{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "de051992-ce69-4129-ab04-e176dbc9256d",
          "code": "872182-46-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=872182-46-2",
          "code_system": "CAS",
          "references": [
            "8f300a3a-f888-4bb0-b77d-3c58362cba34",
            "24acbb30-3be6-4807-9e59-d69b342b15df"
          ]
        },
        {
          "uuid": "aba32ee3-7e84-41f6-a5f0-927251ae64ef",
          "code": "1313226",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1313226/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "8f300a3a-f888-4bb0-b77d-3c58362cba34"
          ]
        },
        {
          "uuid": "af0e3c28-800d-464d-94f3-8a9af1e96226",
          "code": "11961068",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11961068",
          "code_system": "PUBCHEM",
          "references": [
            "8f300a3a-f888-4bb0-b77d-3c58362cba34"
          ]
        },
        {
          "uuid": "227767cb-1505-452c-9415-57ac7d67ed77",
          "code": "7D4Q5YJ8NV",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e98d67bb-d307-3029-29fa-2fffc01cd602",
          "code": "DTXSID401007429",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID401007429",
          "code_system": "EPA CompTox",
          "references": [
            "ddc891bf-9928-a2d4-d878-0bd51cbf8021"
          ]
        },
        {
          "uuid": "1fb45923-d745-da43-46d3-3d76b6913467",
          "code": "7D4Q5YJ8NV",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=7D4Q5YJ8NV",
          "code_system": "DAILYMED",
          "references": [
            "2df48378-99fe-a38b-5dca-b20b64beabd8"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "616f2d65-2e1c-4eb3-a95e-f56ba2716818",
          "name": "(±)-BIS-ETHYLHEXYL HYDROXYDIMETHOXY BENZYLMALONATE",
          "stdName": "(+/-)-BIS-ETHYLHEXYL HYDROXYDIMETHOXY BENZYLMALONATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f5ba1bb9-1909-40c9-8e5f-461acd1e4454",
            "9a216907-d861-47ea-b355-180158551e8f"
          ],
          "display_name": false
        },
        {
          "uuid": "41781f62-1856-421d-af58-358dd139124c",
          "name": "BIS-ETHYLHEXYL HYDROXYDIMETHOXY BENZYLMALONATE",
          "stdName": "BIS-ETHYLHEXYL HYDROXYDIMETHOXY BENZYLMALONATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9a216907-d861-47ea-b355-180158551e8f",
            "4fc14af4-89f1-4482-87ae-72e545e9ee16",
            "84d01f17-07e3-4973-a284-9b53c0a1eb00"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "0da68b3a-7e9d-46ff-b87f-3421a02e28da",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "41cc1338-052f-4e61-978f-51723b2228fd",
          "name": "PROPANEDIOIC ACID, ((4-HYDROXY-3,5-DIMETHOXYPHENYL)METHYL)-, BIS(2-ETHYLHEXYL) ESTER",
          "stdName": "PROPANEDIOIC ACID, ((4-HYDROXY-3,5-DIMETHOXYPHENYL)METHYL)-, BIS(2-ETHYLHEXYL) ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "881f7e16-223b-48b1-8270-114605e8b0ba",
            "9a216907-d861-47ea-b355-180158551e8f"
          ],
          "display_name": false
        },
        {
          "uuid": "e96e34ea-7661-4184-bdfa-3e83562a63de",
          "name": "PROPANEDIOIC ACID, 2-((4-HYDROXY-3,5-DIMETHOXYPHENYL)METHYL)-, 1,3-BIS(2-ETHYLHEXYL) ESTER",
          "stdName": "PROPANEDIOIC ACID, 2-((4-HYDROXY-3,5-DIMETHOXYPHENYL)METHYL)-, 1,3-BIS(2-ETHYLHEXYL) ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "881f7e16-223b-48b1-8270-114605e8b0ba",
            "9a216907-d861-47ea-b355-180158551e8f"
          ],
          "display_name": false
        },
        {
          "uuid": "9917ad35-ee65-4105-ba81-4abd9fa24e9a",
          "name": "RONACARE AP",
          "stdName": "RONACARE AP",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "881f7e16-223b-48b1-8270-114605e8b0ba",
            "9a216907-d861-47ea-b355-180158551e8f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "4fc14af4-89f1-4482-87ae-72e545e9ee16",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "9a216907-d861-47ea-b355-180158551e8f",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "881f7e16-223b-48b1-8270-114605e8b0ba",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f5ba1bb9-1909-40c9-8e5f-461acd1e4454",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8f300a3a-f888-4bb0-b77d-3c58362cba34",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391412000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "05be2bab-3c53-4192-abdf-5379f21d3420",
          "citation": "SRS import [7D4Q5YJ8NV]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7D4Q5YJ8NV",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391412000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "84d01f17-07e3-4973-a284-9b53c0a1eb00",
          "citation": "BIS-ETHYLHEXYL HYDROXYDIMETHOXY BENZYLMALONATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "24acbb30-3be6-4807-9e59-d69b342b15df",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "2df48378-99fe-a38b-5dca-b20b64beabd8",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "ddc891bf-9928-a2d4-d878-0bd51cbf8021",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "dca04b83-10bb-4dcc-8352-ef888a1e49f4",
          "id": "dca04b83-10bb-4dcc-8352-ef888a1e49f4",
          "molfile": "\n  Marvin  01132111262D          \n\n 35 35  0  0  0  0            999 V2000\n   13.2967   -6.0277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5823   -5.6153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8678   -6.0278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1533   -5.6153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4389   -6.0278    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   10.4389   -6.8528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1533   -7.2653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7244   -5.6153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0099   -6.0278    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2955   -5.6153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2955   -4.7903    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5810   -6.0278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8665   -5.6153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1521   -6.0278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4376   -5.6153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7231   -6.0278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0086   -5.6153    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2941   -6.0278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7231   -6.8528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0086   -7.2653    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4376   -7.2653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4376   -8.0903    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1521   -8.5028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1521   -6.8528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5810   -6.8528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8665   -7.2653    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2955   -7.2653    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2955   -8.0903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0100   -8.5028    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    9.0100   -9.3278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7244   -9.7403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7244   -8.0903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4389   -8.5028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1533   -8.0903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8678   -8.5027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  8  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 12 25  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 24 14  2  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 16 19  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 19 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 21 24  1  0  0  0  0\n 22 23  1  0  0  0  0\n 25 26  2  0  0  0  0\n 25 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  1  0  0  0  0\n 29 30  1  0  0  0  0\n 29 32  1  0  0  0  0\n 30 31  1  0  0  0  0\n 32 33  1  0  0  0  0\n 33 34  1  0  0  0  0\n 34 35  1  0  0  0  0\nM  END",
          "smiles": "CCCCC(CC)COC(=O)C(Cc1cc(c(c(c1)OC)O)OC)C(=O)OCC(CC)CCCC",
          "formula": "C28H46O7",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7b6abf40-6578-4fe9-95d8-45b5a2919c22"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "494.6617",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b12233e4-db71-41af-b812-000c5f06e2e4",
      "version": "9",
      "structure": {
        "id": "e200a69c-dfad-4adc-8985-c3cb1aa247ee",
        "molfile": "\n  Marvin  01132111422D          \n\n 35 35  0  0  0  0            999 V2000\n    4.7231   -6.0278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4376   -5.6153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1521   -6.0278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1521   -6.8528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4376   -7.2653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7231   -6.8528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0086   -7.2653    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4376   -8.0903    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0086   -5.6153    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2941   -6.0278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1521   -8.5028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8665   -5.6153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5810   -6.0278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5810   -6.8528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2955   -5.6153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0099   -6.0278    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7244   -5.6153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4389   -6.0278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1533   -5.6153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8678   -6.0278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5823   -5.6153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2967   -6.0277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2955   -7.2653    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2955   -8.0903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0100   -8.5028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7244   -8.0903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4389   -8.5028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1533   -8.0903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8678   -8.5027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2955   -4.7903    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8665   -7.2653    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4389   -6.8528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1533   -7.2653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0100   -9.3278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7244   -9.7403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  1  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  5  8  1  0  0  0  0\n  1  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  8 11  1  0  0  0  0\n  3 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 14 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  1  0  0  0  0\n 15 30  2  0  0  0  0\n 14 31  2  0  0  0  0\n 18 32  1  0  0  0  0\n 32 33  1  0  0  0  0\n 25 34  1  0  0  0  0\n 34 35  1  0  0  0  0\nM  END",
        "smiles": "CCCCC(CC)COC(=O)C(Cc1cc(c(c(c1)OC)O)OC)C(=O)OCC(CC)CCCC",
        "formula": "C28H46O7",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "494.6617",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "881f7e16-223b-48b1-8270-114605e8b0ba",
          "05be2bab-3c53-4192-abdf-5379f21d3420"
        ],
        "stereo_centers": 3
      },
      "unii": "7D4Q5YJ8NV"
    }
  ]
}