926262247", "5225c3f9-b874-4903-af9d-bd329aa371b1" ], "display_name": false }, { "uuid": "dd6374a2-997a-4981-b1e8-4a2186f9c61c", "name": "2-NAPHTHALENESULFONIC ACID, 7-(BENZOYLAMINO)-4-HYDROXY-3-(2-(4-(2-(4-SULFOPHENYL)DIAZENYL)PHENYL)DIAZENYL)-, SODIUM SALT (1:2)", "stdName": "2-NAPHTHALENESULFONIC ACID, 7-(BENZOYLAMINO)-4-HYDROXY-3-(2-(4-(2-(4-SULFOPHENYL)DIAZENYL)PHENYL)DIAZENYL)-, SODIUM SALT (1:2)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "5225c3f9-b874-4903-af9d-bd329aa371b1", "af0ca9fc-cb4b-4a39-be46-b5aaabb81028" ], "display_name": false }, { "uuid": "7999d13f-03a8-4797-8f8f-a86ab1f975a4", "name": "7-(BENZOYLAMINO)-4-HYDROXY-3-((4-((4-SULFOPHENYL)AZO)PHENYL)AZO)-2-NAPHTHALENESULFONIC ACID, DISODIUM SALT", "stdName": "7-(BENZOYLAMINO)-4-HYDROXY-3-((4-((4-SULFOPHENYL)AZO)PHENYL)AZO)-2-NAPHTHALENESULFONIC ACID, DISODIUM SALT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c001e6ac-2256-4089-80ef-e88926262247", "5225c3f9-b874-4903-af9d-bd329aa371b1" ], "display_name": false }, { "uuid": "9926576a-58fb-436b-8605-f91f585568da", "name": "AIREDALE RED KD", "stdName": "AIREDALE RED KD", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "5225c3f9-b874-4903-af9d-bd329aa371b1", "af0ca9fc-cb4b-4a39-be46-b5aaabb81028" ], "display_name": false }, { "uuid": "baaf672a-4ac7-43f6-87b0-9f692f67dce3", "name": "C.I. DIRECT RED 81", "stdName": "C.I. DIRECT RED 81", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "5225c3f9-b874-4903-af9d-bd329aa371b1", "af0ca9fc-cb4b-4a39-be46-b5aaabb81028" ], "display_name": false }, { "uuid": "714c5575-7cdf-45fb-9e50-ba5a572b5173", "name": "C.I. DIRECT RED 81 DISODIUM SALT", "stdName": "C.I. DIRECT RED 81 DISODIUM SALT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "a70f789d-b708-462a-8b06-38d015f86280", "5225c3f9-b874-4903-af9d-bd329aa371b1" ], "display_name": false }, { "uuid": "85824a58-14bf-4281-990d-b28686e3f2d8", "name": "CHLORANTINE FAST RED 5B", "stdName": "CHLORANTINE FAST RED 5B", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "5225c3f9-b874-4903-af9d-bd329aa371b1", "af0ca9fc-cb4b-4a39-be46-b5aaabb81028" ], "display_name": false }, { "uuid": "ae094c03-7805-4639-b75c-db74a2e380d2", "name": "DIRECT RED 81", "stdName": "DIRECT RED 81", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "c001e6ac-2256-4089-80ef-e88926262247", "5225c3f9-b874-4903-af9d-bd329aa371b1", "e119e872-1d2a-41f8-91cc-aa03853a448b" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "5207ce4d-feec-4498-a90c-630dcdb05640", "name_org": "INCI" } ] }, { "uuid": "ca2e2217-e565-433e-a070-c31a1f34d4d3", "name": "NSC-326198", "stdName": "NSC-326198", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "5225c3f9-b874-4903-af9d-bd329aa371b1", "4ce59bbc-12b1-4c67-83e9-c03bf8958e36" ], "display_name": false }, { "uuid": "c839bba2-dc8b-4c85-9c2e-a5b92f342e4e", "name": "SIRIUS SUPRA RED 4B", "stdName": "SIRIUS SUPRA RED 4B", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "5225c3f9-b874-4903-af9d-bd329aa371b1", "af0ca9fc-cb4b-4a39-be46-b5aaabb81028" ], "display_name": false }, { "uuid": "9778e80f-42d9-4e94-9fa7-15b61a46a587", "name": "TRIANTINE LIGHT RED 4BN", "stdName": "TRIANTINE LIGHT RED 4BN", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "5225c3f9-b874-4903-af9d-bd329aa371b1", "af0ca9fc-cb4b-4a39-be46-b5aaabb81028" ], "display_name": false } ], "references": [ { "uuid": "c001e6ac-2256-4089-80ef-e88926262247", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "5225c3f9-b874-4903-af9d-bd329aa371b1", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "af0ca9fc-cb4b-4a39-be46-b5aaabb81028", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a70f789d-b708-462a-8b06-38d015f86280", "citation": "TOX 21", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4ce59bbc-12b1-4c67-83e9-c03bf8958e36", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "acd894d9-f2aa-450f-8371-ba5957378e31", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391525000, "tags": [ "NOMEN" ] }, { "uuid": "140f1278-a68b-4d72-ac62-14dbb4f66504", "citation": "SRS import [7E49Q56PNB]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7E49Q56PNB", "doc_type": "SRS", "public_domain": true, "document_date": 1493391525000, "tags": [ "NOMEN" ] }, { "uuid": "e119e872-1d2a-41f8-91cc-aa03853a448b", "citation": "DIRECT RED 81 [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "35a1b18f-ccf0-9146-886d-836ef0c2aec3", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2610-11-9", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "f9c0818d-7f12-4509-eb7d-879e67100c33", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "6aa88825-2516-446a-a604-291de14ee4ea", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "ace85e20-0116-bc7d-1824-becd7d70028b", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true }, { "uuid": "c5a6c3e6-7bea-2653-f51b-4efc8f7c6ffb", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "54873ff4-0f14-5c99-913e-4027c91e1f78", "citation": "DAILYMED", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "d755f066-85d2-4b36-9cf0-26ad5145510a", "id": "d755f066-85d2-4b36-9cf0-26ad5145510a", "molfile": "\n Marvin 01132111102D \n\n 1 0 0 0 0 0 999 V2000\n 15.1324 -13.4844 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 1\nM END", "smiles": "[Na+]", "formula": "Na", "atropisomerism": "No", "charge": 1, "count": 2, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 2, "units": "MOL RATIO", "uuid": "bebcc939-fc0c-4f8c-8159-3a0d1403f7e6" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "22.9898", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "fc2d040b-d26a-49f2-a0f8-1603b6e7dd04", "id": "fc2d040b-d26a-49f2-a0f8-1603b6e7dd04", "molfile": "\n Marvin 01132113032D \n\n 44 48 0 0 0 0 999 V2000\n 13.7731 -13.4254 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7731 -12.5997 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6388 -12.5997 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9472 -12.5997 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7731 -11.7638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4937 -11.3084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4937 -10.5077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1944 -10.0722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1944 -9.2764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9450 -8.8361 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6908 -9.2764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4113 -8.8361 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6908 -10.0722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9951 -10.5077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9951 -11.3084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6908 -11.7638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4113 -11.3084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4113 -10.5077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4937 -8.8361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7731 -9.2764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7731 -10.0722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0623 -10.5077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3065 -10.0722 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 13.0623 -11.3084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3065 -11.7638 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3065 -12.5997 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5860 -12.9900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8702 -12.5997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1595 -12.9900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1595 -13.8158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8702 -14.1963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5860 -13.8158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4038 -14.2613 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4038 -15.1120 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6932 -15.4974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9873 -15.1120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2717 -15.4974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2717 -16.3482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9873 -16.7335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6932 -16.3482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5110 -16.7335 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0807 -16.0029 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 5.7653 -17.1840 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9364 -17.5193 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 2 0 0 0 0\n 2 4 2 0 0 0 0\n 5 2 1 0 0 0 0\n 6 5 1 0 0 0 0\n 5 24 2 0 0 0 0\n 7 6 2 0 0 0 0\n 7 8 1 0 0 0 0\n 7 21 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 9 19 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 11 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 18 2 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 17 16 2 0 0 0 0\n 18 17 1 0 0 0 0\n 20 19 2 0 0 0 0\n 21 20 1 0 0 0 0\n 21 22 2 0 0 0 0\n 22 23 1 0 0 0 0\n 22 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 2 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 27 32 2 0 0 0 0\n 28 29 2 0 0 0 0\n 29 30 1 0 0 0 0\n 31 30 2 0 0 0 0\n 30 33 1 0 0 0 0\n 32 31 1 0 0 0 0\n 33 34 2 0 0 0 0\n 34 35 1 0 0 0 0\n 35 36 1 0 0 0 0\n 35 40 2 0 0 0 0\n 36 37 2 0 0 0 0\n 37 38 1 0 0 0 0\n 39 38 2 0 0 0 0\n 38 41 1 0 0 0 0\n 40 39 1 0 0 0 0\n 41 42 1 0 0 0 0\n 41 43 2 0 0 0 0\n 41 44 2 0 0 0 0\nM CHG 2 23 -1 42 -1\nM END", "smiles": "c1ccc(cc1)C(=O)Nc2ccc3c(c2)cc(c(c3[O-])/N=N/c4ccc(cc4)/N=N/c5ccc(cc5)S(=O)(=O)[O-])S(=O)(=O)O", "formula": "C29H19N5O8S2", "atropisomerism": "No", "charge": -2, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "e3eecef2-50f6-4d0d-b77d-32387528d651" }, "defined_stereo": 0, "ez_centers": 2, "molecular_weight": "629.6231", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "be49bb07-fd8c-47ba-b977-3fd176ffdfe5", "version": "9", "structure": { "id": "c892f387-29ed-4fc4-90ce-ba8c61f92be6", "molfile": "\n Marvin 01132110222D \n\n 46 48 0 0 0 0 999 V2000\n 6.0807 -16.0029 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 5.7653 -17.1840 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9364 -17.5193 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5110 -16.7335 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2717 -16.3482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2717 -15.4974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9873 -16.7335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9873 -15.1120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6932 -16.3482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6932 -15.4974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4038 -15.1120 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4038 -14.2613 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1595 -13.8158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6908 -11.7638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1595 -12.9900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8702 -14.1963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9951 -11.3084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4113 -11.3084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8702 -12.5997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5860 -13.8158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9951 -10.5077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4113 -10.5077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5860 -12.9900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4113 -8.8361 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6908 -10.0722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3065 -12.5997 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6908 -9.2764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7731 -13.4254 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 14.6388 -12.5997 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9472 -12.5997 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3065 -11.7638 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9450 -8.8361 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7731 -12.5997 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4937 -8.8361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3065 -10.0722 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0623 -11.3084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1944 -9.2764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7731 -11.7638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7731 -9.2764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0623 -10.5077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1944 -10.0722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4937 -11.3084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7731 -10.0722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.4937 -10.5077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.1324 -13.4844 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 4.6953 -15.4820 0.0000 Na 0 3 0 0 0 0 0 0 0 0 0 0\n 6 5 2 0 0 0 0\n 15 13 2 0 0 0 0\n 17 14 2 0 0 0 0\n 37 34 1 0 0 0 0\n 38 36 2 0 0 0 0\n 4 1 1 0 0 0 0\n 4 2 2 0 0 0 0\n 4 3 2 0 0 0 0\n 5 4 1 0 0 0 0\n 7 5 1 0 0 0 0\n 8 6 1 0 0 0 0\n 9 7 2 0 0 0 0\n 10 8 2 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 2 0 0 0 0\n 13 12 1 0 0 0 0\n 16 13 1 0 0 0 0\n 18 14 1 0 0 0 0\n 19 15 1 0 0 0 0\n 20 16 2 0 0 0 0\n 21 17 1 0 0 0 0\n 22 18 2 0 0 0 0\n 23 19 2 0 0 0 0\n 23 20 1 0 0 0 0\n 25 21 2 0 0 0 0\n 25 22 1 0 0 0 0\n 26 23 1 0 0 0 0\n 27 24 2 0 0 0 0\n 27 25 1 0 0 0 0\n 31 26 2 0 0 0 0\n 32 27 1 0 0 0 0\n 33 28 1 0 0 0 0\n 33 29 2 0 0 0 0\n 33 30 2 0 0 0 0\n 36 31 1 0 0 0 0\n 37 32 1 0 0 0 0\n 38 33 1 0 0 0 0\n 39 34 2 0 0 0 0\n 40 35 1 0 0 0 0\n 40 36 1 0 0 0 0\n 41 37 2 0 0 0 0\n 42 38 1 0 0 0 0\n 43 39 1 0 0 0 0\n 43 40 2 0 0 0 0\n 44 41 1 0 0 0 0\n 44 42 2 0 0 0 0\n 44 43 1 0 0 0 0\nM CHG 4 1 -1 28 -1 45 1 46 1\nM END", "smiles": "c1ccc(cc1)C(=O)Nc2ccc3c(c2)cc(c(c3O)/N=N/c4ccc(cc4)/N=N/c5ccc(cc5)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+]", "formula": "C29H19N5O8S2.2Na", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 2, "molecular_weight": "675.6027", "optical_activity": "NONE", "references": [ "c001e6ac-2256-4089-80ef-e88926262247", "140f1278-a68b-4d72-ac62-14dbb4f66504" ], "stereo_centers": 0 }, "unii": "7E49Q56PNB" } ] }