{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "6481bd73-378a-4ae7-a09d-ffd06c25a60c", "code": "36105-20-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=36105-20-1", "code_system": "CAS", "references": [ "0bec4e7b-8bc6-4cdf-be5c-b6e6b060a063", "75c3e947-83d9-457e-92e9-009f7b42a318" ] }, { "uuid": "bf6e8b6f-373c-40eb-9c81-88a5665244ba", "code": "C98134", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C98134", "code_system": "NCI_THESAURUS", "references": [ "0bec4e7b-8bc6-4cdf-be5c-b6e6b060a063" ] }, { "uuid": "3dc0bbab-5874-44d0-aac5-0438787d8a21", "code": "252-867-1", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.048.047", "code_system": "ECHA (EC/EINECS)", "references": [ "0bec4e7b-8bc6-4cdf-be5c-b6e6b060a063" ] }, { "uuid": "6e60a017-c864-4fe1-9b47-5bc11f21d7e2", "code": "SUB11971MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "0bec4e7b-8bc6-4cdf-be5c-b6e6b060a063" ] }, { "uuid": "08284f61-5b3a-448b-b846-19cbb27130a6", "code": "37368", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/37368", "code_system": "PUBCHEM", "references": [ "0bec4e7b-8bc6-4cdf-be5c-b6e6b060a063" ] }, { "uuid": "c84335b5-eb6b-fd98-877e-bba63beb322f", "code": "Flurazepam monohydrochloride", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Flurazepam_monohydrochloride", "code_system": "WIKIPEDIA", "references": [ "f3f7dd98-0d7b-55a9-8ece-92e2cd46ba32" ] }, { "uuid": "5aad1fd3-bf0e-6cc8-1845-3bf94293f08a", "code": "DTXSID40189686", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40189686", "code_system": "EPA CompTox", "references": [ "4afe799f-f7c2-b116-d8e6-b98f97b6d878" ] }, { "uuid": "ac95729f-af0c-8f2c-ba6a-8d8582b12d1a", "code": "C1012", "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Antianxiety Agent[C28197]|Benzodiazepine", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1012", "code_system": "NCI_THESAURUS", "references": [ "770e2b1a-7cf2-4498-08c2-e11c9d873850" ] }, { "uuid": "3bd8b4ed-f42f-444b-810f-a119b4795be0", "code": "7C4JH842IJ", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "51a78106-34b7-c402-9581-532afa9d3f19", "code": "100000092417", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "f9968ede-6173-2a99-780a-c248b030915b" ] } ], "relationships": [ { "uuid": "513f83ba-de4f-4143-a9c3-14f4c137b10c", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "70569a1d-1212-4797-bbb6-b53c08d2d276", "refuuid": "2f922ff4-e09a-4d0e-8e5b-b4a7a33874d5", "name": "FLURAZEPAM", "unii": "IHP475989U", "linking_id": "IHP475989U", "ref_pname": "FLURAZEPAM", "substance_class": "reference" } }, { "uuid": "5e453028-40c9-45bc-bb94-9f0c5202d5b7", "amount": { "uuid": "5bcc86bc-f80e-4a56-9449-1a0d3b48a88d" }, "type": "IMPURITY->PARENT", "references": [ "2504be9c-a0f9-48b1-a66a-31a7ec9a72d4" ], "related_substance": { "uuid": "50d244a6-0c88-4f65-9c50-d1598fea3add", "refuuid": "25c1c4ff-7ae4-43d8-9a94-a980844fea51", "name": "Flurazepam-N-1-hydroxyethyl", "unii": "876FMY2W5N", "linking_id": "876FMY2W5N", "ref_pname": "Flurazepam-N-1-hydroxyethyl", "substance_class": "reference" } }, { "uuid": "1b25a68c-37be-4283-bbf9-e08bf9a297ca", "amount": { "uuid": "849427e8-a393-4145-a183-b026bdadab84" }, "type": "IMPURITY->PARENT", "references": [ "53a17cb1-04ab-46e7-969a-76195f00e780" ], "related_substance": { "uuid": "e7b0cb91-f1f9-4dd0-806a-49d0ff3bd569", "refuuid": "1afa2a7c-4db2-49f7-98c3-9c4bfe7ab39f", "name": "NORFLURAZEPAM", "unii": "X9U41NXR6M", "linking_id": "X9U41NXR6M", "ref_pname": "NORFLURAZEPAM", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "f21d9883-69b0-4438-8a55-6947acb89f22", "name": "2H-1,4-BENZODIAZEPIN-2-ONE, 7-CHLORO-1-(2-(DIETHYLAMINO)ETHYL)-5-(2-FLUOROPHENYL)-1,3-DIHYDRO-, HYDROCHLORIDE (1:1)", "stdName": "2H-1,4-BENZODIAZEPIN-2-ONE, 7-CHLORO-1-(2-(DIETHYLAMINO)ETHYL)-5-(2-FLUOROPHENYL)-1,3-DIHYDRO-, HYDROCHLORIDE (1:1)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "5584daf7-411a-4481-ac3a-c996f9ecb5e6" ], "display_name": false }, { "uuid": "c8405a93-f1d8-4fcd-a38b-8fc1db706895", "name": "2H-1,4-BENZODIAZEPIN-2-ONE, 7-CHLORO-1-(2-(DIETHYLAMINO)ETHYL)-5-(2-FLUOROPHENYL)-1,3-DIHYDRO-, MONOHYDROCHLORIDE", "stdName": "2H-1,4-BENZODIAZEPIN-2-ONE, 7-CHLORO-1-(2-(DIETHYLAMINO)ETHYL)-5-(2-FLUOROPHENYL)-1,3-DIHYDRO-, MONOHYDROCHLORIDE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "5584daf7-411a-4481-ac3a-c996f9ecb5e6" ], "display_name": false }, { "uuid": "c9ff003e-4529-47d5-9b7f-7ce2a1581846", "name": "FLURAZEPAM MONOHYDROCHLORIDE", "stdName": "FLURAZEPAM MONOHYDROCHLORIDE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "3fc9fb6e-2d66-4383-a021-ed9e6fea5a94", "b0b79696-d5b5-4f8d-8321-f2b12ca95507", "582dbaff-2dab-4cd9-a3b8-1dea9351980e" ], "display_name": true }, { "uuid": "6aed343c-e603-bd55-78bc-c2b49f385c04", "name": "FLURAZEPAM MONOHYDROCHLORIDE [EP MONOGRAPH]", "stdName": "FLURAZEPAM MONOHYDROCHLORIDE [EP MONOGRAPH]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "f5811a1d-24e8-97b6-b213-35c130fc9e0d" ], "display_name": false }, { "uuid": "94865e44-8095-4e28-be1d-3c63583ed52e", "name": "FLURAZEPAM MONOHYDROCHLORIDE [MART.]", "stdName": "FLURAZEPAM MONOHYDROCHLORIDE [MART.]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "3fc9fb6e-2d66-4383-a021-ed9e6fea5a94" ], "display_name": false } ], "references": [ { "uuid": "582dbaff-2dab-4cd9-a3b8-1dea9351980e", "citation": "EP", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "5584daf7-411a-4481-ac3a-c996f9ecb5e6", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "3fc9fb6e-2d66-4383-a021-ed9e6fea5a94", "citation": "MARTINDALE 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "0bec4e7b-8bc6-4cdf-be5c-b6e6b060a063", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391014000, "tags": [ "NOMEN" ] }, { "uuid": "8b1e3de7-be47-4b76-9812-c8446086015b", "citation": "SRS import [7C4JH842IJ]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7C4JH842IJ", "doc_type": "SRS", "public_domain": true, "document_date": 1493391014000, "tags": [ "NOMEN" ] }, { "uuid": "b0b79696-d5b5-4f8d-8321-f2b12ca95507", "citation": "FLURAZEPAM MONOHYDROCHLORIDE [MART.]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "f3f7dd98-0d7b-55a9-8ece-92e2cd46ba32", "citation": "WIKI", "url": "https://en.wikipedia.org/wiki/Flurazepam_monohydrochloride", "doc_type": "WIKI", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "4afe799f-f7c2-b116-d8e6-b98f97b6d878", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=36105-20-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "770e2b1a-7cf2-4498-08c2-e11c9d873850", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "f5811a1d-24e8-97b6-b213-35c130fc9e0d", "citation": "EP 10.5", "doc_type": "EP", "public_domain": true }, { "uuid": "75c3e947-83d9-457e-92e9-009f7b42a318", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "7e5ba845-8c80-4869-8390-4dbeca6de6ad", "citation": "11.2", "doc_type": "EP", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "53a17cb1-04ab-46e7-969a-76195f00e780", "citation": "EP 10.5", "doc_type": "EP", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "f9968ede-6173-2a99-780a-c248b030915b", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "2504be9c-a0f9-48b1-a66a-31a7ec9a72d4", "citation": "11.2", "doc_type": "EP", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "d89e0f81-f302-4323-a158-d2732bf7292d", "id": "d89e0f81-f302-4323-a158-d2732bf7292d", "molfile": "\n Marvin 01132111142D \n\n 1 0 0 0 0 0 999 V2000\n 9.4130 -2.1299 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\nM END", "smiles": "Cl", "formula": "ClH", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "20793b80-c152-429a-92bf-a0a497c7e88c" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "36.4609", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "37775290-c10d-4830-8ef2-276638275241", "id": "37775290-c10d-4830-8ef2-276638275241", "molfile": "\n Marvin 01132102572D \n\n 27 29 0 0 0 0 999 V2000\n 7.1291 -0.3762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2733 -0.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8499 0.3168 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3011 1.0517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1291 1.0517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0266 0.3400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4358 -0.5065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8871 -1.3251 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5988 -1.7252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2314 -1.2647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9895 -1.5670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0919 -2.3624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8362 -2.6881 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4174 -2.8602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7011 -2.5438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1057 -3.1254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2870 -3.0369 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8405 -2.3392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1149 -1.5857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5335 -1.0135 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4127 -3.9068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1709 -4.0603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4592 -4.8231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9290 -5.4556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1289 -5.3208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8545 -4.5301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0265 -4.3905 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 3 1 0 0 0 0\n 3 6 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 8 19 1 0 0 0 0\n 10 9 1 0 0 0 0\n 9 15 2 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 13 12 1 0 0 0 0\n 12 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 17 16 2 0 0 0 0\n 21 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 1 0 0 0 0\n 20 19 2 0 0 0 0\n 22 21 1 0 0 0 0\n 26 21 2 0 0 0 0\n 23 22 2 0 0 0 0\n 24 23 1 0 0 0 0\n 25 24 2 0 0 0 0\n 25 26 1 0 0 0 0\n 27 26 1 0 0 0 0\nM END", "smiles": "CCN(CC)CCN1c2ccc(cc2C(=NCC1=O)c3ccccc3F)Cl", "formula": "C21H23ClFN3O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "50f2adb8-e918-4766-8abe-94d3da8ddb37" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "387.8789", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "79a90025-68cf-4aa9-9896-1385313257dc", "version": "10", "structure": { "id": "9830934d-764b-4222-9289-c256e54b6eff", "molfile": "\n Marvin 01132107542D \n\n 28 29 0 0 0 0 999 V2000\n 9.4130 -2.1299 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 5.9290 -5.4556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1289 -5.3208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8545 -4.5301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0265 -4.3905 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4127 -3.9068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1709 -4.0603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4592 -4.8231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1057 -3.1254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2870 -3.0369 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8405 -2.3392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.1149 -1.5857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8871 -1.3251 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4358 -0.5065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0266 0.3400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8499 0.3168 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2733 -0.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1291 -0.3762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.3011 1.0517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1291 1.0517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5988 -1.7252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2314 -1.2647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9895 -1.5670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0919 -2.3624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8362 -2.6881 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4174 -2.8602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7011 -2.5438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5335 -1.0135 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3 2 2 0 0 0 0\n 3 4 1 0 0 0 0\n 5 4 1 0 0 0 0\n 4 6 2 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 2 0 0 0 0\n 2 8 1 0 0 0 0\n 6 9 1 0 0 0 0\n 10 9 2 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 19 16 1 0 0 0 0\n 20 19 1 0 0 0 0\n 13 21 1 0 0 0 0\n 22 21 1 0 0 0 0\n 22 23 2 0 0 0 0\n 23 24 1 0 0 0 0\n 25 24 1 0 0 0 0\n 24 26 2 0 0 0 0\n 26 27 1 0 0 0 0\n 21 27 2 0 0 0 0\n 27 9 1 0 0 0 0\n 28 12 2 0 0 0 0\nM END", "smiles": "CCN(CC)CCN1c2ccc(cc2C(=NCC1=O)c3ccccc3F)Cl.Cl", "formula": "C21H23ClFN3O.ClH", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "424.3398", "optical_activity": "NONE", "references": [ "8b1e3de7-be47-4b76-9812-c8446086015b", "582dbaff-2dab-4cd9-a3b8-1dea9351980e" ], "stereo_centers": 0 }, "unii": "7C4JH842IJ" } ] }