{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "291872e2-dacb-42b2-a9d1-b16fd875d666",
          "code": "C03DB01",
          "comments": "ATC|CARDIOVASCULAR SYSTEM|DIURETICS|POTASSIUM-SPARING AGENTS|Other potassium-sparing agents|amiloride",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=C03DB01&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "70e96958-987d-4aca-8f5b-be80a96ea43c"
          ]
        },
        {
          "uuid": "7e204088-9095-42a5-8581-82d957da1344",
          "code": "N0000175418",
          "comments": "Established Pharmacologic Class [EPC]|Potassium-sparing Diuretic [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175418",
          "code_system": "NDF-RT",
          "references": [
            "70e96958-987d-4aca-8f5b-be80a96ea43c"
          ]
        },
        {
          "uuid": "0c80734a-f2c4-4470-ada4-6d7595d719ca",
          "code": "N0000008859",
          "comments": "Physiological Effects [PE]|Organ System Specific Effects [PE]|Renal/Urological Activity Alteration [PE]|Renal Ion Transport Alteration [PE]|Decreased Renal Ion Excretion [PE]|Decreased Renal K+ Excretion [PE]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000008859",
          "code_system": "NDF-RT",
          "references": [
            "70e96958-987d-4aca-8f5b-be80a96ea43c"
          ]
        },
        {
          "uuid": "e531dd54-800a-42fd-b2e8-d13179ae724c",
          "code": "N0000175359",
          "comments": "Physiological Effects [PE]|Organ System Specific Effects [PE]|Renal/Urological Activity Alteration [PE]|Diuresis Alteration [PE]|Increased Diuresis [PE]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175359",
          "code_system": "NDF-RT",
          "references": [
            "70e96958-987d-4aca-8f5b-be80a96ea43c"
          ]
        },
        {
          "uuid": "46be9b12-9f53-471c-b85e-d5de1b408050",
          "code": "QC03DB01",
          "comments": "VATC|DIURETICS|POTASSIUM-SPARING AGENTS|Other potassium-sparing agents|amiloride",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QC03DB01&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "70e96958-987d-4aca-8f5b-be80a96ea43c"
          ]
        },
        {
          "uuid": "fcf9c769-ec05-4eb7-85f5-f43804362338",
          "code": "2609-46-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2609-46-3",
          "code_system": "CAS",
          "references": [
            "70e96958-987d-4aca-8f5b-be80a96ea43c",
            "cc5a2523-5308-477e-b5fd-46a92708f15b"
          ]
        },
        {
          "uuid": "cd742185-4e9d-4a4a-9bd6-5fe38777579f",
          "code": "C61633",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C61633",
          "code_system": "NCI_THESAURUS",
          "references": [
            "70e96958-987d-4aca-8f5b-be80a96ea43c"
          ]
        },
        {
          "uuid": "95d557eb-3141-4725-ac4f-f0fdfad3c6b3",
          "code": "NBK547934",
          "comments": "LiverTox|Cardiac|Diuretic|Potassium sparing diuretic",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/NBK547934/",
          "code_system": "LIVERTOX",
          "references": [
            "0931980c-2b51-8157-c7bc-45942f9a8a43"
          ]
        },
        {
          "uuid": "216759cc-e3ff-4814-8c07-5f917044d0b0",
          "code": "D000584",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68000584",
          "code_system": "MESH",
          "references": [
            "70e96958-987d-4aca-8f5b-be80a96ea43c"
          ]
        },
        {
          "uuid": "85e48646-1fbb-44c4-9f46-58755d63a036",
          "code": "16",
          "comments": "WHO ESSENTIAL MEDICINES LIST|Diuretics",
          "type": "PRIMARY",
          "url": "http://prais.paho.org/medicine/257/?section=109#type609",
          "code_system": "WHO-ESSENTIAL MEDICINES LIST",
          "references": [
            "70e96958-987d-4aca-8f5b-be80a96ea43c"
          ]
        },
        {
          "uuid": "d7c755e5-c5a8-4776-8ff1-337b8313d4b2",
          "code": "SUB05433MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "70e96958-987d-4aca-8f5b-be80a96ea43c"
          ]
        },
        {
          "uuid": "dc6fb5d8-d8af-4d1d-95df-7e68f4e354b0",
          "code": "2352",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2352",
          "code_system": "INN",
          "references": [
            "70e96958-987d-4aca-8f5b-be80a96ea43c"
          ]
        },
        {
          "uuid": "03ad4aab-8a2a-4c84-ab87-5f47d10886ce",
          "code": "2421",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=2421",
          "code_system": "IUPHAR",
          "references": [
            "70e96958-987d-4aca-8f5b-be80a96ea43c"
          ]
        },
        {
          "uuid": "424d80dd-2436-4ee3-999a-7649821c0aba",
          "code": "644",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/644/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "70e96958-987d-4aca-8f5b-be80a96ea43c"
          ]
        },
        {
          "uuid": "d86ac5f3-ed62-473f-a380-9ec43beca51d",
          "code": "m1671",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m1671?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "70e96958-987d-4aca-8f5b-be80a96ea43c"
          ]
        },
        {
          "uuid": "630226f6-339f-414e-975d-155646c2b5ce",
          "code": "CHEMBL945",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL945",
          "code_system": "ChEMBL",
          "references": [
            "70e96958-987d-4aca-8f5b-be80a96ea43c"
          ]
        },
        {
          "uuid": "ae3fca4d-6c94-442a-ae2a-da7137d08ec9",
          "code": "16231",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/16231",
          "code_system": "PUBCHEM",
          "references": [
            "70e96958-987d-4aca-8f5b-be80a96ea43c"
          ]
        },
        {
          "uuid": "a9491812-d7db-4295-84bd-e4a7daa741f4",
          "code": "220-024-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.018.205",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "70e96958-987d-4aca-8f5b-be80a96ea43c"
          ]
        },
        {
          "uuid": "a3b118d0-785e-4c55-a653-c37fc1891b8d",
          "code": "7DZO8EB0Z3",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e00ea6fe-ebb1-0e29-261d-01f6cfc85f3c",
          "code": "Amiloride",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Amiloride",
          "code_system": "WIKIPEDIA",
          "references": [
            "ecfe0226-47e8-d84d-b11a-a6e964fe2558"
          ]
        },
        {
          "uuid": "90996b36-f6e7-13dd-38d4-657595202421",
          "code": "DTXSID9043853",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9043853",
          "code_system": "EPA CompTox",
          "references": [
            "15a9db9f-e55f-6135-4db6-30c1a57836e1"
          ]
        },
        {
          "uuid": "e004238e-292b-9ae3-960a-de6c6c2f8063",
          "code": "C582",
          "comments": "Pharmacologic Substance[C1909]|Antineoplastic Agent[C274]|DNA Binding Agent[C2842]|DNA Intercalating Agent",
          "codeText": "Pharmacologic Substance[C1909]|Antineoplastic Agent[C274]|DNA Binding Agent[C2842]|DNA Intercalating Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C582",
          "code_system": "NCI_THESAURUS",
          "references": [
            "0931980c-2b51-8157-c7bc-45942f9a8a43"
          ]
        },
        {
          "uuid": "11aa828c-d420-102c-1e5f-5fcee4965176",
          "code": "C49186",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Blood or Body Fluid[C78275]|Diuretic[C448]|Potassium-Sparing Diuretic",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C49186",
          "code_system": "NCI_THESAURUS",
          "references": [
            "0931980c-2b51-8157-c7bc-45942f9a8a43"
          ]
        },
        {
          "uuid": "1e861583-52f0-a08a-ecb1-fd850b182db7",
          "code": "Amiloride",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM1356/",
          "code_system": "LACTMED",
          "references": [
            "0931980c-2b51-8157-c7bc-45942f9a8a43"
          ]
        },
        {
          "uuid": "90251712-52ed-b362-64c9-cce316dce481",
          "code": "158",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/158",
          "code_system": "DRUG CENTRAL",
          "references": [
            "0931980c-2b51-8157-c7bc-45942f9a8a43"
          ]
        },
        {
          "uuid": "9664fbe9-fe02-47bd-9af9-c06521aa7e2c",
          "code": "DB00594",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00594",
          "code_system": "DRUG BANK",
          "references": [
            "0931980c-2b51-8157-c7bc-45942f9a8a43"
          ]
        },
        {
          "uuid": "7a0c6400-4844-a89a-19d0-ce8332ea7ca7",
          "code": "2639",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:2639",
          "code_system": "CHEBI",
          "references": [
            "0931980c-2b51-8157-c7bc-45942f9a8a43"
          ]
        },
        {
          "uuid": "5236b197-3a7c-820f-c9e2-96a33484eaa3",
          "code": "100000087224",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "501f7e85-2340-4826-0454-7b53835776db"
          ]
        },
        {
          "uuid": "ecb50802-1e16-413d-fdc7-c75daeb4678c",
          "code": "7DZO8EB0Z3",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=7DZO8EB0Z3",
          "code_system": "DAILYMED",
          "references": [
            "b655ce42-a955-ca1a-ef3d-a17122940c5c"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "da81a6ce-b4c8-4f85-bf42-0b3f4ab63238",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "6bc8341d-7d1b-4b24-9009-b628c9f90d77",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "55425482-1e9e-4e0b-a38e-a756fcef8cfd",
          "citation": "INN Proposed List 18",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL18.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fdc09e02-ae85-47c4-95eb-56cbb0d259e6",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b19933d3-1964-454e-8dcd-5a925a6b0482",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5cfdc01d-62ae-47a9-a2d4-badd343fa4f7",
          "citation": "D07447",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4320a865-f24a-4fcf-b619-fdefabbcda60",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6fc6ff2a-9b6d-43a4-8a5b-116179c63808",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "70e96958-987d-4aca-8f5b-be80a96ea43c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389713000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "16fc08f4-10b9-48b8-b507-91bbd4167875",
          "citation": "SRS import [7DZO8EB0Z3]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7DZO8EB0Z3",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389713000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1a3651b6-dd08-4fd7-bbd7-cb3cc1b0be17",
          "citation": "AMILORIDE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3246dd0c-e1f4-4b88-a780-dfe7277d1404",
          "citation": "AMILORIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1487c6fb-5903-47dc-b6e5-c2d9981757b9",
          "citation": "AMILORIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "da6ed7e9-2a3d-4ff3-8d17-10d5572f512e",
          "citation": "AMILORIDE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ecfe0226-47e8-d84d-b11a-a6e964fe2558",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Amiloride",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "15a9db9f-e55f-6135-4db6-30c1a57836e1",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2609-46-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "334688e2-c595-82b7-9051-10a8bebaf264",
          "citation": "http://fco.factsandcomparisons.com/lco/action/doc/retrieve/docid/fc_dfc/5548981#f_pharmacokinetics",
          "doc_type": "LEPINDEX",
          "public_domain": true
        },
        {
          "uuid": "0931980c-2b51-8157-c7bc-45942f9a8a43",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "cc5a2523-5308-477e-b5fd-46a92708f15b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b655ce42-a955-ca1a-ef3d-a17122940c5c",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "6cfc1d58-aca6-6d3c-a60d-028ce5f6567b",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "501f7e85-2340-4826-0454-7b53835776db",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "369b158a-dc68-461d-a8b9-5312fb3f9713",
          "id": "369b158a-dc68-461d-a8b9-5312fb3f9713",
          "molfile": "\n  Marvin  01132102542D          \n\n 15 15  0  0  0  0            999 V2000\n    3.8080   -6.7466    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8106   -5.9210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5252   -5.5057    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1063   -5.5082    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3865   -5.9210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3813   -6.7363    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6744   -5.4979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6847   -4.6749    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9649   -4.2621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9701   -3.4391    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.2477   -4.6697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4541   -4.2647    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2503   -5.4953    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9571   -5.9055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9675   -6.7311    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  2  0  0  0  0\n  5  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n 14  7  2  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11  9  1  0  0  0  0\n 12 11  1  0  0  0  0\n 11 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 15 14  1  0  0  0  0\nM  END",
          "smiles": "c1(c(N)nc(c(Cl)n1)N)C(=O)NC(=N)N",
          "formula": "C6H8ClN7O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "70e62a93-999f-4483-bfaf-7daece28e434"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "229.6272",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ecfffcc0-2253-4d84-a45a-4dd1639f1dba",
      "version": "21",
      "structure": {
        "id": "fc57b6ac-1385-45aa-8bfc-ab4b98139b08",
        "molfile": "\n  Marvin  01132113042D          \n\n 15 15  0  0  0  0            999 V2000\n    1.6744   -5.4979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6847   -4.6749    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2503   -5.4953    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3865   -5.9210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9571   -5.9055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1063   -5.5082    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9649   -4.2621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2477   -4.6697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8106   -5.9210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8080   -6.7466    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3813   -6.7363    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9675   -6.7311    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4541   -4.2647    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5252   -5.5057    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9701   -3.4391    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  5  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  1  2  0  0  0  0\n  6  4  1  0  0  0  0\n  7  2  2  0  0  0  0\n  8  3  2  0  0  0  0\n  9  6  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11  4  2  0  0  0  0\n 12  5  1  0  0  0  0\n 13  8  1  0  0  0  0\n 14  9  1  0  0  0  0\n 15  7  1  0  0  0  0\n  8  7  1  0  0  0  0\nM  END",
        "smiles": "c1(c(N)nc(c(Cl)n1)N)C(=O)NC(=N)N",
        "formula": "C6H8ClN7O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "229.6272",
        "optical_activity": "NONE",
        "references": [
          "16fc08f4-10b9-48b8-b507-91bbd4167875",
          "da81a6ce-b4c8-4f85-bf42-0b3f4ab63238",
          "55425482-1e9e-4e0b-a38e-a756fcef8cfd"
        ],
        "stereo_centers": 0
      },
      "unii": "7DZO8EB0Z3",
      "relationships": [
        {
          "uuid": "da2239ec-52bf-4357-bfb2-1d07dcd322fd",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "a99616c4-0fd9-47d6-a0ad-21314d17a81a",
            "refuuid": "ecfffcc0-2253-4d84-a45a-4dd1639f1dba",
            "name": "AMILORIDE",
            "unii": "7DZO8EB0Z3",
            "linking_id": "7DZO8EB0Z3",
            "ref_pname": "AMILORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "aa9659f6-1216-468b-b065-ed2ae5a193e6",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "74775378-d99b-432a-ac0e-240d5b3a8dc9",
            "refuuid": "96a7b6f3-dff4-4b9a-a0e3-3bace8a3e6b2",
            "name": "AMILORIDE HYDROCHLORIDE",
            "unii": "FZJ37245UC",
            "linking_id": "FZJ37245UC",
            "ref_pname": "AMILORIDE HYDROCHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d3d5c0a2-3b96-4188-b6cf-d4fbf08b8c31",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "fb3de008-0698-4147-975f-ce82766114ba",
            "refuuid": "03fe1c22-7a86-4cef-b23b-582a523cf185",
            "name": "AMILORIDE HYDROCHLORIDE ANHYDROUS",
            "unii": "7M458Q65S3",
            "linking_id": "7M458Q65S3",
            "ref_pname": "AMILORIDE HYDROCHLORIDE ANHYDROUS",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "822498b1-579f-49ef-9414-a594cc1a8a3b",
          "amount": {
            "uuid": "9015794a-a8c8-48ff-97e1-c1bea8a206e1"
          },
          "type": "TARGET->INHIBITOR",
          "related_substance": {
            "uuid": "15a468a3-6a1d-430a-a415-31717a193367",
            "refuuid": "76242922-ae46-4db4-9b5a-d0a839ceb020",
            "name": "ACID-SENSING ION CHANNEL 3",
            "unii": "Q3MD3R8161",
            "linking_id": "Q3MD3R8161",
            "ref_pname": "ACID-SENSING ION CHANNEL 3"
          }
        }
      ],
      "names": [
        {
          "uuid": "45832c26-8064-4603-8077-0c32a1168e45",
          "name": "AMICLARAN",
          "stdName": "AMICLARAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5cfdc01d-62ae-47a9-a2d4-badd343fa4f7",
            "b19933d3-1964-454e-8dcd-5a925a6b0482"
          ],
          "display_name": false
        },
        {
          "uuid": "3e39fde7-8e7f-4307-84f5-733bad381910",
          "name": "AMILORIDE",
          "stdName": "AMILORIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4320a865-f24a-4fcf-b619-fdefabbcda60",
            "55425482-1e9e-4e0b-a38e-a756fcef8cfd",
            "6fc6ff2a-9b6d-43a4-8a5b-116179c63808",
            "da6ed7e9-2a3d-4ff3-8d17-10d5572f512e",
            "da81a6ce-b4c8-4f85-bf42-0b3f4ab63238",
            "fdc09e02-ae85-47c4-95eb-56cbb0d259e6",
            "1487c6fb-5903-47dc-b6e5-c2d9981757b9",
            "1a3651b6-dd08-4fd7-bbd7-cb3cc1b0be17",
            "3246dd0c-e1f4-4b88-a780-dfe7277d1404"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "d6eec32d-67d7-4ad6-bc64-79a5bb981437",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "396f9565-079d-42c7-a545-245768308181",
          "name": "AMILORIDE [MI]",
          "stdName": "AMILORIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fdc09e02-ae85-47c4-95eb-56cbb0d259e6"
          ],
          "display_name": false
        },
        {
          "uuid": "b747d11e-3e6b-4a6d-a7fd-6a901726affa",
          "name": "AMILORIDE [VANDF]",
          "stdName": "AMILORIDE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6fc6ff2a-9b6d-43a4-8a5b-116179c63808"
          ],
          "display_name": false
        },
        {
          "uuid": "691491d9-2ca6-80cc-c876-30f2fddb6cb7",
          "name": "Amiloride [WHO-DD]",
          "stdName": "AMILORIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6cfc1d58-aca6-6d3c-a60d-028ce5f6567b"
          ],
          "display_name": false
        },
        {
          "uuid": "7dc84dd9-91ee-4b61-ac3e-78441b46fbb2",
          "name": "N-AMIDINO-3,5-DIAMINO-6-CHLOROPYRAZINECARBOXAMIDE",
          "stdName": "N-AMIDINO-3,5-DIAMINO-6-CHLOROPYRAZINECARBOXAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6bc8341d-7d1b-4b24-9009-b628c9f90d77"
          ],
          "display_name": false
        },
        {
          "uuid": "f5df3c66-08c1-43fb-a6b3-192fae96b5b8",
          "name": "PYRAZINECARBOXAMIDE, 3,5-DIAMINO-N-(AMINOIMINOMETHYL)-6-CHLORO-",
          "stdName": "PYRAZINECARBOXAMIDE, 3,5-DIAMINO-N-(AMINOIMINOMETHYL)-6-CHLORO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6bc8341d-7d1b-4b24-9009-b628c9f90d77"
          ],
          "display_name": false
        },
        {
          "uuid": "8cc2b393-1f15-4027-a20f-4adae4043286",
          "name": "amiloride [INN]",
          "stdName": "AMILORIDE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "55425482-1e9e-4e0b-a38e-a756fcef8cfd"
          ],
          "display_name": false
        }
      ],
      "properties": [
        {
          "uuid": "860ff233-9f05-4a1a-9049-1c9623b9777f",
          "name": "Biological Half-life",
          "value": {
            "uuid": "c720a43a-fbf3-42a9-806f-eda339c3be60",
            "high": 9,
            "low": 6,
            "units": "hours"
          },
          "defining": false,
          "property_type": "PHARMACOKINETIC",
          "references": [
            "334688e2-c595-82b7-9051-10a8bebaf264"
          ]
        },
        {
          "uuid": "8be16a20-19cf-4189-8388-c5ff675a3a0a",
          "name": "Volume of Distribution",
          "value": {
            "uuid": "2aa36d5b-94f1-4054-9aa7-ae05b044348a",
            "high": 5.43,
            "low": 5,
            "units": "Liters/Kilogram"
          },
          "defining": false,
          "property_type": "PHARMACOKINETIC",
          "references": [
            "334688e2-c595-82b7-9051-10a8bebaf264"
          ]
        }
      ]
    }
  ]
}