{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "9327bb77-2ada-4127-9021-f2076025291f",
          "code": "R06AX13",
          "comments": "ATC|RESPIRATORY SYSTEM|ANTIHISTAMINES FOR SYSTEMIC USE|ANTIHISTAMINES FOR SYSTEMIC USE|Other antihistamines for systemic use|loratadine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=R06AX13&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "4535ff58-723c-4021-8be3-3e2b1512a7c4"
          ]
        },
        {
          "uuid": "9f30be04-38b7-44d0-9bc9-2761e5c4d897",
          "code": "QR06AX13",
          "comments": "VATC|ANTIHISTAMINES FOR SYSTEMIC USE|ANTIHISTAMINES FOR SYSTEMIC USE|Other antihistamines for systemic use|loratadine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QR06AX13&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "4535ff58-723c-4021-8be3-3e2b1512a7c4"
          ]
        },
        {
          "uuid": "3df12083-f0ae-4e9f-b56d-8f24af507a80",
          "code": "79794-75-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=79794-75-5",
          "code_system": "CAS",
          "references": [
            "4535ff58-723c-4021-8be3-3e2b1512a7c4",
            "4a5acd5c-56e1-43cf-a592-c0b9dabb11b1"
          ]
        },
        {
          "uuid": "fd8ae7a2-4771-43db-8431-8c3a139a1f97",
          "code": "C29162",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29162",
          "code_system": "NCI_THESAURUS",
          "references": [
            "4535ff58-723c-4021-8be3-3e2b1512a7c4"
          ]
        },
        {
          "uuid": "a5b58f76-82c2-4e63-9b6c-fd9df270e6d2",
          "code": "D017336",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68017336",
          "code_system": "MESH",
          "references": [
            "4535ff58-723c-4021-8be3-3e2b1512a7c4"
          ]
        },
        {
          "uuid": "a000ca69-dfda-4fb8-b053-714039e6bed8",
          "code": "NBK548831",
          "comments": "LiverTox|Respiratory|Allergy symptoms|Antihistamine",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/NBK548831/",
          "code_system": "LIVERTOX",
          "references": [
            "8b1210a3-d446-f446-9cfb-882182d34847"
          ]
        },
        {
          "uuid": "e61a0ba8-4652-459d-abfb-d28c9e092bce",
          "code": "LORATADINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Loratadine",
          "code_system": "WIKIPEDIA",
          "references": [
            "4535ff58-723c-4021-8be3-3e2b1512a7c4"
          ]
        },
        {
          "uuid": "bc6cd262-65e0-4cd9-afbc-216a56ec47c1",
          "code": "SUB08581MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "4535ff58-723c-4021-8be3-3e2b1512a7c4"
          ]
        },
        {
          "uuid": "374fb33a-093b-42f4-a271-c26d87d9b6ae",
          "code": "5864",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=5864",
          "code_system": "INN",
          "references": [
            "4535ff58-723c-4021-8be3-3e2b1512a7c4"
          ]
        },
        {
          "uuid": "0ad729ca-0def-4a1f-8669-5434b3ce4ecf",
          "code": "7216",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=7216",
          "code_system": "IUPHAR",
          "references": [
            "4535ff58-723c-4021-8be3-3e2b1512a7c4"
          ]
        },
        {
          "uuid": "d402da48-b6c9-4c16-a6b0-96b058bb8ad4",
          "code": "28889",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/28889/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "4535ff58-723c-4021-8be3-3e2b1512a7c4"
          ]
        },
        {
          "uuid": "8ecb60ad-ef77-47d8-9841-6a7bd90e6ea4",
          "code": "m6905",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6905?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "4535ff58-723c-4021-8be3-3e2b1512a7c4"
          ]
        },
        {
          "uuid": "e1ff866a-5c91-4e91-945d-157ec1dd4425",
          "code": "DB00455",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00455",
          "code_system": "DRUG BANK",
          "references": [
            "4535ff58-723c-4021-8be3-3e2b1512a7c4"
          ]
        },
        {
          "uuid": "d7358997-84d7-424b-ac18-32f4b526ed36",
          "code": "CHEMBL998",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL998",
          "code_system": "ChEMBL",
          "references": [
            "4535ff58-723c-4021-8be3-3e2b1512a7c4"
          ]
        },
        {
          "uuid": "86846268-ebf7-47d2-861c-38629ca20cdd",
          "code": "3957",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3957",
          "code_system": "PUBCHEM",
          "references": [
            "4535ff58-723c-4021-8be3-3e2b1512a7c4"
          ]
        },
        {
          "uuid": "bffd27e3-3491-03a2-4cb7-ff1e96c418d9",
          "code": "3578",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3578",
          "code_system": "HSDB",
          "references": [
            "158a44b7-624a-28e0-51ee-0e1ea1f3ff28"
          ]
        },
        {
          "uuid": "07f0b688-da7c-737e-f9d4-deb82e7ff5f2",
          "code": "DTXSID2023224",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2023224",
          "code_system": "EPA CompTox",
          "references": [
            "2d0d8aaa-84b2-90e8-03c6-58c533492ffa"
          ]
        },
        {
          "uuid": "937093d3-6faf-22a9-202f-9862b658f7bc",
          "code": "C29578",
          "comments": "Pharmacologic Substance[C1909]|Immunotherapeutic Agent[C308]|Histamine-1 Receptor Antagonist",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29578",
          "code_system": "NCI_THESAURUS",
          "references": [
            "8b1210a3-d446-f446-9cfb-882182d34847"
          ]
        },
        {
          "uuid": "b804d475-55eb-4ed1-b180-9f3e976b64e7",
          "code": "7AJO3BO7QN",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b7cce686-3609-807f-8afa-e4aa9051040b",
          "code": "Loratadine",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM163/",
          "code_system": "LACTMED",
          "references": [
            "8b1210a3-d446-f446-9cfb-882182d34847"
          ]
        },
        {
          "uuid": "a18047ab-3a62-b5e0-faa7-71771a2b05af",
          "code": "1605",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1605",
          "code_system": "DRUG CENTRAL",
          "references": [
            "8b1210a3-d446-f446-9cfb-882182d34847"
          ]
        },
        {
          "uuid": "78106e40-3151-2bf5-032b-956084b450a6",
          "code": "1370270",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1370270",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "8b1210a3-d446-f446-9cfb-882182d34847"
          ]
        },
        {
          "uuid": "c084baed-2926-dccf-3d7e-d7eaf1de5309",
          "code": "W-119",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/W-119/relevant/1/",
          "code_system": "USAN",
          "references": [
            "33e3fb09-7138-b52c-07e6-e45e5a10c878"
          ]
        },
        {
          "uuid": "da33a232-4e31-0e8b-4056-ee88602f5214",
          "code": "7AJO3BO7QN",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=7AJO3BO7QN",
          "code_system": "DAILYMED",
          "references": [
            "c8b26780-8e4f-9ea6-5a07-405d8c8cbbfd"
          ]
        },
        {
          "uuid": "2c9fe87c-662c-6088-73d0-57f9b3e8089d",
          "code": "100000092179",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "1e4ed494-cad4-773b-56c7-c4084d8b8d03"
          ]
        },
        {
          "uuid": "10a1c02b-71f3-4b1a-5ea6-f08908e80845",
          "code": "758628",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=758628",
          "code_system": "NSC",
          "references": [
            "502c12e9-060b-d723-23c8-4b565f395ac2"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "3c6c8247-837d-42e5-885f-9972c22ed3f2",
          "citation": "USP42-NF37 - 2621, Loratadine Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b5b62804-bd94-2725-386f-b2b3e7d5dd3e",
          "citation": "https://clinicaltrials.gov/ct2/show/NCT04162795?intr=BAY76-2211&draw=2&rank=1",
          "doc_type": "CLINICAL_TRIALS.GOV",
          "public_domain": true
        },
        {
          "uuid": "85e84a30-eca7-1271-e199-59c7b7f52c53",
          "citation": "European Pharmacopoeia Online 9.8, Loratadine Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "17c27045-0b05-4f2d-e2c7-37b355d90371",
          "citation": "USP42-NF37 - 2621, Loratadine Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "73527977-1f21-492d-a30d-9a8377761a9d",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "cb1b9751-b451-4999-8b2f-6b68a8232da1",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b440223b-e05d-41bc-a428-88be223d890d",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "abe1b1ac-dd53-4194-831b-8779ae94f7bf",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a872db4e-ae3d-4360-ac8b-431e23f62832",
          "citation": "INN Proposed List 54",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL54.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3e1f22c3-7ce5-4477-93b8-4e36c9328182",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "253af2db-1695-4ca6-ad80-db2ec699c83f",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "48e1e7ab-064e-4571-a4cb-87f1c0302d14",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2d0f7aca-fa49-4d72-a2b8-1ec77a54501b",
          "citation": "Drugs@FDA 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "59873d17-40e2-4499-be94-0249b3942d30",
          "citation": "Drugs@FDA 2012",
          "doc_type": "DRUGS@FDA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e9f5ee2d-55b4-44cc-aa78-264576505350",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cf7a7296-3885-4efa-9182-98f95412597d",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5e3d5153-841b-4a34-9ccd-e55eca7462c7",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3e6bf796-23e1-43fe-aef1-f9ba477b4beb",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9cf48005-3b9f-4161-b693-ff71285cac24",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8bfebe3f-66f5-40d8-bd15-ea4d5b58200c",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "987058ff-8c5d-4bc2-9ba5-0e8e15df0ff6",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6f4edcc4-c312-452a-b710-784ed56302ca",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4535ff58-723c-4021-8be3-3e2b1512a7c4",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389743000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f5fed123-1046-46ac-93e9-fa161afae6e9",
          "citation": "EP 7.8 LORATADINE MONOGRAPH",
          "doc_type": "EUROPEAN PHARMACOPEIA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ef04c15f-519d-47cc-971d-f95ddae1a10f",
          "citation": "USP 36 LORATADINE MONOGRAPH",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7849fbc9-25e0-4511-9085-a70eda5092f0",
          "citation": "BIOCHEM PHARMACOL. 1996, 51,\\\\n165-172",
          "url": "http://www.ncbi.nlm.nih.gov/pubmed/?term=8615885",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "af1c5b64-33fa-4096-a9b3-9f254e304335",
          "citation": "https://en.wikipedia.org/wiki/Loratadine",
          "url": "https://en.wikipedia.org/wiki/Loratadine",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d66cf34a-5e51-4262-9179-24297c1ce53c",
          "citation": "SRS import [7AJO3BO7QN]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=7AJO3BO7QN",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389743000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f59ee0c5-23c5-458b-8a4c-6cbcd5ceefe8",
          "citation": "LORATADINE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0fe173eb-c096-4ac4-91cc-662b2d2bdd0a",
          "citation": "LORATADINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "dda60c2f-6793-414c-a26a-78933a0d012e",
          "citation": "LORATADINE [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7ae1f315-01b6-4552-8e37-e8b2931531eb",
          "citation": "LORATADINE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f93ce815-fbde-42ec-b0f7-654953b94bd9",
          "citation": "LORATADINE [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5a27ce38-76ef-4ab6-be15-bb3e6b346928",
          "citation": "LORATADINE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5d24a762-eddd-4645-a4f3-f2f58e81be3e",
          "citation": "LORATADINE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ba2c7e94-6b0c-47e2-9f9d-9b7fd0f5c766",
          "citation": "LORATADINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9339f294-9a4d-48d3-a776-84e3a7a4b2b1",
          "citation": "LORATADINE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3945734b-2e07-4ec3-83b8-5259405c11b7",
          "citation": "LORATADINE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "963b9d77-1004-44f5-9d2a-1b5bab2281f6",
          "citation": "LORATADINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4769c9ce-36f0-4173-bf58-d9343b67a9e0",
          "citation": "LORATADINE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "942c2155-cf46-afbe-a519-908fb77402f3",
          "citation": "Pharmacol Rev 65:578–640, April 2013",
          "url": "http://dx.doi.org/10.1124/pr.111.005439",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "158a44b7-624a-28e0-51ee-0e1ea1f3ff28",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+79794-75-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2d0d8aaa-84b2-90e8-03c6-58c533492ffa",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=79794-75-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9d05145c-1e2a-73b6-468a-a9aaf263e995",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+79794-75-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0418ad90-bbb0-50bf-763d-84b8b6a765b8",
          "citation": "https://www.clinicalkey.com/pharmacology/monograph/356?sec=monphar",
          "doc_type": "LEPINDEX",
          "public_domain": true
        },
        {
          "uuid": "ba81b0e8-2272-5c7f-8dec-eaf0d2e1b541",
          "citation": "Obach, R. S., Huynh, P., Allen, M. C. and Beedham, C. (2004), Human Liver Aldehyde Oxidase: Inhibition by 239 Drugs. The Journal of Clinical Pharmacology, 44: 7–19. doi:10.1177/0091270003260336",
          "url": "http://onlinelibrary.wiley.com/doi/10.1177/0091270003260336/full",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "1e4ed494-cad4-773b-56c7-c4084d8b8d03",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "8b1210a3-d446-f446-9cfb-882182d34847",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "33e3fb09-7138-b52c-07e6-e45e5a10c878",
          "citation": "USAD COUN",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "4a5acd5c-56e1-43cf-a592-c0b9dabb11b1",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "39825c53-158a-9f7c-c21b-8befd5d6e904",
          "citation": "USP43-NF38 - 1259, Desloratadine Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2f78385d-ecd7-48f7-9506-5b24800baacd",
          "citation": "SCIFINDER",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e93bebb9-975f-4c46-b3e1-71ba8b49faed",
          "citation": "SCIFINDER",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "26e13c28-57a8-a16f-4c7f-2fb618d92b5e",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "432ee183-518b-415a-962e-bb770c562400",
          "citation": "Pharmacol Rev 65:578–640, April 2013",
          "url": "http://dx.doi.org/10.1124/pr.111.005439",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "bb3bc22a-0f98-42f6-b790-eb72578e7c6b",
          "citation": "Eur J Pharmacol 1999 Jun 18;374(2):249-54",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "502c12e9-060b-d723-23c8-4b565f395ac2",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "253a5a9b-d224-319e-d898-615631c624aa",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "e483e53e-2c35-46f5-8f60-303d06289fbc",
          "citation": "Pharmacol Rev 65:578–640, April 2013",
          "url": "http://dx.doi.org/10.1124/pr.111.005439",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "c9aaeae2-50ec-4ee8-87c9-5eb49ffdcbc5",
          "citation": "Eur J Pharmacol 1999 Jun 18;374(2):249-54",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c8b26780-8e4f-9ea6-5a07-405d8c8cbbfd",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "0ad7c647-c60d-02fc-6c2c-0b0fedf84131",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a700c043-1c21-48b6-9e76-41429b8c4d55",
          "id": "a700c043-1c21-48b6-9e76-41429b8c4d55",
          "molfile": "\n  Marvin  01132108402D          \n\n 27 30  0  0  0  0            999 V2000\n    5.4360   -6.2685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7581   -5.8497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1424   -6.3108    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4695   -5.8921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7915   -6.2984    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4695   -5.2815    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7093   -4.8029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7093   -3.9804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3897   -3.6439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1200   -3.9929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1300   -4.8104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3897   -3.1031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1823   -2.7242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8777   -3.0906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6080   -2.7068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6180   -1.8644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2361   -1.5204    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    4.8901   -1.4456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1723   -1.8768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7785   -1.4232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0732   -1.4157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6121   -1.8195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8419   -1.3609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0767   -1.8195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0767   -2.6769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8419   -3.1255    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6121   -2.6769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6 11  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  1  0  0  0  0\n  9 12  2  0  0  0  0\n 11 10  1  0  0  0  0\n 13 12  1  0  0  0  0\n 27 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 19 13  2  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 16  2  0  0  0  0\n 18 19  1  0  0  0  0\n 20 19  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 23 22  1  0  0  0  0\n 22 27  2  0  0  0  0\n 24 23  2  0  0  0  0\n 25 24  1  0  0  0  0\n 25 26  2  0  0  0  0\n 26 27  1  0  0  0  0\nM  END",
          "smiles": "CCOC(=O)N1CCC(=C2c3ccc(cc3CCc4cccnc42)Cl)CC1",
          "formula": "C22H23ClN2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c0f889d2-d6ef-4a0c-a7ab-eaef726b35ad"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "382.884",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "236d3871-a486-479d-b589-cfba4507c20b",
      "version": "51",
      "structure": {
        "id": "477f17a5-0327-4ef0-8782-24fd2d96f573",
        "molfile": "\n  Marvin  01132103452D          \n\n 27 30  0  0  0  0            999 V2000\n    3.3897   -3.1031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1823   -2.7242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6121   -2.6769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4695   -5.2815    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4695   -5.8921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3897   -3.6439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1723   -1.8768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8777   -3.0906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8419   -3.1255    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6121   -1.8195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7093   -4.8029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1300   -4.8104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7915   -6.2984    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8901   -1.4456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7093   -3.9804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1200   -3.9929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7785   -1.4232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0732   -1.4157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6180   -1.8644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1424   -6.3108    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6080   -2.7068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2361   -1.5204    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    1.0767   -2.6769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8419   -1.3609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7581   -5.8497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0767   -1.8195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4360   -6.2685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4 12  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  1  2  0  0  0  0\n  7  2  2  0  0  0  0\n  8  2  1  0  0  0  0\n  9  3  1  0  0  0  0\n 10  3  2  0  0  0  0\n 11 15  1  0  0  0  0\n 12 16  1  0  0  0  0\n 13  5  2  0  0  0  0\n 14  7  1  0  0  0  0\n 15  6  1  0  0  0  0\n 16  6  1  0  0  0  0\n 17  7  1  0  0  0  0\n 18 10  1  0  0  0  0\n 19 21  1  0  0  0  0\n 20  5  1  0  0  0  0\n 21  8  2  0  0  0  0\n 22 19  1  0  0  0  0\n 23  9  2  0  0  0  0\n 24 10  1  0  0  0  0\n 25 20  1  0  0  0  0\n 26 24  2  0  0  0  0\n 27 25  1  0  0  0  0\n  4 11  1  0  0  0  0\n 17 18  1  0  0  0  0\n 23 26  1  0  0  0  0\n 14 19  2  0  0  0  0\nM  END",
        "smiles": "CCOC(=O)N1CCC(=C2c3ccc(cc3CCc4cccnc42)Cl)CC1",
        "formula": "C22H23ClN2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "382.884",
        "optical_activity": "NONE",
        "references": [
          "d66cf34a-5e51-4262-9179-24297c1ce53c",
          "73527977-1f21-492d-a30d-9a8377761a9d",
          "a872db4e-ae3d-4360-ac8b-431e23f62832"
        ],
        "stereo_centers": 0
      },
      "unii": "7AJO3BO7QN",
      "relationships": [
        {
          "uuid": "d1ddbee3-d2fb-4d28-9319-94c566417630",
          "amount": {
            "uuid": "4174be48-59a2-4a60-9061-534643dc3e5a",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 101.5,
            "low_limit": 98.5
          },
          "qualification": "EP",
          "type": "BASIS OF STRENGTH->SUBSTANCE",
          "interaction_type": "ASSAY (TITRATION)",
          "references": [
            "f5fed123-1046-46ac-93e9-fa161afae6e9"
          ],
          "related_substance": {
            "uuid": "4055e49a-cf63-4dcc-a78a-5a6c28875eb1",
            "refuuid": "236d3871-a486-479d-b589-cfba4507c20b",
            "name": "LORATADINE",
            "unii": "7AJO3BO7QN",
            "linking_id": "7AJO3BO7QN",
            "ref_pname": "LORATADINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f4544f2a-c3e8-4e83-95c9-ebc0319fc1b4",
          "amount": {
            "uuid": "6903720a-f853-4af9-9fa3-ee347e296a7a",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 101,
            "low_limit": 98.5
          },
          "qualification": "USP",
          "type": "BASIS OF STRENGTH->SUBSTANCE",
          "interaction_type": "ASSAY (HPLC)",
          "references": [
            "ef04c15f-519d-47cc-971d-f95ddae1a10f"
          ],
          "related_substance": {
            "uuid": "2eb34a5f-6c5d-4a60-859b-167a9eeb78f2",
            "refuuid": "236d3871-a486-479d-b589-cfba4507c20b",
            "name": "LORATADINE",
            "unii": "7AJO3BO7QN",
            "linking_id": "7AJO3BO7QN",
            "ref_pname": "LORATADINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "47ccc3d3-2589-46fc-bd14-4d01e9d74469",
          "amount": {
            "uuid": "915a79cb-554f-4e3f-bf41-26faca3d73a8",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "f5fed123-1046-46ac-93e9-fa161afae6e9"
          ],
          "related_substance": {
            "uuid": "ef31a473-6b71-4da6-ad46-e73421b9d768",
            "refuuid": "2fc57b0a-9eb6-46c1-b738-6d40a353d710",
            "name": "Desloratadine",
            "unii": "FVF865388R",
            "linking_id": "FVF865388R",
            "ref_pname": "Desloratadine",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6f19be46-78b4-462e-b837-8ce4616b9fd5",
          "amount": {
            "uuid": "7ca6e4f5-cce7-4080-a114-ccce78ba9b63",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "ef04c15f-519d-47cc-971d-f95ddae1a10f",
            "17c27045-0b05-4f2d-e2c7-37b355d90371"
          ],
          "related_substance": {
            "uuid": "daa7c7e5-df4e-4ac5-88dc-3208c140082a",
            "refuuid": "2fc57b0a-9eb6-46c1-b738-6d40a353d710",
            "name": "Desloratadine",
            "unii": "FVF865388R",
            "linking_id": "FVF865388R",
            "ref_pname": "Desloratadine",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "24a45e05-0806-4d7d-a6ab-8ac2e49680e2",
          "amount": {
            "uuid": "a6dfe66a-5a55-4fda-8470-bae00add8cec",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "comments": "UNSPECIFIED",
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "f5fed123-1046-46ac-93e9-fa161afae6e9",
            "85e84a30-eca7-1271-e199-59c7b7f52c53"
          ],
          "related_substance": {
            "uuid": "602d6c45-fa67-4a23-b68c-112f6c5b4a48",
            "refuuid": "a3a31365-4f59-4cfa-8f22-f36ac85e76c2",
            "name": "N-METHYLDESLORATADINE",
            "unii": "70V8053T5G",
            "linking_id": "70V8053T5G",
            "ref_pname": "N-METHYLDESLORATADINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "419980c8-0329-4598-887b-5e91ba6d26d5",
          "amount": {
            "uuid": "f71b0717-4b5a-49fa-82b2-15f96fd7bc40",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "ef04c15f-519d-47cc-971d-f95ddae1a10f",
            "17c27045-0b05-4f2d-e2c7-37b355d90371"
          ],
          "related_substance": {
            "uuid": "15c6fc62-07cf-4410-b44a-ac9353b213db",
            "refuuid": "a3a31365-4f59-4cfa-8f22-f36ac85e76c2",
            "name": "N-METHYLDESLORATADINE",
            "unii": "70V8053T5G",
            "linking_id": "70V8053T5G",
            "ref_pname": "N-METHYLDESLORATADINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6d3fe303-4557-4a64-9e17-3fbc5bd555d0",
          "amount": {
            "uuid": "b19daed0-fc05-43c2-a4bd-03be5b2de76b",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "ef04c15f-519d-47cc-971d-f95ddae1a10f",
            "17c27045-0b05-4f2d-e2c7-37b355d90371"
          ],
          "related_substance": {
            "uuid": "f78f8258-7398-440e-bed9-2e8df8e927a6",
            "refuuid": "ffb626da-617b-46a2-a62d-115abbf1359b",
            "name": "8-CHLORO-5,6-DIHYDRO-11H-BENZO(5,6)CYCLOHEPTA(1,2-B)PYRIDIN-11-ONE",
            "unii": "Y8MA5G8500",
            "linking_id": "Y8MA5G8500",
            "ref_pname": "8-CHLORO-5,6-DIHYDRO-11H-BENZO(5,6)CYCLOHEPTA(1,2-B)PYRIDIN-11-ONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f4653393-bcd3-4aa2-9785-9c1099b73eaf",
          "amount": {
            "uuid": "a33c98ff-f092-4e2c-a15b-dae75277e6b1",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "ef04c15f-519d-47cc-971d-f95ddae1a10f",
            "17c27045-0b05-4f2d-e2c7-37b355d90371"
          ],
          "related_substance": {
            "uuid": "d54b879a-d4c2-4869-bc94-3ef546abe82e",
            "refuuid": "0f07f7d4-65da-4d0d-b7f7-7c513576361a",
            "name": "4-CHLOROLORATADINE",
            "unii": "K330Z55R0Q",
            "linking_id": "K330Z55R0Q",
            "ref_pname": "4-CHLOROLORATADINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "5a5ab1a8-54a1-4506-b774-a7e6cde070e9",
          "amount": {
            "uuid": "a3b17d99-ed92-4f21-b58b-9cfcf5659933",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "ef04c15f-519d-47cc-971d-f95ddae1a10f",
            "17c27045-0b05-4f2d-e2c7-37b355d90371"
          ],
          "related_substance": {
            "uuid": "a73b0d0f-27f9-4629-ae2e-c3988723c50a",
            "refuuid": "6d849696-a854-4bf9-b666-7357dfac9caa",
            "name": "4,8-DICHLORO-5,6-DIHYDRO-11H-BENZO(5,6)CYCLOHEPTA(1,2-B)PYRIDIN-11-ONE",
            "unii": "U665LG9V5L",
            "linking_id": "U665LG9V5L",
            "ref_pname": "4,8-DICHLORO-5,6-DIHYDRO-11H-BENZO(5,6)CYCLOHEPTA(1,2-B)PYRIDIN-11-ONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "47a0c8e4-eb26-48d3-9d90-816b33d7fa31",
          "amount": {
            "uuid": "1c20bb9c-6395-4f2d-96f1-ba0f7800a12f",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "comments": "For the calculation of contents, multiply the peak areas by 1.9",
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "f5fed123-1046-46ac-93e9-fa161afae6e9",
            "17c27045-0b05-4f2d-e2c7-37b355d90371"
          ],
          "related_substance": {
            "uuid": "2d3e0917-7e34-4905-8122-b52b9037d728",
            "refuuid": "fbefd18c-6458-46fb-a849-21589c7bfad9",
            "name": "ISOLORATADINE",
            "unii": "YK67152G1K",
            "linking_id": "YK67152G1K",
            "ref_pname": "ISOLORATADINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "69648503-0a0b-4bfc-a28a-3547c096a451",
          "amount": {
            "uuid": "ef013847-32e4-4477-9b3e-b11113a615cb",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "comments": "For the calculation of contents, multiply the peak areas by 1.6",
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "f5fed123-1046-46ac-93e9-fa161afae6e9",
            "85e84a30-eca7-1271-e199-59c7b7f52c53"
          ],
          "related_substance": {
            "uuid": "f79cbc3d-1185-4a8d-b29d-f192333c6229",
            "refuuid": "54a7e110-78e4-4b4c-8709-105ec6a20892",
            "name": "11-FLUORO DIHYDROLORATADINE",
            "unii": "VLO9J5175E",
            "linking_id": "VLO9J5175E",
            "ref_pname": "11-FLUORO DIHYDROLORATADINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "dbc2b2c4-f135-47c9-a96e-be269d1068c2",
          "amount": {
            "uuid": "67c4494a-9bb9-4881-bdfa-2e87521fa29b",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (GC)",
          "references": [
            "f5fed123-1046-46ac-93e9-fa161afae6e9"
          ],
          "related_substance": {
            "uuid": "88a88249-a6c0-4910-9890-f60dcfa0f6b8",
            "refuuid": "6503d4e7-62b2-41ec-b5e2-05d42eaf7396",
            "name": "ETHYL 4-OXO-1-PIPERIDINECARBOXYLATE",
            "unii": "7H5JX1S259",
            "linking_id": "7H5JX1S259",
            "ref_pname": "ETHYL 4-OXO-1-PIPERIDINECARBOXYLATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d5a41575-1d0a-48fb-93d4-5ae62f8f6818",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "68d6de6a-5b3a-4e0d-bb1c-115e26ab13bb",
            "refuuid": "236d3871-a486-479d-b589-cfba4507c20b",
            "name": "LORATADINE",
            "unii": "7AJO3BO7QN",
            "linking_id": "7AJO3BO7QN",
            "ref_pname": "LORATADINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "544de947-aff2-483c-8b25-4426b558dbc7",
          "type": "METABOLITE ACTIVE->PARENT",
          "mediator_substance": {
            "uuid": "60a7e5c1-1dfd-443e-9f21-5e24908fa309",
            "refuuid": "cc92795c-ba54-4e71-a72b-1af36b57df6b",
            "name": "CYTOCHROME P450 2D6",
            "unii": "8E4LAA4357",
            "linking_id": "8E4LAA4357",
            "ref_pname": "CYTOCHROME P450 2D6",
            "substance_class": "reference"
          },
          "references": [
            "7849fbc9-25e0-4511-9085-a70eda5092f0"
          ],
          "related_substance": {
            "uuid": "34bbf08b-3d57-487c-a524-b2a8370a8c2a",
            "refuuid": "2fc57b0a-9eb6-46c1-b738-6d40a353d710",
            "name": "Desloratadine",
            "unii": "FVF865388R",
            "linking_id": "FVF865388R",
            "ref_pname": "Desloratadine",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "7ece470d-79e9-48b6-9c70-9739e5cf2840",
          "amount": {
            "uuid": "d3241ade-b7b4-4d86-804b-163d1188ed6a"
          },
          "type": "METABOLITE ACTIVE->PARENT",
          "interaction_type": "MAJOR",
          "mediator_substance": {
            "uuid": "4d6c4b94-ec87-434d-9b85-7cc2cd700d8d",
            "refuuid": "4275827d-e329-4907-95b5-7d690692872a",
            "name": "CYTOCHROME P450 3A4",
            "unii": "PUO0521HZV",
            "linking_id": "PUO0521HZV",
            "ref_pname": "CYTOCHROME P450 3A4",
            "substance_class": "reference"
          },
          "references": [
            "e483e53e-2c35-46f5-8f60-303d06289fbc",
            "c9aaeae2-50ec-4ee8-87c9-5eb49ffdcbc5"
          ],
          "related_substance": {
            "uuid": "494cd078-3783-4772-befb-5d5839e3c43d",
            "refuuid": "2fc57b0a-9eb6-46c1-b738-6d40a353d710",
            "name": "Desloratadine",
            "unii": "FVF865388R",
            "linking_id": "FVF865388R",
            "ref_pname": "Desloratadine",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "7d75932d-33a2-4400-af04-a8d6a0a8f893",
          "type": "TARGET->INHIBITOR",
          "references": [
            "af1c5b64-33fa-4096-a9b3-9f254e304335"
          ],
          "related_substance": {
            "uuid": "b26b5d5a-b543-4796-a065-39a6038461d2",
            "refuuid": "23559f52-21c8-4b43-92f1-981b36cdfe1d",
            "name": "HISTAMINE H1 RECEPTOR",
            "unii": "28XBT591QG",
            "linking_id": "28XBT591QG",
            "ref_pname": "HISTAMINE H1 RECEPTOR",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1eef9daf-578e-4d5d-b9a2-53eeeb40a503",
          "amount": {
            "uuid": "3e99dabb-f1ea-47f4-a484-49cd0363d55f",
            "average": 97,
            "units": "%"
          },
          "type": "BINDER->LIGAND",
          "references": [
            "942c2155-cf46-afbe-a519-908fb77402f3"
          ],
          "related_substance": {
            "uuid": "42fcb36e-5177-4699-8e6f-ede6371f682d",
            "refuuid": "e95d330b-4c2d-44bb-a61b-860afeb4aa30",
            "name": "PLASMA PROTEIN FRACTION (HUMAN)",
            "unii": "6D53G0FD0Z",
            "linking_id": "6D53G0FD0Z",
            "ref_pname": "PLASMA PROTEIN FRACTION (HUMAN)",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "68f46e38-4f34-44c8-9b1a-b70e7e98e329",
          "amount": {
            "uuid": "c6e72c99-3dd9-4282-97ca-70189bd0976d",
            "average": 0.49,
            "high": 0.62,
            "low": 0.36,
            "units": "MICROMOLAR"
          },
          "qualification": "IC50",
          "type": "METABOLIC ENZYME->INHIBITOR",
          "references": [
            "ba81b0e8-2272-5c7f-8dec-eaf0d2e1b541"
          ],
          "related_substance": {
            "uuid": "e7916c62-74ae-43f0-b46b-3839df855643",
            "refuuid": "393aa2e6-c500-402e-8f58-a069ed6e2771",
            "name": "ALDEHYDE OXIDASE",
            "unii": "LR0F81F33L",
            "linking_id": "LR0F81F33L",
            "ref_pname": "ALDEHYDE OXIDASE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "85868646-d5ff-4b3c-a02e-5367a8217d9b",
          "amount": {
            "uuid": "1f179f7f-2f85-4004-aa49-d70b1af3a59d",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.2
          },
          "qualification": "USP",
          "type": "PARENT->IMPURITY",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "39825c53-158a-9f7c-c21b-8befd5d6e904"
          ],
          "related_substance": {
            "uuid": "5fdd7cb7-d10c-45f4-8158-7fb793166923",
            "refuuid": "2fc57b0a-9eb6-46c1-b738-6d40a353d710",
            "name": "Desloratadine",
            "unii": "FVF865388R",
            "linking_id": "FVF865388R",
            "ref_pname": "Desloratadine",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "07c5e907-bfa7-4c76-9e18-38fe8caefb73",
          "amount": {
            "uuid": "de0eeaa7-a0d8-4bd7-aba9-6e172534814a",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "17c27045-0b05-4f2d-e2c7-37b355d90371"
          ],
          "related_substance": {
            "uuid": "227197c8-4b08-4ca4-8f9e-b34f80af2816",
            "refuuid": "6a2e19e2-d381-44dc-84ef-d9c2a307e62b",
            "name": "11-HYDROXY DIHYDRO LORATADINE",
            "unii": "7EJO90SZA2",
            "linking_id": "7EJO90SZA2",
            "ref_pname": "11-HYDROXY DIHYDRO LORATADINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ac43dd04-a439-41bf-a3ba-56010bfbc4f3",
          "amount": {
            "uuid": "5ca9933a-ca2b-48c3-b516-71b8550dac9d",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.2
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "17c27045-0b05-4f2d-e2c7-37b355d90371"
          ],
          "related_substance": {
            "uuid": "c0c241ab-1b0f-4e16-9c08-cb80558b2690",
            "refuuid": "54a7e110-78e4-4b4c-8709-105ec6a20892",
            "name": "11-FLUORO DIHYDROLORATADINE",
            "unii": "VLO9J5175E",
            "linking_id": "VLO9J5175E",
            "ref_pname": "11-FLUORO DIHYDROLORATADINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "72abda96-6747-4585-9553-7fba4e178d89",
          "amount": {
            "uuid": "2d758d65-3621-4fd4-a581-7d3c24e12924"
          },
          "type": "IMPURITY->PARENT",
          "references": [
            "e93bebb9-975f-4c46-b3e1-71ba8b49faed"
          ],
          "related_substance": {
            "uuid": "25e7a2a6-f9a2-4c0e-958f-0b7956e134cf",
            "refuuid": "dd07ed6e-c652-4b35-be21-d080a7cac54b",
            "name": "2-HYDROXYMETHYL LORATADINE",
            "unii": "ST4DXF8D32",
            "linking_id": "ST4DXF8D32",
            "ref_pname": "2-HYDROXYMETHYL LORATADINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0fd98505-8c91-4473-a12d-c152ddfb0765",
          "amount": {
            "uuid": "40b9e8fe-afe1-4760-83bd-04175a7f86e0"
          },
          "type": "IMPURITY->PARENT",
          "references": [
            "2f78385d-ecd7-48f7-9506-5b24800baacd"
          ],
          "related_substance": {
            "uuid": "d87d9147-9d03-4444-a4e0-78c087873355",
            "refuuid": "d8935600-5c9b-4c29-87f4-c184032ce4f6",
            "name": "4-HYDROXYMETHYL LORATADINE",
            "unii": "W2PK8Q54XB",
            "linking_id": "W2PK8Q54XB",
            "ref_pname": "4-HYDROXYMETHYL LORATADINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f1c9aab8-a429-48c4-9928-b7218c06796b",
          "type": "PARENT->INNOVATOR",
          "related_substance": {
            "uuid": "858dd308-f399-417e-bf39-0c8ced32516c",
            "refuuid": "8d876e36-d044-4d46-b7c8-0401d032f8a1",
            "name": "LORATADINE HYDROCHLORIDE",
            "unii": "RTQ46SZY8H",
            "linking_id": "RTQ46SZY8H",
            "ref_pname": "LORATADINE HYDROCHLORIDE"
          }
        }
      ],
      "names": [
        {
          "uuid": "076f1b62-942f-4474-a0ab-81188bd48f2d",
          "name": "1-PIPERIDINECARBOXYLIC ACID, 4-(8-CHLORO-5,6-DIHYDRO-11H-BENZO(5,6)CYCLOHEPTA(1,2-B)PYRIDIN-11-YLIDENE)-, ETHYL ESTER",
          "stdName": "1-PIPERIDINECARBOXYLIC ACID, 4-(8-CHLORO-5,6-DIHYDRO-11H-BENZO(5,6)CYCLOHEPTA(1,2-B)PYRIDIN-11-YLIDENE)-, ETHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b440223b-e05d-41bc-a428-88be223d890d"
          ],
          "display_name": false
        },
        {
          "uuid": "6f9ead00-1658-42ed-9d12-929a5c1e49ef",
          "name": "ALAVERT",
          "stdName": "ALAVERT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b440223b-e05d-41bc-a428-88be223d890d"
          ],
          "display_name": false
        },
        {
          "uuid": "56d23800-5d30-6cdd-186e-2e872aaa1bca",
          "name": "BAY76-2211",
          "stdName": "BAY76-2211",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b5b62804-bd94-2725-386f-b2b3e7d5dd3e"
          ],
          "display_name": false
        },
        {
          "uuid": "c84ebdf7-76b6-4e75-91b1-09ecd7ed707d",
          "name": "CLARITIN",
          "stdName": "CLARITIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b440223b-e05d-41bc-a428-88be223d890d"
          ],
          "display_name": false
        },
        {
          "uuid": "785418cb-3a11-47a0-a7c9-503cc2fc2de1",
          "name": "CLARITIN-D COMPONENT LORATADINE",
          "stdName": "CLARITIN-D COMPONENT LORATADINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2d0f7aca-fa49-4d72-a2b8-1ec77a54501b",
            "59873d17-40e2-4499-be94-0249b3942d30"
          ],
          "display_name": false
        },
        {
          "uuid": "d464e5fc-83c1-4ecc-b27a-1f0be2472535",
          "name": "Ethyl 4-(8-chloro-5,6-dihydro-11H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-ylidene)-1-piperidinecarboxylate",
          "stdName": "ETHYL 4-(8-CHLORO-5,6-DIHYDRO-11H-BENZO(5,6)CYCLOHEPTA(1,2-B)PYRIDIN-11-YLIDENE)-1-PIPERIDINECARBOXYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b440223b-e05d-41bc-a428-88be223d890d"
          ],
          "display_name": false
        },
        {
          "uuid": "97c67e2c-b446-4fd1-91a0-14f2879d3ab8",
          "name": "LORATADINE",
          "stdName": "LORATADINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3e6bf796-23e1-43fe-aef1-f9ba477b4beb",
            "963b9d77-1004-44f5-9d2a-1b5bab2281f6",
            "cf7a7296-3885-4efa-9182-98f95412597d",
            "9cf48005-3b9f-4161-b693-ff71285cac24",
            "4769c9ce-36f0-4173-bf58-d9343b67a9e0",
            "48e1e7ab-064e-4571-a4cb-87f1c0302d14",
            "dda60c2f-6793-414c-a26a-78933a0d012e",
            "8bfebe3f-66f5-40d8-bd15-ea4d5b58200c",
            "9339f294-9a4d-48d3-a776-84e3a7a4b2b1",
            "3945734b-2e07-4ec3-83b8-5259405c11b7",
            "f59ee0c5-23c5-458b-8a4c-6cbcd5ceefe8",
            "a872db4e-ae3d-4360-ac8b-431e23f62832",
            "5e3d5153-841b-4a34-9ccd-e55eca7462c7",
            "abe1b1ac-dd53-4194-831b-8779ae94f7bf",
            "e9f5ee2d-55b4-44cc-aa78-264576505350",
            "ba2c7e94-6b0c-47e2-9f9d-9b7fd0f5c766",
            "3e1f22c3-7ce5-4477-93b8-4e36c9328182",
            "5d24a762-eddd-4645-a4f3-f2f58e81be3e",
            "f93ce815-fbde-42ec-b0f7-654953b94bd9",
            "253af2db-1695-4ca6-ad80-db2ec699c83f",
            "0fe173eb-c096-4ac4-91cc-662b2d2bdd0a",
            "987058ff-8c5d-4bc2-9ba5-0e8e15df0ff6",
            "7ae1f315-01b6-4552-8e37-e8b2931531eb",
            "73527977-1f21-492d-a30d-9a8377761a9d",
            "5a27ce38-76ef-4ab6-be15-bb3e6b346928"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "9deb3a94-aa4b-4b65-904b-3a2543cafe31",
              "name_org": "USAN"
            },
            {
              "uuid": "667a5867-df66-4703-8089-3f29b7cdc7e1",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "ce6dcd83-e79e-7dfd-cb1f-843da1a17670",
          "name": "LORATADINE [EP IMPURITY]",
          "stdName": "LORATADINE [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3e1f22c3-7ce5-4477-93b8-4e36c9328182"
          ],
          "display_name": false
        },
        {
          "uuid": "3f4a45ac-7f0f-d244-3bf3-1f291c3e4923",
          "name": "LORATADINE [EP MONOGRAPH]",
          "stdName": "LORATADINE [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "253a5a9b-d224-319e-d898-615631c624aa"
          ],
          "display_name": false
        },
        {
          "uuid": "4415cea1-011b-4c04-b8c0-2f4eaf10212a",
          "name": "LORATADINE [HSDB]",
          "stdName": "LORATADINE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3e6bf796-23e1-43fe-aef1-f9ba477b4beb"
          ],
          "display_name": false
        },
        {
          "uuid": "bb4de7af-33b5-4a93-abe9-898bebc24612",
          "name": "LORATADINE [JAN]",
          "stdName": "LORATADINE [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "48e1e7ab-064e-4571-a4cb-87f1c0302d14"
          ],
          "display_name": false
        },
        {
          "uuid": "26576cad-52ed-48bb-8c06-1794a1289bd5",
          "name": "LORATADINE [MART.]",
          "stdName": "LORATADINE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cf7a7296-3885-4efa-9182-98f95412597d"
          ],
          "display_name": false
        },
        {
          "uuid": "50414b1f-ed72-4092-9d6e-7966e3a3484f",
          "name": "LORATADINE [MI]",
          "stdName": "LORATADINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5e3d5153-841b-4a34-9ccd-e55eca7462c7"
          ],
          "display_name": false
        },
        {
          "uuid": "9741b888-b6d3-4b8a-a78f-b68f6c345560",
          "name": "LORATADINE [ORANGE BOOK]",
          "stdName": "LORATADINE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e9f5ee2d-55b4-44cc-aa78-264576505350"
          ],
          "display_name": false
        },
        {
          "uuid": "64cd6677-e7f2-484f-979e-1bcd838d1245",
          "name": "LORATADINE [USAN]",
          "stdName": "LORATADINE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "abe1b1ac-dd53-4194-831b-8779ae94f7bf"
          ],
          "display_name": false
        },
        {
          "uuid": "3a1079b3-4923-ca99-46ce-9e27900f12c0",
          "name": "LORATADINE [USP MONOGRAPH]",
          "stdName": "LORATADINE [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "26e13c28-57a8-a16f-4c7f-2fb618d92b5e"
          ],
          "display_name": false
        },
        {
          "uuid": "5bb3146f-7e20-43c6-a9b4-b6c167a8cb97",
          "name": "LORATADINE [USP-RS]",
          "stdName": "LORATADINE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9cf48005-3b9f-4161-b693-ff71285cac24"
          ],
          "display_name": false
        },
        {
          "uuid": "9cb23acb-d3f1-4fa7-9fce-c05d200582ac",
          "name": "LORATADINE [VANDF]",
          "stdName": "LORATADINE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "987058ff-8c5d-4bc2-9ba5-0e8e15df0ff6"
          ],
          "display_name": false
        },
        {
          "uuid": "05d29c31-e230-899e-b0b5-65b07a7a89e4",
          "name": "Loratadine [WHO-DD]",
          "stdName": "LORATADINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0ad7c647-c60d-02fc-6c2c-0b0fedf84131"
          ],
          "display_name": false
        },
        {
          "uuid": "9322713e-60f2-da7a-20ac-e1edccd2226e",
          "name": "NSC-758628",
          "stdName": "NSC-758628",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "502c12e9-060b-d723-23c8-4b565f395ac2"
          ],
          "display_name": false
        },
        {
          "uuid": "63a7b3ba-07bc-4b27-b2f6-554572645fff",
          "name": "SCH 29851",
          "stdName": "SCH 29851",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6f4edcc4-c312-452a-b710-784ed56302ca"
          ],
          "display_name": false
        },
        {
          "uuid": "053eef2b-e3b7-4261-b677-7b98dd3dccee",
          "name": "SCH-29851",
          "stdName": "SCH-29851",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cb1b9751-b451-4999-8b2f-6b68a8232da1"
          ],
          "display_name": false
        },
        {
          "uuid": "8d6e6ca7-8aa5-4385-ba5e-934f308e671b",
          "name": "loratadine [INN]",
          "stdName": "LORATADINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a872db4e-ae3d-4360-ac8b-431e23f62832"
          ],
          "display_name": false
        }
      ],
      "properties": [
        {
          "uuid": "cdef9d70-9ff5-458e-b68f-cc2dc0293e0f",
          "name": "Biological Half-life",
          "value": {
            "uuid": "d9e3f08b-e7be-44c9-8210-02ea8b1176b8",
            "average": 8.4,
            "units": "hours"
          },
          "defining": false,
          "property_type": "PHARMACOKINETIC",
          "references": [
            "0418ad90-bbb0-50bf-763d-84b8b6a765b8"
          ]
        }
      ]
    }
  ]
}