{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "a12b1717-d5cf-4d62-a48e-5bca78ecf608", "code": "1093200-92-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1093200-92-0", "code_system": "CAS", "references": [ "53e16157-56c1-4792-961a-374420bb7d89", "b475ea57-eb9c-4732-9ad1-12ee382163d4" ] }, { "uuid": "6bb4d904-3bc7-4054-956a-3cc13e716311", "code": "44628330", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/44628330", "code_system": "PUBCHEM", "references": [ "53e16157-56c1-4792-961a-374420bb7d89" ] }, { "uuid": "e49b0f6d-8203-4bee-a5a4-fa868e376dae", "code": "7BJN24VU6P", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "862afd9f-6ac8-5dd1-cf9b-c52e0fa83fd7", "code": "DTXSID201019799", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID201019799", "code_system": "EPA CompTox" }, { "uuid": "45a568de-6a71-c70a-620f-b9554c06884a", "code": "2059", "type": "PRIMARY", "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/2059/", "code_system": "JECFA MONOGRAPH", "references": [ "94e5fce4-9c34-b1ec-475a-264b1e99a26c" ] } ], "substance_class": "chemical", "names": [ { "uuid": "84467495-9cd5-4216-a956-05875ccd0481", "name": "3-[(4-Amino-2,2-dioxido-1H-2,1,3-benzothiadiazin-5-yl)oxy]-2,2-dimethyl-N-propylpropanamide", "stdName": "3-((4-AMINO-2,2-DIOXIDO-1H-2,1,3-BENZOTHIADIAZIN-5-YL)OXY)-2,2-DIMETHYL-N-PROPYLPROPANAMIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "e5a02717-b70c-46b6-8116-d6feb0c84678" ], "display_name": true }, { "uuid": "1d5533a6-98da-464c-bd21-9c85181b540e", "name": "Propanamide, 3-[(4-amino-2,2-dioxido-1H-2,1,3-benzothiadiazin-5-yl)oxy]-2,2-dimethyl-N-propyl-", "stdName": "PROPANAMIDE, 3-((4-AMINO-2,2-DIOXIDO-1H-2,1,3-BENZOTHIADIAZIN-5-YL)OXY)-2,2-DIMETHYL-N-PROPYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "b475ea57-eb9c-4732-9ad1-12ee382163d4" ], "display_name": false } ], "references": [ { "uuid": "e5a02717-b70c-46b6-8116-d6feb0c84678", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "53e16157-56c1-4792-961a-374420bb7d89", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493394375000, "tags": [ "NOMEN" ] }, { "uuid": "b475ea57-eb9c-4732-9ad1-12ee382163d4", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "94e5fce4-9c34-b1ec-475a-264b1e99a26c", "citation": "JECFA", "doc_type": "JECFA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "d6814335-05ae-4e7d-b594-53abb6530e0e", "id": "d6814335-05ae-4e7d-b594-53abb6530e0e", "molfile": "\n Marvin 06202317542D \n\n 24 25 0 0 0 0 999 V2000\n 13.9792 -3.6673 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.5152 -1.7443 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9874 -0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9836 -1.1808 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7031 -1.5995 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 14.7021 -2.4302 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9815 -2.8424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2666 -2.4282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2677 -1.5976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5505 -2.8379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8345 -2.4271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8345 -1.5976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5505 -1.1784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5501 -3.6628 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.0888 -4.9010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4389 -4.9002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5483 -6.9626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8337 -7.3747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8332 -8.1997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2634 -5.7255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2638 -4.9006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2643 -4.0756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9776 -6.1384 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5487 -6.1377 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1 7 1 0 0 0 0\n 2 5 2 0 0 0 0\n 3 5 2 0 0 0 0\n 4 5 1 0 0 0 0\n 4 9 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 8 10 1 0 0 0 0\n 9 13 1 0 0 0 0\n 10 11 2 0 0 0 0\n 10 14 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 14 22 1 0 0 0 0\n 15 21 1 0 0 0 0\n 16 21 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 24 1 0 0 0 0\n 18 19 1 0 0 0 0\n 20 21 1 0 0 0 0\n 20 23 2 0 0 0 0\n 20 24 1 0 0 0 0\n 21 22 1 0 0 0 0\nM END", "smiles": "CCCNC(=O)C(C)(C)COc1cccc2c1C(=NS(=O)(=O)N2)N", "formula": "C15H22N4O4S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "eb2f94e7-f8b4-4bc2-a9a3-2436dfb60260" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "354.4263", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "e4f51e03-6d9e-40ca-b9d8-4ae402579743", "version": "7", "structure": { "id": "745742b2-eb04-435b-9f28-ea20ca23c130", "molfile": "\n JSDraw206202317542D\n\n 24 25 0 0 0 0 0 V2000\n 26.4327 -6.9344 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3371 -3.2982 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.3390 -1.5600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.4410 -2.2327 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.8016 -3.0244 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 27.7996 -4.5951 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 26.4370 -5.3745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.0853 -4.5913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.0874 -3.0208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.7313 -5.3660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.3773 -4.5894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.3773 -3.0208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.7313 -2.2282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.7304 -6.9259 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 26.6399 -9.2671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.5203 -9.2656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.7270 -13.1653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.3758 -13.9445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.3750 -15.5044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.0793 -10.8262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.0800 -9.2663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.0810 -7.7064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.4297 -11.6069 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 23.7279 -11.6056 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 4 9 1 0 0 0 0\n 8 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 9 13 1 0 0 0 0\n 3 5 2 0 0 0 0\n 2 5 2 0 0 0 0\n 1 7 1 0 0 0 0\n 10 14 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 20 23 2 0 0 0 0\n 20 24 1 0 0 0 0\n 17 24 1 0 0 0 0\n 16 21 1 0 0 0 0\n 15 21 1 0 0 0 0\n 14 22 1 0 0 0 0\nM END", "smiles": "CCCNC(=O)C(C)(C)COc1cccc2c1C(=NS(=O)(=O)N2)N", "formula": "C15H22N4O4S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "354.4263", "optical_activity": "NONE", "references": [ "e5a02717-b70c-46b6-8116-d6feb0c84678" ], "stereo_centers": 0 }, "unii": "7BJN24VU6P" } ] }