{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "693fb73a-2c96-4bc7-9aa3-1337b922e932",
          "code": "C01BD02",
          "comments": "ATC|CARDIOVASCULAR SYSTEM|CARDIAC THERAPY|ANTIARRHYTHMICS, CLASS I AND III|Antiarrhythmics, class III|bretylium tosilate",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=C01BD02&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "0e19ce81-772c-476e-ba0d-b06f4a8a3ca7"
          ]
        },
        {
          "uuid": "09e55b07-d1f1-4c56-8bdc-4c76c2ebc960",
          "code": "QC01BD02",
          "comments": "VATC|CARDIAC THERAPY|ANTIARRYTHMICS, CLASS I  AND III|Antiarrhythmics, class III|bretylium tosilate",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QC01BD02&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "0e19ce81-772c-476e-ba0d-b06f4a8a3ca7"
          ]
        },
        {
          "uuid": "9f45e1d0-472a-4b2d-a99d-4b745e5522ae",
          "code": "61-75-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=61-75-6",
          "code_system": "CAS",
          "references": [
            "0e19ce81-772c-476e-ba0d-b06f4a8a3ca7",
            "376624ea-7645-4479-994a-6e0d28fa5014"
          ]
        },
        {
          "uuid": "313b9b08-1e17-4cc9-aa1c-667bb6c9355f",
          "code": "C47418",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47418",
          "code_system": "NCI_THESAURUS",
          "references": [
            "0e19ce81-772c-476e-ba0d-b06f4a8a3ca7"
          ]
        },
        {
          "uuid": "e34af642-e80b-4034-ba67-cf3fd457c712",
          "code": "D001950",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68001950",
          "code_system": "MESH",
          "references": [
            "0e19ce81-772c-476e-ba0d-b06f4a8a3ca7"
          ]
        },
        {
          "uuid": "19f87e8a-52e9-4c3f-8da6-bfa644ed7d6d",
          "code": "SUB05887MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "0e19ce81-772c-476e-ba0d-b06f4a8a3ca7"
          ]
        },
        {
          "uuid": "72ccb594-36a2-4efc-8458-f873c5c4e76b",
          "code": "927",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=927",
          "code_system": "INN",
          "references": [
            "0e19ce81-772c-476e-ba0d-b06f4a8a3ca7"
          ]
        },
        {
          "uuid": "ef2610cb-3ad7-4d77-b65a-001187f4f87a",
          "code": "1737",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1737/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "0e19ce81-772c-476e-ba0d-b06f4a8a3ca7"
          ]
        },
        {
          "uuid": "9795b546-90a3-421b-8de0-af6cac3ff901",
          "code": "m2647",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2647?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "0e19ce81-772c-476e-ba0d-b06f4a8a3ca7"
          ]
        },
        {
          "uuid": "bd7a1263-66f2-446d-9b6e-6710d93909a2",
          "code": "CHEMBL1199080",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1199080",
          "code_system": "ChEMBL",
          "references": [
            "0e19ce81-772c-476e-ba0d-b06f4a8a3ca7"
          ]
        },
        {
          "uuid": "cb0c3445-1e0f-485a-83f5-f70cc880deb6",
          "code": "200-516-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.470",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "0e19ce81-772c-476e-ba0d-b06f4a8a3ca7"
          ]
        },
        {
          "uuid": "51567a8b-25be-4557-a611-e6cde6b09983",
          "code": "6100",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6100",
          "code_system": "PUBCHEM",
          "references": [
            "0e19ce81-772c-476e-ba0d-b06f4a8a3ca7"
          ]
        },
        {
          "uuid": "cfb0db36-2962-4431-5786-cee088aacc86",
          "code": "DTXSID1022685",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1022685",
          "code_system": "EPA CompTox",
          "references": [
            "93fb9d32-6bfd-7633-5df8-b6f22edfd22f"
          ]
        },
        {
          "uuid": "8f8d80a5-6b1f-257c-dd37-c8997d1b6594",
          "code": "C47793",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Cardiovascular System[C78274]|Antiarrhythmic Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47793",
          "code_system": "NCI_THESAURUS",
          "references": [
            "f527acd3-7c4f-1730-fb5d-4dc1ccf99874"
          ]
        },
        {
          "uuid": "5bc15234-d990-31b7-7c9f-9eea3dd0c076",
          "code": "C29713",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Adrenergic Agent[C29747]|Adrenergic Antagonist[C72900]|Alpha-Adrenergic Antagonist",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29713",
          "code_system": "NCI_THESAURUS",
          "references": [
            "f527acd3-7c4f-1730-fb5d-4dc1ccf99874"
          ]
        },
        {
          "uuid": "cd5726b4-6f08-4c12-a337-829c780f05c0",
          "code": "78ZP3YR353",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "7e552410-3132-af73-313d-33cb85e66fd8",
          "code": "DBSALT001050",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DBSALT001050",
          "code_system": "DRUG BANK",
          "references": [
            "f527acd3-7c4f-1730-fb5d-4dc1ccf99874"
          ]
        },
        {
          "uuid": "6e535635-6e62-db3f-6b8d-9256f53cc36f",
          "code": "3173",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:3173",
          "code_system": "CHEBI",
          "references": [
            "f527acd3-7c4f-1730-fb5d-4dc1ccf99874"
          ]
        },
        {
          "uuid": "92248d2c-71e0-66f1-ef01-70e0ca459cb4",
          "code": "1076352",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1076352",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "f527acd3-7c4f-1730-fb5d-4dc1ccf99874"
          ]
        },
        {
          "uuid": "c98e530b-edeb-c15e-943d-bc69658e6982",
          "code": "62164",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=62164",
          "code_system": "NSC",
          "references": [
            "d48a7da7-b014-4cea-ef4c-71f24d21b329"
          ]
        },
        {
          "uuid": "b5e985e0-c7dd-4ef5-7d0a-174a1c278597",
          "code": "100000088661",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "cac88911-8a20-f9f5-ddab-aa6a76e70dbd"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "604fdde7-b2e1-45f6-9335-5414dbd2e556",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "befc514b-c11b-414b-9bd4-72f322b6f53f",
            "refuuid": "246c4770-26cd-496c-b19d-2501a923f924",
            "name": "BRETYLIUM",
            "unii": "RZR75EQ2KJ",
            "linking_id": "RZR75EQ2KJ",
            "ref_pname": "BRETYLIUM",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a81f58f8-aead-46b3-a139-b3da7a1d6733",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "a89c4958-370a-4e1b-8540-cac4d5f27247",
            "refuuid": "246c4770-26cd-496c-b19d-2501a923f924",
            "name": "BRETYLIUM",
            "unii": "RZR75EQ2KJ",
            "linking_id": "RZR75EQ2KJ",
            "ref_pname": "BRETYLIUM",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f9bf10e9-4450-48d4-8a1f-98116f3705e9",
          "name": "(O-BROMOBENZYL)ETHYLDIMETHYLAMMONIUM P-TOLUENESULFONATE",
          "stdName": "(O-BROMOBENZYL)ETHYLDIMETHYLAMMONIUM P-TOLUENESULFONATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4e988934-ddb9-4984-8b5b-083ab16e9a20"
          ],
          "display_name": false
        },
        {
          "uuid": "1d8c796e-56e9-4c3c-b36d-42cae51155da",
          "name": "(O-BROMOBENZYL)ETHYLDIMETHYLAMMONIUM P-TOLUENESULPHONATE",
          "stdName": "(O-BROMOBENZYL)ETHYLDIMETHYLAMMONIUM P-TOLUENESULPHONATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e651bf82-6814-452b-bb72-eb2598485d61"
          ],
          "display_name": false
        },
        {
          "uuid": "bc981915-9265-48d5-862b-32a71d3babbc",
          "name": "ASL-603",
          "stdName": "ASL-603",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4e988934-ddb9-4984-8b5b-083ab16e9a20"
          ],
          "display_name": false
        },
        {
          "uuid": "09df9930-0af2-471c-85fc-76bb46de6d52",
          "name": "BENZENEMETHANAMINIUM, 2-BROMO-N-ETHYL-N,N-DIMETHYL-, SALT WITH 4-METHYLBENZENESULFONIC ACID (1:1)",
          "stdName": "BENZENEMETHANAMINIUM, 2-BROMO-N-ETHYL-N,N-DIMETHYL-, SALT WITH 4-METHYLBENZENESULFONIC ACID (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4e988934-ddb9-4984-8b5b-083ab16e9a20"
          ],
          "display_name": false
        },
        {
          "uuid": "abd60fbf-0efc-407d-805b-31112f51e736",
          "name": "BRETYLIUM TOSILATE",
          "stdName": "BRETYLIUM TOSILATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e27e7740-1abe-4f4e-9b08-a630f59bda0d",
            "454c42b6-ab83-4bc4-b2c4-511a1131861d",
            "883dbaae-367f-417c-94c7-6e2d46dc9757",
            "767b58d9-0209-4273-a9f7-e11d7db1c1b1",
            "712586d2-1edd-4cdc-8acd-2849122bbdc5",
            "3e84ba90-2de8-4fab-8ae7-81d6ebf99c31",
            "e651bf82-6814-452b-bb72-eb2598485d61"
          ],
          "display_name": false,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "1ebc2bd2-f53b-4ac2-ba34-1543b2189caa",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "007c0618-66de-4022-a666-bb85b11f070a",
          "name": "BRETYLIUM TOSILATE [MART.]",
          "stdName": "BRETYLIUM TOSILATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "767b58d9-0209-4273-a9f7-e11d7db1c1b1"
          ],
          "display_name": false
        },
        {
          "uuid": "15b6a506-be5f-4733-9d88-c54d6a0ea54e",
          "name": "BRETYLIUM TOSYLATE",
          "stdName": "BRETYLIUM TOSYLATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "354529f0-62a9-49dc-a031-269408c15683",
            "cbb754e6-61c4-4c50-bf21-35ffd1ac8d41",
            "dcee094c-dbf1-40f5-b39e-80019d32322c",
            "629bfcef-edea-4e24-993b-83ee497aacc4",
            "c5975a62-a990-42b2-8c47-7c43076d7c57",
            "af4b7290-1d50-4200-a874-479d138001d9",
            "dffd52fa-ab63-4aea-af16-76d955bcae3a",
            "ab17c8bf-10ba-4d49-8a71-785c839be1d0",
            "44fd6d63-681b-4ae4-9a7d-004485d31407",
            "db83993d-af6c-4ca5-b5ac-4aeefa4d9fba",
            "61c05ec0-5e4d-43c8-b89c-b1aab1e25371",
            "83e7bc71-257c-43cb-ad59-229c10d87fb1",
            "80b720ad-2465-43ff-ab33-df0855d602c3"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "4aaf0127-d3b5-4a6b-aee1-19599d058468",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "f50b0dd9-4557-486e-8cb6-8df786f5bfd5",
          "name": "BRETYLIUM TOSYLATE [MI]",
          "stdName": "BRETYLIUM TOSYLATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ab17c8bf-10ba-4d49-8a71-785c839be1d0"
          ],
          "display_name": false
        },
        {
          "uuid": "2c70b5ae-8b2c-43b0-a806-35659b881db6",
          "name": "BRETYLIUM TOSYLATE [ORANGE BOOK]",
          "stdName": "BRETYLIUM TOSYLATE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cbb754e6-61c4-4c50-bf21-35ffd1ac8d41"
          ],
          "display_name": false
        },
        {
          "uuid": "0d9bdc8c-73d8-4423-8ade-c17bafa5da33",
          "name": "BRETYLIUM TOSYLATE [USAN]",
          "stdName": "BRETYLIUM TOSYLATE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "44fd6d63-681b-4ae4-9a7d-004485d31407"
          ],
          "display_name": false
        },
        {
          "uuid": "9597f80f-05d5-b294-0469-ae467d458339",
          "name": "BRETYLIUM TOSYLATE [USP MONOGRAPH]",
          "stdName": "BRETYLIUM TOSYLATE [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d047db74-99aa-9e9d-a62f-4b0b451bca5f"
          ],
          "display_name": false
        },
        {
          "uuid": "2e2c3c21-0f7d-46af-8d26-5273d4461ee5",
          "name": "BRETYLIUM TOSYLATE [USP-RS]",
          "stdName": "BRETYLIUM TOSYLATE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c5975a62-a990-42b2-8c47-7c43076d7c57"
          ],
          "display_name": false
        },
        {
          "uuid": "ffe1e415-eee9-4502-856a-db4d75541db6",
          "name": "BRETYLIUM TOSYLATE [VANDF]",
          "stdName": "BRETYLIUM TOSYLATE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "83e7bc71-257c-43cb-ad59-229c10d87fb1"
          ],
          "display_name": false
        },
        {
          "uuid": "a6c65298-aff5-40eb-9e6b-78c0e36bd5ce",
          "name": "BRETYLOL",
          "stdName": "BRETYLOL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6c6b3ec-8cd9-43f4-916c-28762d232a20"
          ],
          "display_name": false
        },
        {
          "uuid": "ae90027c-1785-07dd-ccd7-6baf9f42582b",
          "name": "Bretylium tosilate [WHO-DD]",
          "stdName": "BRETYLIUM TOSILATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "01701066-5604-f0d9-055e-8daf8e4ff421"
          ],
          "display_name": false
        },
        {
          "uuid": "5bc8f067-66ca-484d-9ac2-bd622152ce90",
          "name": "NSC-62164",
          "stdName": "NSC-62164",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "219eb09e-63f2-4866-9e5c-ce7126f1b6bb"
          ],
          "display_name": false
        },
        {
          "uuid": "1cc9d6e0-93f6-4eae-aed8-0c0cf432b8b6",
          "name": "bretylium tosilate [INN]",
          "stdName": "BRETYLIUM TOSILATE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "883dbaae-367f-417c-94c7-6e2d46dc9757"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "af4b7290-1d50-4200-a874-479d138001d9",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "4e988934-ddb9-4984-8b5b-083ab16e9a20",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f6c6b3ec-8cd9-43f4-916c-28762d232a20",
          "citation": "ORANGE BOOK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e651bf82-6814-452b-bb72-eb2598485d61",
          "citation": "FDA-SRS 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "883dbaae-367f-417c-94c7-6e2d46dc9757",
          "citation": "INN Proposed List 10",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL10.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "44fd6d63-681b-4ae4-9a7d-004485d31407",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dffd52fa-ab63-4aea-af16-76d955bcae3a",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cbb754e6-61c4-4c50-bf21-35ffd1ac8d41",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "767b58d9-0209-4273-a9f7-e11d7db1c1b1",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ab17c8bf-10ba-4d49-8a71-785c839be1d0",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c5975a62-a990-42b2-8c47-7c43076d7c57",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3e84ba90-2de8-4fab-8ae7-81d6ebf99c31",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "83e7bc71-257c-43cb-ad59-229c10d87fb1",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "219eb09e-63f2-4866-9e5c-ce7126f1b6bb",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0e19ce81-772c-476e-ba0d-b06f4a8a3ca7",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389661000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e1acf054-aa45-443f-ad50-23a9514d1bde",
          "citation": "SRS import [78ZP3YR353]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=78ZP3YR353",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389661000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "454c42b6-ab83-4bc4-b2c4-511a1131861d",
          "citation": "BRETYLIUM TOSILATE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "629bfcef-edea-4e24-993b-83ee497aacc4",
          "citation": "BRETYLIUM TOSYLATE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "db83993d-af6c-4ca5-b5ac-4aeefa4d9fba",
          "citation": "BRETYLIUM TOSYLATE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "61c05ec0-5e4d-43c8-b89c-b1aab1e25371",
          "citation": "BRETYLIUM TOSYLATE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "712586d2-1edd-4cdc-8acd-2849122bbdc5",
          "citation": "BRETYLIUM TOSILATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "80b720ad-2465-43ff-ab33-df0855d602c3",
          "citation": "BRETYLIUM TOSYLATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "dcee094c-dbf1-40f5-b39e-80019d32322c",
          "citation": "BRETYLIUM TOSYLATE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e27e7740-1abe-4f4e-9b08-a630f59bda0d",
          "citation": "BRETYLIUM TOSILATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "354529f0-62a9-49dc-a031-269408c15683",
          "citation": "BRETYLIUM TOSYLATE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "93fb9d32-6bfd-7633-5df8-b6f22edfd22f",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=61-75-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "cac88911-8a20-f9f5-ddab-aa6a76e70dbd",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "f527acd3-7c4f-1730-fb5d-4dc1ccf99874",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "376624ea-7645-4479-994a-6e0d28fa5014",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d047db74-99aa-9e9d-a62f-4b0b451bca5f",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "ab4390aa-48a4-bdbb-4027-eb76323ab82f",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "d48a7da7-b014-4cea-ef4c-71f24d21b329",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "01701066-5604-f0d9-055e-8daf8e4ff421",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ad94ad71-bb06-446c-a183-445e0c2f8e68",
          "id": "ad94ad71-bb06-446c-a183-445e0c2f8e68",
          "molfile": "\n  Marvin  01132109002D          \n\n 11 11  0  0  0  0            999 V2000\n    6.7292  -15.6169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4418  -16.0294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1543  -15.6169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8751  -16.0294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8751  -16.8544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1543  -17.2669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4418  -16.8544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5876  -17.2669    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3001  -17.6794    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    9.9918  -16.5544    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1668  -17.9795    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  7  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  2  0  0  0  0\n  5  8  1  0  0  0  0\n  7  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  2  0  0  0  0\n 11  8  2  0  0  0  0\nM  CHG  1   9  -1\nM  END",
          "smiles": "Cc1ccc(cc1)S(=O)(=O)[O-]",
          "formula": "C7H7O3S",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "01c2e7a7-688d-4354-84c9-c9336217fe04"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "171.195",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "d8893daf-236f-4d78-a3d7-1d64f014c082",
          "id": "d8893daf-236f-4d78-a3d7-1d64f014c082",
          "molfile": "\n  Marvin  01132111132D          \n\n 13 13  0  0  0  0            999 V2000\n    5.9164  -16.4633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2025  -16.0582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4885  -16.4716    0.0000 N   0  3  0  0  0  0  0  0  0  3  0  0\n    4.0751  -17.1855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9018  -17.1855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7745  -16.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0605  -16.4758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0605  -17.3025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3466  -17.7158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6326  -17.3025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6326  -16.4758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3466  -16.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3423  -15.2357    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  3  1  0  0  0  0\n  3  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n 12  7  2  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  0  0  0  0\nM  CHG  1   3   1\nM  END",
          "smiles": "CC[N+](C)(C)Cc1ccccc1Br",
          "formula": "C11H17BrN",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9341c8f3-414e-47fc-8a18-19c2428a6201"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "243.1633",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "606566f1-7861-4eff-bad0-6184bd843b85",
      "version": "21",
      "structure": {
        "id": "7b40df5e-9baf-4719-b423-881e46d7596d",
        "molfile": "\n  Marvin  01132106242D          \n\n 24 24  0  0  0  0            999 V2000\n    9.6074  -17.3025    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8934  -16.8891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3213  -17.7158    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   10.0124  -16.5885    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1857  -18.0165    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1711  -17.3025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8934  -16.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1711  -15.6491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4571  -16.8891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4571  -16.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7431  -15.6491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0605  -16.4758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4885  -16.4716    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    3.7745  -16.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3466  -16.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3423  -15.2357    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    3.0605  -17.3025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2025  -16.0582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0751  -17.1855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9018  -17.1855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6326  -16.4758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9164  -16.4633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3466  -17.7158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6326  -17.3025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  2  0  0  0  0\n  5  1  2  0  0  0  0\n  6  2  2  0  0  0  0\n  7  2  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  6  1  0  0  0  0\n 10  8  1  0  0  0  0\n 11 10  1  0  0  0  0\n 10  9  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 12  1  0  0  0  0\n 15 12  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 12  1  0  0  0  0\n 18 13  1  0  0  0  0\n 19 13  1  0  0  0  0\n 20 13  1  0  0  0  0\n 21 15  1  0  0  0  0\n 22 18  1  0  0  0  0\n 23 17  2  0  0  0  0\n 24 23  1  0  0  0  0\n 21 24  2  0  0  0  0\nM  CHG  2   3  -1  13   1\nM  END",
        "smiles": "CC[N+](C)(C)Cc1ccccc1Br.Cc1ccc(cc1)S(=O)(=O)[O-]",
        "formula": "C11H17BrN.C7H7O3S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "414.3584",
        "optical_activity": "NONE",
        "references": [
          "af4b7290-1d50-4200-a874-479d138001d9",
          "e1acf054-aa45-443f-ad50-23a9514d1bde",
          "883dbaae-367f-417c-94c7-6e2d46dc9757"
        ],
        "stereo_centers": 0
      },
      "unii": "78ZP3YR353"
    }
  ]
}