{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "015f6ef5-843d-48b8-9647-6ae294e0aa87",
          "code": "26218-04-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=26218-04-2",
          "code_system": "CAS",
          "references": [
            "92c32659-9101-6f82-8b58-0ac060b83a71"
          ]
        },
        {
          "uuid": "fcfec15d-6321-4759-aac8-cb1a72d6e1be",
          "code": "11436614",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11436614",
          "code_system": "PUBCHEM",
          "references": [
            "97d2905e-e5fe-261b-4a00-c27afc8995a9"
          ]
        },
        {
          "uuid": "ebb53315-2fcd-4daa-9e85-7849eb1d67af",
          "code": "7CHI67POY6",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f1ecf728-e39b-0b5d-36d7-78643c3d2aae",
          "code": "1265548",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1265548",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "edbf51d4-835c-1475-1872-c68065343469"
          ]
        },
        {
          "uuid": "9de25484-4269-031b-f1ea-95633ca58fa1",
          "code": "DTXSID801309631",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID801309631",
          "code_system": "EPA CompTox",
          "references": [
            "25f1379c-b014-3e60-35a6-20c36d25c133"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "b040f538-1fe9-485a-9c9f-58cb03b793d0",
          "type": "PARENT->IMPURITY",
          "references": [
            "d76f237b-a2d2-8037-774c-f7b9f9a70d40"
          ],
          "related_substance": {
            "uuid": "ad9c4720-25df-4b65-877a-d3fd1231d99e",
            "refuuid": "f0789739-c309-42e4-a3e8-85370cc4d4d9",
            "name": "ETHYLHEXYL TRIAZONE",
            "unii": "XQN8R9SAK4",
            "linking_id": "XQN8R9SAK4",
            "ref_pname": "ETHYLHEXYL TRIAZONE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b6fe438d-0266-81f8-abad-3c7ec0c1393c",
          "name": "2-ETHYLHEXYL 4-AMINOBENZOATE",
          "stdName": "2-ETHYLHEXYL 4-AMINOBENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d76f237b-a2d2-8037-774c-f7b9f9a70d40"
          ],
          "display_name": true
        },
        {
          "uuid": "6b15a402-4006-219a-4ebb-70448f958de1",
          "name": "2-ETHYLHEXYL P-AMINOBENZOATE",
          "stdName": "2-ETHYLHEXYL P-AMINOBENZOATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92c32659-9101-6f82-8b58-0ac060b83a71"
          ],
          "display_name": false
        },
        {
          "uuid": "574194a7-25f7-6cf9-b9b2-5052ec776520",
          "name": "BENZOIC ACID, 4-AMINO-, 2-ETHYLHEXYL ESTER",
          "stdName": "BENZOIC ACID, 4-AMINO-, 2-ETHYLHEXYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92c32659-9101-6f82-8b58-0ac060b83a71"
          ],
          "display_name": false
        },
        {
          "uuid": "e552d646-8fb7-def7-83b2-98c01656f94d",
          "name": "ETHYLHEXYL TRIAZONE RELATED COMPOUND A",
          "stdName": "ETHYLHEXYL TRIAZONE RELATED COMPOUND A",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d76f237b-a2d2-8037-774c-f7b9f9a70d40"
          ],
          "display_name": false
        },
        {
          "uuid": "c0b171c8-cb7d-a414-4b88-cc4f04dba1f0",
          "name": "ETHYLHEXYL TRIAZONE RELATED COMPOUND A [USP IMPURITY]",
          "stdName": "ETHYLHEXYL TRIAZONE RELATED COMPOUND A [USP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d76f237b-a2d2-8037-774c-f7b9f9a70d40"
          ],
          "display_name": false
        },
        {
          "uuid": "fa6eab55-03d7-6b1a-0bd9-15198e0c9b9e",
          "name": "ETHYLHEXYL TRIAZONE RELATED COMPOUND A [USP-RS]",
          "stdName": "ETHYLHEXYL TRIAZONE RELATED COMPOUND A [USP-RS]",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d76f237b-a2d2-8037-774c-f7b9f9a70d40"
          ],
          "display_name": false
        },
        {
          "uuid": "7fb6936e-1153-c068-bcd4-47488f1cec3b",
          "name": "P-AMINOBENZOIC ACID 2-ETHYLHEXYL ESTER",
          "stdName": "P-AMINOBENZOIC ACID 2-ETHYLHEXYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92c32659-9101-6f82-8b58-0ac060b83a71"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "abd81db9-ad8e-44f0-9471-e923cd6602b3",
          "citation": "SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "92c32659-9101-6f82-8b58-0ac060b83a71",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d76f237b-a2d2-8037-774c-f7b9f9a70d40",
          "citation": "USP-NF",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "97d2905e-e5fe-261b-4a00-c27afc8995a9",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "edbf51d4-835c-1475-1872-c68065343469",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "25f1379c-b014-3e60-35a6-20c36d25c133",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "676bafbc-2984-4851-bd6a-435fcbf01135",
          "id": "676bafbc-2984-4851-bd6a-435fcbf01135",
          "molfile": "\n  Marvin  01132105232D          \n\n 18 18  0  0  0  0            999 V2000\n   10.4386   -3.2719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7242   -2.8594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0097   -3.2719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2952   -2.8594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5808   -3.2719    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    7.5808   -4.0969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8663   -4.5094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8663   -2.8594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1518   -3.2719    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4373   -2.8594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4373   -2.0344    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7229   -3.2719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7229   -4.0969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0084   -4.5094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2939   -4.0969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5795   -4.5094    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2939   -3.2719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0084   -2.8594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  8  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 18  2  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  2  0  0  0  0\n 17 18  1  0  0  0  0\nM  END",
          "smiles": "CCCCC(CC)COC(=O)c1ccc(cc1)N",
          "formula": "C15H23NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4e1d3df6-4f7d-458a-bfea-fa8cda8002bd"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "249.3492",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "2181606b-2947-49b8-80c2-f012781b82f7",
      "version": "13",
      "structure": {
        "id": "e025a350-76c9-4522-8037-edc7e645fab3",
        "molfile": "\n  Marvin  01132111372D          \n\n 18 18  0  0  0  0            999 V2000\n   14.1908   -3.6575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4764   -4.0700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.4764   -4.8950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7619   -5.3074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0474   -4.8950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0474   -4.0700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7619   -3.6575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.1908   -2.8326    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9053   -4.0700    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3331   -5.3074    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6197   -3.6575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3342   -4.0700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0486   -3.6575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7631   -4.0700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4776   -3.6575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.1919   -4.0700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3342   -4.8950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.6197   -5.3074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  2  7  2  0  0  0  0\n  1  8  2  0  0  0  0\n  1  9  1  0  0  0  0\n  5 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 12 17  1  0  0  0  0\n  9 11  1  0  0  0  0\nM  END",
        "smiles": "CCCCC(CC)COC(=O)c1ccc(cc1)N",
        "formula": "C15H23NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "249.3492",
        "optical_activity": "( + / - )",
        "references": [
          "abd81db9-ad8e-44f0-9471-e923cd6602b3"
        ],
        "stereo_centers": 1
      },
      "unii": "7CHI67POY6"
    }
  ]
}