{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "48479341-46f8-4ada-b4b2-aade08c77e2e",
          "code": "51321-79-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=51321-79-0",
          "code_system": "CAS",
          "references": [
            "5d6cbf94-109c-4a00-b913-b83cbaebeec4",
            "6fff8f3d-65ee-4006-8cb7-a2ff099eef33"
          ]
        },
        {
          "uuid": "8b9783e0-ed1e-419f-a02c-79e1d1c003b6",
          "code": "C1398",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1398",
          "code_system": "NCI_THESAURUS",
          "references": [
            "5d6cbf94-109c-4a00-b913-b83cbaebeec4"
          ]
        },
        {
          "uuid": "2e46a91b-0899-4f09-8548-b377089bc89f",
          "code": "SUB10611MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "5d6cbf94-109c-4a00-b913-b83cbaebeec4"
          ]
        },
        {
          "uuid": "e1cbbb05-7885-40a2-819b-433fbacf8244",
          "code": "5059",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=5059",
          "code_system": "INN",
          "references": [
            "5d6cbf94-109c-4a00-b913-b83cbaebeec4"
          ]
        },
        {
          "uuid": "2af9cee6-0806-4842-95ce-07d4958ac7e8",
          "code": "CHEMBL37681",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL37681",
          "code_system": "ChEMBL",
          "references": [
            "5d6cbf94-109c-4a00-b913-b83cbaebeec4"
          ]
        },
        {
          "uuid": "c686e70a-f06f-4de0-8ebc-993f112babc7",
          "code": "39981",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/39981",
          "code_system": "PUBCHEM",
          "references": [
            "5d6cbf94-109c-4a00-b913-b83cbaebeec4"
          ]
        },
        {
          "uuid": "2d17b2fa-ee2e-e47d-7759-d778cb593768",
          "code": "DTXSID80199325",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80199325",
          "code_system": "EPA CompTox",
          "references": [
            "19c893f1-7162-348a-927b-50449eec68fc"
          ]
        },
        {
          "uuid": "17f2c02f-eba2-48c2-87f5-da8cc79bb42a",
          "code": "C272",
          "comments": "Pharmacologic Substance[C1909]|Antineoplastic Agent[C274]|Antimetabolite",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C272",
          "code_system": "NCI_THESAURUS",
          "references": [
            "dd47b9ac-299f-e869-a9f3-874644b344e8"
          ]
        },
        {
          "uuid": "20dbd3e6-6b2c-2001-9e6a-4f0cc7a6c3c1",
          "code": "C471",
          "comments": "Pharmacologic Substance[C1909]|Enzyme Inhibitor",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C471",
          "code_system": "NCI_THESAURUS",
          "references": [
            "dd47b9ac-299f-e869-a9f3-874644b344e8"
          ]
        },
        {
          "uuid": "3e4cbf04-e94f-4498-9e3a-c2e380719ee7",
          "code": "78QVZ7RG8L",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "efcba7e1-17e9-de2b-e52f-72c0f8527cda",
          "code": "DB03459",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB03459",
          "code_system": "DRUG BANK",
          "references": [
            "dd47b9ac-299f-e869-a9f3-874644b344e8"
          ]
        },
        {
          "uuid": "e8f759c6-cb13-919a-1291-a904b94159bd",
          "code": "100000083799",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "551ddc2e-84d2-aaf5-10f5-c3d42fb45323"
          ]
        },
        {
          "uuid": "12f8b6fc-9167-3e10-3e1d-a98288a91175",
          "code": "224131",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=224131",
          "code_system": "NSC",
          "references": [
            "440adbb6-6ad1-d404-8955-dfc74e9e9dec"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "d0c4ac67-8be3-4215-824f-605e8b2ea66e",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "466004e0-2f63-4074-9927-33ceb5d568f9",
            "refuuid": "89a85b99-e93e-4b91-a492-8d90e5c413f8",
            "name": "SPARFOSIC ACID",
            "unii": "78QVZ7RG8L",
            "linking_id": "78QVZ7RG8L",
            "ref_pname": "SPARFOSIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "2ad71ed5-1954-463f-8878-95e5f4b9b38f",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "25091cc7-693d-41f4-a600-d59838b54719",
            "refuuid": "fa4d692b-7c34-4722-b4bb-a222488c729d",
            "name": "SPARFOSATE SODIUM",
            "unii": "5R33Q73DYD",
            "linking_id": "5R33Q73DYD",
            "ref_pname": "SPARFOSATE SODIUM",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2f873250-58c1-4fef-b53b-655a1d65d4e5",
          "name": "L-ASPARTIC ACID, N-(2-PHOSPHONOACETYL)-",
          "stdName": "L-ASPARTIC ACID, N-(2-PHOSPHONOACETYL)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f1b32bb5-f7d9-4a43-8730-23f116269701",
            "c5a00aee-05c4-4d4a-8fba-7f385a083f3f"
          ],
          "display_name": false
        },
        {
          "uuid": "31fe9a3b-9ba2-4554-9960-ef8f806d4a07",
          "name": "L-ASPARTIC ACID, N-(PHOSPHONOACETYL)-",
          "stdName": "L-ASPARTIC ACID, N-(PHOSPHONOACETYL)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f1b32bb5-f7d9-4a43-8730-23f116269701",
            "c5a00aee-05c4-4d4a-8fba-7f385a083f3f"
          ],
          "display_name": false
        },
        {
          "uuid": "51868624-a2c9-42e2-bd0c-7a21d5197388",
          "name": "N-(PHOSPHONOACETYL)-L-ASPARTIC ACID",
          "stdName": "N-(PHOSPHONOACETYL)-L-ASPARTIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "def01089-8aa2-41bf-a950-3733ce2bc050",
            "c5a00aee-05c4-4d4a-8fba-7f385a083f3f"
          ],
          "display_name": false
        },
        {
          "uuid": "a05236c7-2c23-4e3a-922e-5f6376e24ec2",
          "name": "N-PHOSPHONACETYL-L-ASPARTIC ACID",
          "stdName": "N-PHOSPHONACETYL-L-ASPARTIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f1b32bb5-f7d9-4a43-8730-23f116269701",
            "c5a00aee-05c4-4d4a-8fba-7f385a083f3f"
          ],
          "display_name": false
        },
        {
          "uuid": "579982b4-aeec-4f9e-abef-11ac946887e1",
          "name": "NCI 224131",
          "stdName": "NCI 224131",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f1b32bb5-f7d9-4a43-8730-23f116269701",
            "c5a00aee-05c4-4d4a-8fba-7f385a083f3f"
          ],
          "display_name": false
        },
        {
          "uuid": "9355d479-8185-412a-b160-f4f6df34b304",
          "name": "NSC-224131",
          "stdName": "NSC-224131",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c5a00aee-05c4-4d4a-8fba-7f385a083f3f",
            "bf625dd3-dca3-448d-b6bc-a9c73049f69b"
          ],
          "display_name": false
        },
        {
          "uuid": "488460e8-bb4b-4f8f-a097-6d184ef2509e",
          "name": "PALA",
          "stdName": "PALA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f1b32bb5-f7d9-4a43-8730-23f116269701",
            "c5a00aee-05c4-4d4a-8fba-7f385a083f3f"
          ],
          "display_name": false
        },
        {
          "uuid": "96e6e699-025d-42e9-ac9b-aba799003f12",
          "name": "PHOSPHONOACETYL-L-ASPARTIC ACID",
          "stdName": "PHOSPHONOACETYL-L-ASPARTIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f1b32bb5-f7d9-4a43-8730-23f116269701",
            "c5a00aee-05c4-4d4a-8fba-7f385a083f3f"
          ],
          "display_name": false
        },
        {
          "uuid": "3ac5ebb8-bd23-4afc-9f9a-74a4a6486ef1",
          "name": "SPARFOSIC ACID",
          "stdName": "SPARFOSIC ACID",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "60dc6822-dd2c-4edf-abf9-80238d67812f",
            "747d07f7-055c-478a-b8d2-ff10be3c733e",
            "85dabc1c-d058-4603-82bc-32dcba8ac276",
            "320274fa-e986-446c-84dd-166386d7620c",
            "c5a00aee-05c4-4d4a-8fba-7f385a083f3f",
            "f428a9c5-bdd0-4779-9858-faa3014628a3"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "ce1b5ca5-d01d-484e-8368-36c0738c1232",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "b89a2133-a19e-4bee-9665-0b0d0184dc8d",
          "name": "SPARFOSIC ACID [MART.]",
          "stdName": "SPARFOSIC ACID [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "85dabc1c-d058-4603-82bc-32dcba8ac276"
          ],
          "display_name": false
        },
        {
          "uuid": "d5c4beec-d45e-42d3-b1c3-476381a22011",
          "name": "sparfosic acid [INN]",
          "stdName": "SPARFOSIC ACID [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "747d07f7-055c-478a-b8d2-ff10be3c733e",
            "0bca512d-f661-431f-a3b9-7895db1e7c2d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f428a9c5-bdd0-4779-9858-faa3014628a3",
          "citation": "INN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c5a00aee-05c4-4d4a-8fba-7f385a083f3f",
          "citation": "INN",
          "doc_type": "INN",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "def01089-8aa2-41bf-a950-3733ce2bc050",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f1b32bb5-f7d9-4a43-8730-23f116269701",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bf625dd3-dca3-448d-b6bc-a9c73049f69b",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "747d07f7-055c-478a-b8d2-ff10be3c733e",
          "citation": "INN 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "85dabc1c-d058-4603-82bc-32dcba8ac276",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5d6cbf94-109c-4a00-b913-b83cbaebeec4",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390903000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e8bfeb1f-d331-4ed2-8d73-164ad6e15a29",
          "citation": "SRS import [78QVZ7RG8L]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=78QVZ7RG8L",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390903000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "60dc6822-dd2c-4edf-abf9-80238d67812f",
          "citation": "SPARFOSIC ACID [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "320274fa-e986-446c-84dd-166386d7620c",
          "citation": "SPARFOSIC ACID [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "19c893f1-7162-348a-927b-50449eec68fc",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=51321-79-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "551ddc2e-84d2-aaf5-10f5-c3d42fb45323",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "dd47b9ac-299f-e869-a9f3-874644b344e8",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "0bca512d-f661-431f-a3b9-7895db1e7c2d",
          "citation": "INN Proposed List 46",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL46.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6fff8f3d-65ee-4006-8cb7-a2ff099eef33",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "440adbb6-6ad1-d404-8955-dfc74e9e9dec",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d82ed743-7cd2-47b4-b46a-7f45940c08d8",
          "id": "d82ed743-7cd2-47b4-b46a-7f45940c08d8",
          "molfile": "\n  Marvin  01132111122D          \n\n 16 15  0  0  1  0            999 V2000\n    4.3876   -2.1720    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    4.3876   -2.9970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1266   -3.4187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6296   -3.1331    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1266   -4.2663    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6714   -1.7686    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9643   -2.1720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9643   -2.9970    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2707   -1.7686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5453   -2.1630    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9062   -2.6979    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9515   -1.5918    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0213   -2.8339    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1266   -1.7776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8428   -2.1811    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1266   -0.9435    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  6  1  6  0  0  0\n  1 14  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  3  2  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  2  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 10  1  0  0  0  0\n 13 10  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 14  2  0  0  0  0\nM  END",
          "smiles": "C([C@@H](C(=O)O)NC(=O)CP(=O)(O)O)C(=O)O",
          "formula": "C6H10NO8P",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "83411b39-d903-45be-ba9c-1a7aad9a8139"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "255.1195",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "89a85b99-e93e-4b91-a492-8d90e5c413f8",
      "version": "9",
      "structure": {
        "id": "1e70a113-160c-4202-8d65-40b6ed8df370",
        "molfile": "\n  Marvin  01132101452D          \n\n 16 15  0  0  1  0            999 V2000\n    2.0213   -2.8339    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5453   -2.1630    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2707   -1.7686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9643   -2.1720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9643   -2.9970    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6714   -1.7686    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3876   -2.1720    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    5.1266   -1.7776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8428   -2.1811    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1266   -0.9435    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3876   -2.9970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1266   -3.4187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6296   -3.1331    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1266   -4.2663    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9062   -2.6979    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9515   -1.5918    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  2  0  0  0  0\n  7 11  1  6  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 12  2  0  0  0  0\n 15  2  1  0  0  0  0\n 16  2  1  0  0  0  0\nM  END",
        "smiles": "C([C@@H](C(=O)O)NC(=O)CP(=O)(O)O)C(=O)O",
        "formula": "C6H10NO8P",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "255.1195",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "def01089-8aa2-41bf-a950-3733ce2bc050",
          "e8bfeb1f-d331-4ed2-8d73-164ad6e15a29",
          "0bca512d-f661-431f-a3b9-7895db1e7c2d"
        ],
        "stereo_centers": 1
      },
      "unii": "78QVZ7RG8L"
    }
  ]
}