{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "4560638f-8718-43e7-a8c6-d591124eda07",
          "code": "222-212-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.020.194",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "13a68f1b-f5f9-4726-ba11-aca875dd0b69"
          ]
        },
        {
          "uuid": "afca22d6-1f4b-4613-bedb-21c6d183f5ed",
          "code": "3387-41-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3387-41-5",
          "code_system": "CAS",
          "references": [
            "13a68f1b-f5f9-4726-ba11-aca875dd0b69",
            "1769607b-0a1c-443c-8c8e-fabde2e01fad"
          ]
        },
        {
          "uuid": "b340f3f0-86be-4ae8-ab4d-2b55b728a8e2",
          "code": "SABINENE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Sabinene",
          "code_system": "WIKIPEDIA",
          "references": [
            "13a68f1b-f5f9-4726-ba11-aca875dd0b69"
          ]
        },
        {
          "uuid": "eb4e0cc5-c320-4ba4-ba58-64fbf6cd8517",
          "code": "SUB76343",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "13a68f1b-f5f9-4726-ba11-aca875dd0b69"
          ]
        },
        {
          "uuid": "6f6df5b3-b3ab-45d2-ab2b-c815b8ec1eb0",
          "code": "7D1TL44GPC",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f8b9cca1-1226-af27-041a-76f6d6a5e342",
          "code": "2557219",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2557219/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "f1462a6c-bb29-654e-ed4c-a8f074a16c26"
          ]
        },
        {
          "uuid": "eef7f5d4-9e4c-814d-6630-0527d8d64e9a",
          "code": "50027",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:50027",
          "code_system": "CHEBI",
          "references": [
            "c56bf5af-54cf-34ef-0c74-f1d2cbcb6a29"
          ]
        },
        {
          "uuid": "20307c09-373d-5723-ac37-f157ff442826",
          "code": "7D1TL44GPC",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=7D1TL44GPC",
          "code_system": "DAILYMED",
          "references": [
            "74521dcd-4272-41a3-1cfc-da307a9c23c6"
          ]
        },
        {
          "uuid": "92fdcf07-8910-5f52-f5f7-1d5f3148c631",
          "code": "100000137752",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "36997d2d-6d11-0890-1ef8-9b4163c9cda5"
          ]
        },
        {
          "uuid": "b76dcc33-d1a4-b3f7-9f95-9e803e39e4ce",
          "code": "DTXSID70863164",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70863164",
          "code_system": "EPA CompTox",
          "references": [
            "c56bf5af-54cf-34ef-0c74-f1d2cbcb6a29"
          ]
        },
        {
          "uuid": "bbf2e1ae-480b-0b49-5377-356ca7f47bb7",
          "code": "407278",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=407278",
          "code_system": "NSC",
          "references": [
            "2c64f1b5-8867-a34a-e18c-8f5533cba6fd"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "a968081b-0068-4576-80d8-663efc52f466",
          "type": "ENANTIOMER->RACEMATE",
          "references": [
            "cdb57f6e-0929-a994-4cfa-ca70e4c8a4af"
          ],
          "related_substance": {
            "uuid": "e533870d-c06c-4737-9c3f-17abdbe39db7",
            "refuuid": "4d55f7e2-b77d-4526-85ca-be3b272a72dd",
            "name": "SABINENE, (+)-",
            "unii": "XYL0G8758O",
            "linking_id": "XYL0G8758O",
            "ref_pname": "SABINENE, (+)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e28c1978-0733-48d2-87f0-98ef25fc1015",
          "type": "ENANTIOMER->RACEMATE",
          "references": [
            "cdb57f6e-0929-a994-4cfa-ca70e4c8a4af"
          ],
          "related_substance": {
            "uuid": "0eb6bb46-e22f-4997-862e-4376ee8f6869",
            "refuuid": "9b62ca24-3164-0975-59c0-00ae58982252",
            "name": "SABINENE, (-)-",
            "unii": "0W0K1SDY3N",
            "linking_id": "0W0K1SDY3N",
            "ref_pname": "SABINENE, (-)-",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a93dbab2-e378-450c-a437-f573ceed8802",
          "name": "1-ISOPROPYL-4-METHYLENEBICYCLO(3.1.0)HEXANE",
          "stdName": "1-ISOPROPYL-4-METHYLENEBICYCLO(3.1.0)HEXANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d3fc07b8-109a-4e86-b119-a362116172fe",
            "2d65058f-95cf-48b1-8588-746584ed5a26"
          ],
          "display_name": false
        },
        {
          "uuid": "ec6f6e20-6ad3-4f1e-a8cf-4ee24dabdbde",
          "name": "4(10)-THUJENE",
          "stdName": "4(10)-THUJENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d3fc07b8-109a-4e86-b119-a362116172fe",
            "2d65058f-95cf-48b1-8588-746584ed5a26"
          ],
          "display_name": false
        },
        {
          "uuid": "0f493d0a-1c0a-45f3-965e-6367b3e3a2f2",
          "name": "4-METHYLENE-1-(1-METHYLETHYL)-BICYCLO(3.1.0)HEXANE",
          "stdName": "4-METHYLENE-1-(1-METHYLETHYL)-BICYCLO(3.1.0)HEXANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d3fc07b8-109a-4e86-b119-a362116172fe",
            "2d65058f-95cf-48b1-8588-746584ed5a26"
          ],
          "display_name": false
        },
        {
          "uuid": "85978068-fe79-4d38-93ee-f61ccb684f7e",
          "name": "BICYCLO(3.1.0)HEXANE, 4-METHYLENE-1-(1-METHYLETHYL)-",
          "stdName": "BICYCLO(3.1.0)HEXANE, 4-METHYLENE-1-(1-METHYLETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d3fc07b8-109a-4e86-b119-a362116172fe",
            "3e90b448-c999-4094-9289-398409040f6d"
          ],
          "display_name": false
        },
        {
          "uuid": "ba6eca2d-a5c0-4eb8-97c3-a2e982a73b9e",
          "name": "NSC-407278",
          "stdName": "NSC-407278",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d3fc07b8-109a-4e86-b119-a362116172fe",
            "3e90b448-c999-4094-9289-398409040f6d"
          ],
          "display_name": false
        },
        {
          "uuid": "3837e36a-05d2-4c1f-a8b9-d3972ca5019f",
          "name": "SABENENE",
          "stdName": "SABENENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d3fc07b8-109a-4e86-b119-a362116172fe",
            "2d65058f-95cf-48b1-8588-746584ed5a26"
          ],
          "display_name": false
        },
        {
          "uuid": "5d20b545-e914-4365-9200-b30ed86943c7",
          "name": "SABINEN",
          "stdName": "SABINEN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d3fc07b8-109a-4e86-b119-a362116172fe",
            "3e90b448-c999-4094-9289-398409040f6d"
          ],
          "display_name": false
        },
        {
          "uuid": "be286394-d9b9-41cf-87e2-43fd1b4c4850",
          "name": "SABINENE",
          "stdName": "SABINENE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d3fc07b8-109a-4e86-b119-a362116172fe",
            "3e90b448-c999-4094-9289-398409040f6d"
          ],
          "display_name": true
        },
        {
          "uuid": "2aef5ebc-0dce-4eb5-9ce6-e76849cbe161",
          "name": "THUJENE, 4(10)-",
          "stdName": "THUJENE, 4(10)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d3fc07b8-109a-4e86-b119-a362116172fe",
            "3e90b448-c999-4094-9289-398409040f6d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3e90b448-c999-4094-9289-398409040f6d",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "d3fc07b8-109a-4e86-b119-a362116172fe",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2d65058f-95cf-48b1-8588-746584ed5a26",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "13a68f1b-f5f9-4726-ba11-aca875dd0b69",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391318000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cf32dea8-796f-46cf-bca0-16eeb9534631",
          "citation": "SRS import [7D1TL44GPC]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7D1TL44GPC",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391318000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "36997d2d-6d11-0890-1ef8-9b4163c9cda5",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "cdb57f6e-0929-a994-4cfa-ca70e4c8a4af",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f1462a6c-bb29-654e-ed4c-a8f074a16c26",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "c56bf5af-54cf-34ef-0c74-f1d2cbcb6a29",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "2c64f1b5-8867-a34a-e18c-8f5533cba6fd",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "1769607b-0a1c-443c-8c8e-fabde2e01fad",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "74521dcd-4272-41a3-1cfc-da307a9c23c6",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "c9871932-07b3-cd58-05bf-6b6ae2e2c54a",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "42902505-b84c-402b-9e8c-1c78df1c8dde",
          "id": "42902505-b84c-402b-9e8c-1c78df1c8dde",
          "molfile": "\n  Marvin  01132103312D          \n\n 10 11  0  0  0  0            999 V2000\n    6.9825   -6.1451    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.5498   -5.4190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3744   -5.4190    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    8.1882   -5.5672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2965   -6.3833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5545   -6.7397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4064   -7.5489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4390   -4.5967    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.7571   -4.1308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1808   -4.2357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  3  1  1  0  0  0  0\n  1  6  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  8  1  6  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  2  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\nM  END",
          "smiles": "CC(C)[C@@]12CCC(=C)[C@H]2C1",
          "formula": "C10H16",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "431b5021-3906-45b0-823f-facb1e3e5d70"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "136.2344",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "617f53d1-5bc5-4163-b560-dd72078a6027",
      "version": "12",
      "structure": {
        "id": "f6621344-78e1-4850-b529-081c0c06551c",
        "molfile": "\n  Marvin  01132112462D          \n\n 11 12  0  0  0  0            999 V2000\n    7.4064   -7.5489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5545   -6.7397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9825   -6.1451    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.3744   -5.4190    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.5498   -5.4190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1882   -5.5672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2965   -6.3833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4390   -4.5967    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.1808   -4.2357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7571   -4.1308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2547   -6.5827    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  3  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  2  7  1  0  0  0  0\n  4  8  1  6  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n  3 11  1  6  0  0  0\nM  END",
        "smiles": "CC(C)[C@@]12CCC(=C)[C@@]2([H])C1",
        "formula": "C10H16",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "136.2344",
        "optical_activity": "( + / - )",
        "references": [
          "cf32dea8-796f-46cf-bca0-16eeb9534631",
          "3e90b448-c999-4094-9289-398409040f6d"
        ],
        "stereo_centers": 2
      },
      "unii": "7D1TL44GPC"
    }
  ]
}