{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "dd9cf351-8996-47a6-810a-7b64be3c446b",
          "code": "58-19-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=58-19-5",
          "code_system": "CAS",
          "references": [
            "8cbbf6d9-f347-42b1-a517-59c4428051a9",
            "22f15b13-0fc4-430b-ba7c-2368e6f61c86"
          ]
        },
        {
          "uuid": "38cf14ae-8f57-40c4-9218-df0fb9ca0442",
          "code": "C1076",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1076",
          "code_system": "NCI_THESAURUS",
          "references": [
            "8cbbf6d9-f347-42b1-a517-59c4428051a9"
          ]
        },
        {
          "uuid": "93a8ec15-83f9-43ea-8c11-a5ae335396e1",
          "code": "C100263",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67100263",
          "code_system": "MESH",
          "references": [
            "8cbbf6d9-f347-42b1-a517-59c4428051a9"
          ]
        },
        {
          "uuid": "9e3da592-1a89-47f8-869b-f40d2fd8453d",
          "code": "SUB06414MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "8cbbf6d9-f347-42b1-a517-59c4428051a9"
          ]
        },
        {
          "uuid": "a5ede55b-49d8-44cf-a2d1-bd8d44f705f2",
          "code": "1159",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1159",
          "code_system": "INN",
          "references": [
            "8cbbf6d9-f347-42b1-a517-59c4428051a9"
          ]
        },
        {
          "uuid": "ec1c70ba-0844-4508-92ca-0aabbeb69edb",
          "code": "200-367-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.334",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "8cbbf6d9-f347-42b1-a517-59c4428051a9"
          ]
        },
        {
          "uuid": "e6631ebf-e112-4891-87e9-80d9bc7f1072",
          "code": "4000",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule III.|Anabolic Steroids",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "8cbbf6d9-f347-42b1-a517-59c4428051a9"
          ]
        },
        {
          "uuid": "8b58792d-984e-43dd-8f09-85a479946115",
          "code": "23678",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/23678/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "8cbbf6d9-f347-42b1-a517-59c4428051a9"
          ]
        },
        {
          "uuid": "1821d12a-de2b-4b71-8e2d-ceaab1e1a815",
          "code": "m4767",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4767?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "8cbbf6d9-f347-42b1-a517-59c4428051a9"
          ]
        },
        {
          "uuid": "9b8ccc0c-8019-49bc-8c30-9f037629689f",
          "code": "DB00858",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00858",
          "code_system": "DRUG BANK",
          "references": [
            "8cbbf6d9-f347-42b1-a517-59c4428051a9"
          ]
        },
        {
          "uuid": "de5eb2e5-e05e-4ca9-ac61-1c53141df788",
          "code": "CHEMBL1201048",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1201048",
          "code_system": "ChEMBL",
          "references": [
            "8cbbf6d9-f347-42b1-a517-59c4428051a9"
          ]
        },
        {
          "uuid": "905bdcec-3455-43b0-8561-8d39c53ae81c",
          "code": "6011",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6011",
          "code_system": "PUBCHEM",
          "references": [
            "8cbbf6d9-f347-42b1-a517-59c4428051a9"
          ]
        },
        {
          "uuid": "136a51ee-863a-b2a2-81a6-a7c8ec62c6a1",
          "code": "Drostanolone",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Drostanolone",
          "code_system": "WIKIPEDIA",
          "references": [
            "4928b307-776f-65d6-d38a-50c745d8ba6c"
          ]
        },
        {
          "uuid": "660ad4bf-d15e-fc24-804f-2864a18c1074",
          "code": "3319",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3319",
          "code_system": "HSDB",
          "references": [
            "215d17ae-1bde-cc59-ffdf-471cee5d895d"
          ]
        },
        {
          "uuid": "55ad3f78-0695-5951-d1af-2fb5150ef1b9",
          "code": "DTXSID6022971",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6022971",
          "code_system": "EPA CompTox",
          "references": [
            "74a1132e-6d57-f838-d831-df0a8980140a"
          ]
        },
        {
          "uuid": "9c311aad-36a9-3e4d-24cb-916b3e9bf464",
          "code": "C2360",
          "comments": "Pharmacologic Substance[C1909]|Hormone Therapy Agent[C147908]|Therapeutic Hormone[C548]|Anabolic Steroid",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2360",
          "code_system": "NCI_THESAURUS",
          "references": [
            "36a6bc03-f23e-a5ef-9eda-fa4155b5f7f3"
          ]
        },
        {
          "uuid": "4b2ef336-c089-540b-2a8c-672fe4934ba2",
          "code": "C243",
          "comments": "Pharmacologic Substance[C1909]|Hormone Therapy Agent[C147908]|Therapeutic Hormone[C548]|Therapeutic Steroid Hormone[C1636]|Therapeutic Androgen",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C243",
          "code_system": "NCI_THESAURUS",
          "references": [
            "36a6bc03-f23e-a5ef-9eda-fa4155b5f7f3"
          ]
        },
        {
          "uuid": "4159ec03-495a-4697-a501-18c0c96172d3",
          "code": "7DR7H00HDT",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "dc78d343-4763-19f6-bfb9-83e673fc5437",
          "code": "34838",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:34838",
          "code_system": "CHEBI",
          "references": [
            "36a6bc03-f23e-a5ef-9eda-fa4155b5f7f3"
          ]
        },
        {
          "uuid": "cbde70ef-59b9-ab77-89bf-0dfe86c0e7d9",
          "code": "Designer-drugs-Drostanolone",
          "comments": "Wikipedia|List of designer drugs|Androgens|DHT based",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/List_of_designer_drugs",
          "code_system": "WIKIPEDIA",
          "references": [
            "36a6bc03-f23e-a5ef-9eda-fa4155b5f7f3"
          ]
        },
        {
          "uuid": "b43497f1-1e6d-8647-0fee-08cf97cef937",
          "code": "100000081008",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "331f86d4-3952-cb6a-600c-e0f3fc5d7996"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "ee06db95-2c60-4893-8506-302782aa4762",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "82466c89-5e7f-4e07-9526-90fdf0b58c33",
            "refuuid": "2126a4b8-3a6a-49b3-b0ed-3c2bd74ffad0",
            "name": "DROMOSTANOLONE",
            "unii": "7DR7H00HDT",
            "linking_id": "7DR7H00HDT",
            "ref_pname": "DROMOSTANOLONE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c476cb86-0132-4338-a9f0-881ead890a75",
          "name": "(2.ALPHA.,5.ALPHA.,17.BETA.)-17-HYDROXY-2-METHYLANDROSTAN-3-ONE",
          "stdName": "(2.ALPHA.,5.ALPHA.,17.BETA.)-17-HYDROXY-2-METHYLANDROSTAN-3-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5b9809be-49f8-c601-14d0-699e46087c89"
          ],
          "display_name": false
        },
        {
          "uuid": "56a7d381-8257-48b1-903b-12d5e6573734",
          "name": "ANDROSTAN-3-ONE, 17-HYDROXY-2-METHYL-, (2.ALPHA.,5.ALPHA.,17.BETA.)-",
          "stdName": "ANDROSTAN-3-ONE, 17-HYDROXY-2-METHYL-, (2.ALPHA.,5.ALPHA.,17.BETA.)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5b9809be-49f8-c601-14d0-699e46087c89"
          ],
          "display_name": false
        },
        {
          "uuid": "39b22d3e-3ab8-4d37-a94b-699710912d1c",
          "name": "DROMOSTANOLONE",
          "stdName": "DROMOSTANOLONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f972d605-2b99-40d2-8b19-766d70e496f8",
            "bebc7e21-5c37-438b-b333-168961609e5a",
            "82a76acc-660f-46c5-848f-dded44385af2"
          ],
          "display_name": true
        },
        {
          "uuid": "fc036813-3441-4bbd-a771-c17a05fc2460",
          "name": "DROMOSTANOLONE [MI]",
          "stdName": "DROMOSTANOLONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f972d605-2b99-40d2-8b19-766d70e496f8"
          ],
          "display_name": false
        },
        {
          "uuid": "92d9e16a-24f9-4769-af18-13074dbab6f1",
          "name": "DROSTANOLONE",
          "stdName": "DROSTANOLONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "abcf61d9-d6b0-4efc-9448-0ee0670022b9",
            "c04b61d8-08ea-4c16-9cbb-20019c7244b2",
            "e1e01466-59d1-4591-b033-30b04f8bffa2",
            "fc93fc17-f910-4cdb-931a-dc6486212730",
            "32073e75-3bd6-4738-8318-a7ecc82f7961",
            "c4328fa4-2ac2-49ce-b5cd-f4f24a62c458",
            "bc117b17-314e-4d80-9f0b-0f66772ec762"
          ],
          "display_name": false,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "01843c86-0428-48a6-968c-331f4afc8be9",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "161ffd38-e348-487b-901a-bfb411193121",
          "name": "DROSTANOLONE [HSDB]",
          "stdName": "DROSTANOLONE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e1e01466-59d1-4591-b033-30b04f8bffa2"
          ],
          "display_name": false
        },
        {
          "uuid": "d3ec0c18-c573-ddf5-7a0a-f5a28fe401de",
          "name": "Drostanolone [WHO-DD]",
          "stdName": "DROSTANOLONE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d55521a5-75c1-977f-aaf5-e266b00c44d3"
          ],
          "display_name": false
        },
        {
          "uuid": "3f31a367-be9a-4159-93ba-f0ebb6b97be4",
          "name": "drostanolone [INN]",
          "stdName": "DROSTANOLONE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c04b61d8-08ea-4c16-9cbb-20019c7244b2"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f972d605-2b99-40d2-8b19-766d70e496f8",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e1e01466-59d1-4591-b033-30b04f8bffa2",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "abcf61d9-d6b0-4efc-9448-0ee0670022b9",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8cbbf6d9-f347-42b1-a517-59c4428051a9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390734000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e4d4ca24-0d80-4aec-b5b8-1af5d43f96da",
          "citation": "SRS import [7DR7H00HDT]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7DR7H00HDT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390734000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fc93fc17-f910-4cdb-931a-dc6486212730",
          "citation": "DROSTANOLONE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bebc7e21-5c37-438b-b333-168961609e5a",
          "citation": "DROMOSTANOLONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "32073e75-3bd6-4738-8318-a7ecc82f7961",
          "citation": "DROSTANOLONE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c4328fa4-2ac2-49ce-b5cd-f4f24a62c458",
          "citation": "DROSTANOLONE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "82a76acc-660f-46c5-848f-dded44385af2",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e1b8992c-9e94-45c2-8cfc-5a15c3f1161e",
          "citation": "ACD9.0(USAN 2006)",
          "doc_type": "ACD",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bc117b17-314e-4d80-9f0b-0f66772ec762",
          "citation": "EMEA 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c04b61d8-08ea-4c16-9cbb-20019c7244b2",
          "citation": "INN Proposed List 13",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL13.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4928b307-776f-65d6-d38a-50c745d8ba6c",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Methyltestosterone",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "215d17ae-1bde-cc59-ffdf-471cee5d895d",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+58-19-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "74a1132e-6d57-f838-d831-df0a8980140a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=58-19-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5b9809be-49f8-c601-14d0-699e46087c89",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "331f86d4-3952-cb6a-600c-e0f3fc5d7996",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "36a6bc03-f23e-a5ef-9eda-fa4155b5f7f3",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "22f15b13-0fc4-430b-ba7c-2368e6f61c86",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d55521a5-75c1-977f-aaf5-e266b00c44d3",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d56b1eb9-5c3d-4cc6-ad95-646598434987",
          "id": "d56b1eb9-5c3d-4cc6-ad95-646598434987",
          "molfile": "\n  Marvin  01132111032D          \n\n 22 25  0  0  1  0            999 V2000\n    5.8913   -0.0334    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.1457    0.7656    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3768   -0.6912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8913   -1.3514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1001   -1.1074    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    4.3909   -1.5159    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    4.3909   -2.3458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6716   -2.7619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9701   -2.3458    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    2.2481   -2.7619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5313   -2.3458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8196   -2.7619    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5313   -1.5159    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    0.8196   -1.1074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2481   -1.1074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9701   -1.5159    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    2.9701   -0.6912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6716   -1.1074    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    3.6716   -0.2826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3909    0.1336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1001   -0.2826    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.1078    0.5189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n 21  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  1  0  0  0\n  6  5  1  0  0  0  0\n  5 21  1  0  0  0  0\n  6  7  1  6  0  0  0\n  6 18  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  1  0  0  0\n 16  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 11  1  0  0  0  0\n 13 14  1  6  0  0  0\n 13 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  1  0  0  0\n 18 16  1  0  0  0  0\n 18 19  1  1  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 21 22  1  1  0  0  0\nM  END",
          "smiles": "C[C@@H]1C[C@@]2(C)[C@@H](CC[C@H]3[C@@H]4CC[C@@H]([C@@]4(C)CC[C@@H]32)O)CC1=O",
          "formula": "C20H32O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4148ca33-1987-463a-91e5-abfe744e422e"
          },
          "defined_stereo": 8,
          "ez_centers": 0,
          "molecular_weight": "304.4676",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 8
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "2126a4b8-3a6a-49b3-b0ed-3c2bd74ffad0",
      "version": "16",
      "structure": {
        "id": "1e7357ae-c71b-4f46-a1fd-a4d6f2e4831f",
        "molfile": "\n  Marvin  01132101452D          \n\n 26 29  0  0  1  0            999 V2000\n    2.9705   -1.5161    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.1007   -0.2827    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.6720   -1.1075    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.1007   -1.1075    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.3915   -1.5161    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.2484   -1.1075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9705   -2.3461    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    1.5315   -2.3461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3915    0.1336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6720   -0.2827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2484   -2.7623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5315   -1.5161    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.3915   -2.3461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8921   -1.3516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8921   -0.0334    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.6720   -2.7623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8197   -2.7623    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3777   -0.6913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9705   -0.6913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1084    0.5190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1465    0.7657    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8197   -1.1075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9268   -3.1246    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6977   -1.8784    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1084   -1.8861    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3889   -0.6990    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  9  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  3  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  1  1  0  0  0  0\n  8 11  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10  3  1  0  0  0  0\n 11  7  1  0  0  0  0\n 12  6  1  0  0  0  0\n 13 16  1  0  0  0  0\n 14  4  1  0  0  0  0\n 15  2  1  0  0  0  0\n 16  7  1  0  0  0  0\n 17  8  2  0  0  0  0\n 18 14  1  0  0  0  0\n  1 19  1  1  0  0  0\n  2 20  1  1  0  0  0\n 15 21  1  1  0  0  0\n 12 22  1  6  0  0  0\n  7 23  1  6  0  0  0\n  3 24  1  6  0  0  0\n  4 25  1  6  0  0  0\n  5 26  1  1  0  0  0\n 12  8  1  0  0  0  0\n  5 13  1  0  0  0  0\n  2  4  1  0  0  0  0\n 15 18  1  0  0  0  0\nM  END",
        "smiles": "C[C@@H]1C[C@@]2(C)[C@@]([H])(CC[C@@]3([H])[C@]4([H])CC[C@@H]([C@@]4(C)CC[C@@]32[H])O)CC1=O",
        "formula": "C20H32O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 8,
        "ez_centers": 0,
        "molecular_weight": "304.4676",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "e4d4ca24-0d80-4aec-b5b8-1af5d43f96da",
          "82a76acc-660f-46c5-848f-dded44385af2",
          "c04b61d8-08ea-4c16-9cbb-20019c7244b2"
        ],
        "stereo_centers": 8
      },
      "unii": "7DR7H00HDT"
    }
  ]
}